mirror of
https://gitlab.com/skysthelimit.dev/selenite.git
synced 2025-06-18 03:22:08 -05:00
17892 lines
618 KiB
Plaintext
17892 lines
618 KiB
Plaintext
function unityFramework(Module) {
|
|
var Module = typeof Module !== "undefined" ? Module : {};
|
|
var stackTraceReference = "(^|\\n)(\\s+at\\s+|)jsStackTrace(\\s+\\(|@)([^\\n]+):\\d+:\\d+(\\)|)(\\n|$)";
|
|
var stackTraceReferenceMatch = jsStackTrace().match(new RegExp(stackTraceReference));
|
|
if (stackTraceReferenceMatch) Module.stackTraceRegExp = new RegExp(stackTraceReference.replace("([^\\n]+)", stackTraceReferenceMatch[4].replace(/[\\^${}[\]().*+?|]/g, "\\$&")).replace("jsStackTrace", "[^\\n]+"));
|
|
var abort = function (what) {
|
|
if (ABORT) return;
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
if (typeof ENVIRONMENT_IS_PTHREAD !== "undefined" && ENVIRONMENT_IS_PTHREAD) console.error("Pthread aborting at " + new Error().stack);
|
|
if (what !== undefined) {
|
|
out(what);
|
|
err(what);
|
|
what = JSON.stringify(what);
|
|
} else {
|
|
what = "";
|
|
}
|
|
var message = "abort(" + what + ") at " + stackTrace();
|
|
if (Module.abortHandler && Module.abortHandler(message)) return;
|
|
throw message;
|
|
};
|
|
if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) {
|
|
Module["preRun"].push(function () {
|
|
var unityFileSystemInit =
|
|
Module["unityFileSystemInit"] ||
|
|
function () {
|
|
FS.mkdir("/idbfs");
|
|
FS.mount(IDBFS, {}, "/idbfs");
|
|
Module.addRunDependency("JS_FileSystem_Mount");
|
|
FS.syncfs(true, function (err) {
|
|
if (err) console.log("IndexedDB is not available. Data will not persist in cache and PlayerPrefs will not be saved.");
|
|
Module.removeRunDependency("JS_FileSystem_Mount");
|
|
});
|
|
};
|
|
unityFileSystemInit();
|
|
});
|
|
}
|
|
Module["SetFullscreen"] = function (fullscreen) {
|
|
if (typeof runtimeInitialized === "undefined" || !runtimeInitialized) {
|
|
console.log("Runtime not initialized yet.");
|
|
} else if (typeof JSEvents === "undefined") {
|
|
console.log("Player not loaded yet.");
|
|
} else {
|
|
var tmp = JSEvents.canPerformEventHandlerRequests;
|
|
JSEvents.canPerformEventHandlerRequests = function () {
|
|
return 1;
|
|
};
|
|
Module.ccall("SetFullscreen", null, ["number"], [fullscreen]);
|
|
JSEvents.canPerformEventHandlerRequests = tmp;
|
|
}
|
|
};
|
|
var MediaDevices = [];
|
|
if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) {
|
|
Module["preRun"].push(function () {
|
|
var enumerateMediaDevices = function () {
|
|
var getMedia = navigator.getUserMedia || navigator.webkitGetUserMedia || navigator.mozGetUserMedia || navigator.msGetUserMedia;
|
|
if (!getMedia) return;
|
|
function addDevice(label) {
|
|
label = label ? label : "device #" + MediaDevices.length;
|
|
var device = { deviceName: label, refCount: 0, video: null };
|
|
MediaDevices.push(device);
|
|
}
|
|
if (!navigator.mediaDevices || !navigator.mediaDevices.enumerateDevices) {
|
|
if (typeof MediaStreamTrack == "undefined" || typeof MediaStreamTrack.getSources == "undefined") {
|
|
console.log("Media Devices cannot be enumerated on this browser.");
|
|
return;
|
|
}
|
|
function gotSources(sourceInfos) {
|
|
for (var i = 0; i !== sourceInfos.length; ++i) {
|
|
var sourceInfo = sourceInfos[i];
|
|
if (sourceInfo.kind === "video") addDevice(sourceInfo.label);
|
|
}
|
|
}
|
|
MediaStreamTrack.getSources(gotSources);
|
|
}
|
|
navigator.mediaDevices
|
|
.enumerateDevices()
|
|
.then(function (devices) {
|
|
devices.forEach(function (device) {
|
|
if (device.kind == "videoinput") addDevice(device.label);
|
|
});
|
|
})
|
|
.catch(function (err) {
|
|
console.log(err.name + ": " + error.message);
|
|
});
|
|
};
|
|
enumerateMediaDevices();
|
|
});
|
|
}
|
|
function SendMessage(gameObject, func, param) {
|
|
if (param === undefined) Module.ccall("SendMessage", null, ["string", "string"], [gameObject, func]);
|
|
else if (typeof param === "string") Module.ccall("SendMessageString", null, ["string", "string", "string"], [gameObject, func, param]);
|
|
else if (typeof param === "number") Module.ccall("SendMessageFloat", null, ["string", "string", "number"], [gameObject, func, param]);
|
|
else throw "" + param + " is does not have a type which is supported by SendMessage.";
|
|
}
|
|
Module["SendMessage"] = SendMessage;
|
|
var moduleOverrides = {};
|
|
var key;
|
|
for (key in Module) {
|
|
if (Module.hasOwnProperty(key)) {
|
|
moduleOverrides[key] = Module[key];
|
|
}
|
|
}
|
|
Module["arguments"] = [];
|
|
Module["thisProgram"] = "./this.program";
|
|
Module["quit"] = function (status, toThrow) {
|
|
throw toThrow;
|
|
};
|
|
Module["preRun"] = [];
|
|
Module["postRun"] = [];
|
|
var ENVIRONMENT_IS_WEB = false;
|
|
var ENVIRONMENT_IS_WORKER = false;
|
|
var ENVIRONMENT_IS_NODE = false;
|
|
var ENVIRONMENT_IS_SHELL = false;
|
|
ENVIRONMENT_IS_WEB = typeof window === "object";
|
|
ENVIRONMENT_IS_WORKER = typeof importScripts === "function";
|
|
ENVIRONMENT_IS_NODE = typeof process === "object" && typeof require === "function" && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
|
|
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
|
|
var scriptDirectory = "";
|
|
function locateFile(path) {
|
|
if (Module["locateFile"]) {
|
|
return Module["locateFile"](path, scriptDirectory);
|
|
} else {
|
|
return scriptDirectory + path;
|
|
}
|
|
}
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
scriptDirectory = __dirname + "/";
|
|
var nodeFS;
|
|
var nodePath;
|
|
Module["read"] = function shell_read(filename, binary) {
|
|
var ret;
|
|
if (!nodeFS) nodeFS = require("fs");
|
|
if (!nodePath) nodePath = require("path");
|
|
filename = nodePath["normalize"](filename);
|
|
ret = nodeFS["readFileSync"](filename);
|
|
return binary ? ret : ret.toString();
|
|
};
|
|
Module["readBinary"] = function readBinary(filename) {
|
|
var ret = Module["read"](filename, true);
|
|
if (!ret.buffer) {
|
|
ret = new Uint8Array(ret);
|
|
}
|
|
assert(ret.buffer);
|
|
return ret;
|
|
};
|
|
if (process["argv"].length > 1) {
|
|
Module["thisProgram"] = process["argv"][1].replace(/\\/g, "/");
|
|
}
|
|
Module["arguments"] = process["argv"].slice(2);
|
|
if (typeof module !== "undefined") {
|
|
module["exports"] = Module;
|
|
}
|
|
process["on"]("uncaughtException", function (ex) {
|
|
if (!(ex instanceof ExitStatus)) {
|
|
throw ex;
|
|
}
|
|
});
|
|
process["on"]("unhandledRejection", function (reason, p) {
|
|
process["exit"](1);
|
|
});
|
|
Module["quit"] = function (status) {
|
|
process["exit"](status);
|
|
};
|
|
Module["inspect"] = function () {
|
|
return "[Emscripten Module object]";
|
|
};
|
|
} else if (ENVIRONMENT_IS_SHELL) {
|
|
if (typeof read != "undefined") {
|
|
Module["read"] = function shell_read(f) {
|
|
return read(f);
|
|
};
|
|
}
|
|
Module["readBinary"] = function readBinary(f) {
|
|
var data;
|
|
if (typeof readbuffer === "function") {
|
|
return new Uint8Array(readbuffer(f));
|
|
}
|
|
data = read(f, "binary");
|
|
assert(typeof data === "object");
|
|
return data;
|
|
};
|
|
if (typeof scriptArgs != "undefined") {
|
|
Module["arguments"] = scriptArgs;
|
|
} else if (typeof arguments != "undefined") {
|
|
Module["arguments"] = arguments;
|
|
}
|
|
if (typeof quit === "function") {
|
|
Module["quit"] = function (status) {
|
|
quit(status);
|
|
};
|
|
}
|
|
} else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
|
|
if (ENVIRONMENT_IS_WEB) {
|
|
if (document.currentScript) {
|
|
scriptDirectory = document.currentScript.src;
|
|
}
|
|
} else {
|
|
scriptDirectory = self.location.href;
|
|
}
|
|
if (scriptDirectory.indexOf("blob:") !== 0) {
|
|
scriptDirectory = scriptDirectory.split("/").slice(0, -1).join("/") + "/";
|
|
} else {
|
|
scriptDirectory = "";
|
|
}
|
|
Module["read"] = function shell_read(url) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open("GET", url, false);
|
|
xhr.send(null);
|
|
return xhr.responseText;
|
|
};
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module["readBinary"] = function readBinary(url) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open("GET", url, false);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.send(null);
|
|
return new Uint8Array(xhr.response);
|
|
};
|
|
}
|
|
Module["readAsync"] = function readAsync(url, onload, onerror) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open("GET", url, true);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.onload = function xhr_onload() {
|
|
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) {
|
|
onload(xhr.response);
|
|
return;
|
|
}
|
|
onerror();
|
|
};
|
|
xhr.onerror = onerror;
|
|
xhr.send(null);
|
|
};
|
|
Module["setWindowTitle"] = function (title) {
|
|
document.title = title;
|
|
};
|
|
} else {
|
|
}
|
|
var out = Module["print"] || (typeof console !== "undefined" ? console.log.bind(console) : typeof print !== "undefined" ? print : null);
|
|
var err = Module["printErr"] || (typeof printErr !== "undefined" ? printErr : (typeof console !== "undefined" && console.warn.bind(console)) || out);
|
|
for (key in moduleOverrides) {
|
|
if (moduleOverrides.hasOwnProperty(key)) {
|
|
Module[key] = moduleOverrides[key];
|
|
}
|
|
}
|
|
moduleOverrides = undefined;
|
|
var STACK_ALIGN = 16;
|
|
function staticAlloc(size) {
|
|
var ret = STATICTOP;
|
|
STATICTOP = (STATICTOP + size + 15) & -16;
|
|
return ret;
|
|
}
|
|
function dynamicAlloc(size) {
|
|
var ret = HEAP32[DYNAMICTOP_PTR >> 2];
|
|
var end = (ret + size + 15) & -16;
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = end;
|
|
if (end >= TOTAL_MEMORY) {
|
|
var success = enlargeMemory();
|
|
if (!success) {
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = ret;
|
|
return 0;
|
|
}
|
|
}
|
|
return ret;
|
|
}
|
|
function alignMemory(size, factor) {
|
|
if (!factor) factor = STACK_ALIGN;
|
|
var ret = (size = Math.ceil(size / factor) * factor);
|
|
return ret;
|
|
}
|
|
function getNativeTypeSize(type) {
|
|
switch (type) {
|
|
case "i1":
|
|
case "i8":
|
|
return 1;
|
|
case "i16":
|
|
return 2;
|
|
case "i32":
|
|
return 4;
|
|
case "i64":
|
|
return 8;
|
|
case "float":
|
|
return 4;
|
|
case "double":
|
|
return 8;
|
|
default: {
|
|
if (type[type.length - 1] === "*") {
|
|
return 4;
|
|
} else if (type[0] === "i") {
|
|
var bits = parseInt(type.substr(1));
|
|
assert(bits % 8 === 0);
|
|
return bits / 8;
|
|
} else {
|
|
return 0;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function warnOnce(text) {
|
|
if (!warnOnce.shown) warnOnce.shown = {};
|
|
if (!warnOnce.shown[text]) {
|
|
warnOnce.shown[text] = 1;
|
|
err(text);
|
|
}
|
|
}
|
|
var asm2wasmImports = {
|
|
"f64-rem": function (x, y) {
|
|
return x % y;
|
|
},
|
|
debugger: function () {
|
|
debugger;
|
|
},
|
|
};
|
|
var jsCallStartIndex = 1;
|
|
var functionPointers = new Array(0);
|
|
function addFunction(func, sig) {
|
|
var base = 0;
|
|
for (var i = base; i < base + 0; i++) {
|
|
if (!functionPointers[i]) {
|
|
functionPointers[i] = func;
|
|
return jsCallStartIndex + i;
|
|
}
|
|
}
|
|
throw "Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.";
|
|
}
|
|
var funcWrappers = {};
|
|
function getFuncWrapper(func, sig) {
|
|
if (!func) return;
|
|
assert(sig);
|
|
if (!funcWrappers[sig]) {
|
|
funcWrappers[sig] = {};
|
|
}
|
|
var sigCache = funcWrappers[sig];
|
|
if (!sigCache[func]) {
|
|
if (sig.length === 1) {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return dynCall(sig, func);
|
|
};
|
|
} else if (sig.length === 2) {
|
|
sigCache[func] = function dynCall_wrapper(arg) {
|
|
return dynCall(sig, func, [arg]);
|
|
};
|
|
} else {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return dynCall(sig, func, Array.prototype.slice.call(arguments));
|
|
};
|
|
}
|
|
}
|
|
return sigCache[func];
|
|
}
|
|
function makeBigInt(low, high, unsigned) {
|
|
return unsigned ? +(low >>> 0) + +(high >>> 0) * 4294967296 : +(low >>> 0) + +(high | 0) * 4294967296;
|
|
}
|
|
function dynCall(sig, ptr, args) {
|
|
if (args && args.length) {
|
|
return Module["dynCall_" + sig].apply(null, [ptr].concat(args));
|
|
} else {
|
|
return Module["dynCall_" + sig].call(null, ptr);
|
|
}
|
|
}
|
|
var GLOBAL_BASE = 1024;
|
|
var ABORT = 0;
|
|
var EXITSTATUS = 0;
|
|
function assert(condition, text) {
|
|
if (!condition) {
|
|
abort("Assertion failed: " + text);
|
|
}
|
|
}
|
|
function getCFunc(ident) {
|
|
var func = Module["_" + ident];
|
|
assert(func, "Cannot call unknown function " + ident + ", make sure it is exported");
|
|
return func;
|
|
}
|
|
var JSfuncs = {
|
|
stackSave: function () {
|
|
stackSave();
|
|
},
|
|
stackRestore: function () {
|
|
stackRestore();
|
|
},
|
|
arrayToC: function (arr) {
|
|
var ret = stackAlloc(arr.length);
|
|
writeArrayToMemory(arr, ret);
|
|
return ret;
|
|
},
|
|
stringToC: function (str) {
|
|
var ret = 0;
|
|
if (str !== null && str !== undefined && str !== 0) {
|
|
var len = (str.length << 2) + 1;
|
|
ret = stackAlloc(len);
|
|
stringToUTF8(str, ret, len);
|
|
}
|
|
return ret;
|
|
},
|
|
};
|
|
var toC = { string: JSfuncs["stringToC"], array: JSfuncs["arrayToC"] };
|
|
function ccall(ident, returnType, argTypes, args, opts) {
|
|
function convertReturnValue(ret) {
|
|
if (returnType === "string") return Pointer_stringify(ret);
|
|
if (returnType === "boolean") return Boolean(ret);
|
|
return ret;
|
|
}
|
|
var func = getCFunc(ident);
|
|
var cArgs = [];
|
|
var stack = 0;
|
|
if (args) {
|
|
for (var i = 0; i < args.length; i++) {
|
|
var converter = toC[argTypes[i]];
|
|
if (converter) {
|
|
if (stack === 0) stack = stackSave();
|
|
cArgs[i] = converter(args[i]);
|
|
} else {
|
|
cArgs[i] = args[i];
|
|
}
|
|
}
|
|
}
|
|
var ret = func.apply(null, cArgs);
|
|
ret = convertReturnValue(ret);
|
|
if (stack !== 0) stackRestore(stack);
|
|
return ret;
|
|
}
|
|
function cwrap(ident, returnType, argTypes, opts) {
|
|
argTypes = argTypes || [];
|
|
var numericArgs = argTypes.every(function (type) {
|
|
return type === "number";
|
|
});
|
|
var numericRet = returnType !== "string";
|
|
if (numericRet && numericArgs && !opts) {
|
|
return getCFunc(ident);
|
|
}
|
|
return function () {
|
|
return ccall(ident, returnType, argTypes, arguments, opts);
|
|
};
|
|
}
|
|
function setValue(ptr, value, type, noSafe) {
|
|
type = type || "i8";
|
|
if (type.charAt(type.length - 1) === "*") type = "i32";
|
|
switch (type) {
|
|
case "i1":
|
|
HEAP8[ptr >> 0] = value;
|
|
break;
|
|
case "i8":
|
|
HEAP8[ptr >> 0] = value;
|
|
break;
|
|
case "i16":
|
|
HEAP16[ptr >> 1] = value;
|
|
break;
|
|
case "i32":
|
|
HEAP32[ptr >> 2] = value;
|
|
break;
|
|
case "i64":
|
|
(tempI64 = [value >>> 0, ((tempDouble = value), +Math_abs(tempDouble) >= 1 ? (tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0) : 0)]), (HEAP32[ptr >> 2] = tempI64[0]), (HEAP32[(ptr + 4) >> 2] = tempI64[1]);
|
|
break;
|
|
case "float":
|
|
HEAPF32[ptr >> 2] = value;
|
|
break;
|
|
case "double":
|
|
HEAPF64[ptr >> 3] = value;
|
|
break;
|
|
default:
|
|
abort("invalid type for setValue: " + type);
|
|
}
|
|
}
|
|
var ALLOC_NORMAL = 0;
|
|
var ALLOC_STATIC = 2;
|
|
var ALLOC_NONE = 4;
|
|
function allocate(slab, types, allocator, ptr) {
|
|
var zeroinit, size;
|
|
if (typeof slab === "number") {
|
|
zeroinit = true;
|
|
size = slab;
|
|
} else {
|
|
zeroinit = false;
|
|
size = slab.length;
|
|
}
|
|
var singleType = typeof types === "string" ? types : null;
|
|
var ret;
|
|
if (allocator == ALLOC_NONE) {
|
|
ret = ptr;
|
|
} else {
|
|
ret = [typeof _malloc === "function" ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
|
|
}
|
|
if (zeroinit) {
|
|
var stop;
|
|
ptr = ret;
|
|
assert((ret & 3) == 0);
|
|
stop = ret + (size & ~3);
|
|
for (; ptr < stop; ptr += 4) {
|
|
HEAP32[ptr >> 2] = 0;
|
|
}
|
|
stop = ret + size;
|
|
while (ptr < stop) {
|
|
HEAP8[ptr++ >> 0] = 0;
|
|
}
|
|
return ret;
|
|
}
|
|
if (singleType === "i8") {
|
|
if (slab.subarray || slab.slice) {
|
|
HEAPU8.set(slab, ret);
|
|
} else {
|
|
HEAPU8.set(new Uint8Array(slab), ret);
|
|
}
|
|
return ret;
|
|
}
|
|
var i = 0,
|
|
type,
|
|
typeSize,
|
|
previousType;
|
|
while (i < size) {
|
|
var curr = slab[i];
|
|
type = singleType || types[i];
|
|
if (type === 0) {
|
|
i++;
|
|
continue;
|
|
}
|
|
if (type == "i64") type = "i32";
|
|
setValue(ret + i, curr, type);
|
|
if (previousType !== type) {
|
|
typeSize = getNativeTypeSize(type);
|
|
previousType = type;
|
|
}
|
|
i += typeSize;
|
|
}
|
|
return ret;
|
|
}
|
|
function getMemory(size) {
|
|
if (!staticSealed) return staticAlloc(size);
|
|
if (!runtimeInitialized) return dynamicAlloc(size);
|
|
return _malloc(size);
|
|
}
|
|
function Pointer_stringify(ptr, length) {
|
|
if (length === 0 || !ptr) return "";
|
|
var hasUtf = 0;
|
|
var t;
|
|
var i = 0;
|
|
while (1) {
|
|
t = HEAPU8[(ptr + i) >> 0];
|
|
hasUtf |= t;
|
|
if (t == 0 && !length) break;
|
|
i++;
|
|
if (length && i == length) break;
|
|
}
|
|
if (!length) length = i;
|
|
var ret = "";
|
|
if (hasUtf < 128) {
|
|
var MAX_CHUNK = 1024;
|
|
var curr;
|
|
while (length > 0) {
|
|
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
|
|
ret = ret ? ret + curr : curr;
|
|
ptr += MAX_CHUNK;
|
|
length -= MAX_CHUNK;
|
|
}
|
|
return ret;
|
|
}
|
|
return UTF8ToString(ptr);
|
|
}
|
|
var UTF8Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf8") : undefined;
|
|
function UTF8ArrayToString(u8Array, idx) {
|
|
var endPtr = idx;
|
|
while (u8Array[endPtr]) ++endPtr;
|
|
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
|
|
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
|
|
} else {
|
|
var u0, u1, u2, u3, u4, u5;
|
|
var str = "";
|
|
while (1) {
|
|
u0 = u8Array[idx++];
|
|
if (!u0) return str;
|
|
if (!(u0 & 128)) {
|
|
str += String.fromCharCode(u0);
|
|
continue;
|
|
}
|
|
u1 = u8Array[idx++] & 63;
|
|
if ((u0 & 224) == 192) {
|
|
str += String.fromCharCode(((u0 & 31) << 6) | u1);
|
|
continue;
|
|
}
|
|
u2 = u8Array[idx++] & 63;
|
|
if ((u0 & 240) == 224) {
|
|
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
|
|
} else {
|
|
u3 = u8Array[idx++] & 63;
|
|
if ((u0 & 248) == 240) {
|
|
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
|
|
} else {
|
|
u4 = u8Array[idx++] & 63;
|
|
if ((u0 & 252) == 248) {
|
|
u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
|
|
} else {
|
|
u5 = u8Array[idx++] & 63;
|
|
u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
|
|
}
|
|
}
|
|
}
|
|
if (u0 < 65536) {
|
|
str += String.fromCharCode(u0);
|
|
} else {
|
|
var ch = u0 - 65536;
|
|
str += String.fromCharCode(55296 | (ch >> 10), 56320 | (ch & 1023));
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function UTF8ToString(ptr) {
|
|
return UTF8ArrayToString(HEAPU8, ptr);
|
|
}
|
|
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
|
|
if (!(maxBytesToWrite > 0)) return 0;
|
|
var startIdx = outIdx;
|
|
var endIdx = outIdx + maxBytesToWrite - 1;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
var u = str.charCodeAt(i);
|
|
if (u >= 55296 && u <= 57343) {
|
|
var u1 = str.charCodeAt(++i);
|
|
u = (65536 + ((u & 1023) << 10)) | (u1 & 1023);
|
|
}
|
|
if (u <= 127) {
|
|
if (outIdx >= endIdx) break;
|
|
outU8Array[outIdx++] = u;
|
|
} else if (u <= 2047) {
|
|
if (outIdx + 1 >= endIdx) break;
|
|
outU8Array[outIdx++] = 192 | (u >> 6);
|
|
outU8Array[outIdx++] = 128 | (u & 63);
|
|
} else if (u <= 65535) {
|
|
if (outIdx + 2 >= endIdx) break;
|
|
outU8Array[outIdx++] = 224 | (u >> 12);
|
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 128 | (u & 63);
|
|
} else if (u <= 2097151) {
|
|
if (outIdx + 3 >= endIdx) break;
|
|
outU8Array[outIdx++] = 240 | (u >> 18);
|
|
outU8Array[outIdx++] = 128 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 128 | (u & 63);
|
|
} else if (u <= 67108863) {
|
|
if (outIdx + 4 >= endIdx) break;
|
|
outU8Array[outIdx++] = 248 | (u >> 24);
|
|
outU8Array[outIdx++] = 128 | ((u >> 18) & 63);
|
|
outU8Array[outIdx++] = 128 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 128 | (u & 63);
|
|
} else {
|
|
if (outIdx + 5 >= endIdx) break;
|
|
outU8Array[outIdx++] = 252 | (u >> 30);
|
|
outU8Array[outIdx++] = 128 | ((u >> 24) & 63);
|
|
outU8Array[outIdx++] = 128 | ((u >> 18) & 63);
|
|
outU8Array[outIdx++] = 128 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 128 | (u & 63);
|
|
}
|
|
}
|
|
outU8Array[outIdx] = 0;
|
|
return outIdx - startIdx;
|
|
}
|
|
function stringToUTF8(str, outPtr, maxBytesToWrite) {
|
|
return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite);
|
|
}
|
|
function lengthBytesUTF8(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
var u = str.charCodeAt(i);
|
|
if (u >= 55296 && u <= 57343) u = (65536 + ((u & 1023) << 10)) | (str.charCodeAt(++i) & 1023);
|
|
if (u <= 127) {
|
|
++len;
|
|
} else if (u <= 2047) {
|
|
len += 2;
|
|
} else if (u <= 65535) {
|
|
len += 3;
|
|
} else if (u <= 2097151) {
|
|
len += 4;
|
|
} else if (u <= 67108863) {
|
|
len += 5;
|
|
} else {
|
|
len += 6;
|
|
}
|
|
}
|
|
return len;
|
|
}
|
|
var UTF16Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le") : undefined;
|
|
function allocateUTF8(str) {
|
|
var size = lengthBytesUTF8(str) + 1;
|
|
var ret = _malloc(size);
|
|
if (ret) stringToUTF8Array(str, HEAP8, ret, size);
|
|
return ret;
|
|
}
|
|
function allocateUTF8OnStack(str) {
|
|
var size = lengthBytesUTF8(str) + 1;
|
|
var ret = stackAlloc(size);
|
|
stringToUTF8Array(str, HEAP8, ret, size);
|
|
return ret;
|
|
}
|
|
function demangle(func) {
|
|
return func;
|
|
}
|
|
function demangleAll(text) {
|
|
var regex = /__Z[\w\d_]+/g;
|
|
return text.replace(regex, function (x) {
|
|
var y = demangle(x);
|
|
return x === y ? x : x + " [" + y + "]";
|
|
});
|
|
}
|
|
function jsStackTrace() {
|
|
var err = new Error();
|
|
if (!err.stack) {
|
|
try {
|
|
throw new Error(0);
|
|
} catch (e) {
|
|
err = e;
|
|
}
|
|
if (!err.stack) {
|
|
return "(no stack trace available)";
|
|
}
|
|
}
|
|
return err.stack.toString();
|
|
}
|
|
function stackTrace() {
|
|
var js = jsStackTrace();
|
|
if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"]();
|
|
return demangleAll(js);
|
|
}
|
|
var PAGE_SIZE = 16384;
|
|
var WASM_PAGE_SIZE = 65536;
|
|
var ASMJS_PAGE_SIZE = 16777216;
|
|
var MIN_TOTAL_MEMORY = 16777216;
|
|
function alignUp(x, multiple) {
|
|
if (x % multiple > 0) {
|
|
x += multiple - (x % multiple);
|
|
}
|
|
return x;
|
|
}
|
|
var buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
|
|
function updateGlobalBuffer(buf) {
|
|
Module["buffer"] = buffer = buf;
|
|
}
|
|
function updateGlobalBufferViews() {
|
|
Module["HEAP8"] = HEAP8 = new Int8Array(buffer);
|
|
Module["HEAP16"] = HEAP16 = new Int16Array(buffer);
|
|
Module["HEAP32"] = HEAP32 = new Int32Array(buffer);
|
|
Module["HEAPU8"] = HEAPU8 = new Uint8Array(buffer);
|
|
Module["HEAPU16"] = HEAPU16 = new Uint16Array(buffer);
|
|
Module["HEAPU32"] = HEAPU32 = new Uint32Array(buffer);
|
|
Module["HEAPF32"] = HEAPF32 = new Float32Array(buffer);
|
|
Module["HEAPF64"] = HEAPF64 = new Float64Array(buffer);
|
|
}
|
|
var STATIC_BASE, STATICTOP, staticSealed;
|
|
var STACK_BASE, STACKTOP, STACK_MAX;
|
|
var DYNAMIC_BASE, DYNAMICTOP_PTR;
|
|
STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
|
|
staticSealed = false;
|
|
function abortOnCannotGrowMemory() {
|
|
abort("Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value " + TOTAL_MEMORY + ", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ");
|
|
}
|
|
if (!Module["reallocBuffer"])
|
|
Module["reallocBuffer"] = function (size) {
|
|
var ret;
|
|
try {
|
|
if (ArrayBuffer.transfer) {
|
|
ret = ArrayBuffer.transfer(buffer, size);
|
|
} else {
|
|
var oldHEAP8 = HEAP8;
|
|
ret = new ArrayBuffer(size);
|
|
var temp = new Int8Array(ret);
|
|
temp.set(oldHEAP8);
|
|
}
|
|
} catch (e) {
|
|
return false;
|
|
}
|
|
var success = _emscripten_replace_memory(ret);
|
|
if (!success) return false;
|
|
return ret;
|
|
};
|
|
function enlargeMemory() {
|
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE;
|
|
var LIMIT = 2147483648 - PAGE_MULTIPLE;
|
|
if (HEAP32[DYNAMICTOP_PTR >> 2] > LIMIT) {
|
|
return false;
|
|
}
|
|
var OLD_TOTAL_MEMORY = TOTAL_MEMORY;
|
|
TOTAL_MEMORY = Math.max(TOTAL_MEMORY, MIN_TOTAL_MEMORY);
|
|
while (TOTAL_MEMORY < HEAP32[DYNAMICTOP_PTR >> 2]) {
|
|
if (TOTAL_MEMORY <= 536870912) {
|
|
TOTAL_MEMORY = alignUp(2 * TOTAL_MEMORY, PAGE_MULTIPLE);
|
|
} else {
|
|
TOTAL_MEMORY = Math.min(alignUp((3 * TOTAL_MEMORY + 2147483648) / 4, PAGE_MULTIPLE), LIMIT);
|
|
}
|
|
}
|
|
var replacement = Module["reallocBuffer"](TOTAL_MEMORY);
|
|
if (!replacement || replacement.byteLength != TOTAL_MEMORY) {
|
|
TOTAL_MEMORY = OLD_TOTAL_MEMORY;
|
|
return false;
|
|
}
|
|
updateGlobalBuffer(replacement);
|
|
updateGlobalBufferViews();
|
|
return true;
|
|
}
|
|
var byteLength;
|
|
try {
|
|
byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, "byteLength").get);
|
|
byteLength(new ArrayBuffer(4));
|
|
} catch (e) {
|
|
byteLength = function (buffer) {
|
|
return buffer.byteLength;
|
|
};
|
|
}
|
|
var TOTAL_STACK = Module["TOTAL_STACK"] || 5242880;
|
|
var TOTAL_MEMORY = Module["TOTAL_MEMORY"] || 33554432;
|
|
if (TOTAL_MEMORY < TOTAL_STACK) err("TOTAL_MEMORY should be larger than TOTAL_STACK, was " + TOTAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")");
|
|
if (Module["buffer"]) {
|
|
buffer = Module["buffer"];
|
|
} else {
|
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Memory === "function") {
|
|
Module["wasmMemory"] = new WebAssembly.Memory({ initial: TOTAL_MEMORY / WASM_PAGE_SIZE });
|
|
buffer = Module["wasmMemory"].buffer;
|
|
} else {
|
|
buffer = new ArrayBuffer(TOTAL_MEMORY);
|
|
}
|
|
Module["buffer"] = buffer;
|
|
}
|
|
updateGlobalBufferViews();
|
|
function getTotalMemory() {
|
|
return TOTAL_MEMORY;
|
|
}
|
|
function callRuntimeCallbacks(callbacks) {
|
|
while (callbacks.length > 0) {
|
|
var callback = callbacks.shift();
|
|
if (typeof callback == "function") {
|
|
callback();
|
|
continue;
|
|
}
|
|
var func = callback.func;
|
|
if (typeof func === "number") {
|
|
if (callback.arg === undefined) {
|
|
Module["dynCall_v"](func);
|
|
} else {
|
|
Module["dynCall_vi"](func, callback.arg);
|
|
}
|
|
} else {
|
|
func(callback.arg === undefined ? null : callback.arg);
|
|
}
|
|
}
|
|
}
|
|
var __ATPRERUN__ = [];
|
|
var __ATINIT__ = [];
|
|
var __ATMAIN__ = [];
|
|
var __ATEXIT__ = [];
|
|
var __ATPOSTRUN__ = [];
|
|
var runtimeInitialized = false;
|
|
var runtimeExited = false;
|
|
function preRun() {
|
|
if (Module["preRun"]) {
|
|
if (typeof Module["preRun"] == "function") Module["preRun"] = [Module["preRun"]];
|
|
while (Module["preRun"].length) {
|
|
addOnPreRun(Module["preRun"].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPRERUN__);
|
|
}
|
|
function ensureInitRuntime() {
|
|
if (runtimeInitialized) return;
|
|
runtimeInitialized = true;
|
|
callRuntimeCallbacks(__ATINIT__);
|
|
}
|
|
function preMain() {
|
|
callRuntimeCallbacks(__ATMAIN__);
|
|
}
|
|
function exitRuntime() {
|
|
callRuntimeCallbacks(__ATEXIT__);
|
|
runtimeExited = true;
|
|
}
|
|
function postRun() {
|
|
if (Module["postRun"]) {
|
|
if (typeof Module["postRun"] == "function") Module["postRun"] = [Module["postRun"]];
|
|
while (Module["postRun"].length) {
|
|
addOnPostRun(Module["postRun"].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPOSTRUN__);
|
|
}
|
|
function addOnPreRun(cb) {
|
|
__ATPRERUN__.unshift(cb);
|
|
}
|
|
function addOnPostRun(cb) {
|
|
__ATPOSTRUN__.unshift(cb);
|
|
}
|
|
function writeStringToMemory(string, buffer, dontAddNull) {
|
|
warnOnce("writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!");
|
|
var lastChar, end;
|
|
if (dontAddNull) {
|
|
end = buffer + lengthBytesUTF8(string);
|
|
lastChar = HEAP8[end];
|
|
}
|
|
stringToUTF8(string, buffer, Infinity);
|
|
if (dontAddNull) HEAP8[end] = lastChar;
|
|
}
|
|
function writeArrayToMemory(array, buffer) {
|
|
HEAP8.set(array, buffer);
|
|
}
|
|
function writeAsciiToMemory(str, buffer, dontAddNull) {
|
|
for (var i = 0; i < str.length; ++i) {
|
|
HEAP8[buffer++ >> 0] = str.charCodeAt(i);
|
|
}
|
|
if (!dontAddNull) HEAP8[buffer >> 0] = 0;
|
|
}
|
|
function unSign(value, bits, ignore) {
|
|
if (value >= 0) {
|
|
return value;
|
|
}
|
|
return bits <= 32 ? 2 * Math.abs(1 << (bits - 1)) + value : Math.pow(2, bits) + value;
|
|
}
|
|
function reSign(value, bits, ignore) {
|
|
if (value <= 0) {
|
|
return value;
|
|
}
|
|
var half = bits <= 32 ? Math.abs(1 << (bits - 1)) : Math.pow(2, bits - 1);
|
|
if (value >= half && (bits <= 32 || value > half)) {
|
|
value = -2 * half + value;
|
|
}
|
|
return value;
|
|
}
|
|
var Math_abs = Math.abs;
|
|
var Math_sqrt = Math.sqrt;
|
|
var Math_ceil = Math.ceil;
|
|
var Math_floor = Math.floor;
|
|
var Math_pow = Math.pow;
|
|
var Math_min = Math.min;
|
|
var Math_clz32 = Math.clz32;
|
|
var Math_trunc = Math.trunc;
|
|
var runDependencies = 0;
|
|
var runDependencyWatcher = null;
|
|
var dependenciesFulfilled = null;
|
|
function getUniqueRunDependency(id) {
|
|
return id;
|
|
}
|
|
function addRunDependency(id) {
|
|
runDependencies++;
|
|
if (Module["monitorRunDependencies"]) {
|
|
Module["monitorRunDependencies"](runDependencies);
|
|
}
|
|
}
|
|
function removeRunDependency(id) {
|
|
runDependencies--;
|
|
if (Module["monitorRunDependencies"]) {
|
|
Module["monitorRunDependencies"](runDependencies);
|
|
}
|
|
if (runDependencies == 0) {
|
|
if (runDependencyWatcher !== null) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null;
|
|
}
|
|
if (dependenciesFulfilled) {
|
|
var callback = dependenciesFulfilled;
|
|
dependenciesFulfilled = null;
|
|
callback();
|
|
}
|
|
}
|
|
}
|
|
Module["preloadedImages"] = {};
|
|
Module["preloadedAudios"] = {};
|
|
var dataURIPrefix = "data:application/octet-stream;base64,";
|
|
function isDataURI(filename) {
|
|
return String.prototype.startsWith ? filename.startsWith(dataURIPrefix) : filename.indexOf(dataURIPrefix) === 0;
|
|
}
|
|
function integrateWasmJS() {
|
|
var wasmTextFile = "build.wast";
|
|
var wasmBinaryFile = "build.wasm";
|
|
var asmjsCodeFile = "build.temp.asm.js";
|
|
if (!isDataURI(wasmTextFile)) {
|
|
wasmTextFile = locateFile(wasmTextFile);
|
|
}
|
|
if (!isDataURI(wasmBinaryFile)) {
|
|
wasmBinaryFile = locateFile(wasmBinaryFile);
|
|
}
|
|
if (!isDataURI(asmjsCodeFile)) {
|
|
asmjsCodeFile = locateFile(asmjsCodeFile);
|
|
}
|
|
var wasmPageSize = 64 * 1024;
|
|
var info = { global: null, env: null, asm2wasm: asm2wasmImports, parent: Module };
|
|
var exports = null;
|
|
function mergeMemory(newBuffer) {
|
|
var oldBuffer = Module["buffer"];
|
|
if (newBuffer.byteLength < oldBuffer.byteLength) {
|
|
err("the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here");
|
|
}
|
|
var oldView = new Int8Array(oldBuffer);
|
|
var newView = new Int8Array(newBuffer);
|
|
newView.set(oldView);
|
|
updateGlobalBuffer(newBuffer);
|
|
updateGlobalBufferViews();
|
|
}
|
|
function fixImports(imports) {
|
|
return imports;
|
|
}
|
|
function getBinary() {
|
|
try {
|
|
if (Module["wasmBinary"]) {
|
|
return new Uint8Array(Module["wasmBinary"]);
|
|
}
|
|
if (Module["readBinary"]) {
|
|
return Module["readBinary"](wasmBinaryFile);
|
|
} else {
|
|
throw "both async and sync fetching of the wasm failed";
|
|
}
|
|
} catch (err) {
|
|
abort(err);
|
|
}
|
|
}
|
|
function getBinaryPromise() {
|
|
if (!Module["wasmBinary"] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === "function") {
|
|
return fetch(wasmBinaryFile, { credentials: "same-origin" })
|
|
.then(function (response) {
|
|
if (!response["ok"]) {
|
|
throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
|
|
}
|
|
return response["arrayBuffer"]();
|
|
})
|
|
.catch(function () {
|
|
return getBinary();
|
|
});
|
|
}
|
|
return new Promise(function (resolve, reject) {
|
|
resolve(getBinary());
|
|
});
|
|
}
|
|
function doNativeWasm(global, env, providedBuffer) {
|
|
if (typeof WebAssembly !== "object") {
|
|
err("no native wasm support detected");
|
|
return false;
|
|
}
|
|
if (!(Module["wasmMemory"] instanceof WebAssembly.Memory)) {
|
|
err("no native wasm Memory in use");
|
|
return false;
|
|
}
|
|
env["memory"] = Module["wasmMemory"];
|
|
info["global"] = { NaN: NaN, Infinity: Infinity };
|
|
info["global.Math"] = Math;
|
|
info["env"] = env;
|
|
function receiveInstance(instance, module) {
|
|
exports = instance.exports;
|
|
if (exports.memory) mergeMemory(exports.memory);
|
|
Module["asm"] = exports;
|
|
Module["usingWasm"] = true;
|
|
removeRunDependency("wasm-instantiate");
|
|
}
|
|
addRunDependency("wasm-instantiate");
|
|
if (Module["instantiateWasm"]) {
|
|
try {
|
|
return Module["instantiateWasm"](info, receiveInstance);
|
|
} catch (e) {
|
|
err("Module.instantiateWasm callback failed with error: " + e);
|
|
return false;
|
|
}
|
|
}
|
|
function receiveInstantiatedSource(output) {
|
|
receiveInstance(output["instance"], output["module"]);
|
|
}
|
|
function instantiateArrayBuffer(receiver) {
|
|
getBinaryPromise()
|
|
.then(function (binary) {
|
|
return WebAssembly.instantiate(binary, info);
|
|
})
|
|
.then(receiver)
|
|
.catch(function (reason) {
|
|
err("failed to asynchronously prepare wasm: " + reason);
|
|
abort(reason);
|
|
});
|
|
}
|
|
if (!Module["wasmBinary"] && typeof WebAssembly.instantiateStreaming === "function" && !isDataURI(wasmBinaryFile) && typeof fetch === "function") {
|
|
WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: "same-origin" }), info)
|
|
.then(receiveInstantiatedSource)
|
|
.catch(function (reason) {
|
|
err("wasm streaming compile failed: " + reason);
|
|
err("falling back to ArrayBuffer instantiation");
|
|
instantiateArrayBuffer(receiveInstantiatedSource);
|
|
});
|
|
} else {
|
|
instantiateArrayBuffer(receiveInstantiatedSource);
|
|
}
|
|
return {};
|
|
}
|
|
Module["asmPreload"] = Module["asm"];
|
|
var asmjsReallocBuffer = Module["reallocBuffer"];
|
|
var wasmReallocBuffer = function (size) {
|
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE;
|
|
size = alignUp(size, PAGE_MULTIPLE);
|
|
var old = Module["buffer"];
|
|
var oldSize = old.byteLength;
|
|
if (Module["usingWasm"]) {
|
|
try {
|
|
var result = Module["wasmMemory"].grow((size - oldSize) / wasmPageSize);
|
|
if (result !== (-1 | 0)) {
|
|
return (Module["buffer"] = Module["wasmMemory"].buffer);
|
|
} else {
|
|
return null;
|
|
}
|
|
} catch (e) {
|
|
return null;
|
|
}
|
|
}
|
|
};
|
|
Module["reallocBuffer"] = function (size) {
|
|
if (finalMethod === "asmjs") {
|
|
return asmjsReallocBuffer(size);
|
|
} else {
|
|
return wasmReallocBuffer(size);
|
|
}
|
|
};
|
|
var finalMethod = "";
|
|
Module["asm"] = function (global, env, providedBuffer) {
|
|
env = fixImports(env);
|
|
if (!env["table"]) {
|
|
var TABLE_SIZE = Module["wasmTableSize"];
|
|
if (TABLE_SIZE === undefined) TABLE_SIZE = 1024;
|
|
var MAX_TABLE_SIZE = Module["wasmMaxTableSize"];
|
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Table === "function") {
|
|
if (MAX_TABLE_SIZE !== undefined) {
|
|
env["table"] = new WebAssembly.Table({ initial: TABLE_SIZE, maximum: MAX_TABLE_SIZE, element: "anyfunc" });
|
|
} else {
|
|
env["table"] = new WebAssembly.Table({ initial: TABLE_SIZE, element: "anyfunc" });
|
|
}
|
|
} else {
|
|
env["table"] = new Array(TABLE_SIZE);
|
|
}
|
|
Module["wasmTable"] = env["table"];
|
|
}
|
|
if (!env["memoryBase"]) {
|
|
env["memoryBase"] = Module["STATIC_BASE"];
|
|
}
|
|
if (!env["tableBase"]) {
|
|
env["tableBase"] = 0;
|
|
}
|
|
var exports;
|
|
exports = doNativeWasm(global, env, providedBuffer);
|
|
assert(exports, "no binaryen method succeeded.");
|
|
return exports;
|
|
};
|
|
}
|
|
integrateWasmJS();
|
|
var ASM_CONSTS = [
|
|
function () {
|
|
return Module.webglContextAttributes.premultipliedAlpha;
|
|
},
|
|
function () {
|
|
return Module.webglContextAttributes.preserveDrawingBuffer;
|
|
},
|
|
function ($0) {
|
|
throw new Error('Internal Unity error: gles::GetProcAddress("' + Pointer_stringify($0) + '") was called but gles::GetProcAddress() is not implemented on Unity WebGL. Please report a bug.');
|
|
},
|
|
function () {
|
|
return typeof Module.shouldQuit != "undefined";
|
|
},
|
|
function () {
|
|
for (var id in Module.intervals) {
|
|
window.clearInterval(id);
|
|
}
|
|
Module.intervals = {};
|
|
for (var i = 0; i < Module.deinitializers.length; i++) {
|
|
Module.deinitializers[i]();
|
|
}
|
|
Module.deinitializers = [];
|
|
if (typeof Module.onQuit == "function") Module.onQuit();
|
|
},
|
|
];
|
|
function _emscripten_asm_const_i(code) {
|
|
return ASM_CONSTS[code]();
|
|
}
|
|
function _emscripten_asm_const_sync_on_main_thread_i(code) {
|
|
return ASM_CONSTS[code]();
|
|
}
|
|
function _emscripten_asm_const_ii(code, a0) {
|
|
return ASM_CONSTS[code](a0);
|
|
}
|
|
STATIC_BASE = GLOBAL_BASE;
|
|
STATICTOP = STATIC_BASE + 3845648;
|
|
__ATINIT__.push(
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AIScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AnimationScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Animation_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Animation_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Animation_7_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AnimationClip_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AudioScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Video_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_3_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_ClothScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Cloth_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_18();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_nvcloth_src_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_nvcloth_src_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_SwInterCollision_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_SwSolverKernel_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Input_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_GfxDeviceNull_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Allocator_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Application_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Burst_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_6_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_7_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_8_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Shadows_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_GUITexture_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Containers_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_File_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Geometry_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_104();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_4_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_5_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_6_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_8_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_10_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_11_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Interfaces_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Interfaces_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Interfaces_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Jobs_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Jobs_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Math_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Math_Random_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Misc_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Misc_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_131();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Misc_4_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Misc_5_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Profiler_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Profiler_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_SceneManager_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_7754();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Shaders_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Shaders_3_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_9();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_8911();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Transform_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Transform_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Utilities_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_9307();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Utilities_5_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Utilities_6_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Utilities_7_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Utilities_9_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_AssetBundleFileSystem_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Modules_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_18_1180();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_19();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_20();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Director_Core_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Scripting_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Scripting_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Scripting_3_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_TemplateInstantiations_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Serialize_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Serialize_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Mesh_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_LogAssert_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Shader_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_DirectorScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_GridScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Grid_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_3785();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_IMGUIScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_IMGUI_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_23();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_IMGUI_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_InputScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Input_Private_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_ShapeModule_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_UVModule_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Physics2DScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_PhysicsScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Physics_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Physics_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_PhysicsQuery_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Subsystems_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_TerrainScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___cxx_global_var_init_89();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_TextCoreScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_TilemapScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Tilemap_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_UIScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_UI_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_UI_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_UI_2_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_umbra_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_UnityAdsSettings_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_VFXScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_VFX_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_VFX_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_VisualEffectAsset_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_VideoScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_VRScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_VR_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_VR_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_PluginInterfaceVR_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Wind_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_XRScriptingClasses_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_XRAudio_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_XRPreInit_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Stats_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_os_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp();
|
|
},
|
|
},
|
|
{
|
|
func: function () {
|
|
___emscripten_environ_constructor();
|
|
},
|
|
}
|
|
);
|
|
var STATIC_BUMP = 3845648;
|
|
Module["STATIC_BASE"] = STATIC_BASE;
|
|
Module["STATIC_BUMP"] = STATIC_BUMP;
|
|
var tempDoublePtr = STATICTOP;
|
|
STATICTOP += 16;
|
|
function _CopyToClipboardSDK(text) {
|
|
const elem = document.createElement("textarea");
|
|
elem.value = typeof UTF8ToString !== "undefined" ? UTF8ToString(text) : Pointer_stringify(text);
|
|
document.body.appendChild(elem);
|
|
elem.select();
|
|
elem.setSelectionRange(0, 99999);
|
|
document.execCommand("copy");
|
|
document.body.removeChild(elem);
|
|
}
|
|
function _GameplayStartSDK() {
|
|
window.Crazygames.gameplayStart();
|
|
}
|
|
function _GameplayStopSDK() {
|
|
window.Crazygames.gameplayStop();
|
|
}
|
|
function _GetOverlayHtmlInputFieldValue() {
|
|
var inputField = document.getElementById("nativeInputDialogInput");
|
|
var result = "";
|
|
if (inputField && inputField.value) {
|
|
result = inputField.value;
|
|
}
|
|
var buffer = _malloc(lengthBytesUTF8(result) + 1);
|
|
writeStringToMemory(result, buffer);
|
|
return buffer;
|
|
}
|
|
function _GetScreenshotSDK(img, size) {
|
|
var binary = "";
|
|
for (var i = 0; i < size; i++) binary += String.fromCharCode(HEAPU8[img + i]);
|
|
var dataUrl = "data:image/jpg;base64," + btoa(binary);
|
|
window.Crazygames.screenshotReceived(dataUrl);
|
|
}
|
|
function _GetUrlParametersSDK() {
|
|
const urlParameters = window.location.search;
|
|
var bufferSize = lengthBytesUTF8(urlParameters) + 1;
|
|
var buffer = _malloc(bufferSize);
|
|
stringToUTF8(urlParameters, buffer, bufferSize);
|
|
return buffer;
|
|
}
|
|
function _HappyTimeSDK() {
|
|
window.Crazygames.happytime();
|
|
}
|
|
function _HideUnityScreenIfHtmlOverlayCant() {
|
|
if (navigator.userAgent.indexOf("Chrome/") < 0) {
|
|
document.getElementById("canvas").style.display = "none";
|
|
}
|
|
}
|
|
function _InitSDK(version, objectName) {
|
|
if (!window.Crazygames) {
|
|
return false;
|
|
}
|
|
window.Crazygames.init({ version: typeof UTF8ToString !== "undefined" ? UTF8ToString(version) : Pointer_stringify(version), crazySDKObjectName: typeof UTF8ToString !== "undefined" ? UTF8ToString(objectName) : Pointer_stringify(objectName), sdkType: "unity5.6" });
|
|
return true;
|
|
}
|
|
function _InitSDKLite(version) {
|
|
if (!window.Crazygames) {
|
|
return false;
|
|
}
|
|
window.Crazygames.init({ version: typeof UTF8ToString !== "undefined" ? UTF8ToString(version) : Pointer_stringify(version), sdkType: "unity-lite" });
|
|
}
|
|
function _IsOverlayDialogHtmlActive() {
|
|
var nativeDialog = document.getElementById("nativeInputDialog");
|
|
if (!nativeDialog) {
|
|
return false;
|
|
}
|
|
return nativeDialog.style.display != "none";
|
|
}
|
|
function _IsOverlayDialogHtmlCanceled() {
|
|
var check = document.getElementById("nativeInputDialogCheck");
|
|
if (!check) {
|
|
return false;
|
|
}
|
|
return check.checked;
|
|
}
|
|
function _IsRunningOnEdgeBrowser() {
|
|
if (navigator.userAgent.indexOf("Edge/") < 0) {
|
|
return false;
|
|
}
|
|
return true;
|
|
}
|
|
function _JS_Cursor_SetImage(ptr, length) {
|
|
var binary = "";
|
|
for (var i = 0; i < length; i++) binary += String.fromCharCode(HEAPU8[ptr + i]);
|
|
Module.canvas.style.cursor = "url(data:image/cur;base64," + btoa(binary) + "),default";
|
|
}
|
|
function _JS_Cursor_SetShow(show) {
|
|
Module.canvas.style.cursor = show ? "default" : "none";
|
|
}
|
|
function _JS_Eval_ClearInterval(id) {
|
|
window.clearInterval(id);
|
|
}
|
|
function _JS_Eval_OpenURL(ptr) {
|
|
var str = Pointer_stringify(ptr);
|
|
window.open(str, "_blank", "");
|
|
}
|
|
function _JS_Eval_SetInterval(func, arg, millis) {
|
|
Module["noExitRuntime"] = true;
|
|
function wrapper() {
|
|
getFuncWrapper(func, "vi")(arg);
|
|
}
|
|
return Browser.safeSetInterval(wrapper, millis);
|
|
}
|
|
var fs = {
|
|
numPendingSync: 0,
|
|
syncInternal: 1e3,
|
|
syncInProgress: false,
|
|
sync: function (onlyPendingSync) {
|
|
if (onlyPendingSync) {
|
|
if (fs.numPendingSync == 0) return;
|
|
} else if (fs.syncInProgress) {
|
|
fs.numPendingSync++;
|
|
return;
|
|
}
|
|
fs.syncInProgress = true;
|
|
FS.syncfs(false, function (err) {
|
|
fs.syncInProgress = false;
|
|
});
|
|
fs.numPendingSync = 0;
|
|
},
|
|
};
|
|
function _JS_FileSystem_Initialize() {
|
|
Module.setInterval(function () {
|
|
fs.sync(true);
|
|
}, fs.syncInternal);
|
|
}
|
|
function _JS_FileSystem_Sync() {
|
|
fs.sync(false);
|
|
}
|
|
function _JS_Log_Dump(ptr, type) {
|
|
var str = Pointer_stringify(ptr);
|
|
if (typeof dump == "function") dump(str);
|
|
switch (type) {
|
|
case 0:
|
|
case 1:
|
|
case 4:
|
|
console.error(str);
|
|
return;
|
|
case 2:
|
|
console.warn(str);
|
|
return;
|
|
case 3:
|
|
case 5:
|
|
console.log(ptr);
|
|
console.log(str);
|
|
return;
|
|
default:
|
|
console.error("Unknown console message type!");
|
|
console.error(str);
|
|
}
|
|
}
|
|
function _JS_Log_StackTrace(buffer, bufferSize) {
|
|
var trace = stackTrace();
|
|
if (buffer) stringToUTF8(trace, buffer, bufferSize);
|
|
return lengthBytesUTF8(trace);
|
|
}
|
|
var WEBAudio = { audioInstances: [], audioContext: {}, audioWebEnabled: 0 };
|
|
function _JS_Sound_Create_Channel(callback, userData) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = {
|
|
gain: WEBAudio.audioContext.createGain(),
|
|
panner: WEBAudio.audioContext.createPanner(),
|
|
threeD: false,
|
|
playBuffer: function (delay, buffer, offset) {
|
|
this.source.buffer = buffer;
|
|
var chan = this;
|
|
this.source.onended = function () {
|
|
if (callback) dynCall("vi", callback, [userData]);
|
|
chan.setup();
|
|
};
|
|
this.source.start(delay, offset);
|
|
},
|
|
setup: function () {
|
|
this.source = WEBAudio.audioContext.createBufferSource();
|
|
this.setupPanning();
|
|
},
|
|
setupPanning: function () {
|
|
if (this.threeD) {
|
|
this.source.disconnect();
|
|
this.source.connect(this.panner);
|
|
this.panner.connect(this.gain);
|
|
} else {
|
|
this.panner.disconnect();
|
|
this.source.connect(this.gain);
|
|
}
|
|
},
|
|
};
|
|
channel.panner.rolloffFactor = 0;
|
|
channel.gain.connect(WEBAudio.audioContext.destination);
|
|
channel.setup();
|
|
return WEBAudio.audioInstances.push(channel) - 1;
|
|
}
|
|
function _JS_Sound_GetLength(bufferInstance) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 0;
|
|
var sound = WEBAudio.audioInstances[bufferInstance];
|
|
var sampleRateRatio = 44100 / sound.buffer.sampleRate;
|
|
return sound.buffer.length * sampleRateRatio;
|
|
}
|
|
function _JS_Sound_GetLoadState(bufferInstance) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 2;
|
|
var sound = WEBAudio.audioInstances[bufferInstance];
|
|
if (sound.error) return 2;
|
|
if (sound.buffer) return 0;
|
|
return 1;
|
|
}
|
|
function _JS_Sound_Init() {
|
|
try {
|
|
window.AudioContext = window.AudioContext || window.webkitAudioContext;
|
|
WEBAudio.audioContext = new AudioContext();
|
|
var tryToResumeAudioContext = function () {
|
|
if (WEBAudio.audioContext.state === "suspended") WEBAudio.audioContext.resume();
|
|
else Module.clearInterval(resumeInterval);
|
|
};
|
|
var resumeInterval = Module.setInterval(tryToResumeAudioContext, 400);
|
|
WEBAudio.audioWebEnabled = 1;
|
|
} catch (e) {
|
|
alert("Web Audio API is not supported in this browser");
|
|
}
|
|
}
|
|
function _JS_Sound_Load(ptr, length) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 0;
|
|
var sound = { buffer: null, error: false };
|
|
var instance = WEBAudio.audioInstances.push(sound) - 1;
|
|
var audioData = HEAPU8.buffer.slice(ptr, ptr + length);
|
|
WEBAudio.audioContext.decodeAudioData(
|
|
audioData,
|
|
function (buffer) {
|
|
sound.buffer = buffer;
|
|
},
|
|
function () {
|
|
sound.error = true;
|
|
console.log("Decode error.");
|
|
}
|
|
);
|
|
return instance;
|
|
}
|
|
function _JS_Sound_Load_PCM(channels, length, sampleRate, ptr) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 0;
|
|
var sound = { buffer: WEBAudio.audioContext.createBuffer(channels, length, sampleRate), error: false };
|
|
for (var i = 0; i < channels; i++) {
|
|
var offs = (ptr >> 2) + length * i;
|
|
var buffer = sound.buffer;
|
|
var copyToChannel =
|
|
buffer["copyToChannel"] ||
|
|
function (source, channelNumber, startInChannel) {
|
|
var clipped = source.subarray(0, Math.min(source.length, this.length - (startInChannel | 0)));
|
|
this.getChannelData(channelNumber | 0).set(clipped, startInChannel | 0);
|
|
};
|
|
copyToChannel.apply(buffer, [HEAPF32.subarray(offs, offs + length), i, 0]);
|
|
}
|
|
var instance = WEBAudio.audioInstances.push(sound) - 1;
|
|
return instance;
|
|
}
|
|
function _JS_Sound_Play(bufferInstance, channelInstance, offset, delay) {
|
|
_JS_Sound_Stop(channelInstance, 0);
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var sound = WEBAudio.audioInstances[bufferInstance];
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (sound.buffer) {
|
|
try {
|
|
channel.playBuffer(WEBAudio.audioContext.currentTime + delay, sound.buffer, offset);
|
|
} catch (e) {
|
|
console.error("playBuffer error. Exception: " + e);
|
|
}
|
|
} else console.log("Trying to play sound which is not loaded.");
|
|
}
|
|
function _JS_Sound_ReleaseInstance(instance) {
|
|
WEBAudio.audioInstances[instance] = null;
|
|
}
|
|
function _JS_Sound_ResumeIfNeeded() {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
if (WEBAudio.audioContext.state === "suspended") WEBAudio.audioContext.resume();
|
|
}
|
|
function _JS_Sound_Set3D(channelInstance, threeD) {
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (channel.threeD != threeD) {
|
|
channel.threeD = threeD;
|
|
channel.setupPanning();
|
|
}
|
|
}
|
|
function _JS_Sound_SetListenerOrientation(x, y, z, xUp, yUp, zUp) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
if (WEBAudio.audioContext.listener.forwardX) {
|
|
WEBAudio.audioContext.listener.forwardX.setValueAtTime(-x, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.forwardY.setValueAtTime(-y, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.forwardZ.setValueAtTime(-z, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.upX.setValueAtTime(xUp, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.upY.setValueAtTime(yUp, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.upZ.setValueAtTime(zUp, WEBAudio.audioContext.currentTime);
|
|
} else {
|
|
WEBAudio.audioContext.listener.setOrientation(-x, -y, -z, xUp, yUp, zUp);
|
|
}
|
|
}
|
|
function _JS_Sound_SetListenerPosition(x, y, z) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
if (WEBAudio.audioContext.listener.positionX) {
|
|
WEBAudio.audioContext.listener.positionX.setValueAtTime(x, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.positionY.setValueAtTime(y, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.positionZ.setValueAtTime(z, WEBAudio.audioContext.currentTime);
|
|
} else {
|
|
WEBAudio.audioContext.listener.setPosition(x, y, z);
|
|
}
|
|
}
|
|
function _JS_Sound_SetLoop(channelInstance, loop) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
WEBAudio.audioInstances[channelInstance].source.loop = loop;
|
|
}
|
|
function _JS_Sound_SetLoopPoints(channelInstance, loopStart, loopEnd) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
channel.source.loopStart = loopStart;
|
|
channel.source.loopEnd = loopEnd;
|
|
}
|
|
function _JS_Sound_SetPitch(channelInstance, v) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
try {
|
|
WEBAudio.audioInstances[channelInstance].source.playbackRate.setValueAtTime(v, WEBAudio.audioContext.currentTime);
|
|
} catch (e) {
|
|
console.error("Invalid audio pitch " + v + " specified to WebAudio backend!");
|
|
}
|
|
}
|
|
function _JS_Sound_SetPosition(channelInstance, x, y, z) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
WEBAudio.audioInstances[channelInstance].panner.setPosition(x, y, z);
|
|
}
|
|
function _JS_Sound_SetVolume(channelInstance, v) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
try {
|
|
WEBAudio.audioInstances[channelInstance].gain.gain.setValueAtTime(v, WEBAudio.audioContext.currentTime);
|
|
} catch (e) {
|
|
console.error("Invalid audio volume " + v + " specified to WebAudio backend!");
|
|
}
|
|
}
|
|
function _JS_Sound_Stop(channelInstance, delay) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (channel.source.buffer) {
|
|
try {
|
|
channel.source.stop(WEBAudio.audioContext.currentTime + delay);
|
|
} catch (e) {
|
|
channel.source.disconnect();
|
|
}
|
|
if (delay == 0) {
|
|
channel.source.onended = function () {};
|
|
channel.setup();
|
|
}
|
|
}
|
|
}
|
|
function _JS_SystemInfo_GetBrowserName(buffer, bufferSize) {
|
|
var browser = Module.SystemInfo.browser;
|
|
if (buffer) stringToUTF8(browser, buffer, bufferSize);
|
|
return lengthBytesUTF8(browser);
|
|
}
|
|
function _JS_SystemInfo_GetBrowserVersionString(buffer, bufferSize) {
|
|
var browserVer = Module.SystemInfo.browserVersion;
|
|
if (buffer) stringToUTF8(browserVer, buffer, bufferSize);
|
|
return lengthBytesUTF8(browserVer);
|
|
}
|
|
function _JS_SystemInfo_GetCanvasClientSize(domElementSelector, outWidth, outHeight) {
|
|
var selector = UTF8ToString(domElementSelector);
|
|
var canvas = selector == "#canvas" ? Module["canvas"] : document.querySelector(selector);
|
|
HEAPF64[outWidth >> 3] = canvas ? canvas.clientWidth : 0;
|
|
HEAPF64[outHeight >> 3] = canvas ? canvas.clientHeight : 0;
|
|
}
|
|
function _JS_SystemInfo_GetDocumentURL(buffer, bufferSize) {
|
|
if (buffer) stringToUTF8(document.URL, buffer, bufferSize);
|
|
return lengthBytesUTF8(document.URL);
|
|
}
|
|
function _JS_SystemInfo_GetGPUInfo(buffer, bufferSize) {
|
|
var gpuinfo = Module.SystemInfo.gpu;
|
|
if (buffer) stringToUTF8(gpuinfo, buffer, bufferSize);
|
|
return lengthBytesUTF8(gpuinfo);
|
|
}
|
|
function _JS_SystemInfo_GetLanguage(buffer, bufferSize) {
|
|
var language = Module.SystemInfo.language;
|
|
if (buffer) stringToUTF8(language, buffer, bufferSize);
|
|
return lengthBytesUTF8(language);
|
|
}
|
|
function _JS_SystemInfo_GetMatchWebGLToCanvasSize() {
|
|
return Module.matchWebGLToCanvasSize || Module.matchWebGLToCanvasSize === undefined;
|
|
}
|
|
function _JS_SystemInfo_GetMemory() {
|
|
return TOTAL_MEMORY / (1024 * 1024);
|
|
}
|
|
function _JS_SystemInfo_GetOS(buffer, bufferSize) {
|
|
var browser = Module.SystemInfo.os + " " + Module.SystemInfo.osVersion;
|
|
if (buffer) stringToUTF8(browser, buffer, bufferSize);
|
|
return lengthBytesUTF8(browser);
|
|
}
|
|
function _JS_SystemInfo_GetPreferredDevicePixelRatio() {
|
|
return Module.devicePixelRatio || window.devicePixelRatio || 1;
|
|
}
|
|
function _JS_SystemInfo_GetScreenSize(outWidth, outHeight) {
|
|
HEAPF64[outWidth >> 3] = Module.SystemInfo.width;
|
|
HEAPF64[outHeight >> 3] = Module.SystemInfo.height;
|
|
}
|
|
function _JS_SystemInfo_GetStreamingAssetsURL(buffer, bufferSize) {
|
|
if (buffer) stringToUTF8(Module.streamingAssetsUrl, buffer, bufferSize);
|
|
return lengthBytesUTF8(Module.streamingAssetsUrl);
|
|
}
|
|
function _JS_SystemInfo_HasCursorLock() {
|
|
return Module.SystemInfo.hasCursorLock;
|
|
}
|
|
function _JS_SystemInfo_HasFullscreen() {
|
|
return Module.SystemInfo.hasFullscreen;
|
|
}
|
|
function _JS_SystemInfo_HasWebGL() {
|
|
return Module.SystemInfo.hasWebGL;
|
|
}
|
|
var wr = { requestInstances: {}, nextRequestId: 1 };
|
|
function _JS_WebRequest_Abort(request) {
|
|
wr.requestInstances[request].abort();
|
|
}
|
|
function _JS_WebRequest_Create(url, method) {
|
|
var _url = Pointer_stringify(url);
|
|
var _method = Pointer_stringify(method);
|
|
var http = Module.companyName && Module.productName && Module.XMLHttpRequest ? new Module.XMLHttpRequest({ companyName: Module.companyName, productName: Module.productName, cacheControl: Module.cacheControl(_url) }) : new XMLHttpRequest();
|
|
http.open(_method, _url, true);
|
|
http.responseType = "arraybuffer";
|
|
wr.requestInstances[wr.nextRequestId] = http;
|
|
return wr.nextRequestId++;
|
|
}
|
|
function _JS_WebRequest_GetResponseHeaders(request, buffer, bufferSize) {
|
|
var headers = wr.requestInstances[request].getAllResponseHeaders();
|
|
if (buffer) stringToUTF8(headers, buffer, bufferSize);
|
|
return lengthBytesUTF8(headers);
|
|
}
|
|
function _JS_WebRequest_Release(request) {
|
|
var http = wr.requestInstances[request];
|
|
http.onload = null;
|
|
http.onerror = null;
|
|
http.ontimeout = null;
|
|
http.onabort = null;
|
|
delete http;
|
|
wr.requestInstances[request] = null;
|
|
}
|
|
function _JS_WebRequest_Send(request, ptr, length) {
|
|
var http = wr.requestInstances[request];
|
|
try {
|
|
if (length > 0) {
|
|
var postData = HEAPU8.subarray(ptr, ptr + length);
|
|
http.send(postData);
|
|
} else http.send();
|
|
} catch (e) {
|
|
console.error(e.name + ": " + e.message);
|
|
}
|
|
}
|
|
function _JS_WebRequest_SetProgressHandler(request, arg, onprogress) {
|
|
var http = wr.requestInstances[request];
|
|
http.onprogress = function http_onprogress(e) {
|
|
if (onprogress) {
|
|
if (e.lengthComputable) dynCall("viii", onprogress, [arg, e.loaded, e.total]);
|
|
}
|
|
};
|
|
}
|
|
function _JS_WebRequest_SetRequestHeader(request, header, value) {
|
|
var _header = Pointer_stringify(header);
|
|
var _value = Pointer_stringify(value);
|
|
wr.requestInstances[request].setRequestHeader(_header, _value);
|
|
}
|
|
function _JS_WebRequest_SetResponseHandler(request, arg, onresponse) {
|
|
var http = wr.requestInstances[request];
|
|
http.onload = function http_onload(e) {
|
|
if (onresponse) {
|
|
var kWebRequestOK = 0;
|
|
var byteArray = new Uint8Array(http.response);
|
|
if (byteArray.length != 0) {
|
|
var buffer = _malloc(byteArray.length);
|
|
HEAPU8.set(byteArray, buffer);
|
|
dynCall("viiiiii", onresponse, [arg, http.status, buffer, byteArray.length, 0, kWebRequestOK]);
|
|
} else {
|
|
dynCall("viiiiii", onresponse, [arg, http.status, 0, 0, 0, kWebRequestOK]);
|
|
}
|
|
}
|
|
};
|
|
function HandleError(err, code) {
|
|
if (onresponse) {
|
|
var len = lengthBytesUTF8(err) + 1;
|
|
var buffer = _malloc(len);
|
|
stringToUTF8(err, buffer, len);
|
|
dynCall("viiiiii", onresponse, [arg, http.status, 0, 0, buffer, code]);
|
|
_free(buffer);
|
|
}
|
|
}
|
|
http.onerror = function http_onerror(e) {
|
|
var kWebErrorUnknown = 2;
|
|
HandleError("Unknown error.", kWebErrorUnknown);
|
|
};
|
|
http.ontimeout = function http_onerror(e) {
|
|
var kWebErrorTimeout = 14;
|
|
HandleError("Connection timed out.", kWebErrorTimeout);
|
|
};
|
|
http.onabort = function http_onerror(e) {
|
|
var kWebErrorAborted = 17;
|
|
HandleError("Aborted.", kWebErrorAborted);
|
|
};
|
|
}
|
|
function _JS_WebRequest_SetTimeout(request, timeout) {
|
|
wr.requestInstances[request].timeout = timeout;
|
|
}
|
|
function _NativeDialogPrompt(title, defaultValue) {
|
|
defaultValue = Pointer_stringify(defaultValue);
|
|
title = Pointer_stringify(title);
|
|
var result = window.prompt(title, defaultValue);
|
|
if (!result) {
|
|
result = defaultValue;
|
|
}
|
|
var buffer = _malloc(lengthBytesUTF8(result) + 1);
|
|
writeStringToMemory(result, buffer);
|
|
return buffer;
|
|
}
|
|
function _RequestAdSDK(adType) {
|
|
window.Crazygames.requestAd(typeof UTF8ToString !== "undefined" ? UTF8ToString(adType) : Pointer_stringify(adType));
|
|
}
|
|
function _RequestBannersSDK(bannersJSON) {
|
|
const banners = JSON.parse(typeof UTF8ToString !== "undefined" ? UTF8ToString(bannersJSON) : Pointer_stringify(bannersJSON));
|
|
window.Crazygames.requestBanners(banners);
|
|
}
|
|
function _RequestInviteUrlSDK(url) {
|
|
window.Crazygames.requestInviteUrl(typeof UTF8ToString !== "undefined" ? UTF8ToString(url) : Pointer_stringify(url));
|
|
}
|
|
function _SetupOverlayDialogHtml(title, defaultValue, okBtnText, cancelBtnText) {
|
|
title = Pointer_stringify(title);
|
|
defaultValue = Pointer_stringify(defaultValue);
|
|
okBtnText = Pointer_stringify(okBtnText);
|
|
cancelBtnText = Pointer_stringify(cancelBtnText);
|
|
if (!document.getElementById("nativeInputDialogInput")) {
|
|
var style = document.createElement("style");
|
|
style.setAttribute("id", "inputDialogTextSelect");
|
|
style.appendChild(document.createTextNode("#nativeInputDialogInput::-moz-selection { background-color:#00ffff;}"));
|
|
style.appendChild(document.createTextNode("#nativeInputDialogInput::selection { background-color:#00ffff;}"));
|
|
document.head.appendChild(style);
|
|
}
|
|
if (!document.getElementById("nativeInputDialog")) {
|
|
var html = '<div id="nativeInputDialog" style="background:#000000;opacity:0.9;width:100%;height:100%;position:fixed;top:0%;z-index:2147483647;">' + ' <div style="position:relative;top:30%;" align="center" vertical-align="middle">' + ' <div id="nativeInputDialogTitle" style="color:#ffffff;">Here is title</div>' + " <div>" + ' <input id="nativeInputDialogInput" type="text" size="40" onsubmit="">' + " </div>" + ' <div style="margin-top:10px">' + ' <input id="nativeInputDialogOkBtn" type="button" value="OK" onclick="" >' + ' <input id="nativeInputDialogCancelBtn" type="button" value="Cancel" onclick ="">' + ' <input id="nativeInputDialogCheck" type="checkBox" style="display:none;">' + " </div>" + " </div>" + "</div>";
|
|
var element = document.createElement("div");
|
|
element.innerHTML = html;
|
|
document.body.appendChild(element);
|
|
var okFunction = 'document.getElementById("nativeInputDialog" ).style.display = "none";' + 'document.getElementById("nativeInputDialogCheck").checked = false;' + 'document.getElementById("canvas").style.display="";';
|
|
var cancelFunction = 'document.getElementById("nativeInputDialog" ).style.display = "none";' + 'document.getElementById("nativeInputDialogCheck").checked = true;' + 'document.getElementById("canvas").style.display="";';
|
|
var inputField = document.getElementById("nativeInputDialogInput");
|
|
inputField.setAttribute("onsubmit", okFunction);
|
|
var okBtn = document.getElementById("nativeInputDialogOkBtn");
|
|
okBtn.setAttribute("onclick", okFunction);
|
|
var cancelBtn = document.getElementById("nativeInputDialogCancelBtn");
|
|
cancelBtn.setAttribute("onclick", cancelFunction);
|
|
}
|
|
document.getElementById("nativeInputDialogTitle").innerText = title;
|
|
document.getElementById("nativeInputDialogInput").value = defaultValue;
|
|
document.getElementById("nativeInputDialogOkBtn").value = okBtnText;
|
|
document.getElementById("nativeInputDialogCancelBtn").value = cancelBtnText;
|
|
document.getElementById("nativeInputDialog").style.display = "";
|
|
}
|
|
function ___atomic_compare_exchange_8(ptr, expected, desiredl, desiredh, weak, success_memmodel, failure_memmodel) {
|
|
var pl = HEAP32[ptr >> 2];
|
|
var ph = HEAP32[(ptr + 4) >> 2];
|
|
var el = HEAP32[expected >> 2];
|
|
var eh = HEAP32[(expected + 4) >> 2];
|
|
if (pl === el && ph === eh) {
|
|
HEAP32[ptr >> 2] = desiredl;
|
|
HEAP32[(ptr + 4) >> 2] = desiredh;
|
|
return 1;
|
|
} else {
|
|
HEAP32[expected >> 2] = pl;
|
|
HEAP32[(expected + 4) >> 2] = ph;
|
|
return 0;
|
|
}
|
|
}
|
|
function ___atomic_fetch_add_8(ptr, vall, valh, memmodel) {
|
|
var l = HEAP32[ptr >> 2];
|
|
var h = HEAP32[(ptr + 4) >> 2];
|
|
HEAP32[ptr >> 2] = _i64Add(l, h, vall, valh);
|
|
HEAP32[(ptr + 4) >> 2] = getTempRet0();
|
|
return (setTempRet0(h), l) | 0;
|
|
}
|
|
var ENV = {};
|
|
function ___buildEnvironment(environ) {
|
|
var MAX_ENV_VALUES = 64;
|
|
var TOTAL_ENV_SIZE = 1024;
|
|
var poolPtr;
|
|
var envPtr;
|
|
if (!___buildEnvironment.called) {
|
|
___buildEnvironment.called = true;
|
|
ENV["USER"] = ENV["LOGNAME"] = "web_user";
|
|
ENV["PATH"] = "/";
|
|
ENV["PWD"] = "/";
|
|
ENV["HOME"] = "/home/web_user";
|
|
ENV["LANG"] = "C.UTF-8";
|
|
ENV["_"] = Module["thisProgram"];
|
|
poolPtr = getMemory(TOTAL_ENV_SIZE);
|
|
envPtr = getMemory(MAX_ENV_VALUES * 4);
|
|
HEAP32[envPtr >> 2] = poolPtr;
|
|
HEAP32[environ >> 2] = envPtr;
|
|
} else {
|
|
envPtr = HEAP32[environ >> 2];
|
|
poolPtr = HEAP32[envPtr >> 2];
|
|
}
|
|
var strings = [];
|
|
var totalSize = 0;
|
|
for (var key in ENV) {
|
|
if (typeof ENV[key] === "string") {
|
|
var line = key + "=" + ENV[key];
|
|
strings.push(line);
|
|
totalSize += line.length;
|
|
}
|
|
}
|
|
if (totalSize > TOTAL_ENV_SIZE) {
|
|
throw new Error("Environment size exceeded TOTAL_ENV_SIZE!");
|
|
}
|
|
var ptrSize = 4;
|
|
for (var i = 0; i < strings.length; i++) {
|
|
var line = strings[i];
|
|
writeAsciiToMemory(line, poolPtr);
|
|
HEAP32[(envPtr + i * ptrSize) >> 2] = poolPtr;
|
|
poolPtr += line.length + 1;
|
|
}
|
|
HEAP32[(envPtr + strings.length * ptrSize) >> 2] = 0;
|
|
}
|
|
function ___cxa_allocate_exception(size) {
|
|
return _malloc(size);
|
|
}
|
|
function __ZSt18uncaught_exceptionv() {
|
|
return !!__ZSt18uncaught_exceptionv.uncaught_exception;
|
|
}
|
|
var EXCEPTIONS = {
|
|
last: 0,
|
|
caught: [],
|
|
infos: {},
|
|
deAdjust: function (adjusted) {
|
|
if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted;
|
|
for (var key in EXCEPTIONS.infos) {
|
|
var ptr = +key;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
if (info.adjusted === adjusted) {
|
|
return ptr;
|
|
}
|
|
}
|
|
return adjusted;
|
|
},
|
|
addRef: function (ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
info.refcount++;
|
|
},
|
|
decRef: function (ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
assert(info.refcount > 0);
|
|
info.refcount--;
|
|
if (info.refcount === 0 && !info.rethrown) {
|
|
if (info.destructor) {
|
|
Module["dynCall_vi"](info.destructor, ptr);
|
|
}
|
|
delete EXCEPTIONS.infos[ptr];
|
|
___cxa_free_exception(ptr);
|
|
}
|
|
},
|
|
clearRef: function (ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
info.refcount = 0;
|
|
},
|
|
};
|
|
function ___cxa_begin_catch(ptr) {
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
if (info && !info.caught) {
|
|
info.caught = true;
|
|
__ZSt18uncaught_exceptionv.uncaught_exception--;
|
|
}
|
|
if (info) info.rethrown = false;
|
|
EXCEPTIONS.caught.push(ptr);
|
|
EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr));
|
|
return ptr;
|
|
}
|
|
function ___cxa_free_exception(ptr) {
|
|
try {
|
|
return _free(ptr);
|
|
} catch (e) {}
|
|
}
|
|
function ___cxa_end_catch() {
|
|
Module["setThrew"](0);
|
|
var ptr = EXCEPTIONS.caught.pop();
|
|
if (ptr) {
|
|
EXCEPTIONS.decRef(EXCEPTIONS.deAdjust(ptr));
|
|
EXCEPTIONS.last = 0;
|
|
}
|
|
}
|
|
function ___cxa_find_matching_catch_2() {
|
|
return ___cxa_find_matching_catch.apply(null, arguments);
|
|
}
|
|
function ___cxa_find_matching_catch_3() {
|
|
return ___cxa_find_matching_catch.apply(null, arguments);
|
|
}
|
|
function ___cxa_find_matching_catch_4() {
|
|
return ___cxa_find_matching_catch.apply(null, arguments);
|
|
}
|
|
function ___cxa_pure_virtual() {
|
|
ABORT = true;
|
|
throw "Pure virtual function called!";
|
|
}
|
|
function ___cxa_rethrow() {
|
|
var ptr = EXCEPTIONS.caught.pop();
|
|
ptr = EXCEPTIONS.deAdjust(ptr);
|
|
if (!EXCEPTIONS.infos[ptr].rethrown) {
|
|
EXCEPTIONS.caught.push(ptr);
|
|
EXCEPTIONS.infos[ptr].rethrown = true;
|
|
}
|
|
EXCEPTIONS.last = ptr;
|
|
throw ptr;
|
|
}
|
|
function ___resumeException(ptr) {
|
|
if (!EXCEPTIONS.last) {
|
|
EXCEPTIONS.last = ptr;
|
|
}
|
|
throw ptr;
|
|
}
|
|
function ___cxa_find_matching_catch() {
|
|
var thrown = EXCEPTIONS.last;
|
|
if (!thrown) {
|
|
return (setTempRet0(0), 0) | 0;
|
|
}
|
|
var info = EXCEPTIONS.infos[thrown];
|
|
var throwntype = info.type;
|
|
if (!throwntype) {
|
|
return (setTempRet0(0), thrown) | 0;
|
|
}
|
|
var typeArray = Array.prototype.slice.call(arguments);
|
|
var pointer = Module["___cxa_is_pointer_type"](throwntype);
|
|
if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4);
|
|
HEAP32[___cxa_find_matching_catch.buffer >> 2] = thrown;
|
|
thrown = ___cxa_find_matching_catch.buffer;
|
|
for (var i = 0; i < typeArray.length; i++) {
|
|
if (typeArray[i] && Module["___cxa_can_catch"](typeArray[i], throwntype, thrown)) {
|
|
thrown = HEAP32[thrown >> 2];
|
|
info.adjusted = thrown;
|
|
return (setTempRet0(typeArray[i]), thrown) | 0;
|
|
}
|
|
}
|
|
thrown = HEAP32[thrown >> 2];
|
|
return (setTempRet0(throwntype), thrown) | 0;
|
|
}
|
|
function ___cxa_throw(ptr, type, destructor) {
|
|
EXCEPTIONS.infos[ptr] = { ptr: ptr, adjusted: ptr, type: type, destructor: destructor, refcount: 0, caught: false, rethrown: false };
|
|
EXCEPTIONS.last = ptr;
|
|
if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) {
|
|
__ZSt18uncaught_exceptionv.uncaught_exception = 1;
|
|
} else {
|
|
__ZSt18uncaught_exceptionv.uncaught_exception++;
|
|
}
|
|
throw ptr;
|
|
}
|
|
function ___gxx_personality_v0() {}
|
|
function ___lock() {}
|
|
var ERRNO_CODES = { EPERM: 1, ENOENT: 2, ESRCH: 3, EINTR: 4, EIO: 5, ENXIO: 6, E2BIG: 7, ENOEXEC: 8, EBADF: 9, ECHILD: 10, EAGAIN: 11, EWOULDBLOCK: 11, ENOMEM: 12, EACCES: 13, EFAULT: 14, ENOTBLK: 15, EBUSY: 16, EEXIST: 17, EXDEV: 18, ENODEV: 19, ENOTDIR: 20, EISDIR: 21, EINVAL: 22, ENFILE: 23, EMFILE: 24, ENOTTY: 25, ETXTBSY: 26, EFBIG: 27, ENOSPC: 28, ESPIPE: 29, EROFS: 30, EMLINK: 31, EPIPE: 32, EDOM: 33, ERANGE: 34, ENOMSG: 42, EIDRM: 43, ECHRNG: 44, EL2NSYNC: 45, EL3HLT: 46, EL3RST: 47, ELNRNG: 48, EUNATCH: 49, ENOCSI: 50, EL2HLT: 51, EDEADLK: 35, ENOLCK: 37, EBADE: 52, EBADR: 53, EXFULL: 54, ENOANO: 55, EBADRQC: 56, EBADSLT: 57, EDEADLOCK: 35, EBFONT: 59, ENOSTR: 60, ENODATA: 61, ETIME: 62, ENOSR: 63, ENONET: 64, ENOPKG: 65, EREMOTE: 66, ENOLINK: 67, EADV: 68, ESRMNT: 69, ECOMM: 70, EPROTO: 71, EMULTIHOP: 72, EDOTDOT: 73, EBADMSG: 74, ENOTUNIQ: 76, EBADFD: 77, EREMCHG: 78, ELIBACC: 79, ELIBBAD: 80, ELIBSCN: 81, ELIBMAX: 82, ELIBEXEC: 83, ENOSYS: 38, ENOTEMPTY: 39, ENAMETOOLONG: 36, ELOOP: 40, EOPNOTSUPP: 95, EPFNOSUPPORT: 96, ECONNRESET: 104, ENOBUFS: 105, EAFNOSUPPORT: 97, EPROTOTYPE: 91, ENOTSOCK: 88, ENOPROTOOPT: 92, ESHUTDOWN: 108, ECONNREFUSED: 111, EADDRINUSE: 98, ECONNABORTED: 103, ENETUNREACH: 101, ENETDOWN: 100, ETIMEDOUT: 110, EHOSTDOWN: 112, EHOSTUNREACH: 113, EINPROGRESS: 115, EALREADY: 114, EDESTADDRREQ: 89, EMSGSIZE: 90, EPROTONOSUPPORT: 93, ESOCKTNOSUPPORT: 94, EADDRNOTAVAIL: 99, ENETRESET: 102, EISCONN: 106, ENOTCONN: 107, ETOOMANYREFS: 109, EUSERS: 87, EDQUOT: 122, ESTALE: 116, ENOTSUP: 95, ENOMEDIUM: 123, EILSEQ: 84, EOVERFLOW: 75, ECANCELED: 125, ENOTRECOVERABLE: 131, EOWNERDEAD: 130, ESTRPIPE: 86 };
|
|
function ___setErrNo(value) {
|
|
if (Module["___errno_location"]) HEAP32[Module["___errno_location"]() >> 2] = value;
|
|
return value;
|
|
}
|
|
function ___map_file(pathname, size) {
|
|
___setErrNo(ERRNO_CODES.EPERM);
|
|
return -1;
|
|
}
|
|
var ERRNO_MESSAGES = { 0: "Success", 1: "Not super-user", 2: "No such file or directory", 3: "No such process", 4: "Interrupted system call", 5: "I/O error", 6: "No such device or address", 7: "Arg list too long", 8: "Exec format error", 9: "Bad file number", 10: "No children", 11: "No more processes", 12: "Not enough core", 13: "Permission denied", 14: "Bad address", 15: "Block device required", 16: "Mount device busy", 17: "File exists", 18: "Cross-device link", 19: "No such device", 20: "Not a directory", 21: "Is a directory", 22: "Invalid argument", 23: "Too many open files in system", 24: "Too many open files", 25: "Not a typewriter", 26: "Text file busy", 27: "File too large", 28: "No space left on device", 29: "Illegal seek", 30: "Read only file system", 31: "Too many links", 32: "Broken pipe", 33: "Math arg out of domain of func", 34: "Math result not representable", 35: "File locking deadlock error", 36: "File or path name too long", 37: "No record locks available", 38: "Function not implemented", 39: "Directory not empty", 40: "Too many symbolic links", 42: "No message of desired type", 43: "Identifier removed", 44: "Channel number out of range", 45: "Level 2 not synchronized", 46: "Level 3 halted", 47: "Level 3 reset", 48: "Link number out of range", 49: "Protocol driver not attached", 50: "No CSI structure available", 51: "Level 2 halted", 52: "Invalid exchange", 53: "Invalid request descriptor", 54: "Exchange full", 55: "No anode", 56: "Invalid request code", 57: "Invalid slot", 59: "Bad font file fmt", 60: "Device not a stream", 61: "No data (for no delay io)", 62: "Timer expired", 63: "Out of streams resources", 64: "Machine is not on the network", 65: "Package not installed", 66: "The object is remote", 67: "The link has been severed", 68: "Advertise error", 69: "Srmount error", 70: "Communication error on send", 71: "Protocol error", 72: "Multihop attempted", 73: "Cross mount point (not really error)", 74: "Trying to read unreadable message", 75: "Value too large for defined data type", 76: "Given log. name not unique", 77: "f.d. invalid for this operation", 78: "Remote address changed", 79: "Can access a needed shared lib", 80: "Accessing a corrupted shared lib", 81: ".lib section in a.out corrupted", 82: "Attempting to link in too many libs", 83: "Attempting to exec a shared library", 84: "Illegal byte sequence", 86: "Streams pipe error", 87: "Too many users", 88: "Socket operation on non-socket", 89: "Destination address required", 90: "Message too long", 91: "Protocol wrong type for socket", 92: "Protocol not available", 93: "Unknown protocol", 94: "Socket type not supported", 95: "Not supported", 96: "Protocol family not supported", 97: "Address family not supported by protocol family", 98: "Address already in use", 99: "Address not available", 100: "Network interface is not configured", 101: "Network is unreachable", 102: "Connection reset by network", 103: "Connection aborted", 104: "Connection reset by peer", 105: "No buffer space available", 106: "Socket is already connected", 107: "Socket is not connected", 108: "Can't send after socket shutdown", 109: "Too many references", 110: "Connection timed out", 111: "Connection refused", 112: "Host is down", 113: "Host is unreachable", 114: "Socket already connected", 115: "Connection already in progress", 116: "Stale file handle", 122: "Quota exceeded", 123: "No medium (in tape drive)", 125: "Operation canceled", 130: "Previous owner died", 131: "State not recoverable" };
|
|
var PATH = {
|
|
splitPath: function (filename) {
|
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
|
|
return splitPathRe.exec(filename).slice(1);
|
|
},
|
|
normalizeArray: function (parts, allowAboveRoot) {
|
|
var up = 0;
|
|
for (var i = parts.length - 1; i >= 0; i--) {
|
|
var last = parts[i];
|
|
if (last === ".") {
|
|
parts.splice(i, 1);
|
|
} else if (last === "..") {
|
|
parts.splice(i, 1);
|
|
up++;
|
|
} else if (up) {
|
|
parts.splice(i, 1);
|
|
up--;
|
|
}
|
|
}
|
|
if (allowAboveRoot) {
|
|
for (; up; up--) {
|
|
parts.unshift("..");
|
|
}
|
|
}
|
|
return parts;
|
|
},
|
|
normalize: function (path) {
|
|
var isAbsolute = path.charAt(0) === "/",
|
|
trailingSlash = path.substr(-1) === "/";
|
|
path = PATH.normalizeArray(
|
|
path.split("/").filter(function (p) {
|
|
return !!p;
|
|
}),
|
|
!isAbsolute
|
|
).join("/");
|
|
if (!path && !isAbsolute) {
|
|
path = ".";
|
|
}
|
|
if (path && trailingSlash) {
|
|
path += "/";
|
|
}
|
|
return (isAbsolute ? "/" : "") + path;
|
|
},
|
|
dirname: function (path) {
|
|
var result = PATH.splitPath(path),
|
|
root = result[0],
|
|
dir = result[1];
|
|
if (!root && !dir) {
|
|
return ".";
|
|
}
|
|
if (dir) {
|
|
dir = dir.substr(0, dir.length - 1);
|
|
}
|
|
return root + dir;
|
|
},
|
|
basename: function (path) {
|
|
if (path === "/") return "/";
|
|
var lastSlash = path.lastIndexOf("/");
|
|
if (lastSlash === -1) return path;
|
|
return path.substr(lastSlash + 1);
|
|
},
|
|
extname: function (path) {
|
|
return PATH.splitPath(path)[3];
|
|
},
|
|
join: function () {
|
|
var paths = Array.prototype.slice.call(arguments, 0);
|
|
return PATH.normalize(paths.join("/"));
|
|
},
|
|
join2: function (l, r) {
|
|
return PATH.normalize(l + "/" + r);
|
|
},
|
|
resolve: function () {
|
|
var resolvedPath = "",
|
|
resolvedAbsolute = false;
|
|
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
|
|
var path = i >= 0 ? arguments[i] : FS.cwd();
|
|
if (typeof path !== "string") {
|
|
throw new TypeError("Arguments to path.resolve must be strings");
|
|
} else if (!path) {
|
|
return "";
|
|
}
|
|
resolvedPath = path + "/" + resolvedPath;
|
|
resolvedAbsolute = path.charAt(0) === "/";
|
|
}
|
|
resolvedPath = PATH.normalizeArray(
|
|
resolvedPath.split("/").filter(function (p) {
|
|
return !!p;
|
|
}),
|
|
!resolvedAbsolute
|
|
).join("/");
|
|
return (resolvedAbsolute ? "/" : "") + resolvedPath || ".";
|
|
},
|
|
relative: function (from, to) {
|
|
from = PATH.resolve(from).substr(1);
|
|
to = PATH.resolve(to).substr(1);
|
|
function trim(arr) {
|
|
var start = 0;
|
|
for (; start < arr.length; start++) {
|
|
if (arr[start] !== "") break;
|
|
}
|
|
var end = arr.length - 1;
|
|
for (; end >= 0; end--) {
|
|
if (arr[end] !== "") break;
|
|
}
|
|
if (start > end) return [];
|
|
return arr.slice(start, end - start + 1);
|
|
}
|
|
var fromParts = trim(from.split("/"));
|
|
var toParts = trim(to.split("/"));
|
|
var length = Math.min(fromParts.length, toParts.length);
|
|
var samePartsLength = length;
|
|
for (var i = 0; i < length; i++) {
|
|
if (fromParts[i] !== toParts[i]) {
|
|
samePartsLength = i;
|
|
break;
|
|
}
|
|
}
|
|
var outputParts = [];
|
|
for (var i = samePartsLength; i < fromParts.length; i++) {
|
|
outputParts.push("..");
|
|
}
|
|
outputParts = outputParts.concat(toParts.slice(samePartsLength));
|
|
return outputParts.join("/");
|
|
},
|
|
};
|
|
var TTY = {
|
|
ttys: [],
|
|
init: function () {},
|
|
shutdown: function () {},
|
|
register: function (dev, ops) {
|
|
TTY.ttys[dev] = { input: [], output: [], ops: ops };
|
|
FS.registerDevice(dev, TTY.stream_ops);
|
|
},
|
|
stream_ops: {
|
|
open: function (stream) {
|
|
var tty = TTY.ttys[stream.node.rdev];
|
|
if (!tty) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
stream.tty = tty;
|
|
stream.seekable = false;
|
|
},
|
|
close: function (stream) {
|
|
stream.tty.ops.flush(stream.tty);
|
|
},
|
|
flush: function (stream) {
|
|
stream.tty.ops.flush(stream.tty);
|
|
},
|
|
read: function (stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.get_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
|
|
}
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = stream.tty.ops.get_char(stream.tty);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset + i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},
|
|
write: function (stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.put_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
|
|
}
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
stream.tty.ops.put_char(stream.tty, buffer[offset + i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
},
|
|
},
|
|
default_tty_ops: {
|
|
get_char: function (tty) {
|
|
if (!tty.input.length) {
|
|
var result = null;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
var BUFSIZE = 256;
|
|
var buf = new Buffer(BUFSIZE);
|
|
var bytesRead = 0;
|
|
var isPosixPlatform = process.platform != "win32";
|
|
var fd = process.stdin.fd;
|
|
if (isPosixPlatform) {
|
|
var usingDevice = false;
|
|
try {
|
|
fd = fs.openSync("/dev/stdin", "r");
|
|
usingDevice = true;
|
|
} catch (e) {}
|
|
}
|
|
try {
|
|
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
|
|
} catch (e) {
|
|
if (e.toString().indexOf("EOF") != -1) bytesRead = 0;
|
|
else throw e;
|
|
}
|
|
if (usingDevice) {
|
|
fs.closeSync(fd);
|
|
}
|
|
if (bytesRead > 0) {
|
|
result = buf.slice(0, bytesRead).toString("utf-8");
|
|
} else {
|
|
result = null;
|
|
}
|
|
} else if (typeof window != "undefined" && typeof window.prompt == "function") {
|
|
result = window.prompt("Input: ");
|
|
if (result !== null) {
|
|
result += "\n";
|
|
}
|
|
} else if (typeof readline == "function") {
|
|
result = readline();
|
|
if (result !== null) {
|
|
result += "\n";
|
|
}
|
|
}
|
|
if (!result) {
|
|
return null;
|
|
}
|
|
tty.input = intArrayFromString(result, true);
|
|
}
|
|
return tty.input.shift();
|
|
},
|
|
put_char: function (tty, val) {
|
|
if (val === null || val === 10) {
|
|
out(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val);
|
|
}
|
|
},
|
|
flush: function (tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
out(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
},
|
|
},
|
|
default_tty1_ops: {
|
|
put_char: function (tty, val) {
|
|
if (val === null || val === 10) {
|
|
err(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val);
|
|
}
|
|
},
|
|
flush: function (tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
err(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
},
|
|
},
|
|
};
|
|
var MEMFS = {
|
|
ops_table: null,
|
|
mount: function (mount) {
|
|
return MEMFS.createNode(null, "/", 16384 | 511, 0);
|
|
},
|
|
createNode: function (parent, name, mode, dev) {
|
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (!MEMFS.ops_table) {
|
|
MEMFS.ops_table = { dir: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, lookup: MEMFS.node_ops.lookup, mknod: MEMFS.node_ops.mknod, rename: MEMFS.node_ops.rename, unlink: MEMFS.node_ops.unlink, rmdir: MEMFS.node_ops.rmdir, readdir: MEMFS.node_ops.readdir, symlink: MEMFS.node_ops.symlink }, stream: { llseek: MEMFS.stream_ops.llseek } }, file: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: { llseek: MEMFS.stream_ops.llseek, read: MEMFS.stream_ops.read, write: MEMFS.stream_ops.write, allocate: MEMFS.stream_ops.allocate, mmap: MEMFS.stream_ops.mmap, msync: MEMFS.stream_ops.msync } }, link: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, readlink: MEMFS.node_ops.readlink }, stream: {} }, chrdev: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: FS.chrdev_stream_ops } };
|
|
}
|
|
var node = FS.createNode(parent, name, mode, dev);
|
|
if (FS.isDir(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.dir.node;
|
|
node.stream_ops = MEMFS.ops_table.dir.stream;
|
|
node.contents = {};
|
|
} else if (FS.isFile(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.file.node;
|
|
node.stream_ops = MEMFS.ops_table.file.stream;
|
|
node.usedBytes = 0;
|
|
node.contents = null;
|
|
} else if (FS.isLink(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.link.node;
|
|
node.stream_ops = MEMFS.ops_table.link.stream;
|
|
} else if (FS.isChrdev(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.chrdev.node;
|
|
node.stream_ops = MEMFS.ops_table.chrdev.stream;
|
|
}
|
|
node.timestamp = Date.now();
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
}
|
|
return node;
|
|
},
|
|
getFileDataAsRegularArray: function (node) {
|
|
if (node.contents && node.contents.subarray) {
|
|
var arr = [];
|
|
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
|
|
return arr;
|
|
}
|
|
return node.contents;
|
|
},
|
|
getFileDataAsTypedArray: function (node) {
|
|
if (!node.contents) return new Uint8Array();
|
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes);
|
|
return new Uint8Array(node.contents);
|
|
},
|
|
expandFileStorage: function (node, newCapacity) {
|
|
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
|
|
node.contents = MEMFS.getFileDataAsRegularArray(node);
|
|
node.usedBytes = node.contents.length;
|
|
}
|
|
if (!node.contents || node.contents.subarray) {
|
|
var prevCapacity = node.contents ? node.contents.length : 0;
|
|
if (prevCapacity >= newCapacity) return;
|
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
|
|
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125)) | 0);
|
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256);
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newCapacity);
|
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0);
|
|
return;
|
|
}
|
|
if (!node.contents && newCapacity > 0) node.contents = [];
|
|
while (node.contents.length < newCapacity) node.contents.push(0);
|
|
},
|
|
resizeFileStorage: function (node, newSize) {
|
|
if (node.usedBytes == newSize) return;
|
|
if (newSize == 0) {
|
|
node.contents = null;
|
|
node.usedBytes = 0;
|
|
return;
|
|
}
|
|
if (!node.contents || node.contents.subarray) {
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(new ArrayBuffer(newSize));
|
|
if (oldContents) {
|
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes)));
|
|
}
|
|
node.usedBytes = newSize;
|
|
return;
|
|
}
|
|
if (!node.contents) node.contents = [];
|
|
if (node.contents.length > newSize) node.contents.length = newSize;
|
|
else while (node.contents.length < newSize) node.contents.push(0);
|
|
node.usedBytes = newSize;
|
|
},
|
|
node_ops: {
|
|
getattr: function (node) {
|
|
var attr = {};
|
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
|
|
attr.ino = node.id;
|
|
attr.mode = node.mode;
|
|
attr.nlink = 1;
|
|
attr.uid = 0;
|
|
attr.gid = 0;
|
|
attr.rdev = node.rdev;
|
|
if (FS.isDir(node.mode)) {
|
|
attr.size = 4096;
|
|
} else if (FS.isFile(node.mode)) {
|
|
attr.size = node.usedBytes;
|
|
} else if (FS.isLink(node.mode)) {
|
|
attr.size = node.link.length;
|
|
} else {
|
|
attr.size = 0;
|
|
}
|
|
attr.atime = new Date(node.timestamp);
|
|
attr.mtime = new Date(node.timestamp);
|
|
attr.ctime = new Date(node.timestamp);
|
|
attr.blksize = 4096;
|
|
attr.blocks = Math.ceil(attr.size / attr.blksize);
|
|
return attr;
|
|
},
|
|
setattr: function (node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
if (attr.size !== undefined) {
|
|
MEMFS.resizeFileStorage(node, attr.size);
|
|
}
|
|
},
|
|
lookup: function (parent, name) {
|
|
throw FS.genericErrors[ERRNO_CODES.ENOENT];
|
|
},
|
|
mknod: function (parent, name, mode, dev) {
|
|
return MEMFS.createNode(parent, name, mode, dev);
|
|
},
|
|
rename: function (old_node, new_dir, new_name) {
|
|
if (FS.isDir(old_node.mode)) {
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {}
|
|
if (new_node) {
|
|
for (var i in new_node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
}
|
|
}
|
|
delete old_node.parent.contents[old_node.name];
|
|
old_node.name = new_name;
|
|
new_dir.contents[new_name] = old_node;
|
|
old_node.parent = new_dir;
|
|
},
|
|
unlink: function (parent, name) {
|
|
delete parent.contents[name];
|
|
},
|
|
rmdir: function (parent, name) {
|
|
var node = FS.lookupNode(parent, name);
|
|
for (var i in node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
delete parent.contents[name];
|
|
},
|
|
readdir: function (node) {
|
|
var entries = [".", ".."];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue;
|
|
}
|
|
entries.push(key);
|
|
}
|
|
return entries;
|
|
},
|
|
symlink: function (parent, newname, oldpath) {
|
|
var node = MEMFS.createNode(parent, newname, 511 | 40960, 0);
|
|
node.link = oldpath;
|
|
return node;
|
|
},
|
|
readlink: function (node) {
|
|
if (!FS.isLink(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return node.link;
|
|
},
|
|
},
|
|
stream_ops: {
|
|
read: function (stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= stream.node.usedBytes) return 0;
|
|
var size = Math.min(stream.node.usedBytes - position, length);
|
|
assert(size >= 0);
|
|
if (size > 8 && contents.subarray) {
|
|
buffer.set(contents.subarray(position, position + size), offset);
|
|
} else {
|
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
|
|
}
|
|
return size;
|
|
},
|
|
write: function (stream, buffer, offset, length, position, canOwn) {
|
|
if (!length) return 0;
|
|
var node = stream.node;
|
|
node.timestamp = Date.now();
|
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) {
|
|
if (canOwn) {
|
|
node.contents = buffer.subarray(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (node.usedBytes === 0 && position === 0) {
|
|
node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (position + length <= node.usedBytes) {
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
return length;
|
|
}
|
|
}
|
|
MEMFS.expandFileStorage(node, position + length);
|
|
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
else {
|
|
for (var i = 0; i < length; i++) {
|
|
node.contents[position + i] = buffer[offset + i];
|
|
}
|
|
}
|
|
node.usedBytes = Math.max(node.usedBytes, position + length);
|
|
return length;
|
|
},
|
|
llseek: function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position;
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.usedBytes;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
},
|
|
allocate: function (stream, offset, length) {
|
|
MEMFS.expandFileStorage(stream.node, offset + length);
|
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
|
|
},
|
|
mmap: function (stream, buffer, offset, length, position, prot, flags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
var ptr;
|
|
var allocated;
|
|
var contents = stream.node.contents;
|
|
if (!(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer)) {
|
|
allocated = false;
|
|
ptr = contents.byteOffset;
|
|
} else {
|
|
if (position > 0 || position + length < stream.node.usedBytes) {
|
|
if (contents.subarray) {
|
|
contents = contents.subarray(position, position + length);
|
|
} else {
|
|
contents = Array.prototype.slice.call(contents, position, position + length);
|
|
}
|
|
}
|
|
allocated = true;
|
|
var fromHeap = buffer.buffer == HEAP8.buffer;
|
|
ptr = _malloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
|
|
}
|
|
(fromHeap ? HEAP8 : buffer).set(contents, ptr);
|
|
}
|
|
return { ptr: ptr, allocated: allocated };
|
|
},
|
|
msync: function (stream, buffer, offset, length, mmapFlags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
if (mmapFlags & 2) {
|
|
return 0;
|
|
}
|
|
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
|
|
return 0;
|
|
},
|
|
},
|
|
};
|
|
var IDBFS = {
|
|
dbs: {},
|
|
indexedDB: function () {
|
|
if (typeof indexedDB !== "undefined") return indexedDB;
|
|
var ret = null;
|
|
if (typeof window === "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
assert(ret, "IDBFS used, but indexedDB not supported");
|
|
return ret;
|
|
},
|
|
DB_VERSION: 21,
|
|
DB_STORE_NAME: "FILE_DATA",
|
|
mount: function (mount) {
|
|
return MEMFS.mount.apply(null, arguments);
|
|
},
|
|
syncfs: function (mount, populate, callback) {
|
|
IDBFS.getLocalSet(mount, function (err, local) {
|
|
if (err) return callback(err);
|
|
IDBFS.getRemoteSet(mount, function (err, remote) {
|
|
if (err) return callback(err);
|
|
var src = populate ? remote : local;
|
|
var dst = populate ? local : remote;
|
|
IDBFS.reconcile(src, dst, callback);
|
|
});
|
|
});
|
|
},
|
|
getDB: function (name, callback) {
|
|
var db = IDBFS.dbs[name];
|
|
if (db) {
|
|
return callback(null, db);
|
|
}
|
|
var req;
|
|
try {
|
|
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
if (!req) {
|
|
return callback("Unable to connect to IndexedDB");
|
|
}
|
|
req.onupgradeneeded = function (e) {
|
|
var db = e.target.result;
|
|
var transaction = e.target.transaction;
|
|
var fileStore;
|
|
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
|
|
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
} else {
|
|
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
|
|
}
|
|
if (!fileStore.indexNames.contains("timestamp")) {
|
|
fileStore.createIndex("timestamp", "timestamp", { unique: false });
|
|
}
|
|
};
|
|
req.onsuccess = function () {
|
|
db = req.result;
|
|
IDBFS.dbs[name] = db;
|
|
callback(null, db);
|
|
};
|
|
req.onerror = function (e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},
|
|
getLocalSet: function (mount, callback) {
|
|
var entries = {};
|
|
function isRealDir(p) {
|
|
return p !== "." && p !== "..";
|
|
}
|
|
function toAbsolute(root) {
|
|
return function (p) {
|
|
return PATH.join2(root, p);
|
|
};
|
|
}
|
|
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
|
|
while (check.length) {
|
|
var path = check.pop();
|
|
var stat;
|
|
try {
|
|
stat = FS.stat(path);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
if (FS.isDir(stat.mode)) {
|
|
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
|
|
}
|
|
entries[path] = { timestamp: stat.mtime };
|
|
}
|
|
return callback(null, { type: "local", entries: entries });
|
|
},
|
|
getRemoteSet: function (mount, callback) {
|
|
var entries = {};
|
|
IDBFS.getDB(mount.mountpoint, function (err, db) {
|
|
if (err) return callback(err);
|
|
try {
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readonly");
|
|
transaction.onerror = function (e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
var index = store.index("timestamp");
|
|
index.openKeyCursor().onsuccess = function (event) {
|
|
var cursor = event.target.result;
|
|
if (!cursor) {
|
|
return callback(null, { type: "remote", db: db, entries: entries });
|
|
}
|
|
entries[cursor.primaryKey] = { timestamp: cursor.key };
|
|
cursor.continue();
|
|
};
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
});
|
|
},
|
|
loadLocalEntry: function (path, callback) {
|
|
var stat, node;
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
node = lookup.node;
|
|
stat = FS.stat(path);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
if (FS.isDir(stat.mode)) {
|
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode });
|
|
} else if (FS.isFile(stat.mode)) {
|
|
node.contents = MEMFS.getFileDataAsTypedArray(node);
|
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
|
|
} else {
|
|
return callback(new Error("node type not supported"));
|
|
}
|
|
},
|
|
storeLocalEntry: function (path, entry, callback) {
|
|
try {
|
|
if (FS.isDir(entry.mode)) {
|
|
FS.mkdir(path, entry.mode);
|
|
} else if (FS.isFile(entry.mode)) {
|
|
FS.writeFile(path, entry.contents, { canOwn: true });
|
|
} else {
|
|
return callback(new Error("node type not supported"));
|
|
}
|
|
FS.chmod(path, entry.mode);
|
|
FS.utime(path, entry.timestamp, entry.timestamp);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
callback(null);
|
|
},
|
|
removeLocalEntry: function (path, callback) {
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
var stat = FS.stat(path);
|
|
if (FS.isDir(stat.mode)) {
|
|
FS.rmdir(path);
|
|
} else if (FS.isFile(stat.mode)) {
|
|
FS.unlink(path);
|
|
}
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
callback(null);
|
|
},
|
|
loadRemoteEntry: function (store, path, callback) {
|
|
var req = store.get(path);
|
|
req.onsuccess = function (event) {
|
|
callback(null, event.target.result);
|
|
};
|
|
req.onerror = function (e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},
|
|
storeRemoteEntry: function (store, path, entry, callback) {
|
|
var req = store.put(entry, path);
|
|
req.onsuccess = function () {
|
|
callback(null);
|
|
};
|
|
req.onerror = function (e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},
|
|
removeRemoteEntry: function (store, path, callback) {
|
|
var req = store.delete(path);
|
|
req.onsuccess = function () {
|
|
callback(null);
|
|
};
|
|
req.onerror = function (e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},
|
|
reconcile: function (src, dst, callback) {
|
|
var total = 0;
|
|
var create = [];
|
|
Object.keys(src.entries).forEach(function (key) {
|
|
var e = src.entries[key];
|
|
var e2 = dst.entries[key];
|
|
if (!e2 || e.timestamp > e2.timestamp) {
|
|
create.push(key);
|
|
total++;
|
|
}
|
|
});
|
|
var remove = [];
|
|
Object.keys(dst.entries).forEach(function (key) {
|
|
var e = dst.entries[key];
|
|
var e2 = src.entries[key];
|
|
if (!e2) {
|
|
remove.push(key);
|
|
total++;
|
|
}
|
|
});
|
|
if (!total) {
|
|
return callback(null);
|
|
}
|
|
var completed = 0;
|
|
var db = src.type === "remote" ? src.db : dst.db;
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readwrite");
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return callback(err);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= total) {
|
|
return callback(null);
|
|
}
|
|
}
|
|
transaction.onerror = function (e) {
|
|
done(this.error);
|
|
e.preventDefault();
|
|
};
|
|
create.sort().forEach(function (path) {
|
|
if (dst.type === "local") {
|
|
IDBFS.loadRemoteEntry(store, path, function (err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeLocalEntry(path, entry, done);
|
|
});
|
|
} else {
|
|
IDBFS.loadLocalEntry(path, function (err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeRemoteEntry(store, path, entry, done);
|
|
});
|
|
}
|
|
});
|
|
remove
|
|
.sort()
|
|
.reverse()
|
|
.forEach(function (path) {
|
|
if (dst.type === "local") {
|
|
IDBFS.removeLocalEntry(path, done);
|
|
} else {
|
|
IDBFS.removeRemoteEntry(store, path, done);
|
|
}
|
|
});
|
|
},
|
|
};
|
|
var NODEFS = {
|
|
isWindows: false,
|
|
staticInit: function () {
|
|
NODEFS.isWindows = !!process.platform.match(/^win/);
|
|
var flags = process["binding"]("constants");
|
|
if (flags["fs"]) {
|
|
flags = flags["fs"];
|
|
}
|
|
NODEFS.flagsForNodeMap = { 1024: flags["O_APPEND"], 64: flags["O_CREAT"], 128: flags["O_EXCL"], 0: flags["O_RDONLY"], 2: flags["O_RDWR"], 4096: flags["O_SYNC"], 512: flags["O_TRUNC"], 1: flags["O_WRONLY"] };
|
|
},
|
|
bufferFrom: function (arrayBuffer) {
|
|
return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer);
|
|
},
|
|
mount: function (mount) {
|
|
assert(ENVIRONMENT_IS_NODE);
|
|
return NODEFS.createNode(null, "/", NODEFS.getMode(mount.opts.root), 0);
|
|
},
|
|
createNode: function (parent, name, mode, dev) {
|
|
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.node_ops = NODEFS.node_ops;
|
|
node.stream_ops = NODEFS.stream_ops;
|
|
return node;
|
|
},
|
|
getMode: function (path) {
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
if (NODEFS.isWindows) {
|
|
stat.mode = stat.mode | ((stat.mode & 292) >> 2);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return stat.mode;
|
|
},
|
|
realPath: function (node) {
|
|
var parts = [];
|
|
while (node.parent !== node) {
|
|
parts.push(node.name);
|
|
node = node.parent;
|
|
}
|
|
parts.push(node.mount.opts.root);
|
|
parts.reverse();
|
|
return PATH.join.apply(null, parts);
|
|
},
|
|
flagsForNode: function (flags) {
|
|
flags &= ~2097152;
|
|
flags &= ~2048;
|
|
flags &= ~32768;
|
|
flags &= ~524288;
|
|
var newFlags = 0;
|
|
for (var k in NODEFS.flagsForNodeMap) {
|
|
if (flags & k) {
|
|
newFlags |= NODEFS.flagsForNodeMap[k];
|
|
flags ^= k;
|
|
}
|
|
}
|
|
if (!flags) {
|
|
return newFlags;
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
},
|
|
node_ops: {
|
|
getattr: function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
if (NODEFS.isWindows && !stat.blksize) {
|
|
stat.blksize = 4096;
|
|
}
|
|
if (NODEFS.isWindows && !stat.blocks) {
|
|
stat.blocks = ((stat.size + stat.blksize - 1) / stat.blksize) | 0;
|
|
}
|
|
return { dev: stat.dev, ino: stat.ino, mode: stat.mode, nlink: stat.nlink, uid: stat.uid, gid: stat.gid, rdev: stat.rdev, size: stat.size, atime: stat.atime, mtime: stat.mtime, ctime: stat.ctime, blksize: stat.blksize, blocks: stat.blocks };
|
|
},
|
|
setattr: function (node, attr) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (attr.mode !== undefined) {
|
|
fs.chmodSync(path, attr.mode);
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
var date = new Date(attr.timestamp);
|
|
fs.utimesSync(path, date, date);
|
|
}
|
|
if (attr.size !== undefined) {
|
|
fs.truncateSync(path, attr.size);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
lookup: function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
var mode = NODEFS.getMode(path);
|
|
return NODEFS.createNode(parent, name, mode);
|
|
},
|
|
mknod: function (parent, name, mode, dev) {
|
|
var node = NODEFS.createNode(parent, name, mode, dev);
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (FS.isDir(node.mode)) {
|
|
fs.mkdirSync(path, node.mode);
|
|
} else {
|
|
fs.writeFileSync(path, "", { mode: node.mode });
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return node;
|
|
},
|
|
rename: function (oldNode, newDir, newName) {
|
|
var oldPath = NODEFS.realPath(oldNode);
|
|
var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
|
|
try {
|
|
fs.renameSync(oldPath, newPath);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
unlink: function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.unlinkSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
rmdir: function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.rmdirSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
readdir: function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
return fs.readdirSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
symlink: function (parent, newName, oldPath) {
|
|
var newPath = PATH.join2(NODEFS.realPath(parent), newName);
|
|
try {
|
|
fs.symlinkSync(oldPath, newPath);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
readlink: function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
path = fs.readlinkSync(path);
|
|
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
|
|
return path;
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
},
|
|
stream_ops: {
|
|
open: function (stream) {
|
|
var path = NODEFS.realPath(stream.node);
|
|
try {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags));
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
close: function (stream) {
|
|
try {
|
|
if (FS.isFile(stream.node.mode) && stream.nfd) {
|
|
fs.closeSync(stream.nfd);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
read: function (stream, buffer, offset, length, position) {
|
|
if (length === 0) return 0;
|
|
try {
|
|
return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
write: function (stream, buffer, offset, length, position) {
|
|
try {
|
|
return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},
|
|
llseek: function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position;
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
try {
|
|
var stat = fs.fstatSync(stream.nfd);
|
|
position += stat.size;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
},
|
|
},
|
|
};
|
|
var WORKERFS = {
|
|
DIR_MODE: 16895,
|
|
FILE_MODE: 33279,
|
|
reader: null,
|
|
mount: function (mount) {
|
|
assert(ENVIRONMENT_IS_WORKER);
|
|
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
|
|
var root = WORKERFS.createNode(null, "/", WORKERFS.DIR_MODE, 0);
|
|
var createdParents = {};
|
|
function ensureParent(path) {
|
|
var parts = path.split("/");
|
|
var parent = root;
|
|
for (var i = 0; i < parts.length - 1; i++) {
|
|
var curr = parts.slice(0, i + 1).join("/");
|
|
if (!createdParents[curr]) {
|
|
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
|
|
}
|
|
parent = createdParents[curr];
|
|
}
|
|
return parent;
|
|
}
|
|
function base(path) {
|
|
var parts = path.split("/");
|
|
return parts[parts.length - 1];
|
|
}
|
|
Array.prototype.forEach.call(mount.opts["files"] || [], function (file) {
|
|
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
|
|
});
|
|
(mount.opts["blobs"] || []).forEach(function (obj) {
|
|
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
|
|
});
|
|
(mount.opts["packages"] || []).forEach(function (pack) {
|
|
pack["metadata"].files.forEach(function (file) {
|
|
var name = file.filename.substr(1);
|
|
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack["blob"].slice(file.start, file.end));
|
|
});
|
|
});
|
|
return root;
|
|
},
|
|
createNode: function (parent, name, mode, dev, contents, mtime) {
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.mode = mode;
|
|
node.node_ops = WORKERFS.node_ops;
|
|
node.stream_ops = WORKERFS.stream_ops;
|
|
node.timestamp = (mtime || new Date()).getTime();
|
|
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
|
|
if (mode === WORKERFS.FILE_MODE) {
|
|
node.size = contents.size;
|
|
node.contents = contents;
|
|
} else {
|
|
node.size = 4096;
|
|
node.contents = {};
|
|
}
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
}
|
|
return node;
|
|
},
|
|
node_ops: {
|
|
getattr: function (node) {
|
|
return { dev: 1, ino: undefined, mode: node.mode, nlink: 1, uid: 0, gid: 0, rdev: undefined, size: node.size, atime: new Date(node.timestamp), mtime: new Date(node.timestamp), ctime: new Date(node.timestamp), blksize: 4096, blocks: Math.ceil(node.size / 4096) };
|
|
},
|
|
setattr: function (node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
},
|
|
lookup: function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
},
|
|
mknod: function (parent, name, mode, dev) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},
|
|
rename: function (oldNode, newDir, newName) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},
|
|
unlink: function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},
|
|
rmdir: function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},
|
|
readdir: function (node) {
|
|
var entries = [".", ".."];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue;
|
|
}
|
|
entries.push(key);
|
|
}
|
|
return entries;
|
|
},
|
|
symlink: function (parent, newName, oldPath) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},
|
|
readlink: function (node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},
|
|
},
|
|
stream_ops: {
|
|
read: function (stream, buffer, offset, length, position) {
|
|
if (position >= stream.node.size) return 0;
|
|
var chunk = stream.node.contents.slice(position, position + length);
|
|
var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
|
|
buffer.set(new Uint8Array(ab), offset);
|
|
return chunk.size;
|
|
},
|
|
write: function (stream, buffer, offset, length, position) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
},
|
|
llseek: function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position;
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.size;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
},
|
|
},
|
|
};
|
|
STATICTOP += 16;
|
|
STATICTOP += 16;
|
|
STATICTOP += 16;
|
|
var FS = {
|
|
root: null,
|
|
mounts: [],
|
|
devices: {},
|
|
streams: [],
|
|
nextInode: 1,
|
|
nameTable: null,
|
|
currentPath: "/",
|
|
initialized: false,
|
|
ignorePermissions: true,
|
|
trackingDelegate: {},
|
|
tracking: { openFlags: { READ: 1, WRITE: 2 } },
|
|
ErrnoError: null,
|
|
genericErrors: {},
|
|
filesystems: null,
|
|
syncFSRequests: 0,
|
|
handleFSError: function (e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e + " : " + stackTrace();
|
|
return ___setErrNo(e.errno);
|
|
},
|
|
lookupPath: function (path, opts) {
|
|
path = PATH.resolve(FS.cwd(), path);
|
|
opts = opts || {};
|
|
if (!path) return { path: "", node: null };
|
|
var defaults = { follow_mount: true, recurse_count: 0 };
|
|
for (var key in defaults) {
|
|
if (opts[key] === undefined) {
|
|
opts[key] = defaults[key];
|
|
}
|
|
}
|
|
if (opts.recurse_count > 8) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
|
|
}
|
|
var parts = PATH.normalizeArray(
|
|
path.split("/").filter(function (p) {
|
|
return !!p;
|
|
}),
|
|
false
|
|
);
|
|
var current = FS.root;
|
|
var current_path = "/";
|
|
for (var i = 0; i < parts.length; i++) {
|
|
var islast = i === parts.length - 1;
|
|
if (islast && opts.parent) {
|
|
break;
|
|
}
|
|
current = FS.lookupNode(current, parts[i]);
|
|
current_path = PATH.join2(current_path, parts[i]);
|
|
if (FS.isMountpoint(current)) {
|
|
if (!islast || (islast && opts.follow_mount)) {
|
|
current = current.mounted.root;
|
|
}
|
|
}
|
|
if (!islast || opts.follow) {
|
|
var count = 0;
|
|
while (FS.isLink(current.mode)) {
|
|
var link = FS.readlink(current_path);
|
|
current_path = PATH.resolve(PATH.dirname(current_path), link);
|
|
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
|
|
current = lookup.node;
|
|
if (count++ > 40) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return { path: current_path, node: current };
|
|
},
|
|
getPath: function (node) {
|
|
var path;
|
|
while (true) {
|
|
if (FS.isRoot(node)) {
|
|
var mount = node.mount.mountpoint;
|
|
if (!path) return mount;
|
|
return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path;
|
|
}
|
|
path = path ? node.name + "/" + path : node.name;
|
|
node = node.parent;
|
|
}
|
|
},
|
|
hashName: function (parentid, name) {
|
|
var hash = 0;
|
|
for (var i = 0; i < name.length; i++) {
|
|
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
|
|
}
|
|
return ((parentid + hash) >>> 0) % FS.nameTable.length;
|
|
},
|
|
hashAddNode: function (node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
node.name_next = FS.nameTable[hash];
|
|
FS.nameTable[hash] = node;
|
|
},
|
|
hashRemoveNode: function (node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
if (FS.nameTable[hash] === node) {
|
|
FS.nameTable[hash] = node.name_next;
|
|
} else {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
if (current.name_next === node) {
|
|
current.name_next = node.name_next;
|
|
break;
|
|
}
|
|
current = current.name_next;
|
|
}
|
|
}
|
|
},
|
|
lookupNode: function (parent, name) {
|
|
var err = FS.mayLookup(parent);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err, parent);
|
|
}
|
|
var hash = FS.hashName(parent.id, name);
|
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
|
|
var nodeName = node.name;
|
|
if (node.parent.id === parent.id && nodeName === name) {
|
|
return node;
|
|
}
|
|
}
|
|
return FS.lookup(parent, name);
|
|
},
|
|
createNode: function (parent, name, mode, rdev) {
|
|
if (!FS.FSNode) {
|
|
FS.FSNode = function (parent, name, mode, rdev) {
|
|
if (!parent) {
|
|
parent = this;
|
|
}
|
|
this.parent = parent;
|
|
this.mount = parent.mount;
|
|
this.mounted = null;
|
|
this.id = FS.nextInode++;
|
|
this.name = name;
|
|
this.mode = mode;
|
|
this.node_ops = {};
|
|
this.stream_ops = {};
|
|
this.rdev = rdev;
|
|
};
|
|
FS.FSNode.prototype = {};
|
|
var readMode = 292 | 73;
|
|
var writeMode = 146;
|
|
Object.defineProperties(FS.FSNode.prototype, {
|
|
read: {
|
|
get: function () {
|
|
return (this.mode & readMode) === readMode;
|
|
},
|
|
set: function (val) {
|
|
val ? (this.mode |= readMode) : (this.mode &= ~readMode);
|
|
},
|
|
},
|
|
write: {
|
|
get: function () {
|
|
return (this.mode & writeMode) === writeMode;
|
|
},
|
|
set: function (val) {
|
|
val ? (this.mode |= writeMode) : (this.mode &= ~writeMode);
|
|
},
|
|
},
|
|
isFolder: {
|
|
get: function () {
|
|
return FS.isDir(this.mode);
|
|
},
|
|
},
|
|
isDevice: {
|
|
get: function () {
|
|
return FS.isChrdev(this.mode);
|
|
},
|
|
},
|
|
});
|
|
}
|
|
var node = new FS.FSNode(parent, name, mode, rdev);
|
|
FS.hashAddNode(node);
|
|
return node;
|
|
},
|
|
destroyNode: function (node) {
|
|
FS.hashRemoveNode(node);
|
|
},
|
|
isRoot: function (node) {
|
|
return node === node.parent;
|
|
},
|
|
isMountpoint: function (node) {
|
|
return !!node.mounted;
|
|
},
|
|
isFile: function (mode) {
|
|
return (mode & 61440) === 32768;
|
|
},
|
|
isDir: function (mode) {
|
|
return (mode & 61440) === 16384;
|
|
},
|
|
isLink: function (mode) {
|
|
return (mode & 61440) === 40960;
|
|
},
|
|
isChrdev: function (mode) {
|
|
return (mode & 61440) === 8192;
|
|
},
|
|
isBlkdev: function (mode) {
|
|
return (mode & 61440) === 24576;
|
|
},
|
|
isFIFO: function (mode) {
|
|
return (mode & 61440) === 4096;
|
|
},
|
|
isSocket: function (mode) {
|
|
return (mode & 49152) === 49152;
|
|
},
|
|
flagModes: { r: 0, rs: 1052672, "r+": 2, w: 577, wx: 705, xw: 705, "w+": 578, "wx+": 706, "xw+": 706, a: 1089, ax: 1217, xa: 1217, "a+": 1090, "ax+": 1218, "xa+": 1218 },
|
|
modeStringToFlags: function (str) {
|
|
var flags = FS.flagModes[str];
|
|
if (typeof flags === "undefined") {
|
|
throw new Error("Unknown file open mode: " + str);
|
|
}
|
|
return flags;
|
|
},
|
|
flagsToPermissionString: function (flag) {
|
|
var perms = ["r", "w", "rw"][flag & 3];
|
|
if (flag & 512) {
|
|
perms += "w";
|
|
}
|
|
return perms;
|
|
},
|
|
nodePermissions: function (node, perms) {
|
|
if (FS.ignorePermissions) {
|
|
return 0;
|
|
}
|
|
if (perms.indexOf("r") !== -1 && !(node.mode & 292)) {
|
|
return ERRNO_CODES.EACCES;
|
|
} else if (perms.indexOf("w") !== -1 && !(node.mode & 146)) {
|
|
return ERRNO_CODES.EACCES;
|
|
} else if (perms.indexOf("x") !== -1 && !(node.mode & 73)) {
|
|
return ERRNO_CODES.EACCES;
|
|
}
|
|
return 0;
|
|
},
|
|
mayLookup: function (dir) {
|
|
var err = FS.nodePermissions(dir, "x");
|
|
if (err) return err;
|
|
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
|
|
return 0;
|
|
},
|
|
mayCreate: function (dir, name) {
|
|
try {
|
|
var node = FS.lookupNode(dir, name);
|
|
return ERRNO_CODES.EEXIST;
|
|
} catch (e) {}
|
|
return FS.nodePermissions(dir, "wx");
|
|
},
|
|
mayDelete: function (dir, name, isdir) {
|
|
var node;
|
|
try {
|
|
node = FS.lookupNode(dir, name);
|
|
} catch (e) {
|
|
return e.errno;
|
|
}
|
|
var err = FS.nodePermissions(dir, "wx");
|
|
if (err) {
|
|
return err;
|
|
}
|
|
if (isdir) {
|
|
if (!FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.ENOTDIR;
|
|
}
|
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
|
|
return ERRNO_CODES.EBUSY;
|
|
}
|
|
} else {
|
|
if (FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.EISDIR;
|
|
}
|
|
}
|
|
return 0;
|
|
},
|
|
mayOpen: function (node, flags) {
|
|
if (!node) {
|
|
return ERRNO_CODES.ENOENT;
|
|
}
|
|
if (FS.isLink(node.mode)) {
|
|
return ERRNO_CODES.ELOOP;
|
|
} else if (FS.isDir(node.mode)) {
|
|
if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) {
|
|
return ERRNO_CODES.EISDIR;
|
|
}
|
|
}
|
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
|
|
},
|
|
MAX_OPEN_FDS: 4096,
|
|
nextfd: function (fd_start, fd_end) {
|
|
fd_start = fd_start || 0;
|
|
fd_end = fd_end || FS.MAX_OPEN_FDS;
|
|
for (var fd = fd_start; fd <= fd_end; fd++) {
|
|
if (!FS.streams[fd]) {
|
|
return fd;
|
|
}
|
|
}
|
|
throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
|
|
},
|
|
getStream: function (fd) {
|
|
return FS.streams[fd];
|
|
},
|
|
createStream: function (stream, fd_start, fd_end) {
|
|
if (!FS.FSStream) {
|
|
FS.FSStream = function () {};
|
|
FS.FSStream.prototype = {};
|
|
Object.defineProperties(FS.FSStream.prototype, {
|
|
object: {
|
|
get: function () {
|
|
return this.node;
|
|
},
|
|
set: function (val) {
|
|
this.node = val;
|
|
},
|
|
},
|
|
isRead: {
|
|
get: function () {
|
|
return (this.flags & 2097155) !== 1;
|
|
},
|
|
},
|
|
isWrite: {
|
|
get: function () {
|
|
return (this.flags & 2097155) !== 0;
|
|
},
|
|
},
|
|
isAppend: {
|
|
get: function () {
|
|
return this.flags & 1024;
|
|
},
|
|
},
|
|
});
|
|
}
|
|
var newStream = new FS.FSStream();
|
|
for (var p in stream) {
|
|
newStream[p] = stream[p];
|
|
}
|
|
stream = newStream;
|
|
var fd = FS.nextfd(fd_start, fd_end);
|
|
stream.fd = fd;
|
|
FS.streams[fd] = stream;
|
|
return stream;
|
|
},
|
|
closeStream: function (fd) {
|
|
FS.streams[fd] = null;
|
|
},
|
|
chrdev_stream_ops: {
|
|
open: function (stream) {
|
|
var device = FS.getDevice(stream.node.rdev);
|
|
stream.stream_ops = device.stream_ops;
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
},
|
|
llseek: function () {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
},
|
|
},
|
|
major: function (dev) {
|
|
return dev >> 8;
|
|
},
|
|
minor: function (dev) {
|
|
return dev & 255;
|
|
},
|
|
makedev: function (ma, mi) {
|
|
return (ma << 8) | mi;
|
|
},
|
|
registerDevice: function (dev, ops) {
|
|
FS.devices[dev] = { stream_ops: ops };
|
|
},
|
|
getDevice: function (dev) {
|
|
return FS.devices[dev];
|
|
},
|
|
getMounts: function (mount) {
|
|
var mounts = [];
|
|
var check = [mount];
|
|
while (check.length) {
|
|
var m = check.pop();
|
|
mounts.push(m);
|
|
check.push.apply(check, m.mounts);
|
|
}
|
|
return mounts;
|
|
},
|
|
syncfs: function (populate, callback) {
|
|
if (typeof populate === "function") {
|
|
callback = populate;
|
|
populate = false;
|
|
}
|
|
FS.syncFSRequests++;
|
|
if (FS.syncFSRequests > 1) {
|
|
console.log("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work");
|
|
}
|
|
var mounts = FS.getMounts(FS.root.mount);
|
|
var completed = 0;
|
|
function doCallback(err) {
|
|
assert(FS.syncFSRequests > 0);
|
|
FS.syncFSRequests--;
|
|
return callback(err);
|
|
}
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return doCallback(err);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= mounts.length) {
|
|
doCallback(null);
|
|
}
|
|
}
|
|
mounts.forEach(function (mount) {
|
|
if (!mount.type.syncfs) {
|
|
return done(null);
|
|
}
|
|
mount.type.syncfs(mount, populate, done);
|
|
});
|
|
},
|
|
mount: function (type, opts, mountpoint) {
|
|
var root = mountpoint === "/";
|
|
var pseudo = !mountpoint;
|
|
var node;
|
|
if (root && FS.root) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
} else if (!root && !pseudo) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
mountpoint = lookup.path;
|
|
node = lookup.node;
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
if (!FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
}
|
|
var mount = { type: type, opts: opts, mountpoint: mountpoint, mounts: [] };
|
|
var mountRoot = type.mount(mount);
|
|
mountRoot.mount = mount;
|
|
mount.root = mountRoot;
|
|
if (root) {
|
|
FS.root = mountRoot;
|
|
} else if (node) {
|
|
node.mounted = mount;
|
|
if (node.mount) {
|
|
node.mount.mounts.push(mount);
|
|
}
|
|
}
|
|
return mountRoot;
|
|
},
|
|
unmount: function (mountpoint) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
if (!FS.isMountpoint(lookup.node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node = lookup.node;
|
|
var mount = node.mounted;
|
|
var mounts = FS.getMounts(mount);
|
|
Object.keys(FS.nameTable).forEach(function (hash) {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
var next = current.name_next;
|
|
if (mounts.indexOf(current.mount) !== -1) {
|
|
FS.destroyNode(current);
|
|
}
|
|
current = next;
|
|
}
|
|
});
|
|
node.mounted = null;
|
|
var idx = node.mount.mounts.indexOf(mount);
|
|
assert(idx !== -1);
|
|
node.mount.mounts.splice(idx, 1);
|
|
},
|
|
lookup: function (parent, name) {
|
|
return parent.node_ops.lookup(parent, name);
|
|
},
|
|
mknod: function (path, mode, dev) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
if (!name || name === "." || name === "..") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var err = FS.mayCreate(parent, name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.mknod) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return parent.node_ops.mknod(parent, name, mode, dev);
|
|
},
|
|
create: function (path, mode) {
|
|
mode = mode !== undefined ? mode : 438;
|
|
mode &= 4095;
|
|
mode |= 32768;
|
|
return FS.mknod(path, mode, 0);
|
|
},
|
|
mkdir: function (path, mode) {
|
|
mode = mode !== undefined ? mode : 511;
|
|
mode &= 511 | 512;
|
|
mode |= 16384;
|
|
return FS.mknod(path, mode, 0);
|
|
},
|
|
mkdirTree: function (path, mode) {
|
|
var dirs = path.split("/");
|
|
var d = "";
|
|
for (var i = 0; i < dirs.length; ++i) {
|
|
if (!dirs[i]) continue;
|
|
d += "/" + dirs[i];
|
|
try {
|
|
FS.mkdir(d, mode);
|
|
} catch (e) {
|
|
if (e.errno != ERRNO_CODES.EEXIST) throw e;
|
|
}
|
|
}
|
|
},
|
|
mkdev: function (path, mode, dev) {
|
|
if (typeof dev === "undefined") {
|
|
dev = mode;
|
|
mode = 438;
|
|
}
|
|
mode |= 8192;
|
|
return FS.mknod(path, mode, dev);
|
|
},
|
|
symlink: function (oldpath, newpath) {
|
|
if (!PATH.resolve(oldpath)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
var lookup = FS.lookupPath(newpath, { parent: true });
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
var newname = PATH.basename(newpath);
|
|
var err = FS.mayCreate(parent, newname);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.symlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return parent.node_ops.symlink(parent, newname, oldpath);
|
|
},
|
|
rename: function (old_path, new_path) {
|
|
var old_dirname = PATH.dirname(old_path);
|
|
var new_dirname = PATH.dirname(new_path);
|
|
var old_name = PATH.basename(old_path);
|
|
var new_name = PATH.basename(new_path);
|
|
var lookup, old_dir, new_dir;
|
|
try {
|
|
lookup = FS.lookupPath(old_path, { parent: true });
|
|
old_dir = lookup.node;
|
|
lookup = FS.lookupPath(new_path, { parent: true });
|
|
new_dir = lookup.node;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
if (old_dir.mount !== new_dir.mount) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
|
|
}
|
|
var old_node = FS.lookupNode(old_dir, old_name);
|
|
var relative = PATH.relative(old_path, new_dirname);
|
|
if (relative.charAt(0) !== ".") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
relative = PATH.relative(new_path, old_dirname);
|
|
if (relative.charAt(0) !== ".") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {}
|
|
if (old_node === new_node) {
|
|
return;
|
|
}
|
|
var isdir = FS.isDir(old_node.mode);
|
|
var err = FS.mayDelete(old_dir, old_name, isdir);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!old_dir.node_ops.rename) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
if (new_dir !== old_dir) {
|
|
err = FS.nodePermissions(old_dir, "w");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willMovePath"]) {
|
|
FS.trackingDelegate["willMovePath"](old_path, new_path);
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message);
|
|
}
|
|
FS.hashRemoveNode(old_node);
|
|
try {
|
|
old_dir.node_ops.rename(old_node, new_dir, new_name);
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
FS.hashAddNode(old_node);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["onMovePath"]) FS.trackingDelegate["onMovePath"](old_path, new_path);
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message);
|
|
}
|
|
},
|
|
rmdir: function (path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, true);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.rmdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willDeletePath"]) {
|
|
FS.trackingDelegate["willDeletePath"](path);
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message);
|
|
}
|
|
parent.node_ops.rmdir(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path);
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message);
|
|
}
|
|
},
|
|
readdir: function (path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
if (!node.node_ops.readdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
return node.node_ops.readdir(node);
|
|
},
|
|
unlink: function (path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, false);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.unlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willDeletePath"]) {
|
|
FS.trackingDelegate["willDeletePath"](path);
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message);
|
|
}
|
|
parent.node_ops.unlink(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path);
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message);
|
|
}
|
|
},
|
|
readlink: function (path) {
|
|
var lookup = FS.lookupPath(path);
|
|
var link = lookup.node;
|
|
if (!link) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!link.node_ops.readlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
|
|
},
|
|
stat: function (path, dontFollow) {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!node.node_ops.getattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return node.node_ops.getattr(node);
|
|
},
|
|
lstat: function (path) {
|
|
return FS.stat(path, true);
|
|
},
|
|
chmod: function (path, mode, dontFollow) {
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
node.node_ops.setattr(node, { mode: (mode & 4095) | (node.mode & ~4095), timestamp: Date.now() });
|
|
},
|
|
lchmod: function (path, mode) {
|
|
FS.chmod(path, mode, true);
|
|
},
|
|
fchmod: function (fd, mode) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
FS.chmod(stream.node, mode);
|
|
},
|
|
chown: function (path, uid, gid, dontFollow) {
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
node.node_ops.setattr(node, { timestamp: Date.now() });
|
|
},
|
|
lchown: function (path, uid, gid) {
|
|
FS.chown(path, uid, gid, true);
|
|
},
|
|
fchown: function (fd, uid, gid) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
FS.chown(stream.node, uid, gid);
|
|
},
|
|
truncate: function (path, len) {
|
|
if (len < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!FS.isFile(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var err = FS.nodePermissions(node, "w");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
node.node_ops.setattr(node, { size: len, timestamp: Date.now() });
|
|
},
|
|
ftruncate: function (fd, len) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
FS.truncate(stream.node, len);
|
|
},
|
|
utime: function (path, atime, mtime) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
node.node_ops.setattr(node, { timestamp: Math.max(atime, mtime) });
|
|
},
|
|
open: function (path, flags, mode, fd_start, fd_end) {
|
|
if (path === "") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
flags = typeof flags === "string" ? FS.modeStringToFlags(flags) : flags;
|
|
mode = typeof mode === "undefined" ? 438 : mode;
|
|
if (flags & 64) {
|
|
mode = (mode & 4095) | 32768;
|
|
} else {
|
|
mode = 0;
|
|
}
|
|
var node;
|
|
if (typeof path === "object") {
|
|
node = path;
|
|
} else {
|
|
path = PATH.normalize(path);
|
|
try {
|
|
var lookup = FS.lookupPath(path, { follow: !(flags & 131072) });
|
|
node = lookup.node;
|
|
} catch (e) {}
|
|
}
|
|
var created = false;
|
|
if (flags & 64) {
|
|
if (node) {
|
|
if (flags & 128) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
|
|
}
|
|
} else {
|
|
node = FS.mknod(path, mode, 0);
|
|
created = true;
|
|
}
|
|
}
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (FS.isChrdev(node.mode)) {
|
|
flags &= ~512;
|
|
}
|
|
if (flags & 65536 && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
if (!created) {
|
|
var err = FS.mayOpen(node, flags);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
}
|
|
if (flags & 512) {
|
|
FS.truncate(node, 0);
|
|
}
|
|
flags &= ~(128 | 512);
|
|
var stream = FS.createStream({ node: node, path: FS.getPath(node), flags: flags, seekable: true, position: 0, stream_ops: node.stream_ops, ungotten: [], error: false }, fd_start, fd_end);
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
if (Module["logReadFiles"] && !(flags & 1)) {
|
|
if (!FS.readFiles) FS.readFiles = {};
|
|
if (!(path in FS.readFiles)) {
|
|
FS.readFiles[path] = 1;
|
|
err("read file: " + path);
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["onOpenFile"]) {
|
|
var trackingFlags = 0;
|
|
if ((flags & 2097155) !== 1) {
|
|
trackingFlags |= FS.tracking.openFlags.READ;
|
|
}
|
|
if ((flags & 2097155) !== 0) {
|
|
trackingFlags |= FS.tracking.openFlags.WRITE;
|
|
}
|
|
FS.trackingDelegate["onOpenFile"](path, trackingFlags);
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onOpenFile']('" + path + "', flags) threw an exception: " + e.message);
|
|
}
|
|
return stream;
|
|
},
|
|
close: function (stream) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (stream.getdents) stream.getdents = null;
|
|
try {
|
|
if (stream.stream_ops.close) {
|
|
stream.stream_ops.close(stream);
|
|
}
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
FS.closeStream(stream.fd);
|
|
}
|
|
stream.fd = null;
|
|
},
|
|
isClosed: function (stream) {
|
|
return stream.fd === null;
|
|
},
|
|
llseek: function (stream, offset, whence) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (!stream.seekable || !stream.stream_ops.llseek) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
stream.position = stream.stream_ops.llseek(stream, offset, whence);
|
|
stream.ungotten = [];
|
|
return stream.position;
|
|
},
|
|
read: function (stream, buffer, offset, length, position) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!stream.stream_ops.read) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var seeking = typeof position !== "undefined";
|
|
if (!seeking) {
|
|
position = stream.position;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
|
|
if (!seeking) stream.position += bytesRead;
|
|
return bytesRead;
|
|
},
|
|
write: function (stream, buffer, offset, length, position, canOwn) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!stream.stream_ops.write) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if (stream.flags & 1024) {
|
|
FS.llseek(stream, 0, 2);
|
|
}
|
|
var seeking = typeof position !== "undefined";
|
|
if (!seeking) {
|
|
position = stream.position;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
|
|
if (!seeking) stream.position += bytesWritten;
|
|
try {
|
|
if (stream.path && FS.trackingDelegate["onWriteToFile"]) FS.trackingDelegate["onWriteToFile"](stream.path);
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onWriteToFile']('" + path + "') threw an exception: " + e.message);
|
|
}
|
|
return bytesWritten;
|
|
},
|
|
allocate: function (stream, offset, length) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (offset < 0 || length <= 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
if (!stream.stream_ops.allocate) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
|
|
}
|
|
stream.stream_ops.allocate(stream, offset, length);
|
|
},
|
|
mmap: function (stream, buffer, offset, length, position, prot, flags) {
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EACCES);
|
|
}
|
|
if (!stream.stream_ops.mmap) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
|
|
},
|
|
msync: function (stream, buffer, offset, length, mmapFlags) {
|
|
if (!stream || !stream.stream_ops.msync) {
|
|
return 0;
|
|
}
|
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
|
|
},
|
|
munmap: function (stream) {
|
|
return 0;
|
|
},
|
|
ioctl: function (stream, cmd, arg) {
|
|
if (!stream.stream_ops.ioctl) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
|
|
}
|
|
return stream.stream_ops.ioctl(stream, cmd, arg);
|
|
},
|
|
readFile: function (path, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || "r";
|
|
opts.encoding = opts.encoding || "binary";
|
|
if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"');
|
|
}
|
|
var ret;
|
|
var stream = FS.open(path, opts.flags);
|
|
var stat = FS.stat(path);
|
|
var length = stat.size;
|
|
var buf = new Uint8Array(length);
|
|
FS.read(stream, buf, 0, length, 0);
|
|
if (opts.encoding === "utf8") {
|
|
ret = UTF8ArrayToString(buf, 0);
|
|
} else if (opts.encoding === "binary") {
|
|
ret = buf;
|
|
}
|
|
FS.close(stream);
|
|
return ret;
|
|
},
|
|
writeFile: function (path, data, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || "w";
|
|
var stream = FS.open(path, opts.flags, opts.mode);
|
|
if (typeof data === "string") {
|
|
var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
|
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
|
|
FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
|
|
} else if (ArrayBuffer.isView(data)) {
|
|
FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
|
|
} else {
|
|
throw new Error("Unsupported data type");
|
|
}
|
|
FS.close(stream);
|
|
},
|
|
cwd: function () {
|
|
return FS.currentPath;
|
|
},
|
|
chdir: function (path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
if (lookup.node === null) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!FS.isDir(lookup.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
var err = FS.nodePermissions(lookup.node, "x");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
FS.currentPath = lookup.path;
|
|
},
|
|
createDefaultDirectories: function () {
|
|
FS.mkdir("/tmp");
|
|
FS.mkdir("/home");
|
|
FS.mkdir("/home/web_user");
|
|
},
|
|
createDefaultDevices: function () {
|
|
FS.mkdir("/dev");
|
|
FS.registerDevice(FS.makedev(1, 3), {
|
|
read: function () {
|
|
return 0;
|
|
},
|
|
write: function (stream, buffer, offset, length, pos) {
|
|
return length;
|
|
},
|
|
});
|
|
FS.mkdev("/dev/null", FS.makedev(1, 3));
|
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
|
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
|
|
FS.mkdev("/dev/tty", FS.makedev(5, 0));
|
|
FS.mkdev("/dev/tty1", FS.makedev(6, 0));
|
|
var random_device;
|
|
if (typeof crypto !== "undefined") {
|
|
var randomBuffer = new Uint8Array(1);
|
|
random_device = function () {
|
|
crypto.getRandomValues(randomBuffer);
|
|
return randomBuffer[0];
|
|
};
|
|
} else if (ENVIRONMENT_IS_NODE) {
|
|
random_device = function () {
|
|
return require("crypto")["randomBytes"](1)[0];
|
|
};
|
|
} else {
|
|
random_device = function () {
|
|
return (Math.random() * 256) | 0;
|
|
};
|
|
}
|
|
FS.createDevice("/dev", "random", random_device);
|
|
FS.createDevice("/dev", "urandom", random_device);
|
|
FS.mkdir("/dev/shm");
|
|
FS.mkdir("/dev/shm/tmp");
|
|
},
|
|
createSpecialDirectories: function () {
|
|
FS.mkdir("/proc");
|
|
FS.mkdir("/proc/self");
|
|
FS.mkdir("/proc/self/fd");
|
|
FS.mount(
|
|
{
|
|
mount: function () {
|
|
var node = FS.createNode("/proc/self", "fd", 16384 | 511, 73);
|
|
node.node_ops = {
|
|
lookup: function (parent, name) {
|
|
var fd = +name;
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var ret = {
|
|
parent: null,
|
|
mount: { mountpoint: "fake" },
|
|
node_ops: {
|
|
readlink: function () {
|
|
return stream.path;
|
|
},
|
|
},
|
|
};
|
|
ret.parent = ret;
|
|
return ret;
|
|
},
|
|
};
|
|
return node;
|
|
},
|
|
},
|
|
{},
|
|
"/proc/self/fd"
|
|
);
|
|
},
|
|
createStandardStreams: function () {
|
|
if (Module["stdin"]) {
|
|
FS.createDevice("/dev", "stdin", Module["stdin"]);
|
|
} else {
|
|
FS.symlink("/dev/tty", "/dev/stdin");
|
|
}
|
|
if (Module["stdout"]) {
|
|
FS.createDevice("/dev", "stdout", null, Module["stdout"]);
|
|
} else {
|
|
FS.symlink("/dev/tty", "/dev/stdout");
|
|
}
|
|
if (Module["stderr"]) {
|
|
FS.createDevice("/dev", "stderr", null, Module["stderr"]);
|
|
} else {
|
|
FS.symlink("/dev/tty1", "/dev/stderr");
|
|
}
|
|
var stdin = FS.open("/dev/stdin", "r");
|
|
assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")");
|
|
var stdout = FS.open("/dev/stdout", "w");
|
|
assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")");
|
|
var stderr = FS.open("/dev/stderr", "w");
|
|
assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")");
|
|
},
|
|
ensureErrnoError: function () {
|
|
if (FS.ErrnoError) return;
|
|
FS.ErrnoError = function ErrnoError(errno, node) {
|
|
this.node = node;
|
|
this.setErrno = function (errno) {
|
|
this.errno = errno;
|
|
for (var key in ERRNO_CODES) {
|
|
if (ERRNO_CODES[key] === errno) {
|
|
this.code = key;
|
|
break;
|
|
}
|
|
}
|
|
};
|
|
this.setErrno(errno);
|
|
this.message = ERRNO_MESSAGES[errno];
|
|
if (this.stack) Object.defineProperty(this, "stack", { value: new Error().stack, writable: true });
|
|
};
|
|
FS.ErrnoError.prototype = new Error();
|
|
FS.ErrnoError.prototype.constructor = FS.ErrnoError;
|
|
[ERRNO_CODES.ENOENT].forEach(function (code) {
|
|
FS.genericErrors[code] = new FS.ErrnoError(code);
|
|
FS.genericErrors[code].stack = "<generic error, no stack>";
|
|
});
|
|
},
|
|
staticInit: function () {
|
|
FS.ensureErrnoError();
|
|
FS.nameTable = new Array(4096);
|
|
FS.mount(MEMFS, {}, "/");
|
|
FS.createDefaultDirectories();
|
|
FS.createDefaultDevices();
|
|
FS.createSpecialDirectories();
|
|
FS.filesystems = { MEMFS: MEMFS, IDBFS: IDBFS, NODEFS: NODEFS, WORKERFS: WORKERFS };
|
|
},
|
|
init: function (input, output, error) {
|
|
assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");
|
|
FS.init.initialized = true;
|
|
FS.ensureErrnoError();
|
|
Module["stdin"] = input || Module["stdin"];
|
|
Module["stdout"] = output || Module["stdout"];
|
|
Module["stderr"] = error || Module["stderr"];
|
|
FS.createStandardStreams();
|
|
},
|
|
quit: function () {
|
|
FS.init.initialized = false;
|
|
var fflush = Module["_fflush"];
|
|
if (fflush) fflush(0);
|
|
for (var i = 0; i < FS.streams.length; i++) {
|
|
var stream = FS.streams[i];
|
|
if (!stream) {
|
|
continue;
|
|
}
|
|
FS.close(stream);
|
|
}
|
|
},
|
|
getMode: function (canRead, canWrite) {
|
|
var mode = 0;
|
|
if (canRead) mode |= 292 | 73;
|
|
if (canWrite) mode |= 146;
|
|
return mode;
|
|
},
|
|
joinPath: function (parts, forceRelative) {
|
|
var path = PATH.join.apply(null, parts);
|
|
if (forceRelative && path[0] == "/") path = path.substr(1);
|
|
return path;
|
|
},
|
|
absolutePath: function (relative, base) {
|
|
return PATH.resolve(base, relative);
|
|
},
|
|
standardizePath: function (path) {
|
|
return PATH.normalize(path);
|
|
},
|
|
findObject: function (path, dontResolveLastLink) {
|
|
var ret = FS.analyzePath(path, dontResolveLastLink);
|
|
if (ret.exists) {
|
|
return ret.object;
|
|
} else {
|
|
___setErrNo(ret.error);
|
|
return null;
|
|
}
|
|
},
|
|
analyzePath: function (path, dontResolveLastLink) {
|
|
try {
|
|
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
path = lookup.path;
|
|
} catch (e) {}
|
|
var ret = { isRoot: false, exists: false, error: 0, name: null, path: null, object: null, parentExists: false, parentPath: null, parentObject: null };
|
|
try {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
ret.parentExists = true;
|
|
ret.parentPath = lookup.path;
|
|
ret.parentObject = lookup.node;
|
|
ret.name = PATH.basename(path);
|
|
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
ret.exists = true;
|
|
ret.path = lookup.path;
|
|
ret.object = lookup.node;
|
|
ret.name = lookup.node.name;
|
|
ret.isRoot = lookup.path === "/";
|
|
} catch (e) {
|
|
ret.error = e.errno;
|
|
}
|
|
return ret;
|
|
},
|
|
createFolder: function (parent, name, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.mkdir(path, mode);
|
|
},
|
|
createPath: function (parent, path, canRead, canWrite) {
|
|
parent = typeof parent === "string" ? parent : FS.getPath(parent);
|
|
var parts = path.split("/").reverse();
|
|
while (parts.length) {
|
|
var part = parts.pop();
|
|
if (!part) continue;
|
|
var current = PATH.join2(parent, part);
|
|
try {
|
|
FS.mkdir(current);
|
|
} catch (e) {}
|
|
parent = current;
|
|
}
|
|
return current;
|
|
},
|
|
createFile: function (parent, name, properties, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.create(path, mode);
|
|
},
|
|
createDataFile: function (parent, name, data, canRead, canWrite, canOwn) {
|
|
var path = name ? PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name) : parent;
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
var node = FS.create(path, mode);
|
|
if (data) {
|
|
if (typeof data === "string") {
|
|
var arr = new Array(data.length);
|
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
|
|
data = arr;
|
|
}
|
|
FS.chmod(node, mode | 146);
|
|
var stream = FS.open(node, "w");
|
|
FS.write(stream, data, 0, data.length, 0, canOwn);
|
|
FS.close(stream);
|
|
FS.chmod(node, mode);
|
|
}
|
|
return node;
|
|
},
|
|
createDevice: function (parent, name, input, output) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(!!input, !!output);
|
|
if (!FS.createDevice.major) FS.createDevice.major = 64;
|
|
var dev = FS.makedev(FS.createDevice.major++, 0);
|
|
FS.registerDevice(dev, {
|
|
open: function (stream) {
|
|
stream.seekable = false;
|
|
},
|
|
close: function (stream) {
|
|
if (output && output.buffer && output.buffer.length) {
|
|
output(10);
|
|
}
|
|
},
|
|
read: function (stream, buffer, offset, length, pos) {
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = input();
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset + i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},
|
|
write: function (stream, buffer, offset, length, pos) {
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
output(buffer[offset + i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
},
|
|
});
|
|
return FS.mkdev(path, mode, dev);
|
|
},
|
|
createLink: function (parent, name, target, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
return FS.symlink(target, path);
|
|
},
|
|
forceLoadFile: function (obj) {
|
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
|
|
var success = true;
|
|
if (typeof XMLHttpRequest !== "undefined") {
|
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
|
|
} else if (Module["read"]) {
|
|
try {
|
|
obj.contents = intArrayFromString(Module["read"](obj.url), true);
|
|
obj.usedBytes = obj.contents.length;
|
|
} catch (e) {
|
|
success = false;
|
|
}
|
|
} else {
|
|
throw new Error("Cannot load without read() or XMLHttpRequest.");
|
|
}
|
|
if (!success) ___setErrNo(ERRNO_CODES.EIO);
|
|
return success;
|
|
},
|
|
createLazyFile: function (parent, name, url, canRead, canWrite) {
|
|
function LazyUint8Array() {
|
|
this.lengthKnown = false;
|
|
this.chunks = [];
|
|
}
|
|
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
|
|
if (idx > this.length - 1 || idx < 0) {
|
|
return undefined;
|
|
}
|
|
var chunkOffset = idx % this.chunkSize;
|
|
var chunkNum = (idx / this.chunkSize) | 0;
|
|
return this.getter(chunkNum)[chunkOffset];
|
|
};
|
|
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
|
|
this.getter = getter;
|
|
};
|
|
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open("HEAD", url, false);
|
|
xhr.send(null);
|
|
if (!((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
var datalength = Number(xhr.getResponseHeader("Content-length"));
|
|
var header;
|
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
|
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
|
|
var chunkSize = 1024 * 1024;
|
|
if (!hasByteServing) chunkSize = datalength;
|
|
var doXHR = function (from, to) {
|
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
|
|
if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!");
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open("GET", url, false);
|
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
|
|
if (typeof Uint8Array != "undefined") xhr.responseType = "arraybuffer";
|
|
if (xhr.overrideMimeType) {
|
|
xhr.overrideMimeType("text/plain; charset=x-user-defined");
|
|
}
|
|
xhr.send(null);
|
|
if (!((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
if (xhr.response !== undefined) {
|
|
return new Uint8Array(xhr.response || []);
|
|
} else {
|
|
return intArrayFromString(xhr.responseText || "", true);
|
|
}
|
|
};
|
|
var lazyArray = this;
|
|
lazyArray.setDataGetter(function (chunkNum) {
|
|
var start = chunkNum * chunkSize;
|
|
var end = (chunkNum + 1) * chunkSize - 1;
|
|
end = Math.min(end, datalength - 1);
|
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") {
|
|
lazyArray.chunks[chunkNum] = doXHR(start, end);
|
|
}
|
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") throw new Error("doXHR failed!");
|
|
return lazyArray.chunks[chunkNum];
|
|
});
|
|
if (usesGzip || !datalength) {
|
|
chunkSize = datalength = 1;
|
|
datalength = this.getter(0).length;
|
|
chunkSize = datalength;
|
|
console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
|
|
}
|
|
this._length = datalength;
|
|
this._chunkSize = chunkSize;
|
|
this.lengthKnown = true;
|
|
};
|
|
if (typeof XMLHttpRequest !== "undefined") {
|
|
if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
|
|
var lazyArray = new LazyUint8Array();
|
|
Object.defineProperties(lazyArray, {
|
|
length: {
|
|
get: function () {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._length;
|
|
},
|
|
},
|
|
chunkSize: {
|
|
get: function () {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._chunkSize;
|
|
},
|
|
},
|
|
});
|
|
var properties = { isDevice: false, contents: lazyArray };
|
|
} else {
|
|
var properties = { isDevice: false, url: url };
|
|
}
|
|
var node = FS.createFile(parent, name, properties, canRead, canWrite);
|
|
if (properties.contents) {
|
|
node.contents = properties.contents;
|
|
} else if (properties.url) {
|
|
node.contents = null;
|
|
node.url = properties.url;
|
|
}
|
|
Object.defineProperties(node, {
|
|
usedBytes: {
|
|
get: function () {
|
|
return this.contents.length;
|
|
},
|
|
},
|
|
});
|
|
var stream_ops = {};
|
|
var keys = Object.keys(node.stream_ops);
|
|
keys.forEach(function (key) {
|
|
var fn = node.stream_ops[key];
|
|
stream_ops[key] = function forceLoadLazyFile() {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
return fn.apply(null, arguments);
|
|
};
|
|
});
|
|
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
var contents = stream.node.contents;
|
|
if (position >= contents.length) return 0;
|
|
var size = Math.min(contents.length - position, length);
|
|
assert(size >= 0);
|
|
if (contents.slice) {
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents[position + i];
|
|
}
|
|
} else {
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents.get(position + i);
|
|
}
|
|
}
|
|
return size;
|
|
};
|
|
node.stream_ops = stream_ops;
|
|
return node;
|
|
},
|
|
createPreloadedFile: function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
|
|
Browser.init();
|
|
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
|
|
var dep = getUniqueRunDependency("cp " + fullname);
|
|
function processData(byteArray) {
|
|
function finish(byteArray) {
|
|
if (preFinish) preFinish();
|
|
if (!dontCreateFile) {
|
|
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
|
|
}
|
|
if (onload) onload();
|
|
removeRunDependency(dep);
|
|
}
|
|
var handled = false;
|
|
Module["preloadPlugins"].forEach(function (plugin) {
|
|
if (handled) return;
|
|
if (plugin["canHandle"](fullname)) {
|
|
plugin["handle"](byteArray, fullname, finish, function () {
|
|
if (onerror) onerror();
|
|
removeRunDependency(dep);
|
|
});
|
|
handled = true;
|
|
}
|
|
});
|
|
if (!handled) finish(byteArray);
|
|
}
|
|
addRunDependency(dep);
|
|
if (typeof url == "string") {
|
|
Browser.asyncLoad(
|
|
url,
|
|
function (byteArray) {
|
|
processData(byteArray);
|
|
},
|
|
onerror
|
|
);
|
|
} else {
|
|
processData(url);
|
|
}
|
|
},
|
|
indexedDB: function () {
|
|
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
},
|
|
DB_NAME: function () {
|
|
return "EM_FS_" + window.location.pathname;
|
|
},
|
|
DB_VERSION: 20,
|
|
DB_STORE_NAME: "FILE_DATA",
|
|
saveFilesToDB: function (paths, onload, onerror) {
|
|
onload = onload || function () {};
|
|
onerror = onerror || function () {};
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
|
|
} catch (e) {
|
|
return onerror(e);
|
|
}
|
|
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
|
|
console.log("creating db");
|
|
var db = openRequest.result;
|
|
db.createObjectStore(FS.DB_STORE_NAME);
|
|
};
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readwrite");
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0,
|
|
fail = 0,
|
|
total = paths.length;
|
|
function finish() {
|
|
if (fail == 0) onload();
|
|
else onerror();
|
|
}
|
|
paths.forEach(function (path) {
|
|
var putRequest = files.put(FS.analyzePath(path).object.contents, path);
|
|
putRequest.onsuccess = function putRequest_onsuccess() {
|
|
ok++;
|
|
if (ok + fail == total) finish();
|
|
};
|
|
putRequest.onerror = function putRequest_onerror() {
|
|
fail++;
|
|
if (ok + fail == total) finish();
|
|
};
|
|
});
|
|
transaction.onerror = onerror;
|
|
};
|
|
openRequest.onerror = onerror;
|
|
},
|
|
loadFilesFromDB: function (paths, onload, onerror) {
|
|
onload = onload || function () {};
|
|
onerror = onerror || function () {};
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
|
|
} catch (e) {
|
|
return onerror(e);
|
|
}
|
|
openRequest.onupgradeneeded = onerror;
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
try {
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readonly");
|
|
} catch (e) {
|
|
onerror(e);
|
|
return;
|
|
}
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0,
|
|
fail = 0,
|
|
total = paths.length;
|
|
function finish() {
|
|
if (fail == 0) onload();
|
|
else onerror();
|
|
}
|
|
paths.forEach(function (path) {
|
|
var getRequest = files.get(path);
|
|
getRequest.onsuccess = function getRequest_onsuccess() {
|
|
if (FS.analyzePath(path).exists) {
|
|
FS.unlink(path);
|
|
}
|
|
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
|
|
ok++;
|
|
if (ok + fail == total) finish();
|
|
};
|
|
getRequest.onerror = function getRequest_onerror() {
|
|
fail++;
|
|
if (ok + fail == total) finish();
|
|
};
|
|
});
|
|
transaction.onerror = onerror;
|
|
};
|
|
openRequest.onerror = onerror;
|
|
},
|
|
};
|
|
var SYSCALLS = {
|
|
DEFAULT_POLLMASK: 5,
|
|
mappings: {},
|
|
umask: 511,
|
|
calculateAt: function (dirfd, path) {
|
|
if (path[0] !== "/") {
|
|
var dir;
|
|
if (dirfd === -100) {
|
|
dir = FS.cwd();
|
|
} else {
|
|
var dirstream = FS.getStream(dirfd);
|
|
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
dir = dirstream.path;
|
|
}
|
|
path = PATH.join2(dir, path);
|
|
}
|
|
return path;
|
|
},
|
|
doStat: function (func, path, buf) {
|
|
try {
|
|
var stat = func(path);
|
|
} catch (e) {
|
|
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
|
|
return -ERRNO_CODES.ENOTDIR;
|
|
}
|
|
throw e;
|
|
}
|
|
HEAP32[buf >> 2] = stat.dev;
|
|
HEAP32[(buf + 4) >> 2] = 0;
|
|
HEAP32[(buf + 8) >> 2] = stat.ino;
|
|
HEAP32[(buf + 12) >> 2] = stat.mode;
|
|
HEAP32[(buf + 16) >> 2] = stat.nlink;
|
|
HEAP32[(buf + 20) >> 2] = stat.uid;
|
|
HEAP32[(buf + 24) >> 2] = stat.gid;
|
|
HEAP32[(buf + 28) >> 2] = stat.rdev;
|
|
HEAP32[(buf + 32) >> 2] = 0;
|
|
HEAP32[(buf + 36) >> 2] = stat.size;
|
|
HEAP32[(buf + 40) >> 2] = 4096;
|
|
HEAP32[(buf + 44) >> 2] = stat.blocks;
|
|
HEAP32[(buf + 48) >> 2] = (stat.atime.getTime() / 1e3) | 0;
|
|
HEAP32[(buf + 52) >> 2] = 0;
|
|
HEAP32[(buf + 56) >> 2] = (stat.mtime.getTime() / 1e3) | 0;
|
|
HEAP32[(buf + 60) >> 2] = 0;
|
|
HEAP32[(buf + 64) >> 2] = (stat.ctime.getTime() / 1e3) | 0;
|
|
HEAP32[(buf + 68) >> 2] = 0;
|
|
HEAP32[(buf + 72) >> 2] = stat.ino;
|
|
return 0;
|
|
},
|
|
doMsync: function (addr, stream, len, flags) {
|
|
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
|
|
FS.msync(stream, buffer, 0, len, flags);
|
|
},
|
|
doMkdir: function (path, mode) {
|
|
path = PATH.normalize(path);
|
|
if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1);
|
|
FS.mkdir(path, mode, 0);
|
|
return 0;
|
|
},
|
|
doMknod: function (path, mode, dev) {
|
|
switch (mode & 61440) {
|
|
case 32768:
|
|
case 8192:
|
|
case 24576:
|
|
case 4096:
|
|
case 49152:
|
|
break;
|
|
default:
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
FS.mknod(path, mode, dev);
|
|
return 0;
|
|
},
|
|
doReadlink: function (path, buf, bufsize) {
|
|
if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
|
|
var ret = FS.readlink(path);
|
|
var len = Math.min(bufsize, lengthBytesUTF8(ret));
|
|
var endChar = HEAP8[buf + len];
|
|
stringToUTF8(ret, buf, bufsize + 1);
|
|
HEAP8[buf + len] = endChar;
|
|
return len;
|
|
},
|
|
doAccess: function (path, amode) {
|
|
if (amode & ~7) {
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
var node;
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
var perms = "";
|
|
if (amode & 4) perms += "r";
|
|
if (amode & 2) perms += "w";
|
|
if (amode & 1) perms += "x";
|
|
if (perms && FS.nodePermissions(node, perms)) {
|
|
return -ERRNO_CODES.EACCES;
|
|
}
|
|
return 0;
|
|
},
|
|
doDup: function (path, flags, suggestFD) {
|
|
var suggest = FS.getStream(suggestFD);
|
|
if (suggest) FS.close(suggest);
|
|
return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
|
|
},
|
|
doReadv: function (stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[(iov + i * 8) >> 2];
|
|
var len = HEAP32[(iov + (i * 8 + 4)) >> 2];
|
|
var curr = FS.read(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (curr < len) break;
|
|
}
|
|
return ret;
|
|
},
|
|
doWritev: function (stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[(iov + i * 8) >> 2];
|
|
var len = HEAP32[(iov + (i * 8 + 4)) >> 2];
|
|
var curr = FS.write(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
}
|
|
return ret;
|
|
},
|
|
varargs: 0,
|
|
get: function (varargs) {
|
|
SYSCALLS.varargs += 4;
|
|
var ret = HEAP32[(SYSCALLS.varargs - 4) >> 2];
|
|
return ret;
|
|
},
|
|
getStr: function () {
|
|
var ret = Pointer_stringify(SYSCALLS.get());
|
|
return ret;
|
|
},
|
|
getStreamFromFD: function () {
|
|
var stream = FS.getStream(SYSCALLS.get());
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return stream;
|
|
},
|
|
getSocketFromFD: function () {
|
|
var socket = SOCKFS.getSocket(SYSCALLS.get());
|
|
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return socket;
|
|
},
|
|
getSocketAddress: function (allowNull) {
|
|
var addrp = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
if (allowNull && addrp === 0) return null;
|
|
var info = __read_sockaddr(addrp, addrlen);
|
|
if (info.errno) throw new FS.ErrnoError(info.errno);
|
|
info.addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
return info;
|
|
},
|
|
get64: function () {
|
|
var low = SYSCALLS.get(),
|
|
high = SYSCALLS.get();
|
|
if (low >= 0) assert(high === 0);
|
|
else assert(high === -1);
|
|
return low;
|
|
},
|
|
getZero: function () {
|
|
assert(SYSCALLS.get() === 0);
|
|
},
|
|
};
|
|
function ___syscall10(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr();
|
|
FS.unlink(path);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
var SOCKFS = {
|
|
mount: function (mount) {
|
|
Module["websocket"] = Module["websocket"] && "object" === typeof Module["websocket"] ? Module["websocket"] : {};
|
|
Module["websocket"]._callbacks = {};
|
|
Module["websocket"]["on"] = function (event, callback) {
|
|
if ("function" === typeof callback) {
|
|
this._callbacks[event] = callback;
|
|
}
|
|
return this;
|
|
};
|
|
Module["websocket"].emit = function (event, param) {
|
|
if ("function" === typeof this._callbacks[event]) {
|
|
this._callbacks[event].call(this, param);
|
|
}
|
|
};
|
|
return FS.createNode(null, "/", 16384 | 511, 0);
|
|
},
|
|
createSocket: function (family, type, protocol) {
|
|
var streaming = type == 1;
|
|
if (protocol) {
|
|
assert(streaming == (protocol == 6));
|
|
}
|
|
var sock = { family: family, type: type, protocol: protocol, server: null, error: null, peers: {}, pending: [], recv_queue: [], sock_ops: SOCKFS.websocket_sock_ops };
|
|
var name = SOCKFS.nextname();
|
|
var node = FS.createNode(SOCKFS.root, name, 49152, 0);
|
|
node.sock = sock;
|
|
var stream = FS.createStream({ path: name, node: node, flags: FS.modeStringToFlags("r+"), seekable: false, stream_ops: SOCKFS.stream_ops });
|
|
sock.stream = stream;
|
|
return sock;
|
|
},
|
|
getSocket: function (fd) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream || !FS.isSocket(stream.node.mode)) {
|
|
return null;
|
|
}
|
|
return stream.node.sock;
|
|
},
|
|
stream_ops: {
|
|
poll: function (stream) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.poll(sock);
|
|
},
|
|
ioctl: function (stream, request, varargs) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.ioctl(sock, request, varargs);
|
|
},
|
|
read: function (stream, buffer, offset, length, position) {
|
|
var sock = stream.node.sock;
|
|
var msg = sock.sock_ops.recvmsg(sock, length);
|
|
if (!msg) {
|
|
return 0;
|
|
}
|
|
buffer.set(msg.buffer, offset);
|
|
return msg.buffer.length;
|
|
},
|
|
write: function (stream, buffer, offset, length, position) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.sendmsg(sock, buffer, offset, length);
|
|
},
|
|
close: function (stream) {
|
|
var sock = stream.node.sock;
|
|
sock.sock_ops.close(sock);
|
|
},
|
|
},
|
|
nextname: function () {
|
|
if (!SOCKFS.nextname.current) {
|
|
SOCKFS.nextname.current = 0;
|
|
}
|
|
return "socket[" + SOCKFS.nextname.current++ + "]";
|
|
},
|
|
websocket_sock_ops: {
|
|
createPeer: function (sock, addr, port) {
|
|
var ws;
|
|
if (typeof addr === "object") {
|
|
ws = addr;
|
|
addr = null;
|
|
port = null;
|
|
}
|
|
if (ws) {
|
|
if (ws._socket) {
|
|
addr = ws._socket.remoteAddress;
|
|
port = ws._socket.remotePort;
|
|
} else {
|
|
var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
|
|
if (!result) {
|
|
throw new Error("WebSocket URL must be in the format ws(s)://address:port");
|
|
}
|
|
addr = result[1];
|
|
port = parseInt(result[2], 10);
|
|
}
|
|
} else {
|
|
try {
|
|
var runtimeConfig = Module["websocket"] && "object" === typeof Module["websocket"];
|
|
var url = "ws:#".replace("#", "//");
|
|
if (runtimeConfig) {
|
|
if ("string" === typeof Module["websocket"]["url"]) {
|
|
url = Module["websocket"]["url"];
|
|
}
|
|
}
|
|
if (url === "ws://" || url === "wss://") {
|
|
var parts = addr.split("/");
|
|
url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/");
|
|
}
|
|
var subProtocols = "binary";
|
|
if (runtimeConfig) {
|
|
if ("string" === typeof Module["websocket"]["subprotocol"]) {
|
|
subProtocols = Module["websocket"]["subprotocol"];
|
|
}
|
|
}
|
|
subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */);
|
|
var opts = ENVIRONMENT_IS_NODE ? { protocol: subProtocols.toString() } : subProtocols;
|
|
if (runtimeConfig && null === Module["websocket"]["subprotocol"]) {
|
|
subProtocols = "null";
|
|
opts = undefined;
|
|
}
|
|
var WebSocketConstructor;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
WebSocketConstructor = require("ws");
|
|
} else if (ENVIRONMENT_IS_WEB) {
|
|
WebSocketConstructor = window["WebSocket"];
|
|
} else {
|
|
WebSocketConstructor = WebSocket;
|
|
}
|
|
ws = new WebSocketConstructor(url, opts);
|
|
ws.binaryType = "arraybuffer";
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EHOSTUNREACH);
|
|
}
|
|
}
|
|
var peer = { addr: addr, port: port, socket: ws, dgram_send_queue: [] };
|
|
SOCKFS.websocket_sock_ops.addPeer(sock, peer);
|
|
SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
|
|
if (sock.type === 2 && typeof sock.sport !== "undefined") {
|
|
peer.dgram_send_queue.push(new Uint8Array([255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), (sock.sport & 65280) >> 8, sock.sport & 255]));
|
|
}
|
|
return peer;
|
|
},
|
|
getPeer: function (sock, addr, port) {
|
|
return sock.peers[addr + ":" + port];
|
|
},
|
|
addPeer: function (sock, peer) {
|
|
sock.peers[peer.addr + ":" + peer.port] = peer;
|
|
},
|
|
removePeer: function (sock, peer) {
|
|
delete sock.peers[peer.addr + ":" + peer.port];
|
|
},
|
|
handlePeerEvents: function (sock, peer) {
|
|
var first = true;
|
|
var handleOpen = function () {
|
|
Module["websocket"].emit("open", sock.stream.fd);
|
|
try {
|
|
var queued = peer.dgram_send_queue.shift();
|
|
while (queued) {
|
|
peer.socket.send(queued);
|
|
queued = peer.dgram_send_queue.shift();
|
|
}
|
|
} catch (e) {
|
|
peer.socket.close();
|
|
}
|
|
};
|
|
function handleMessage(data) {
|
|
assert(typeof data !== "string" && data.byteLength !== undefined);
|
|
if (data.byteLength == 0) {
|
|
return;
|
|
}
|
|
data = new Uint8Array(data);
|
|
var wasfirst = first;
|
|
first = false;
|
|
if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) {
|
|
var newport = (data[8] << 8) | data[9];
|
|
SOCKFS.websocket_sock_ops.removePeer(sock, peer);
|
|
peer.port = newport;
|
|
SOCKFS.websocket_sock_ops.addPeer(sock, peer);
|
|
return;
|
|
}
|
|
sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
|
|
Module["websocket"].emit("message", sock.stream.fd);
|
|
}
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
peer.socket.on("open", handleOpen);
|
|
peer.socket.on("message", function (data, flags) {
|
|
if (!flags.binary) {
|
|
return;
|
|
}
|
|
handleMessage(new Uint8Array(data).buffer);
|
|
});
|
|
peer.socket.on("close", function () {
|
|
Module["websocket"].emit("close", sock.stream.fd);
|
|
});
|
|
peer.socket.on("error", function (error) {
|
|
sock.error = ERRNO_CODES.ECONNREFUSED;
|
|
Module["websocket"].emit("error", [sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused"]);
|
|
});
|
|
} else {
|
|
peer.socket.onopen = handleOpen;
|
|
peer.socket.onclose = function () {
|
|
Module["websocket"].emit("close", sock.stream.fd);
|
|
};
|
|
peer.socket.onmessage = function peer_socket_onmessage(event) {
|
|
handleMessage(event.data);
|
|
};
|
|
peer.socket.onerror = function (error) {
|
|
sock.error = ERRNO_CODES.ECONNREFUSED;
|
|
Module["websocket"].emit("error", [sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused"]);
|
|
};
|
|
}
|
|
},
|
|
poll: function (sock) {
|
|
if (sock.type === 1 && sock.server) {
|
|
return sock.pending.length ? 64 | 1 : 0;
|
|
}
|
|
var mask = 0;
|
|
var dest = sock.type === 1 ? SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null;
|
|
if (sock.recv_queue.length || !dest || (dest && dest.socket.readyState === dest.socket.CLOSING) || (dest && dest.socket.readyState === dest.socket.CLOSED)) {
|
|
mask |= 64 | 1;
|
|
}
|
|
if (!dest || (dest && dest.socket.readyState === dest.socket.OPEN)) {
|
|
mask |= 4;
|
|
}
|
|
if ((dest && dest.socket.readyState === dest.socket.CLOSING) || (dest && dest.socket.readyState === dest.socket.CLOSED)) {
|
|
mask |= 16;
|
|
}
|
|
return mask;
|
|
},
|
|
ioctl: function (sock, request, arg) {
|
|
switch (request) {
|
|
case 21531:
|
|
var bytes = 0;
|
|
if (sock.recv_queue.length) {
|
|
bytes = sock.recv_queue[0].data.length;
|
|
}
|
|
HEAP32[arg >> 2] = bytes;
|
|
return 0;
|
|
default:
|
|
return ERRNO_CODES.EINVAL;
|
|
}
|
|
},
|
|
close: function (sock) {
|
|
if (sock.server) {
|
|
try {
|
|
sock.server.close();
|
|
} catch (e) {}
|
|
sock.server = null;
|
|
}
|
|
var peers = Object.keys(sock.peers);
|
|
for (var i = 0; i < peers.length; i++) {
|
|
var peer = sock.peers[peers[i]];
|
|
try {
|
|
peer.socket.close();
|
|
} catch (e) {}
|
|
SOCKFS.websocket_sock_ops.removePeer(sock, peer);
|
|
}
|
|
return 0;
|
|
},
|
|
bind: function (sock, addr, port) {
|
|
if (typeof sock.saddr !== "undefined" || typeof sock.sport !== "undefined") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
sock.saddr = addr;
|
|
sock.sport = port;
|
|
if (sock.type === 2) {
|
|
if (sock.server) {
|
|
sock.server.close();
|
|
sock.server = null;
|
|
}
|
|
try {
|
|
sock.sock_ops.listen(sock, 0);
|
|
} catch (e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e;
|
|
if (e.errno !== ERRNO_CODES.EOPNOTSUPP) throw e;
|
|
}
|
|
}
|
|
},
|
|
connect: function (sock, addr, port) {
|
|
if (sock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
|
|
}
|
|
if (typeof sock.daddr !== "undefined" && typeof sock.dport !== "undefined") {
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
|
|
if (dest) {
|
|
if (dest.socket.readyState === dest.socket.CONNECTING) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EALREADY);
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISCONN);
|
|
}
|
|
}
|
|
}
|
|
var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
|
|
sock.daddr = peer.addr;
|
|
sock.dport = peer.port;
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINPROGRESS);
|
|
},
|
|
listen: function (sock, backlog) {
|
|
if (!ENVIRONMENT_IS_NODE) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
|
|
}
|
|
if (sock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var WebSocketServer = require("ws").Server;
|
|
var host = sock.saddr;
|
|
sock.server = new WebSocketServer({ host: host, port: sock.sport });
|
|
Module["websocket"].emit("listen", sock.stream.fd);
|
|
sock.server.on("connection", function (ws) {
|
|
if (sock.type === 1) {
|
|
var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
|
|
var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
|
|
newsock.daddr = peer.addr;
|
|
newsock.dport = peer.port;
|
|
sock.pending.push(newsock);
|
|
Module["websocket"].emit("connection", newsock.stream.fd);
|
|
} else {
|
|
SOCKFS.websocket_sock_ops.createPeer(sock, ws);
|
|
Module["websocket"].emit("connection", sock.stream.fd);
|
|
}
|
|
});
|
|
sock.server.on("closed", function () {
|
|
Module["websocket"].emit("close", sock.stream.fd);
|
|
sock.server = null;
|
|
});
|
|
sock.server.on("error", function (error) {
|
|
sock.error = ERRNO_CODES.EHOSTUNREACH;
|
|
Module["websocket"].emit("error", [sock.stream.fd, sock.error, "EHOSTUNREACH: Host is unreachable"]);
|
|
});
|
|
},
|
|
accept: function (listensock) {
|
|
if (!listensock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var newsock = listensock.pending.shift();
|
|
newsock.stream.flags = listensock.stream.flags;
|
|
return newsock;
|
|
},
|
|
getname: function (sock, peer) {
|
|
var addr, port;
|
|
if (peer) {
|
|
if (sock.daddr === undefined || sock.dport === undefined) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
|
|
}
|
|
addr = sock.daddr;
|
|
port = sock.dport;
|
|
} else {
|
|
addr = sock.saddr || 0;
|
|
port = sock.sport || 0;
|
|
}
|
|
return { addr: addr, port: port };
|
|
},
|
|
sendmsg: function (sock, buffer, offset, length, addr, port) {
|
|
if (sock.type === 2) {
|
|
if (addr === undefined || port === undefined) {
|
|
addr = sock.daddr;
|
|
port = sock.dport;
|
|
}
|
|
if (addr === undefined || port === undefined) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EDESTADDRREQ);
|
|
}
|
|
} else {
|
|
addr = sock.daddr;
|
|
port = sock.dport;
|
|
}
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
|
|
if (sock.type === 1) {
|
|
if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
|
|
} else if (dest.socket.readyState === dest.socket.CONNECTING) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
}
|
|
if (ArrayBuffer.isView(buffer)) {
|
|
offset += buffer.byteOffset;
|
|
buffer = buffer.buffer;
|
|
}
|
|
var data;
|
|
data = buffer.slice(offset, offset + length);
|
|
if (sock.type === 2) {
|
|
if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
|
|
if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
|
|
}
|
|
dest.dgram_send_queue.push(data);
|
|
return length;
|
|
}
|
|
}
|
|
try {
|
|
dest.socket.send(data);
|
|
return length;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
},
|
|
recvmsg: function (sock, length) {
|
|
if (sock.type === 1 && sock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
|
|
}
|
|
var queued = sock.recv_queue.shift();
|
|
if (!queued) {
|
|
if (sock.type === 1) {
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
|
|
if (!dest) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
|
|
} else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
return null;
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
}
|
|
var queuedLength = queued.data.byteLength || queued.data.length;
|
|
var queuedOffset = queued.data.byteOffset || 0;
|
|
var queuedBuffer = queued.data.buffer || queued.data;
|
|
var bytesRead = Math.min(length, queuedLength);
|
|
var res = { buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), addr: queued.addr, port: queued.port };
|
|
if (sock.type === 1 && bytesRead < queuedLength) {
|
|
var bytesRemaining = queuedLength - bytesRead;
|
|
queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
|
|
sock.recv_queue.unshift(queued);
|
|
}
|
|
return res;
|
|
},
|
|
},
|
|
};
|
|
function __inet_pton4_raw(str) {
|
|
var b = str.split(".");
|
|
for (var i = 0; i < 4; i++) {
|
|
var tmp = Number(b[i]);
|
|
if (isNaN(tmp)) return null;
|
|
b[i] = tmp;
|
|
}
|
|
return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
|
|
}
|
|
function __inet_pton6_raw(str) {
|
|
var words;
|
|
var w, offset, z;
|
|
var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;
|
|
var parts = [];
|
|
if (!valid6regx.test(str)) {
|
|
return null;
|
|
}
|
|
if (str === "::") {
|
|
return [0, 0, 0, 0, 0, 0, 0, 0];
|
|
}
|
|
if (str.indexOf("::") === 0) {
|
|
str = str.replace("::", "Z:");
|
|
} else {
|
|
str = str.replace("::", ":Z:");
|
|
}
|
|
if (str.indexOf(".") > 0) {
|
|
str = str.replace(new RegExp("[.]", "g"), ":");
|
|
words = str.split(":");
|
|
words[words.length - 4] = parseInt(words[words.length - 4]) + parseInt(words[words.length - 3]) * 256;
|
|
words[words.length - 3] = parseInt(words[words.length - 2]) + parseInt(words[words.length - 1]) * 256;
|
|
words = words.slice(0, words.length - 2);
|
|
} else {
|
|
words = str.split(":");
|
|
}
|
|
offset = 0;
|
|
z = 0;
|
|
for (w = 0; w < words.length; w++) {
|
|
if (typeof words[w] === "string") {
|
|
if (words[w] === "Z") {
|
|
for (z = 0; z < 8 - words.length + 1; z++) {
|
|
parts[w + z] = 0;
|
|
}
|
|
offset = z - 1;
|
|
} else {
|
|
parts[w + offset] = _htons(parseInt(words[w], 16));
|
|
}
|
|
} else {
|
|
parts[w + offset] = words[w];
|
|
}
|
|
}
|
|
return [(parts[1] << 16) | parts[0], (parts[3] << 16) | parts[2], (parts[5] << 16) | parts[4], (parts[7] << 16) | parts[6]];
|
|
}
|
|
var DNS = {
|
|
address_map: { id: 1, addrs: {}, names: {} },
|
|
lookup_name: function (name) {
|
|
var res = __inet_pton4_raw(name);
|
|
if (res !== null) {
|
|
return name;
|
|
}
|
|
res = __inet_pton6_raw(name);
|
|
if (res !== null) {
|
|
return name;
|
|
}
|
|
var addr;
|
|
if (DNS.address_map.addrs[name]) {
|
|
addr = DNS.address_map.addrs[name];
|
|
} else {
|
|
var id = DNS.address_map.id++;
|
|
assert(id < 65535, "exceeded max address mappings of 65535");
|
|
addr = "172.29." + (id & 255) + "." + (id & 65280);
|
|
DNS.address_map.names[addr] = name;
|
|
DNS.address_map.addrs[name] = addr;
|
|
}
|
|
return addr;
|
|
},
|
|
lookup_addr: function (addr) {
|
|
if (DNS.address_map.names[addr]) {
|
|
return DNS.address_map.names[addr];
|
|
}
|
|
return null;
|
|
},
|
|
};
|
|
function __inet_ntop4_raw(addr) {
|
|
return (addr & 255) + "." + ((addr >> 8) & 255) + "." + ((addr >> 16) & 255) + "." + ((addr >> 24) & 255);
|
|
}
|
|
function __inet_ntop6_raw(ints) {
|
|
var str = "";
|
|
var word = 0;
|
|
var longest = 0;
|
|
var lastzero = 0;
|
|
var zstart = 0;
|
|
var len = 0;
|
|
var i = 0;
|
|
var parts = [ints[0] & 65535, ints[0] >> 16, ints[1] & 65535, ints[1] >> 16, ints[2] & 65535, ints[2] >> 16, ints[3] & 65535, ints[3] >> 16];
|
|
var hasipv4 = true;
|
|
var v4part = "";
|
|
for (i = 0; i < 5; i++) {
|
|
if (parts[i] !== 0) {
|
|
hasipv4 = false;
|
|
break;
|
|
}
|
|
}
|
|
if (hasipv4) {
|
|
v4part = __inet_ntop4_raw(parts[6] | (parts[7] << 16));
|
|
if (parts[5] === -1) {
|
|
str = "::ffff:";
|
|
str += v4part;
|
|
return str;
|
|
}
|
|
if (parts[5] === 0) {
|
|
str = "::";
|
|
if (v4part === "0.0.0.0") v4part = "";
|
|
if (v4part === "0.0.0.1") v4part = "1";
|
|
str += v4part;
|
|
return str;
|
|
}
|
|
}
|
|
for (word = 0; word < 8; word++) {
|
|
if (parts[word] === 0) {
|
|
if (word - lastzero > 1) {
|
|
len = 0;
|
|
}
|
|
lastzero = word;
|
|
len++;
|
|
}
|
|
if (len > longest) {
|
|
longest = len;
|
|
zstart = word - longest + 1;
|
|
}
|
|
}
|
|
for (word = 0; word < 8; word++) {
|
|
if (longest > 1) {
|
|
if (parts[word] === 0 && word >= zstart && word < zstart + longest) {
|
|
if (word === zstart) {
|
|
str += ":";
|
|
if (zstart === 0) str += ":";
|
|
}
|
|
continue;
|
|
}
|
|
}
|
|
str += Number(_ntohs(parts[word] & 65535)).toString(16);
|
|
str += word < 7 ? ":" : "";
|
|
}
|
|
return str;
|
|
}
|
|
function __read_sockaddr(sa, salen) {
|
|
var family = HEAP16[sa >> 1];
|
|
var port = _ntohs(HEAP16[(sa + 2) >> 1]);
|
|
var addr;
|
|
switch (family) {
|
|
case 2:
|
|
if (salen !== 16) {
|
|
return { errno: ERRNO_CODES.EINVAL };
|
|
}
|
|
addr = HEAP32[(sa + 4) >> 2];
|
|
addr = __inet_ntop4_raw(addr);
|
|
break;
|
|
case 10:
|
|
if (salen !== 28) {
|
|
return { errno: ERRNO_CODES.EINVAL };
|
|
}
|
|
addr = [HEAP32[(sa + 8) >> 2], HEAP32[(sa + 12) >> 2], HEAP32[(sa + 16) >> 2], HEAP32[(sa + 20) >> 2]];
|
|
addr = __inet_ntop6_raw(addr);
|
|
break;
|
|
default:
|
|
return { errno: ERRNO_CODES.EAFNOSUPPORT };
|
|
}
|
|
return { family: family, addr: addr, port: port };
|
|
}
|
|
function __write_sockaddr(sa, family, addr, port) {
|
|
switch (family) {
|
|
case 2:
|
|
addr = __inet_pton4_raw(addr);
|
|
HEAP16[sa >> 1] = family;
|
|
HEAP32[(sa + 4) >> 2] = addr;
|
|
HEAP16[(sa + 2) >> 1] = _htons(port);
|
|
break;
|
|
case 10:
|
|
addr = __inet_pton6_raw(addr);
|
|
HEAP32[sa >> 2] = family;
|
|
HEAP32[(sa + 8) >> 2] = addr[0];
|
|
HEAP32[(sa + 12) >> 2] = addr[1];
|
|
HEAP32[(sa + 16) >> 2] = addr[2];
|
|
HEAP32[(sa + 20) >> 2] = addr[3];
|
|
HEAP16[(sa + 2) >> 1] = _htons(port);
|
|
HEAP32[(sa + 4) >> 2] = 0;
|
|
HEAP32[(sa + 24) >> 2] = 0;
|
|
break;
|
|
default:
|
|
return { errno: ERRNO_CODES.EAFNOSUPPORT };
|
|
}
|
|
return {};
|
|
}
|
|
function ___syscall102(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var call = SYSCALLS.get(),
|
|
socketvararg = SYSCALLS.get();
|
|
SYSCALLS.varargs = socketvararg;
|
|
switch (call) {
|
|
case 1: {
|
|
var domain = SYSCALLS.get(),
|
|
type = SYSCALLS.get(),
|
|
protocol = SYSCALLS.get();
|
|
var sock = SOCKFS.createSocket(domain, type, protocol);
|
|
assert(sock.stream.fd < 64);
|
|
return sock.stream.fd;
|
|
}
|
|
case 2: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
info = SYSCALLS.getSocketAddress();
|
|
sock.sock_ops.bind(sock, info.addr, info.port);
|
|
return 0;
|
|
}
|
|
case 3: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
info = SYSCALLS.getSocketAddress();
|
|
sock.sock_ops.connect(sock, info.addr, info.port);
|
|
return 0;
|
|
}
|
|
case 4: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
backlog = SYSCALLS.get();
|
|
sock.sock_ops.listen(sock, backlog);
|
|
return 0;
|
|
}
|
|
case 5: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
var newsock = sock.sock_ops.accept(sock);
|
|
if (addr) {
|
|
var res = __write_sockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport);
|
|
assert(!res.errno);
|
|
}
|
|
return newsock.stream.fd;
|
|
}
|
|
case 6: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || "0.0.0.0"), sock.sport);
|
|
assert(!res.errno);
|
|
return 0;
|
|
}
|
|
case 7: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
if (!sock.daddr) {
|
|
return -ERRNO_CODES.ENOTCONN;
|
|
}
|
|
var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport);
|
|
assert(!res.errno);
|
|
return 0;
|
|
}
|
|
case 11: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
message = SYSCALLS.get(),
|
|
length = SYSCALLS.get(),
|
|
flags = SYSCALLS.get(),
|
|
dest = SYSCALLS.getSocketAddress(true);
|
|
if (!dest) {
|
|
return FS.write(sock.stream, HEAP8, message, length);
|
|
} else {
|
|
return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port);
|
|
}
|
|
}
|
|
case 12: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
len = SYSCALLS.get(),
|
|
flags = SYSCALLS.get(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
var msg = sock.sock_ops.recvmsg(sock, len);
|
|
if (!msg) return 0;
|
|
if (addr) {
|
|
var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port);
|
|
assert(!res.errno);
|
|
}
|
|
HEAPU8.set(msg.buffer, buf);
|
|
return msg.buffer.byteLength;
|
|
}
|
|
case 14: {
|
|
return -ERRNO_CODES.ENOPROTOOPT;
|
|
}
|
|
case 15: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
level = SYSCALLS.get(),
|
|
optname = SYSCALLS.get(),
|
|
optval = SYSCALLS.get(),
|
|
optlen = SYSCALLS.get();
|
|
if (level === 1) {
|
|
if (optname === 4) {
|
|
HEAP32[optval >> 2] = sock.error;
|
|
HEAP32[optlen >> 2] = 4;
|
|
sock.error = null;
|
|
return 0;
|
|
}
|
|
}
|
|
return -ERRNO_CODES.ENOPROTOOPT;
|
|
}
|
|
case 16: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
message = SYSCALLS.get(),
|
|
flags = SYSCALLS.get();
|
|
var iov = HEAP32[(message + 8) >> 2];
|
|
var num = HEAP32[(message + 12) >> 2];
|
|
var addr, port;
|
|
var name = HEAP32[message >> 2];
|
|
var namelen = HEAP32[(message + 4) >> 2];
|
|
if (name) {
|
|
var info = __read_sockaddr(name, namelen);
|
|
if (info.errno) return -info.errno;
|
|
port = info.port;
|
|
addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
}
|
|
var total = 0;
|
|
for (var i = 0; i < num; i++) {
|
|
total += HEAP32[(iov + (8 * i + 4)) >> 2];
|
|
}
|
|
var view = new Uint8Array(total);
|
|
var offset = 0;
|
|
for (var i = 0; i < num; i++) {
|
|
var iovbase = HEAP32[(iov + (8 * i + 0)) >> 2];
|
|
var iovlen = HEAP32[(iov + (8 * i + 4)) >> 2];
|
|
for (var j = 0; j < iovlen; j++) {
|
|
view[offset++] = HEAP8[(iovbase + j) >> 0];
|
|
}
|
|
}
|
|
return sock.sock_ops.sendmsg(sock, view, 0, total, addr, port);
|
|
}
|
|
case 17: {
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
message = SYSCALLS.get(),
|
|
flags = SYSCALLS.get();
|
|
var iov = HEAP32[(message + 8) >> 2];
|
|
var num = HEAP32[(message + 12) >> 2];
|
|
var total = 0;
|
|
for (var i = 0; i < num; i++) {
|
|
total += HEAP32[(iov + (8 * i + 4)) >> 2];
|
|
}
|
|
var msg = sock.sock_ops.recvmsg(sock, total);
|
|
if (!msg) return 0;
|
|
var name = HEAP32[message >> 2];
|
|
if (name) {
|
|
var res = __write_sockaddr(name, sock.family, DNS.lookup_name(msg.addr), msg.port);
|
|
assert(!res.errno);
|
|
}
|
|
var bytesRead = 0;
|
|
var bytesRemaining = msg.buffer.byteLength;
|
|
for (var i = 0; bytesRemaining > 0 && i < num; i++) {
|
|
var iovbase = HEAP32[(iov + (8 * i + 0)) >> 2];
|
|
var iovlen = HEAP32[(iov + (8 * i + 4)) >> 2];
|
|
if (!iovlen) {
|
|
continue;
|
|
}
|
|
var length = Math.min(iovlen, bytesRemaining);
|
|
var buf = msg.buffer.subarray(bytesRead, bytesRead + length);
|
|
HEAPU8.set(buf, iovbase + bytesRead);
|
|
bytesRead += length;
|
|
bytesRemaining -= length;
|
|
}
|
|
return bytesRead;
|
|
}
|
|
default:
|
|
abort("unsupported socketcall syscall " + call);
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall122(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var buf = SYSCALLS.get();
|
|
if (!buf) return -ERRNO_CODES.EFAULT;
|
|
var layout = { sysname: 0, nodename: 65, domainname: 325, machine: 260, version: 195, release: 130, __size__: 390 };
|
|
function copyString(element, value) {
|
|
var offset = layout[element];
|
|
writeAsciiToMemory(value, buf + offset);
|
|
}
|
|
copyString("sysname", "Emscripten");
|
|
copyString("nodename", "emscripten");
|
|
copyString("release", "1.0");
|
|
copyString("version", "#1");
|
|
copyString("machine", "x86-JS");
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall140(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
offset_high = SYSCALLS.get(),
|
|
offset_low = SYSCALLS.get(),
|
|
result = SYSCALLS.get(),
|
|
whence = SYSCALLS.get();
|
|
var offset = offset_low;
|
|
FS.llseek(stream, offset, whence);
|
|
HEAP32[result >> 2] = stream.position;
|
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall142(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var nfds = SYSCALLS.get(),
|
|
readfds = SYSCALLS.get(),
|
|
writefds = SYSCALLS.get(),
|
|
exceptfds = SYSCALLS.get(),
|
|
timeout = SYSCALLS.get();
|
|
assert(nfds <= 64, "nfds must be less than or equal to 64");
|
|
assert(!exceptfds, "exceptfds not supported");
|
|
var total = 0;
|
|
var srcReadLow = readfds ? HEAP32[readfds >> 2] : 0,
|
|
srcReadHigh = readfds ? HEAP32[(readfds + 4) >> 2] : 0;
|
|
var srcWriteLow = writefds ? HEAP32[writefds >> 2] : 0,
|
|
srcWriteHigh = writefds ? HEAP32[(writefds + 4) >> 2] : 0;
|
|
var srcExceptLow = exceptfds ? HEAP32[exceptfds >> 2] : 0,
|
|
srcExceptHigh = exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0;
|
|
var dstReadLow = 0,
|
|
dstReadHigh = 0;
|
|
var dstWriteLow = 0,
|
|
dstWriteHigh = 0;
|
|
var dstExceptLow = 0,
|
|
dstExceptHigh = 0;
|
|
var allLow = (readfds ? HEAP32[readfds >> 2] : 0) | (writefds ? HEAP32[writefds >> 2] : 0) | (exceptfds ? HEAP32[exceptfds >> 2] : 0);
|
|
var allHigh = (readfds ? HEAP32[(readfds + 4) >> 2] : 0) | (writefds ? HEAP32[(writefds + 4) >> 2] : 0) | (exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0);
|
|
function check(fd, low, high, val) {
|
|
return fd < 32 ? low & val : high & val;
|
|
}
|
|
for (var fd = 0; fd < nfds; fd++) {
|
|
var mask = 1 << fd % 32;
|
|
if (!check(fd, allLow, allHigh, mask)) {
|
|
continue;
|
|
}
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var flags = SYSCALLS.DEFAULT_POLLMASK;
|
|
if (stream.stream_ops.poll) {
|
|
flags = stream.stream_ops.poll(stream);
|
|
}
|
|
if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) {
|
|
fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask);
|
|
total++;
|
|
}
|
|
if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) {
|
|
fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask);
|
|
total++;
|
|
}
|
|
if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) {
|
|
fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask);
|
|
total++;
|
|
}
|
|
}
|
|
if (readfds) {
|
|
HEAP32[readfds >> 2] = dstReadLow;
|
|
HEAP32[(readfds + 4) >> 2] = dstReadHigh;
|
|
}
|
|
if (writefds) {
|
|
HEAP32[writefds >> 2] = dstWriteLow;
|
|
HEAP32[(writefds + 4) >> 2] = dstWriteHigh;
|
|
}
|
|
if (exceptfds) {
|
|
HEAP32[exceptfds >> 2] = dstExceptLow;
|
|
HEAP32[(exceptfds + 4) >> 2] = dstExceptHigh;
|
|
}
|
|
return total;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall145(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
iov = SYSCALLS.get(),
|
|
iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doReadv(stream, iov, iovcnt);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall146(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
iov = SYSCALLS.get(),
|
|
iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doWritev(stream, iov, iovcnt);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall15(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
mode = SYSCALLS.get();
|
|
FS.chmod(path, mode);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall168(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var fds = SYSCALLS.get(),
|
|
nfds = SYSCALLS.get(),
|
|
timeout = SYSCALLS.get();
|
|
var nonzero = 0;
|
|
for (var i = 0; i < nfds; i++) {
|
|
var pollfd = fds + 8 * i;
|
|
var fd = HEAP32[pollfd >> 2];
|
|
var events = HEAP16[(pollfd + 4) >> 1];
|
|
var mask = 32;
|
|
var stream = FS.getStream(fd);
|
|
if (stream) {
|
|
mask = SYSCALLS.DEFAULT_POLLMASK;
|
|
if (stream.stream_ops.poll) {
|
|
mask = stream.stream_ops.poll(stream);
|
|
}
|
|
}
|
|
mask &= events | 8 | 16;
|
|
if (mask) nonzero++;
|
|
HEAP16[(pollfd + 6) >> 1] = mask;
|
|
}
|
|
return nonzero;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall183(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var buf = SYSCALLS.get(),
|
|
size = SYSCALLS.get();
|
|
if (size === 0) return -ERRNO_CODES.EINVAL;
|
|
var cwd = FS.cwd();
|
|
var cwdLengthInBytes = lengthBytesUTF8(cwd);
|
|
if (size < cwdLengthInBytes + 1) return -ERRNO_CODES.ERANGE;
|
|
stringToUTF8(cwd, buf, size);
|
|
return buf;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall192(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var addr = SYSCALLS.get(),
|
|
len = SYSCALLS.get(),
|
|
prot = SYSCALLS.get(),
|
|
flags = SYSCALLS.get(),
|
|
fd = SYSCALLS.get(),
|
|
off = SYSCALLS.get();
|
|
off <<= 12;
|
|
var ptr;
|
|
var allocated = false;
|
|
if (fd === -1) {
|
|
ptr = _memalign(PAGE_SIZE, len);
|
|
if (!ptr) return -ERRNO_CODES.ENOMEM;
|
|
_memset(ptr, 0, len);
|
|
allocated = true;
|
|
} else {
|
|
var info = FS.getStream(fd);
|
|
if (!info) return -ERRNO_CODES.EBADF;
|
|
var res = FS.mmap(info, HEAPU8, addr, len, off, prot, flags);
|
|
ptr = res.ptr;
|
|
allocated = res.allocated;
|
|
}
|
|
SYSCALLS.mappings[ptr] = { malloc: ptr, len: len, allocated: allocated, fd: fd, flags: flags };
|
|
return ptr;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall193(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
zero = SYSCALLS.getZero(),
|
|
length = SYSCALLS.get64();
|
|
FS.truncate(path, length);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall194(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var fd = SYSCALLS.get(),
|
|
zero = SYSCALLS.getZero(),
|
|
length = SYSCALLS.get64();
|
|
FS.ftruncate(fd, length);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall195(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
buf = SYSCALLS.get();
|
|
return SYSCALLS.doStat(FS.stat, path, buf);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall196(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
buf = SYSCALLS.get();
|
|
return SYSCALLS.doStat(FS.lstat, path, buf);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall197(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get();
|
|
return SYSCALLS.doStat(FS.stat, stream.path, buf);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall202(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall199() {
|
|
return ___syscall202.apply(null, arguments);
|
|
}
|
|
function ___syscall220(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
dirp = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
if (!stream.getdents) {
|
|
stream.getdents = FS.readdir(stream.path);
|
|
}
|
|
var pos = 0;
|
|
while (stream.getdents.length > 0 && pos + 268 <= count) {
|
|
var id;
|
|
var type;
|
|
var name = stream.getdents.pop();
|
|
if (name[0] === ".") {
|
|
id = 1;
|
|
type = 4;
|
|
} else {
|
|
var child = FS.lookupNode(stream.node, name);
|
|
id = child.id;
|
|
type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8;
|
|
}
|
|
HEAP32[(dirp + pos) >> 2] = id;
|
|
HEAP32[(dirp + pos + 4) >> 2] = stream.position;
|
|
HEAP16[(dirp + pos + 8) >> 1] = 268;
|
|
HEAP8[(dirp + pos + 10) >> 0] = type;
|
|
stringToUTF8(name, dirp + pos + 11, 256);
|
|
pos += 268;
|
|
}
|
|
return pos;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall221(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
cmd = SYSCALLS.get();
|
|
switch (cmd) {
|
|
case 0: {
|
|
var arg = SYSCALLS.get();
|
|
if (arg < 0) {
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
var newStream;
|
|
newStream = FS.open(stream.path, stream.flags, 0, arg);
|
|
return newStream.fd;
|
|
}
|
|
case 1:
|
|
case 2:
|
|
return 0;
|
|
case 3:
|
|
return stream.flags;
|
|
case 4: {
|
|
var arg = SYSCALLS.get();
|
|
stream.flags |= arg;
|
|
return 0;
|
|
}
|
|
case 12:
|
|
case 12: {
|
|
var arg = SYSCALLS.get();
|
|
var offset = 0;
|
|
HEAP16[(arg + offset) >> 1] = 2;
|
|
return 0;
|
|
}
|
|
case 13:
|
|
case 14:
|
|
case 13:
|
|
case 14:
|
|
return 0;
|
|
case 16:
|
|
case 8:
|
|
return -ERRNO_CODES.EINVAL;
|
|
case 9:
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
default: {
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall268(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
size = SYSCALLS.get(),
|
|
buf = SYSCALLS.get();
|
|
assert(size === 64);
|
|
HEAP32[(buf + 4) >> 2] = 4096;
|
|
HEAP32[(buf + 40) >> 2] = 4096;
|
|
HEAP32[(buf + 8) >> 2] = 1e6;
|
|
HEAP32[(buf + 12) >> 2] = 5e5;
|
|
HEAP32[(buf + 16) >> 2] = 5e5;
|
|
HEAP32[(buf + 20) >> 2] = FS.nextInode;
|
|
HEAP32[(buf + 24) >> 2] = 1e6;
|
|
HEAP32[(buf + 28) >> 2] = 42;
|
|
HEAP32[(buf + 44) >> 2] = 2;
|
|
HEAP32[(buf + 36) >> 2] = 255;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall3(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
return FS.read(stream, HEAP8, buf, count);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall33(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
amode = SYSCALLS.get();
|
|
return SYSCALLS.doAccess(path, amode);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall38(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var old_path = SYSCALLS.getStr(),
|
|
new_path = SYSCALLS.getStr();
|
|
FS.rename(old_path, new_path);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall39(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
mode = SYSCALLS.get();
|
|
return SYSCALLS.doMkdir(path, mode);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall4(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
return FS.write(stream, HEAP8, buf, count);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall40(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr();
|
|
FS.rmdir(path);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
var PIPEFS = {
|
|
BUCKET_BUFFER_SIZE: 8192,
|
|
mount: function (mount) {
|
|
return FS.createNode(null, "/", 16384 | 511, 0);
|
|
},
|
|
createPipe: function () {
|
|
var pipe = { buckets: [] };
|
|
pipe.buckets.push({ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), offset: 0, roffset: 0 });
|
|
var rName = PIPEFS.nextname();
|
|
var wName = PIPEFS.nextname();
|
|
var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0);
|
|
var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0);
|
|
rNode.pipe = pipe;
|
|
wNode.pipe = pipe;
|
|
var readableStream = FS.createStream({ path: rName, node: rNode, flags: FS.modeStringToFlags("r"), seekable: false, stream_ops: PIPEFS.stream_ops });
|
|
rNode.stream = readableStream;
|
|
var writableStream = FS.createStream({ path: wName, node: wNode, flags: FS.modeStringToFlags("w"), seekable: false, stream_ops: PIPEFS.stream_ops });
|
|
wNode.stream = writableStream;
|
|
return { readable_fd: readableStream.fd, writable_fd: writableStream.fd };
|
|
},
|
|
stream_ops: {
|
|
poll: function (stream) {
|
|
var pipe = stream.node.pipe;
|
|
if ((stream.flags & 2097155) === 1) {
|
|
return 256 | 4;
|
|
} else {
|
|
if (pipe.buckets.length > 0) {
|
|
for (var i = 0; i < pipe.buckets.length; i++) {
|
|
var bucket = pipe.buckets[i];
|
|
if (bucket.offset - bucket.roffset > 0) {
|
|
return 64 | 1;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return 0;
|
|
},
|
|
ioctl: function (stream, request, varargs) {
|
|
return ERRNO_CODES.EINVAL;
|
|
},
|
|
read: function (stream, buffer, offset, length, position) {
|
|
var pipe = stream.node.pipe;
|
|
var currentLength = 0;
|
|
for (var i = 0; i < pipe.buckets.length; i++) {
|
|
var bucket = pipe.buckets[i];
|
|
currentLength += bucket.offset - bucket.roffset;
|
|
}
|
|
assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
|
|
var data = buffer.subarray(offset, offset + length);
|
|
if (length <= 0) {
|
|
return 0;
|
|
}
|
|
if (currentLength == 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
var toRead = Math.min(currentLength, length);
|
|
var totalRead = toRead;
|
|
var toRemove = 0;
|
|
for (var i = 0; i < pipe.buckets.length; i++) {
|
|
var currBucket = pipe.buckets[i];
|
|
var bucketSize = currBucket.offset - currBucket.roffset;
|
|
if (toRead <= bucketSize) {
|
|
var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
|
|
if (toRead < bucketSize) {
|
|
tmpSlice = tmpSlice.subarray(0, toRead);
|
|
currBucket.roffset += toRead;
|
|
} else {
|
|
toRemove++;
|
|
}
|
|
data.set(tmpSlice);
|
|
break;
|
|
} else {
|
|
var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
|
|
data.set(tmpSlice);
|
|
data = data.subarray(tmpSlice.byteLength);
|
|
toRead -= tmpSlice.byteLength;
|
|
toRemove++;
|
|
}
|
|
}
|
|
if (toRemove && toRemove == pipe.buckets.length) {
|
|
toRemove--;
|
|
pipe.buckets[toRemove].offset = 0;
|
|
pipe.buckets[toRemove].roffset = 0;
|
|
}
|
|
pipe.buckets.splice(0, toRemove);
|
|
return totalRead;
|
|
},
|
|
write: function (stream, buffer, offset, length, position) {
|
|
var pipe = stream.node.pipe;
|
|
assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer));
|
|
var data = buffer.subarray(offset, offset + length);
|
|
var dataLen = data.byteLength;
|
|
if (dataLen <= 0) {
|
|
return 0;
|
|
}
|
|
var currBucket = null;
|
|
if (pipe.buckets.length == 0) {
|
|
currBucket = { buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), offset: 0, roffset: 0 };
|
|
pipe.buckets.push(currBucket);
|
|
} else {
|
|
currBucket = pipe.buckets[pipe.buckets.length - 1];
|
|
}
|
|
assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE);
|
|
var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset;
|
|
if (freeBytesInCurrBuffer >= dataLen) {
|
|
currBucket.buffer.set(data, currBucket.offset);
|
|
currBucket.offset += dataLen;
|
|
return dataLen;
|
|
} else if (freeBytesInCurrBuffer > 0) {
|
|
currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset);
|
|
currBucket.offset += freeBytesInCurrBuffer;
|
|
data = data.subarray(freeBytesInCurrBuffer, data.byteLength);
|
|
}
|
|
var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0;
|
|
var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE;
|
|
for (var i = 0; i < numBuckets; i++) {
|
|
var newBucket = { buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), offset: PIPEFS.BUCKET_BUFFER_SIZE, roffset: 0 };
|
|
pipe.buckets.push(newBucket);
|
|
newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE));
|
|
data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength);
|
|
}
|
|
if (remElements > 0) {
|
|
var newBucket = { buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), offset: data.byteLength, roffset: 0 };
|
|
pipe.buckets.push(newBucket);
|
|
newBucket.buffer.set(data);
|
|
}
|
|
return dataLen;
|
|
},
|
|
close: function (stream) {
|
|
var pipe = stream.node.pipe;
|
|
pipe.buckets = null;
|
|
},
|
|
},
|
|
nextname: function () {
|
|
if (!PIPEFS.nextname.current) {
|
|
PIPEFS.nextname.current = 0;
|
|
}
|
|
return "pipe[" + PIPEFS.nextname.current++ + "]";
|
|
},
|
|
};
|
|
function ___syscall42(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var fdPtr = SYSCALLS.get();
|
|
if (fdPtr == 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EFAULT);
|
|
}
|
|
var res = PIPEFS.createPipe();
|
|
HEAP32[fdPtr >> 2] = res.readable_fd;
|
|
HEAP32[(fdPtr + 4) >> 2] = res.writable_fd;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall5(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var pathname = SYSCALLS.getStr(),
|
|
flags = SYSCALLS.get(),
|
|
mode = SYSCALLS.get();
|
|
var stream = FS.open(pathname, flags, mode);
|
|
return stream.fd;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall54(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
op = SYSCALLS.get();
|
|
switch (op) {
|
|
case 21509:
|
|
case 21505: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
case 21510:
|
|
case 21511:
|
|
case 21512:
|
|
case 21506:
|
|
case 21507:
|
|
case 21508: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
case 21519: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
var argp = SYSCALLS.get();
|
|
HEAP32[argp >> 2] = 0;
|
|
return 0;
|
|
}
|
|
case 21520: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
case 21531: {
|
|
var argp = SYSCALLS.get();
|
|
return FS.ioctl(stream, op, argp);
|
|
}
|
|
case 21523: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
case 21524: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
default:
|
|
abort("bad ioctl syscall " + op);
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall6(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD();
|
|
FS.close(stream);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall63(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var old = SYSCALLS.getStreamFromFD(),
|
|
suggestFD = SYSCALLS.get();
|
|
if (old.fd === suggestFD) return suggestFD;
|
|
return SYSCALLS.doDup(old.path, old.flags, suggestFD);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall77(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var who = SYSCALLS.get(),
|
|
usage = SYSCALLS.get();
|
|
_memset(usage, 0, 136);
|
|
HEAP32[usage >> 2] = 1;
|
|
HEAP32[(usage + 4) >> 2] = 2;
|
|
HEAP32[(usage + 8) >> 2] = 3;
|
|
HEAP32[(usage + 12) >> 2] = 4;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall85(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
buf = SYSCALLS.get(),
|
|
bufsize = SYSCALLS.get();
|
|
return SYSCALLS.doReadlink(path, buf, bufsize);
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___syscall91(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var addr = SYSCALLS.get(),
|
|
len = SYSCALLS.get();
|
|
var info = SYSCALLS.mappings[addr];
|
|
if (!info) return 0;
|
|
if (len === info.len) {
|
|
var stream = FS.getStream(info.fd);
|
|
SYSCALLS.doMsync(addr, stream, len, info.flags);
|
|
FS.munmap(stream);
|
|
SYSCALLS.mappings[addr] = null;
|
|
if (info.allocated) {
|
|
_free(info.malloc);
|
|
}
|
|
}
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
function ___unlock() {}
|
|
function _abort() {
|
|
Module["abort"]();
|
|
}
|
|
function _atexit(func, arg) {
|
|
__ATEXIT__.unshift({ func: func, arg: arg });
|
|
}
|
|
function _clock() {
|
|
if (_clock.start === undefined) _clock.start = Date.now();
|
|
return ((Date.now() - _clock.start) * (1e6 / 1e3)) | 0;
|
|
}
|
|
function _emscripten_get_now_res() {
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
return 1;
|
|
} else if (typeof dateNow !== "undefined" || ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"])) {
|
|
return 1e3;
|
|
} else {
|
|
return 1e3 * 1e3;
|
|
}
|
|
}
|
|
function _emscripten_get_now() {
|
|
abort();
|
|
}
|
|
function _emscripten_get_now_is_monotonic() {
|
|
return ENVIRONMENT_IS_NODE || typeof dateNow !== "undefined" || ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]);
|
|
}
|
|
function _clock_getres(clk_id, res) {
|
|
var nsec;
|
|
if (clk_id === 0) {
|
|
nsec = 1e3 * 1e3;
|
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
|
|
nsec = _emscripten_get_now_res();
|
|
} else {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
HEAP32[res >> 2] = (nsec / 1e9) | 0;
|
|
HEAP32[(res + 4) >> 2] = nsec;
|
|
return 0;
|
|
}
|
|
function _clock_gettime(clk_id, tp) {
|
|
var now;
|
|
if (clk_id === 0) {
|
|
now = Date.now();
|
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
|
|
now = _emscripten_get_now();
|
|
} else {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
HEAP32[tp >> 2] = (now / 1e3) | 0;
|
|
HEAP32[(tp + 4) >> 2] = ((now % 1e3) * 1e3 * 1e3) | 0;
|
|
return 0;
|
|
}
|
|
function _difftime(time1, time0) {
|
|
return time1 - time0;
|
|
}
|
|
var DLFCN = { error: null, errorMsg: null, loadedLibs: {}, loadedLibNames: {} };
|
|
function _dlclose(handle) {
|
|
if (!DLFCN.loadedLibs[handle]) {
|
|
DLFCN.errorMsg = "Tried to dlclose() unopened handle: " + handle;
|
|
return 1;
|
|
} else {
|
|
var lib_record = DLFCN.loadedLibs[handle];
|
|
if (--lib_record.refcount == 0) {
|
|
if (lib_record.module.cleanups) {
|
|
lib_record.module.cleanups.forEach(function (cleanup) {
|
|
cleanup();
|
|
});
|
|
}
|
|
delete DLFCN.loadedLibNames[lib_record.name];
|
|
delete DLFCN.loadedLibs[handle];
|
|
}
|
|
return 0;
|
|
}
|
|
}
|
|
function _dlopen(filename, flag) {
|
|
abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/kripken/emscripten/wiki/Linking");
|
|
var searchpaths = [];
|
|
if (filename === 0) {
|
|
filename = "__self__";
|
|
} else {
|
|
var strfilename = Pointer_stringify(filename);
|
|
var isValidFile = function (filename) {
|
|
var target = FS.findObject(filename);
|
|
return target && !target.isFolder && !target.isDevice;
|
|
};
|
|
if (isValidFile(strfilename)) {
|
|
filename = strfilename;
|
|
} else {
|
|
if (ENV["LD_LIBRARY_PATH"]) {
|
|
searchpaths = ENV["LD_LIBRARY_PATH"].split(":");
|
|
}
|
|
for (var ident in searchpaths) {
|
|
var searchfile = PATH.join2(searchpaths[ident], strfilename);
|
|
if (isValidFile(searchfile)) {
|
|
filename = searchfile;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (DLFCN.loadedLibNames[filename]) {
|
|
var handle = DLFCN.loadedLibNames[filename];
|
|
DLFCN.loadedLibs[handle].refcount++;
|
|
return handle;
|
|
}
|
|
var lib_module;
|
|
if (filename === "__self__") {
|
|
var handle = -1;
|
|
lib_module = Module;
|
|
} else {
|
|
if (Module["preloadedWasm"] !== undefined && Module["preloadedWasm"][filename] !== undefined) {
|
|
lib_module = Module["preloadedWasm"][filename];
|
|
} else {
|
|
var target = FS.findObject(filename);
|
|
if (!target || target.isFolder || target.isDevice) {
|
|
DLFCN.errorMsg = "Could not find dynamic lib: " + filename;
|
|
return 0;
|
|
}
|
|
FS.forceLoadFile(target);
|
|
try {
|
|
var lib_data = FS.readFile(filename, { encoding: "binary" });
|
|
if (!(lib_data instanceof Uint8Array)) lib_data = new Uint8Array(lib_data);
|
|
lib_module = loadWebAssemblyModule(lib_data);
|
|
} catch (e) {
|
|
DLFCN.errorMsg = "Could not evaluate dynamic lib: " + filename + "\n" + e;
|
|
return 0;
|
|
}
|
|
}
|
|
var handle = 1;
|
|
for (var key in DLFCN.loadedLibs) {
|
|
if (DLFCN.loadedLibs.hasOwnProperty(key)) handle++;
|
|
}
|
|
if (flag & 256) {
|
|
for (var ident in lib_module) {
|
|
if (lib_module.hasOwnProperty(ident)) {
|
|
if (ident[0] == "_") {
|
|
Module[ident] = lib_module[ident];
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
DLFCN.loadedLibs[handle] = { refcount: 1, name: filename, module: lib_module };
|
|
DLFCN.loadedLibNames[filename] = handle;
|
|
return handle;
|
|
}
|
|
function _dlsym(handle, symbol) {
|
|
symbol = Pointer_stringify(symbol);
|
|
if (!DLFCN.loadedLibs[handle]) {
|
|
DLFCN.errorMsg = "Tried to dlsym() from an unopened handle: " + handle;
|
|
return 0;
|
|
} else {
|
|
var lib = DLFCN.loadedLibs[handle];
|
|
symbol = "_" + symbol;
|
|
if (!lib.module.hasOwnProperty(symbol)) {
|
|
DLFCN.errorMsg = 'Tried to lookup unknown symbol "' + symbol + '" in dynamic lib: ' + lib.name;
|
|
return 0;
|
|
} else {
|
|
var result = lib.module[symbol];
|
|
if (typeof result === "function") {
|
|
return addFunction(result);
|
|
}
|
|
return result;
|
|
}
|
|
}
|
|
}
|
|
function _emscripten_set_main_loop_timing(mode, value) {
|
|
Browser.mainLoop.timingMode = mode;
|
|
Browser.mainLoop.timingValue = value;
|
|
if (!Browser.mainLoop.func) {
|
|
return 1;
|
|
}
|
|
if (mode == 0) {
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
|
|
var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now()) | 0;
|
|
setTimeout(Browser.mainLoop.runner, timeUntilNextTick);
|
|
};
|
|
Browser.mainLoop.method = "timeout";
|
|
} else if (mode == 1) {
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
|
|
Browser.requestAnimationFrame(Browser.mainLoop.runner);
|
|
};
|
|
Browser.mainLoop.method = "rAF";
|
|
} else if (mode == 2) {
|
|
if (typeof setImmediate === "undefined") {
|
|
var setImmediates = [];
|
|
var emscriptenMainLoopMessageId = "setimmediate";
|
|
function Browser_setImmediate_messageHandler(event) {
|
|
if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
|
|
event.stopPropagation();
|
|
setImmediates.shift()();
|
|
}
|
|
}
|
|
addEventListener("message", Browser_setImmediate_messageHandler, true);
|
|
setImmediate = function Browser_emulated_setImmediate(func) {
|
|
setImmediates.push(func);
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
if (Module["setImmediates"] === undefined) Module["setImmediates"] = [];
|
|
Module["setImmediates"].push(func);
|
|
postMessage({ target: emscriptenMainLoopMessageId });
|
|
} else postMessage(emscriptenMainLoopMessageId, "*");
|
|
};
|
|
}
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
|
|
setImmediate(Browser.mainLoop.runner);
|
|
};
|
|
Browser.mainLoop.method = "immediate";
|
|
}
|
|
return 0;
|
|
}
|
|
function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
|
|
Module["noExitRuntime"] = true;
|
|
assert(!Browser.mainLoop.func, "emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");
|
|
Browser.mainLoop.func = func;
|
|
Browser.mainLoop.arg = arg;
|
|
var browserIterationFunc;
|
|
if (typeof arg !== "undefined") {
|
|
browserIterationFunc = function () {
|
|
Module["dynCall_vi"](func, arg);
|
|
};
|
|
} else {
|
|
browserIterationFunc = function () {
|
|
Module["dynCall_v"](func);
|
|
};
|
|
}
|
|
var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
|
|
Browser.mainLoop.runner = function Browser_mainLoop_runner() {
|
|
if (ABORT) return;
|
|
if (Browser.mainLoop.queue.length > 0) {
|
|
var start = Date.now();
|
|
var blocker = Browser.mainLoop.queue.shift();
|
|
blocker.func(blocker.arg);
|
|
if (Browser.mainLoop.remainingBlockers) {
|
|
var remaining = Browser.mainLoop.remainingBlockers;
|
|
var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining);
|
|
if (blocker.counted) {
|
|
Browser.mainLoop.remainingBlockers = next;
|
|
} else {
|
|
next = next + 0.5;
|
|
Browser.mainLoop.remainingBlockers = (8 * remaining + next) / 9;
|
|
}
|
|
}
|
|
console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + " ms");
|
|
Browser.mainLoop.updateStatus();
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
setTimeout(Browser.mainLoop.runner, 0);
|
|
return;
|
|
}
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
Browser.mainLoop.currentFrameNumber = (Browser.mainLoop.currentFrameNumber + 1) | 0;
|
|
if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
|
|
Browser.mainLoop.scheduler();
|
|
return;
|
|
} else if (Browser.mainLoop.timingMode == 0) {
|
|
Browser.mainLoop.tickStartTime = _emscripten_get_now();
|
|
}
|
|
if (Browser.mainLoop.method === "timeout" && Module.ctx) {
|
|
err("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!");
|
|
Browser.mainLoop.method = "";
|
|
}
|
|
Browser.mainLoop.runIter(browserIterationFunc);
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
if (typeof SDL === "object" && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
|
|
Browser.mainLoop.scheduler();
|
|
};
|
|
if (!noSetTiming) {
|
|
if (fps && fps > 0) _emscripten_set_main_loop_timing(0, 1e3 / fps);
|
|
else _emscripten_set_main_loop_timing(1, 1);
|
|
Browser.mainLoop.scheduler();
|
|
}
|
|
if (simulateInfiniteLoop) {
|
|
throw "SimulateInfiniteLoop";
|
|
}
|
|
}
|
|
var Browser = {
|
|
mainLoop: {
|
|
scheduler: null,
|
|
method: "",
|
|
currentlyRunningMainloop: 0,
|
|
func: null,
|
|
arg: 0,
|
|
timingMode: 0,
|
|
timingValue: 0,
|
|
currentFrameNumber: 0,
|
|
queue: [],
|
|
pause: function () {
|
|
Browser.mainLoop.scheduler = null;
|
|
Browser.mainLoop.currentlyRunningMainloop++;
|
|
},
|
|
resume: function () {
|
|
Browser.mainLoop.currentlyRunningMainloop++;
|
|
var timingMode = Browser.mainLoop.timingMode;
|
|
var timingValue = Browser.mainLoop.timingValue;
|
|
var func = Browser.mainLoop.func;
|
|
Browser.mainLoop.func = null;
|
|
_emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true);
|
|
_emscripten_set_main_loop_timing(timingMode, timingValue);
|
|
Browser.mainLoop.scheduler();
|
|
},
|
|
updateStatus: function () {
|
|
if (Module["setStatus"]) {
|
|
var message = Module["statusMessage"] || "Please wait...";
|
|
var remaining = Browser.mainLoop.remainingBlockers;
|
|
var expected = Browser.mainLoop.expectedBlockers;
|
|
if (remaining) {
|
|
if (remaining < expected) {
|
|
Module["setStatus"](message + " (" + (expected - remaining) + "/" + expected + ")");
|
|
} else {
|
|
Module["setStatus"](message);
|
|
}
|
|
} else {
|
|
Module["setStatus"]("");
|
|
}
|
|
}
|
|
},
|
|
runIter: function (func) {
|
|
if (ABORT) return;
|
|
if (Module["preMainLoop"]) {
|
|
var preRet = Module["preMainLoop"]();
|
|
if (preRet === false) {
|
|
return;
|
|
}
|
|
}
|
|
try {
|
|
func();
|
|
} catch (e) {
|
|
if (e instanceof ExitStatus) {
|
|
return;
|
|
} else {
|
|
if (e && typeof e === "object" && e.stack) err("exception thrown: " + [e, e.stack]);
|
|
throw e;
|
|
}
|
|
}
|
|
if (Module["postMainLoop"]) Module["postMainLoop"]();
|
|
},
|
|
},
|
|
isFullscreen: false,
|
|
pointerLock: false,
|
|
moduleContextCreatedCallbacks: [],
|
|
workers: [],
|
|
init: function () {
|
|
if (!Module["preloadPlugins"]) Module["preloadPlugins"] = [];
|
|
if (Browser.initted) return;
|
|
Browser.initted = true;
|
|
try {
|
|
new Blob();
|
|
Browser.hasBlobConstructor = true;
|
|
} catch (e) {
|
|
Browser.hasBlobConstructor = false;
|
|
console.log("warning: no blob constructor, cannot create blobs with mimetypes");
|
|
}
|
|
Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : !Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null;
|
|
Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
|
|
if (!Module.noImageDecoding && typeof Browser.URLObject === "undefined") {
|
|
console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
|
|
Module.noImageDecoding = true;
|
|
}
|
|
var imagePlugin = {};
|
|
imagePlugin["canHandle"] = function imagePlugin_canHandle(name) {
|
|
return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
|
|
};
|
|
imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) {
|
|
var b = null;
|
|
if (Browser.hasBlobConstructor) {
|
|
try {
|
|
b = new Blob([byteArray], { type: Browser.getMimetype(name) });
|
|
if (b.size !== byteArray.length) {
|
|
b = new Blob([new Uint8Array(byteArray).buffer], { type: Browser.getMimetype(name) });
|
|
}
|
|
} catch (e) {
|
|
warnOnce("Blob constructor present but fails: " + e + "; falling back to blob builder");
|
|
}
|
|
}
|
|
if (!b) {
|
|
var bb = new Browser.BlobBuilder();
|
|
bb.append(new Uint8Array(byteArray).buffer);
|
|
b = bb.getBlob();
|
|
}
|
|
var url = Browser.URLObject.createObjectURL(b);
|
|
var img = new Image();
|
|
img.onload = function img_onload() {
|
|
assert(img.complete, "Image " + name + " could not be decoded");
|
|
var canvas = document.createElement("canvas");
|
|
canvas.width = img.width;
|
|
canvas.height = img.height;
|
|
var ctx = canvas.getContext("2d");
|
|
ctx.drawImage(img, 0, 0);
|
|
Module["preloadedImages"][name] = canvas;
|
|
Browser.URLObject.revokeObjectURL(url);
|
|
if (onload) onload(byteArray);
|
|
};
|
|
img.onerror = function img_onerror(event) {
|
|
console.log("Image " + url + " could not be decoded");
|
|
if (onerror) onerror();
|
|
};
|
|
img.src = url;
|
|
};
|
|
Module["preloadPlugins"].push(imagePlugin);
|
|
var audioPlugin = {};
|
|
audioPlugin["canHandle"] = function audioPlugin_canHandle(name) {
|
|
return !Module.noAudioDecoding && name.substr(-4) in { ".ogg": 1, ".wav": 1, ".mp3": 1 };
|
|
};
|
|
audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) {
|
|
var done = false;
|
|
function finish(audio) {
|
|
if (done) return;
|
|
done = true;
|
|
Module["preloadedAudios"][name] = audio;
|
|
if (onload) onload(byteArray);
|
|
}
|
|
function fail() {
|
|
if (done) return;
|
|
done = true;
|
|
Module["preloadedAudios"][name] = new Audio();
|
|
if (onerror) onerror();
|
|
}
|
|
if (Browser.hasBlobConstructor) {
|
|
try {
|
|
var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
|
|
} catch (e) {
|
|
return fail();
|
|
}
|
|
var url = Browser.URLObject.createObjectURL(b);
|
|
var audio = new Audio();
|
|
audio.addEventListener(
|
|
"canplaythrough",
|
|
function () {
|
|
finish(audio);
|
|
},
|
|
false
|
|
);
|
|
audio.onerror = function audio_onerror(event) {
|
|
if (done) return;
|
|
console.log("warning: browser could not fully decode audio " + name + ", trying slower base64 approach");
|
|
function encode64(data) {
|
|
var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
|
|
var PAD = "=";
|
|
var ret = "";
|
|
var leftchar = 0;
|
|
var leftbits = 0;
|
|
for (var i = 0; i < data.length; i++) {
|
|
leftchar = (leftchar << 8) | data[i];
|
|
leftbits += 8;
|
|
while (leftbits >= 6) {
|
|
var curr = (leftchar >> (leftbits - 6)) & 63;
|
|
leftbits -= 6;
|
|
ret += BASE[curr];
|
|
}
|
|
}
|
|
if (leftbits == 2) {
|
|
ret += BASE[(leftchar & 3) << 4];
|
|
ret += PAD + PAD;
|
|
} else if (leftbits == 4) {
|
|
ret += BASE[(leftchar & 15) << 2];
|
|
ret += PAD;
|
|
}
|
|
return ret;
|
|
}
|
|
audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray);
|
|
finish(audio);
|
|
};
|
|
audio.src = url;
|
|
Browser.safeSetTimeout(function () {
|
|
finish(audio);
|
|
}, 1e4);
|
|
} else {
|
|
return fail();
|
|
}
|
|
};
|
|
Module["preloadPlugins"].push(audioPlugin);
|
|
function pointerLockChange() {
|
|
Browser.pointerLock = document["pointerLockElement"] === Module["canvas"] || document["mozPointerLockElement"] === Module["canvas"] || document["webkitPointerLockElement"] === Module["canvas"] || document["msPointerLockElement"] === Module["canvas"];
|
|
}
|
|
var canvas = Module["canvas"];
|
|
if (canvas) {
|
|
canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || function () {};
|
|
canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || function () {};
|
|
canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
|
|
document.addEventListener("pointerlockchange", pointerLockChange, false);
|
|
document.addEventListener("mozpointerlockchange", pointerLockChange, false);
|
|
document.addEventListener("webkitpointerlockchange", pointerLockChange, false);
|
|
document.addEventListener("mspointerlockchange", pointerLockChange, false);
|
|
if (Module["elementPointerLock"]) {
|
|
canvas.addEventListener(
|
|
"click",
|
|
function (ev) {
|
|
if (!Browser.pointerLock && Module["canvas"].requestPointerLock) {
|
|
Module["canvas"].requestPointerLock();
|
|
ev.preventDefault();
|
|
}
|
|
},
|
|
false
|
|
);
|
|
}
|
|
}
|
|
},
|
|
createContext: function (canvas, useWebGL, setInModule, webGLContextAttributes) {
|
|
if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx;
|
|
var ctx;
|
|
var contextHandle;
|
|
if (useWebGL) {
|
|
var contextAttributes = { antialias: false, alpha: false };
|
|
if (webGLContextAttributes) {
|
|
for (var attribute in webGLContextAttributes) {
|
|
contextAttributes[attribute] = webGLContextAttributes[attribute];
|
|
}
|
|
}
|
|
contextHandle = GL.createContext(canvas, contextAttributes);
|
|
if (contextHandle) {
|
|
ctx = GL.getContext(contextHandle).GLctx;
|
|
}
|
|
} else {
|
|
ctx = canvas.getContext("2d");
|
|
}
|
|
if (!ctx) return null;
|
|
if (setInModule) {
|
|
if (!useWebGL) assert(typeof GLctx === "undefined", "cannot set in module if GLctx is used, but we are a non-GL context that would replace it");
|
|
Module.ctx = ctx;
|
|
if (useWebGL) GL.makeContextCurrent(contextHandle);
|
|
Module.useWebGL = useWebGL;
|
|
Browser.moduleContextCreatedCallbacks.forEach(function (callback) {
|
|
callback();
|
|
});
|
|
Browser.init();
|
|
}
|
|
return ctx;
|
|
},
|
|
destroyContext: function (canvas, useWebGL, setInModule) {},
|
|
fullscreenHandlersInstalled: false,
|
|
lockPointer: undefined,
|
|
resizeCanvas: undefined,
|
|
requestFullscreen: function (lockPointer, resizeCanvas, vrDevice) {
|
|
Browser.lockPointer = lockPointer;
|
|
Browser.resizeCanvas = resizeCanvas;
|
|
Browser.vrDevice = vrDevice;
|
|
if (typeof Browser.lockPointer === "undefined") Browser.lockPointer = true;
|
|
if (typeof Browser.resizeCanvas === "undefined") Browser.resizeCanvas = false;
|
|
if (typeof Browser.vrDevice === "undefined") Browser.vrDevice = null;
|
|
var canvas = Module["canvas"];
|
|
function fullscreenChange() {
|
|
Browser.isFullscreen = false;
|
|
var canvasContainer = canvas.parentNode;
|
|
if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) {
|
|
canvas.exitFullscreen = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || function () {};
|
|
canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
|
|
if (Browser.lockPointer) canvas.requestPointerLock();
|
|
Browser.isFullscreen = true;
|
|
if (Browser.resizeCanvas) {
|
|
Browser.setFullscreenCanvasSize();
|
|
} else {
|
|
Browser.updateCanvasDimensions(canvas);
|
|
}
|
|
} else {
|
|
canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
|
|
canvasContainer.parentNode.removeChild(canvasContainer);
|
|
if (Browser.resizeCanvas) {
|
|
Browser.setWindowedCanvasSize();
|
|
} else {
|
|
Browser.updateCanvasDimensions(canvas);
|
|
}
|
|
}
|
|
if (Module["onFullScreen"]) Module["onFullScreen"](Browser.isFullscreen);
|
|
if (Module["onFullscreen"]) Module["onFullscreen"](Browser.isFullscreen);
|
|
}
|
|
if (!Browser.fullscreenHandlersInstalled) {
|
|
Browser.fullscreenHandlersInstalled = true;
|
|
document.addEventListener("fullscreenchange", fullscreenChange, false);
|
|
document.addEventListener("mozfullscreenchange", fullscreenChange, false);
|
|
document.addEventListener("webkitfullscreenchange", fullscreenChange, false);
|
|
document.addEventListener("MSFullscreenChange", fullscreenChange, false);
|
|
}
|
|
var canvasContainer = document.createElement("div");
|
|
canvas.parentNode.insertBefore(canvasContainer, canvas);
|
|
canvasContainer.appendChild(canvas);
|
|
canvasContainer.requestFullscreen =
|
|
canvasContainer["requestFullscreen"] ||
|
|
canvasContainer["mozRequestFullScreen"] ||
|
|
canvasContainer["msRequestFullscreen"] ||
|
|
(canvasContainer["webkitRequestFullscreen"]
|
|
? function () {
|
|
canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]);
|
|
}
|
|
: null) ||
|
|
(canvasContainer["webkitRequestFullScreen"]
|
|
? function () {
|
|
canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]);
|
|
}
|
|
: null);
|
|
if (vrDevice) {
|
|
canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
|
|
} else {
|
|
canvasContainer.requestFullscreen();
|
|
}
|
|
},
|
|
requestFullScreen: function (lockPointer, resizeCanvas, vrDevice) {
|
|
err("Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.");
|
|
Browser.requestFullScreen = function (lockPointer, resizeCanvas, vrDevice) {
|
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
|
|
};
|
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
|
|
},
|
|
nextRAF: 0,
|
|
fakeRequestAnimationFrame: function (func) {
|
|
var now = Date.now();
|
|
if (Browser.nextRAF === 0) {
|
|
Browser.nextRAF = now + 1e3 / 60;
|
|
} else {
|
|
while (now + 2 >= Browser.nextRAF) {
|
|
Browser.nextRAF += 1e3 / 60;
|
|
}
|
|
}
|
|
var delay = Math.max(Browser.nextRAF - now, 0);
|
|
setTimeout(func, delay);
|
|
},
|
|
requestAnimationFrame: function requestAnimationFrame(func) {
|
|
if (typeof window === "undefined") {
|
|
Browser.fakeRequestAnimationFrame(func);
|
|
} else {
|
|
if (!window.requestAnimationFrame) {
|
|
window.requestAnimationFrame = window["requestAnimationFrame"] || window["mozRequestAnimationFrame"] || window["webkitRequestAnimationFrame"] || window["msRequestAnimationFrame"] || window["oRequestAnimationFrame"] || Browser.fakeRequestAnimationFrame;
|
|
}
|
|
window.requestAnimationFrame(func);
|
|
}
|
|
},
|
|
safeCallback: function (func) {
|
|
return function () {
|
|
if (!ABORT) return func.apply(null, arguments);
|
|
};
|
|
},
|
|
allowAsyncCallbacks: true,
|
|
queuedAsyncCallbacks: [],
|
|
pauseAsyncCallbacks: function () {
|
|
Browser.allowAsyncCallbacks = false;
|
|
},
|
|
resumeAsyncCallbacks: function () {
|
|
Browser.allowAsyncCallbacks = true;
|
|
if (Browser.queuedAsyncCallbacks.length > 0) {
|
|
var callbacks = Browser.queuedAsyncCallbacks;
|
|
Browser.queuedAsyncCallbacks = [];
|
|
callbacks.forEach(function (func) {
|
|
func();
|
|
});
|
|
}
|
|
},
|
|
safeRequestAnimationFrame: function (func) {
|
|
return Browser.requestAnimationFrame(function () {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func();
|
|
} else {
|
|
Browser.queuedAsyncCallbacks.push(func);
|
|
}
|
|
});
|
|
},
|
|
safeSetTimeout: function (func, timeout) {
|
|
Module["noExitRuntime"] = true;
|
|
return setTimeout(function () {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func();
|
|
} else {
|
|
Browser.queuedAsyncCallbacks.push(func);
|
|
}
|
|
}, timeout);
|
|
},
|
|
safeSetInterval: function (func, timeout) {
|
|
Module["noExitRuntime"] = true;
|
|
return setInterval(function () {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func();
|
|
}
|
|
}, timeout);
|
|
},
|
|
getMimetype: function (name) {
|
|
return { jpg: "image/jpeg", jpeg: "image/jpeg", png: "image/png", bmp: "image/bmp", ogg: "audio/ogg", wav: "audio/wav", mp3: "audio/mpeg" }[name.substr(name.lastIndexOf(".") + 1)];
|
|
},
|
|
getUserMedia: function (func) {
|
|
if (!window.getUserMedia) {
|
|
window.getUserMedia = navigator["getUserMedia"] || navigator["mozGetUserMedia"];
|
|
}
|
|
window.getUserMedia(func);
|
|
},
|
|
getMovementX: function (event) {
|
|
return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0;
|
|
},
|
|
getMovementY: function (event) {
|
|
return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0;
|
|
},
|
|
getMouseWheelDelta: function (event) {
|
|
var delta = 0;
|
|
switch (event.type) {
|
|
case "DOMMouseScroll":
|
|
delta = event.detail;
|
|
break;
|
|
case "mousewheel":
|
|
delta = event.wheelDelta;
|
|
break;
|
|
case "wheel":
|
|
delta = event["deltaY"];
|
|
break;
|
|
default:
|
|
throw "unrecognized mouse wheel event: " + event.type;
|
|
}
|
|
return delta;
|
|
},
|
|
mouseX: 0,
|
|
mouseY: 0,
|
|
mouseMovementX: 0,
|
|
mouseMovementY: 0,
|
|
touches: {},
|
|
lastTouches: {},
|
|
calculateMouseEvent: function (event) {
|
|
if (Browser.pointerLock) {
|
|
if (event.type != "mousemove" && "mozMovementX" in event) {
|
|
Browser.mouseMovementX = Browser.mouseMovementY = 0;
|
|
} else {
|
|
Browser.mouseMovementX = Browser.getMovementX(event);
|
|
Browser.mouseMovementY = Browser.getMovementY(event);
|
|
}
|
|
if (typeof SDL != "undefined") {
|
|
Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
|
|
Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
|
|
} else {
|
|
Browser.mouseX += Browser.mouseMovementX;
|
|
Browser.mouseY += Browser.mouseMovementY;
|
|
}
|
|
} else {
|
|
var rect = Module["canvas"].getBoundingClientRect();
|
|
var cw = Module["canvas"].width;
|
|
var ch = Module["canvas"].height;
|
|
var scrollX = typeof window.scrollX !== "undefined" ? window.scrollX : window.pageXOffset;
|
|
var scrollY = typeof window.scrollY !== "undefined" ? window.scrollY : window.pageYOffset;
|
|
if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") {
|
|
var touch = event.touch;
|
|
if (touch === undefined) {
|
|
return;
|
|
}
|
|
var adjustedX = touch.pageX - (scrollX + rect.left);
|
|
var adjustedY = touch.pageY - (scrollY + rect.top);
|
|
adjustedX = adjustedX * (cw / rect.width);
|
|
adjustedY = adjustedY * (ch / rect.height);
|
|
var coords = { x: adjustedX, y: adjustedY };
|
|
if (event.type === "touchstart") {
|
|
Browser.lastTouches[touch.identifier] = coords;
|
|
Browser.touches[touch.identifier] = coords;
|
|
} else if (event.type === "touchend" || event.type === "touchmove") {
|
|
var last = Browser.touches[touch.identifier];
|
|
if (!last) last = coords;
|
|
Browser.lastTouches[touch.identifier] = last;
|
|
Browser.touches[touch.identifier] = coords;
|
|
}
|
|
return;
|
|
}
|
|
var x = event.pageX - (scrollX + rect.left);
|
|
var y = event.pageY - (scrollY + rect.top);
|
|
x = x * (cw / rect.width);
|
|
y = y * (ch / rect.height);
|
|
Browser.mouseMovementX = x - Browser.mouseX;
|
|
Browser.mouseMovementY = y - Browser.mouseY;
|
|
Browser.mouseX = x;
|
|
Browser.mouseY = y;
|
|
}
|
|
},
|
|
asyncLoad: function (url, onload, onerror, noRunDep) {
|
|
var dep = !noRunDep ? getUniqueRunDependency("al " + url) : "";
|
|
Module["readAsync"](
|
|
url,
|
|
function (arrayBuffer) {
|
|
assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
|
|
onload(new Uint8Array(arrayBuffer));
|
|
if (dep) removeRunDependency(dep);
|
|
},
|
|
function (event) {
|
|
if (onerror) {
|
|
onerror();
|
|
} else {
|
|
throw 'Loading data file "' + url + '" failed.';
|
|
}
|
|
}
|
|
);
|
|
if (dep) addRunDependency(dep);
|
|
},
|
|
resizeListeners: [],
|
|
updateResizeListeners: function () {
|
|
var canvas = Module["canvas"];
|
|
Browser.resizeListeners.forEach(function (listener) {
|
|
listener(canvas.width, canvas.height);
|
|
});
|
|
},
|
|
setCanvasSize: function (width, height, noUpdates) {
|
|
var canvas = Module["canvas"];
|
|
Browser.updateCanvasDimensions(canvas, width, height);
|
|
if (!noUpdates) Browser.updateResizeListeners();
|
|
},
|
|
windowedWidth: 0,
|
|
windowedHeight: 0,
|
|
setFullscreenCanvasSize: function () {
|
|
if (typeof SDL != "undefined") {
|
|
var flags = HEAPU32[SDL.screen >> 2];
|
|
flags = flags | 8388608;
|
|
HEAP32[SDL.screen >> 2] = flags;
|
|
}
|
|
Browser.updateCanvasDimensions(Module["canvas"]);
|
|
Browser.updateResizeListeners();
|
|
},
|
|
setWindowedCanvasSize: function () {
|
|
if (typeof SDL != "undefined") {
|
|
var flags = HEAPU32[SDL.screen >> 2];
|
|
flags = flags & ~8388608;
|
|
HEAP32[SDL.screen >> 2] = flags;
|
|
}
|
|
Browser.updateCanvasDimensions(Module["canvas"]);
|
|
Browser.updateResizeListeners();
|
|
},
|
|
updateCanvasDimensions: function (canvas, wNative, hNative) {
|
|
if (wNative && hNative) {
|
|
canvas.widthNative = wNative;
|
|
canvas.heightNative = hNative;
|
|
} else {
|
|
wNative = canvas.widthNative;
|
|
hNative = canvas.heightNative;
|
|
}
|
|
var w = wNative;
|
|
var h = hNative;
|
|
if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) {
|
|
if (w / h < Module["forcedAspectRatio"]) {
|
|
w = Math.round(h * Module["forcedAspectRatio"]);
|
|
} else {
|
|
h = Math.round(w / Module["forcedAspectRatio"]);
|
|
}
|
|
}
|
|
if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode && typeof screen != "undefined") {
|
|
var factor = Math.min(screen.width / w, screen.height / h);
|
|
w = Math.round(w * factor);
|
|
h = Math.round(h * factor);
|
|
}
|
|
if (Browser.resizeCanvas) {
|
|
if (canvas.width != w) canvas.width = w;
|
|
if (canvas.height != h) canvas.height = h;
|
|
if (typeof canvas.style != "undefined") {
|
|
canvas.style.removeProperty("width");
|
|
canvas.style.removeProperty("height");
|
|
}
|
|
} else {
|
|
if (canvas.width != wNative) canvas.width = wNative;
|
|
if (canvas.height != hNative) canvas.height = hNative;
|
|
if (typeof canvas.style != "undefined") {
|
|
if (w != wNative || h != hNative) {
|
|
canvas.style.setProperty("width", w + "px", "important");
|
|
canvas.style.setProperty("height", h + "px", "important");
|
|
} else {
|
|
canvas.style.removeProperty("width");
|
|
canvas.style.removeProperty("height");
|
|
}
|
|
}
|
|
}
|
|
},
|
|
wgetRequests: {},
|
|
nextWgetRequestHandle: 0,
|
|
getNextWgetRequestHandle: function () {
|
|
var handle = Browser.nextWgetRequestHandle;
|
|
Browser.nextWgetRequestHandle++;
|
|
return handle;
|
|
},
|
|
};
|
|
function _emscripten_cancel_main_loop() {
|
|
Browser.mainLoop.pause();
|
|
Browser.mainLoop.func = null;
|
|
}
|
|
function _emscripten_set_canvas_element_size_calling_thread(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (!canvas) return -4;
|
|
if (canvas.canvasSharedPtr) {
|
|
HEAP32[canvas.canvasSharedPtr >> 2] = width;
|
|
HEAP32[(canvas.canvasSharedPtr + 4) >> 2] = height;
|
|
}
|
|
if (canvas.offscreenCanvas || !canvas.controlTransferredOffscreen) {
|
|
if (canvas.offscreenCanvas) canvas = canvas.offscreenCanvas;
|
|
var autoResizeViewport = false;
|
|
if (canvas.GLctxObject && canvas.GLctxObject.GLctx) {
|
|
var prevViewport = canvas.GLctxObject.GLctx.getParameter(canvas.GLctxObject.GLctx.VIEWPORT);
|
|
autoResizeViewport = prevViewport[0] === 0 && prevViewport[1] === 0 && prevViewport[2] === canvas.width && prevViewport[3] === canvas.height;
|
|
}
|
|
canvas.width = width;
|
|
canvas.height = height;
|
|
if (autoResizeViewport) {
|
|
canvas.GLctxObject.GLctx.viewport(0, 0, width, height);
|
|
}
|
|
} else {
|
|
return -4;
|
|
}
|
|
return 0;
|
|
}
|
|
function _emscripten_set_canvas_element_size_main_thread(target, width, height) {
|
|
return _emscripten_set_canvas_element_size_calling_thread(target, width, height);
|
|
}
|
|
function _emscripten_set_canvas_element_size(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (canvas) return _emscripten_set_canvas_element_size_calling_thread(target, width, height);
|
|
else return _emscripten_set_canvas_element_size_main_thread(target, width, height);
|
|
}
|
|
function emscripten_set_canvas_element_size_js(target, width, height) {
|
|
if (typeof target === "string") {
|
|
var stackTop = stackSave();
|
|
var targetInt = stackAlloc(target.length + 1);
|
|
stringToUTF8(target, targetInt, target.length + 1);
|
|
var ret = _emscripten_set_canvas_element_size(targetInt, width, height);
|
|
stackRestore(stackTop);
|
|
return ret;
|
|
} else {
|
|
return _emscripten_set_canvas_element_size(target, width, height);
|
|
}
|
|
}
|
|
function _emscripten_get_canvas_element_size_calling_thread(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (!canvas) return -4;
|
|
if (canvas.canvasSharedPtr) {
|
|
var w = HEAP32[canvas.canvasSharedPtr >> 2];
|
|
var h = HEAP32[(canvas.canvasSharedPtr + 4) >> 2];
|
|
HEAP32[width >> 2] = w;
|
|
HEAP32[height >> 2] = h;
|
|
} else if (canvas.offscreenCanvas) {
|
|
HEAP32[width >> 2] = canvas.offscreenCanvas.width;
|
|
HEAP32[height >> 2] = canvas.offscreenCanvas.height;
|
|
} else if (!canvas.controlTransferredOffscreen) {
|
|
HEAP32[width >> 2] = canvas.width;
|
|
HEAP32[height >> 2] = canvas.height;
|
|
} else {
|
|
return -4;
|
|
}
|
|
return 0;
|
|
}
|
|
function _emscripten_get_canvas_element_size_main_thread(target, width, height) {
|
|
return _emscripten_get_canvas_element_size_calling_thread(target, width, height);
|
|
}
|
|
function _emscripten_get_canvas_element_size(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (canvas) return _emscripten_get_canvas_element_size_calling_thread(target, width, height);
|
|
else return _emscripten_get_canvas_element_size_main_thread(target, width, height);
|
|
}
|
|
function emscripten_get_canvas_element_size_js(target) {
|
|
var stackTop = stackSave();
|
|
var w = stackAlloc(8);
|
|
var h = w + 4;
|
|
if (typeof target === "string") {
|
|
var targetInt = stackAlloc(target.length + 1);
|
|
stringToUTF8(target, targetInt, target.length + 1);
|
|
target = targetInt;
|
|
}
|
|
var ret = _emscripten_get_canvas_element_size(target, w, h);
|
|
var size = [HEAP32[w >> 2], HEAP32[h >> 2]];
|
|
stackRestore(stackTop);
|
|
return size;
|
|
}
|
|
var JSEvents = {
|
|
keyEvent: 0,
|
|
mouseEvent: 0,
|
|
wheelEvent: 0,
|
|
uiEvent: 0,
|
|
focusEvent: 0,
|
|
deviceOrientationEvent: 0,
|
|
deviceMotionEvent: 0,
|
|
fullscreenChangeEvent: 0,
|
|
pointerlockChangeEvent: 0,
|
|
visibilityChangeEvent: 0,
|
|
touchEvent: 0,
|
|
lastGamepadState: null,
|
|
lastGamepadStateFrame: null,
|
|
numGamepadsConnected: 0,
|
|
previousFullscreenElement: null,
|
|
previousScreenX: null,
|
|
previousScreenY: null,
|
|
removeEventListenersRegistered: false,
|
|
_onGamepadConnected: function () {
|
|
++JSEvents.numGamepadsConnected;
|
|
},
|
|
_onGamepadDisconnected: function () {
|
|
--JSEvents.numGamepadsConnected;
|
|
},
|
|
staticInit: function () {
|
|
if (typeof window !== "undefined") {
|
|
window.addEventListener("gamepadconnected", JSEvents._onGamepadConnected);
|
|
window.addEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected);
|
|
var firstState = navigator.getGamepads ? navigator.getGamepads() : navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null;
|
|
if (firstState) {
|
|
JSEvents.numGamepadsConnected = firstState.length;
|
|
}
|
|
}
|
|
},
|
|
removeAllEventListeners: function () {
|
|
for (var i = JSEvents.eventHandlers.length - 1; i >= 0; --i) {
|
|
JSEvents._removeHandler(i);
|
|
}
|
|
JSEvents.eventHandlers = [];
|
|
JSEvents.deferredCalls = [];
|
|
window.removeEventListener("gamepadconnected", JSEvents._onGamepadConnected);
|
|
window.removeEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected);
|
|
},
|
|
registerRemoveEventListeners: function () {
|
|
if (!JSEvents.removeEventListenersRegistered) {
|
|
__ATEXIT__.push(JSEvents.removeAllEventListeners);
|
|
JSEvents.removeEventListenersRegistered = true;
|
|
}
|
|
},
|
|
findEventTarget: function (target) {
|
|
try {
|
|
if (!target) return window;
|
|
if (typeof target === "number") target = Pointer_stringify(target);
|
|
if (target === "#window") return window;
|
|
else if (target === "#document") return document;
|
|
else if (target === "#screen") return window.screen;
|
|
else if (target === "#canvas") return Module["canvas"];
|
|
return typeof target === "string" ? document.getElementById(target) : target;
|
|
} catch (e) {
|
|
return null;
|
|
}
|
|
},
|
|
findCanvasEventTarget: function (target) {
|
|
if (typeof target === "number") target = Pointer_stringify(target);
|
|
if (!target || target === "#canvas") {
|
|
if (typeof GL !== "undefined" && GL.offscreenCanvases["canvas"]) return GL.offscreenCanvases["canvas"];
|
|
return Module["canvas"];
|
|
}
|
|
if (typeof GL !== "undefined" && GL.offscreenCanvases[target]) return GL.offscreenCanvases[target];
|
|
return JSEvents.findEventTarget(target);
|
|
},
|
|
deferredCalls: [],
|
|
deferCall: function (targetFunction, precedence, argsList) {
|
|
function arraysHaveEqualContent(arrA, arrB) {
|
|
if (arrA.length != arrB.length) return false;
|
|
for (var i in arrA) {
|
|
if (arrA[i] != arrB[i]) return false;
|
|
}
|
|
return true;
|
|
}
|
|
for (var i in JSEvents.deferredCalls) {
|
|
var call = JSEvents.deferredCalls[i];
|
|
if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
|
|
return;
|
|
}
|
|
}
|
|
JSEvents.deferredCalls.push({ targetFunction: targetFunction, precedence: precedence, argsList: argsList });
|
|
JSEvents.deferredCalls.sort(function (x, y) {
|
|
return x.precedence < y.precedence;
|
|
});
|
|
},
|
|
removeDeferredCalls: function (targetFunction) {
|
|
for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
|
|
if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
|
|
JSEvents.deferredCalls.splice(i, 1);
|
|
--i;
|
|
}
|
|
}
|
|
},
|
|
canPerformEventHandlerRequests: function () {
|
|
return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
|
|
},
|
|
runDeferredCalls: function () {
|
|
if (!JSEvents.canPerformEventHandlerRequests()) {
|
|
return;
|
|
}
|
|
for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
|
|
var call = JSEvents.deferredCalls[i];
|
|
JSEvents.deferredCalls.splice(i, 1);
|
|
--i;
|
|
call.targetFunction.apply(this, call.argsList);
|
|
}
|
|
},
|
|
inEventHandler: 0,
|
|
currentEventHandler: null,
|
|
eventHandlers: [],
|
|
isInternetExplorer: function () {
|
|
return navigator.userAgent.indexOf("MSIE") !== -1 || navigator.appVersion.indexOf("Trident/") > 0;
|
|
},
|
|
removeAllHandlersOnTarget: function (target, eventTypeString) {
|
|
for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
|
|
if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
|
|
JSEvents._removeHandler(i--);
|
|
}
|
|
}
|
|
},
|
|
_removeHandler: function (i) {
|
|
var h = JSEvents.eventHandlers[i];
|
|
h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
|
|
JSEvents.eventHandlers.splice(i, 1);
|
|
},
|
|
registerOrRemoveHandler: function (eventHandler) {
|
|
var jsEventHandler = function jsEventHandler(event) {
|
|
++JSEvents.inEventHandler;
|
|
JSEvents.currentEventHandler = eventHandler;
|
|
JSEvents.runDeferredCalls();
|
|
eventHandler.handlerFunc(event);
|
|
JSEvents.runDeferredCalls();
|
|
--JSEvents.inEventHandler;
|
|
};
|
|
if (eventHandler.callbackfunc) {
|
|
eventHandler.eventListenerFunc = jsEventHandler;
|
|
eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
|
|
JSEvents.eventHandlers.push(eventHandler);
|
|
JSEvents.registerRemoveEventListeners();
|
|
} else {
|
|
for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
|
|
if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
|
|
JSEvents._removeHandler(i--);
|
|
}
|
|
}
|
|
}
|
|
},
|
|
registerKeyEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc(164);
|
|
var keyEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var keyEventData = JSEvents.keyEvent;
|
|
stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32);
|
|
stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32);
|
|
HEAP32[(keyEventData + 64) >> 2] = e.location;
|
|
HEAP32[(keyEventData + 68) >> 2] = e.ctrlKey;
|
|
HEAP32[(keyEventData + 72) >> 2] = e.shiftKey;
|
|
HEAP32[(keyEventData + 76) >> 2] = e.altKey;
|
|
HEAP32[(keyEventData + 80) >> 2] = e.metaKey;
|
|
HEAP32[(keyEventData + 84) >> 2] = e.repeat;
|
|
stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32);
|
|
stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32);
|
|
HEAP32[(keyEventData + 152) >> 2] = e.charCode;
|
|
HEAP32[(keyEventData + 156) >> 2] = e.keyCode;
|
|
HEAP32[(keyEventData + 160) >> 2] = e.which;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: keyEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
getBoundingClientRectOrZeros: function (target) {
|
|
return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
|
|
},
|
|
fillMouseEventData: function (eventStruct, e, target) {
|
|
HEAPF64[eventStruct >> 3] = JSEvents.tick();
|
|
HEAP32[(eventStruct + 8) >> 2] = e.screenX;
|
|
HEAP32[(eventStruct + 12) >> 2] = e.screenY;
|
|
HEAP32[(eventStruct + 16) >> 2] = e.clientX;
|
|
HEAP32[(eventStruct + 20) >> 2] = e.clientY;
|
|
HEAP32[(eventStruct + 24) >> 2] = e.ctrlKey;
|
|
HEAP32[(eventStruct + 28) >> 2] = e.shiftKey;
|
|
HEAP32[(eventStruct + 32) >> 2] = e.altKey;
|
|
HEAP32[(eventStruct + 36) >> 2] = e.metaKey;
|
|
HEAP16[(eventStruct + 40) >> 1] = e.button;
|
|
HEAP16[(eventStruct + 42) >> 1] = e.buttons;
|
|
HEAP32[(eventStruct + 44) >> 2] = e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || e.screenX - JSEvents.previousScreenX;
|
|
HEAP32[(eventStruct + 48) >> 2] = e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || e.screenY - JSEvents.previousScreenY;
|
|
if (Module["canvas"]) {
|
|
var rect = Module["canvas"].getBoundingClientRect();
|
|
HEAP32[(eventStruct + 60) >> 2] = e.clientX - rect.left;
|
|
HEAP32[(eventStruct + 64) >> 2] = e.clientY - rect.top;
|
|
} else {
|
|
HEAP32[(eventStruct + 60) >> 2] = 0;
|
|
HEAP32[(eventStruct + 64) >> 2] = 0;
|
|
}
|
|
if (target) {
|
|
var rect = JSEvents.getBoundingClientRectOrZeros(target);
|
|
HEAP32[(eventStruct + 52) >> 2] = e.clientX - rect.left;
|
|
HEAP32[(eventStruct + 56) >> 2] = e.clientY - rect.top;
|
|
} else {
|
|
HEAP32[(eventStruct + 52) >> 2] = 0;
|
|
HEAP32[(eventStruct + 56) >> 2] = 0;
|
|
}
|
|
if (e.type !== "wheel" && e.type !== "mousewheel") {
|
|
JSEvents.previousScreenX = e.screenX;
|
|
JSEvents.previousScreenY = e.screenY;
|
|
}
|
|
},
|
|
registerMouseEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc(72);
|
|
target = JSEvents.findEventTarget(target);
|
|
var mouseEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: eventTypeString != "mousemove" && eventTypeString != "mouseenter" && eventTypeString != "mouseleave", eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: mouseEventHandlerFunc, useCapture: useCapture };
|
|
if (JSEvents.isInternetExplorer() && eventTypeString == "mousedown") eventHandler.allowsDeferredCalls = false;
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
registerWheelEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc(104);
|
|
target = JSEvents.findEventTarget(target);
|
|
var wheelHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var wheelEvent = JSEvents.wheelEvent;
|
|
JSEvents.fillMouseEventData(wheelEvent, e, target);
|
|
HEAPF64[(wheelEvent + 72) >> 3] = e["deltaX"];
|
|
HEAPF64[(wheelEvent + 80) >> 3] = e["deltaY"];
|
|
HEAPF64[(wheelEvent + 88) >> 3] = e["deltaZ"];
|
|
HEAP32[(wheelEvent + 96) >> 2] = e["deltaMode"];
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault();
|
|
};
|
|
var mouseWheelHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
|
|
HEAPF64[(JSEvents.wheelEvent + 72) >> 3] = e["wheelDeltaX"] || 0;
|
|
HEAPF64[(JSEvents.wheelEvent + 80) >> 3] = -(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]);
|
|
HEAPF64[(JSEvents.wheelEvent + 88) >> 3] = 0;
|
|
HEAP32[(JSEvents.wheelEvent + 96) >> 2] = 0;
|
|
var shouldCancel = Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: true, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: eventTypeString == "wheel" ? wheelHandlerFunc : mouseWheelHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
pageScrollPos: function () {
|
|
if (window.pageXOffset > 0 || window.pageYOffset > 0) {
|
|
return [window.pageXOffset, window.pageYOffset];
|
|
}
|
|
if (typeof document.documentElement.scrollLeft !== "undefined" || typeof document.documentElement.scrollTop !== "undefined") {
|
|
return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
|
|
}
|
|
return [document.body.scrollLeft | 0, document.body.scrollTop | 0];
|
|
},
|
|
registerUiEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc(36);
|
|
if (eventTypeString == "scroll" && !target) {
|
|
target = document;
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
var uiEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
if (e.target != target) {
|
|
return;
|
|
}
|
|
var scrollPos = JSEvents.pageScrollPos();
|
|
var uiEvent = JSEvents.uiEvent;
|
|
HEAP32[uiEvent >> 2] = e.detail;
|
|
HEAP32[(uiEvent + 4) >> 2] = document.body.clientWidth;
|
|
HEAP32[(uiEvent + 8) >> 2] = document.body.clientHeight;
|
|
HEAP32[(uiEvent + 12) >> 2] = window.innerWidth;
|
|
HEAP32[(uiEvent + 16) >> 2] = window.innerHeight;
|
|
HEAP32[(uiEvent + 20) >> 2] = window.outerWidth;
|
|
HEAP32[(uiEvent + 24) >> 2] = window.outerHeight;
|
|
HEAP32[(uiEvent + 28) >> 2] = scrollPos[0];
|
|
HEAP32[(uiEvent + 32) >> 2] = scrollPos[1];
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: uiEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
getNodeNameForTarget: function (target) {
|
|
if (!target) return "";
|
|
if (target == window) return "#window";
|
|
if (target == window.screen) return "#screen";
|
|
return target && target.nodeName ? target.nodeName : "";
|
|
},
|
|
registerFocusEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc(256);
|
|
var focusEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var nodeName = JSEvents.getNodeNameForTarget(e.target);
|
|
var id = e.target.id ? e.target.id : "";
|
|
var focusEvent = JSEvents.focusEvent;
|
|
stringToUTF8(nodeName, focusEvent + 0, 128);
|
|
stringToUTF8(id, focusEvent + 128, 128);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: focusEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
tick: function () {
|
|
if (window["performance"] && window["performance"]["now"]) return window["performance"]["now"]();
|
|
else return Date.now();
|
|
},
|
|
fillDeviceOrientationEventData: function (eventStruct, e, target) {
|
|
HEAPF64[eventStruct >> 3] = JSEvents.tick();
|
|
HEAPF64[(eventStruct + 8) >> 3] = e.alpha;
|
|
HEAPF64[(eventStruct + 16) >> 3] = e.beta;
|
|
HEAPF64[(eventStruct + 24) >> 3] = e.gamma;
|
|
HEAP32[(eventStruct + 32) >> 2] = e.absolute;
|
|
},
|
|
registerDeviceOrientationEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.deviceOrientationEvent) JSEvents.deviceOrientationEvent = _malloc(40);
|
|
var deviceOrientationEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillDeviceOrientationEventData(JSEvents.deviceOrientationEvent, e, target);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: deviceOrientationEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
fillDeviceMotionEventData: function (eventStruct, e, target) {
|
|
HEAPF64[eventStruct >> 3] = JSEvents.tick();
|
|
HEAPF64[(eventStruct + 8) >> 3] = e.acceleration.x;
|
|
HEAPF64[(eventStruct + 16) >> 3] = e.acceleration.y;
|
|
HEAPF64[(eventStruct + 24) >> 3] = e.acceleration.z;
|
|
HEAPF64[(eventStruct + 32) >> 3] = e.accelerationIncludingGravity.x;
|
|
HEAPF64[(eventStruct + 40) >> 3] = e.accelerationIncludingGravity.y;
|
|
HEAPF64[(eventStruct + 48) >> 3] = e.accelerationIncludingGravity.z;
|
|
HEAPF64[(eventStruct + 56) >> 3] = e.rotationRate.alpha;
|
|
HEAPF64[(eventStruct + 64) >> 3] = e.rotationRate.beta;
|
|
HEAPF64[(eventStruct + 72) >> 3] = e.rotationRate.gamma;
|
|
},
|
|
registerDeviceMotionEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.deviceMotionEvent) JSEvents.deviceMotionEvent = _malloc(80);
|
|
var deviceMotionEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillDeviceMotionEventData(JSEvents.deviceMotionEvent, e, target);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: deviceMotionEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
screenOrientation: function () {
|
|
if (!window.screen) return undefined;
|
|
return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
|
|
},
|
|
fillOrientationChangeEventData: function (eventStruct, e) {
|
|
var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
|
|
var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
|
|
var orientationString = JSEvents.screenOrientation();
|
|
var orientation = orientations.indexOf(orientationString);
|
|
if (orientation == -1) {
|
|
orientation = orientations2.indexOf(orientationString);
|
|
}
|
|
HEAP32[eventStruct >> 2] = 1 << orientation;
|
|
HEAP32[(eventStruct + 4) >> 2] = window.orientation;
|
|
},
|
|
registerOrientationChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.orientationChangeEvent) JSEvents.orientationChangeEvent = _malloc(8);
|
|
if (!target) {
|
|
target = window.screen;
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
var orientationChangeEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var orientationChangeEvent = JSEvents.orientationChangeEvent;
|
|
JSEvents.fillOrientationChangeEventData(orientationChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, orientationChangeEvent, userData)) e.preventDefault();
|
|
};
|
|
if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
|
|
eventTypeString = "mozorientationchange";
|
|
}
|
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: orientationChangeEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
fullscreenEnabled: function () {
|
|
return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
|
|
},
|
|
fillFullscreenChangeEventData: function (eventStruct, e) {
|
|
var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
|
|
var isFullscreen = !!fullscreenElement;
|
|
HEAP32[eventStruct >> 2] = isFullscreen;
|
|
HEAP32[(eventStruct + 4) >> 2] = JSEvents.fullscreenEnabled();
|
|
var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
|
|
var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
|
|
var id = reportedElement && reportedElement.id ? reportedElement.id : "";
|
|
stringToUTF8(nodeName, eventStruct + 8, 128);
|
|
stringToUTF8(id, eventStruct + 136, 128);
|
|
HEAP32[(eventStruct + 264) >> 2] = reportedElement ? reportedElement.clientWidth : 0;
|
|
HEAP32[(eventStruct + 268) >> 2] = reportedElement ? reportedElement.clientHeight : 0;
|
|
HEAP32[(eventStruct + 272) >> 2] = screen.width;
|
|
HEAP32[(eventStruct + 276) >> 2] = screen.height;
|
|
if (isFullscreen) {
|
|
JSEvents.previousFullscreenElement = fullscreenElement;
|
|
}
|
|
},
|
|
registerFullscreenChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc(280);
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var fullscreenChangeEventhandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent;
|
|
JSEvents.fillFullscreenChangeEventData(fullscreenChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: fullscreenChangeEventhandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
resizeCanvasForFullscreen: function (target, strategy) {
|
|
var restoreOldStyle = __registerRestoreOldStyle(target);
|
|
var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
|
|
var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
|
|
var rect = target.getBoundingClientRect();
|
|
var windowedCssWidth = rect.right - rect.left;
|
|
var windowedCssHeight = rect.bottom - rect.top;
|
|
var canvasSize = emscripten_get_canvas_element_size_js(target.id);
|
|
var windowedRttWidth = canvasSize[0];
|
|
var windowedRttHeight = canvasSize[1];
|
|
if (strategy.scaleMode == 3) {
|
|
__setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
|
|
cssWidth = windowedCssWidth;
|
|
cssHeight = windowedCssHeight;
|
|
} else if (strategy.scaleMode == 2) {
|
|
if (cssWidth * windowedRttHeight < windowedRttWidth * cssHeight) {
|
|
var desiredCssHeight = (windowedRttHeight * cssWidth) / windowedRttWidth;
|
|
__setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
|
|
cssHeight = desiredCssHeight;
|
|
} else {
|
|
var desiredCssWidth = (windowedRttWidth * cssHeight) / windowedRttHeight;
|
|
__setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
|
|
cssWidth = desiredCssWidth;
|
|
}
|
|
}
|
|
if (!target.style.backgroundColor) target.style.backgroundColor = "black";
|
|
if (!document.body.style.backgroundColor) document.body.style.backgroundColor = "black";
|
|
target.style.width = cssWidth + "px";
|
|
target.style.height = cssHeight + "px";
|
|
if (strategy.filteringMode == 1) {
|
|
target.style.imageRendering = "optimizeSpeed";
|
|
target.style.imageRendering = "-moz-crisp-edges";
|
|
target.style.imageRendering = "-o-crisp-edges";
|
|
target.style.imageRendering = "-webkit-optimize-contrast";
|
|
target.style.imageRendering = "optimize-contrast";
|
|
target.style.imageRendering = "crisp-edges";
|
|
target.style.imageRendering = "pixelated";
|
|
}
|
|
var dpiScale = strategy.canvasResolutionScaleMode == 2 ? window.devicePixelRatio : 1;
|
|
if (strategy.canvasResolutionScaleMode != 0) {
|
|
var newWidth = (cssWidth * dpiScale) | 0;
|
|
var newHeight = (cssHeight * dpiScale) | 0;
|
|
if (!target.controlTransferredOffscreen) {
|
|
target.width = newWidth;
|
|
target.height = newHeight;
|
|
} else {
|
|
emscripten_set_canvas_element_size_js(target.id, newWidth, newHeight);
|
|
}
|
|
if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight);
|
|
}
|
|
return restoreOldStyle;
|
|
},
|
|
requestFullscreen: function (target, strategy) {
|
|
if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
|
|
JSEvents.resizeCanvasForFullscreen(target, strategy);
|
|
}
|
|
if (target.requestFullscreen) {
|
|
target.requestFullscreen();
|
|
} else if (target.msRequestFullscreen) {
|
|
target.msRequestFullscreen();
|
|
} else if (target.mozRequestFullScreen) {
|
|
target.mozRequestFullScreen();
|
|
} else if (target.mozRequestFullscreen) {
|
|
target.mozRequestFullscreen();
|
|
} else if (target.webkitRequestFullscreen) {
|
|
target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
|
|
} else {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") {
|
|
return -1;
|
|
} else {
|
|
return -3;
|
|
}
|
|
}
|
|
if (strategy.canvasResizedCallback) {
|
|
Module["dynCall_iiii"](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData);
|
|
}
|
|
return 0;
|
|
},
|
|
fillPointerlockChangeEventData: function (eventStruct, e) {
|
|
var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
|
|
var isPointerlocked = !!pointerLockElement;
|
|
HEAP32[eventStruct >> 2] = isPointerlocked;
|
|
var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
|
|
var id = pointerLockElement && pointerLockElement.id ? pointerLockElement.id : "";
|
|
stringToUTF8(nodeName, eventStruct + 4, 128);
|
|
stringToUTF8(id, eventStruct + 132, 128);
|
|
},
|
|
registerPointerlockChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc(260);
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var pointerlockChangeEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent;
|
|
JSEvents.fillPointerlockChangeEventData(pointerlockChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: pointerlockChangeEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
registerPointerlockErrorEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var pointerlockErrorEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: pointerlockErrorEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
requestPointerLock: function (target) {
|
|
if (target.requestPointerLock) {
|
|
target.requestPointerLock();
|
|
} else if (target.mozRequestPointerLock) {
|
|
target.mozRequestPointerLock();
|
|
} else if (target.webkitRequestPointerLock) {
|
|
target.webkitRequestPointerLock();
|
|
} else if (target.msRequestPointerLock) {
|
|
target.msRequestPointerLock();
|
|
} else {
|
|
if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
|
|
return -3;
|
|
} else {
|
|
return -1;
|
|
}
|
|
}
|
|
return 0;
|
|
},
|
|
fillVisibilityChangeEventData: function (eventStruct, e) {
|
|
var visibilityStates = ["hidden", "visible", "prerender", "unloaded"];
|
|
var visibilityState = visibilityStates.indexOf(document.visibilityState);
|
|
HEAP32[eventStruct >> 2] = document.hidden;
|
|
HEAP32[(eventStruct + 4) >> 2] = visibilityState;
|
|
},
|
|
registerVisibilityChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc(8);
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var visibilityChangeEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var visibilityChangeEvent = JSEvents.visibilityChangeEvent;
|
|
JSEvents.fillVisibilityChangeEventData(visibilityChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: visibilityChangeEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
registerTouchEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc(1684);
|
|
target = JSEvents.findEventTarget(target);
|
|
var touchEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var touches = {};
|
|
for (var i = 0; i < e.touches.length; ++i) {
|
|
var touch = e.touches[i];
|
|
touches[touch.identifier] = touch;
|
|
}
|
|
for (var i = 0; i < e.changedTouches.length; ++i) {
|
|
var touch = e.changedTouches[i];
|
|
touches[touch.identifier] = touch;
|
|
touch.changed = true;
|
|
}
|
|
for (var i = 0; i < e.targetTouches.length; ++i) {
|
|
var touch = e.targetTouches[i];
|
|
touches[touch.identifier].onTarget = true;
|
|
}
|
|
var touchEvent = JSEvents.touchEvent;
|
|
var ptr = touchEvent;
|
|
HEAP32[(ptr + 4) >> 2] = e.ctrlKey;
|
|
HEAP32[(ptr + 8) >> 2] = e.shiftKey;
|
|
HEAP32[(ptr + 12) >> 2] = e.altKey;
|
|
HEAP32[(ptr + 16) >> 2] = e.metaKey;
|
|
ptr += 20;
|
|
var canvasRect = Module["canvas"] ? Module["canvas"].getBoundingClientRect() : undefined;
|
|
var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
|
|
var numTouches = 0;
|
|
for (var i in touches) {
|
|
var t = touches[i];
|
|
HEAP32[ptr >> 2] = t.identifier;
|
|
HEAP32[(ptr + 4) >> 2] = t.screenX;
|
|
HEAP32[(ptr + 8) >> 2] = t.screenY;
|
|
HEAP32[(ptr + 12) >> 2] = t.clientX;
|
|
HEAP32[(ptr + 16) >> 2] = t.clientY;
|
|
HEAP32[(ptr + 20) >> 2] = t.pageX;
|
|
HEAP32[(ptr + 24) >> 2] = t.pageY;
|
|
HEAP32[(ptr + 28) >> 2] = t.changed;
|
|
HEAP32[(ptr + 32) >> 2] = t.onTarget;
|
|
if (canvasRect) {
|
|
HEAP32[(ptr + 44) >> 2] = t.clientX - canvasRect.left;
|
|
HEAP32[(ptr + 48) >> 2] = t.clientY - canvasRect.top;
|
|
} else {
|
|
HEAP32[(ptr + 44) >> 2] = 0;
|
|
HEAP32[(ptr + 48) >> 2] = 0;
|
|
}
|
|
HEAP32[(ptr + 36) >> 2] = t.clientX - targetRect.left;
|
|
HEAP32[(ptr + 40) >> 2] = t.clientY - targetRect.top;
|
|
ptr += 52;
|
|
if (++numTouches >= 32) {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[touchEvent >> 2] = numTouches;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: target, allowsDeferredCalls: eventTypeString == "touchstart" || eventTypeString == "touchend", eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: touchEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
fillGamepadEventData: function (eventStruct, e) {
|
|
HEAPF64[eventStruct >> 3] = e.timestamp;
|
|
for (var i = 0; i < e.axes.length; ++i) {
|
|
HEAPF64[(eventStruct + i * 8 + 16) >> 3] = e.axes[i];
|
|
}
|
|
for (var i = 0; i < e.buttons.length; ++i) {
|
|
if (typeof e.buttons[i] === "object") {
|
|
HEAPF64[(eventStruct + i * 8 + 528) >> 3] = e.buttons[i].value;
|
|
} else {
|
|
HEAPF64[(eventStruct + i * 8 + 528) >> 3] = e.buttons[i];
|
|
}
|
|
}
|
|
for (var i = 0; i < e.buttons.length; ++i) {
|
|
if (typeof e.buttons[i] === "object") {
|
|
HEAP32[(eventStruct + i * 4 + 1040) >> 2] = e.buttons[i].pressed;
|
|
} else {
|
|
HEAP32[(eventStruct + i * 4 + 1040) >> 2] = e.buttons[i] == 1;
|
|
}
|
|
}
|
|
HEAP32[(eventStruct + 1296) >> 2] = e.connected;
|
|
HEAP32[(eventStruct + 1300) >> 2] = e.index;
|
|
HEAP32[(eventStruct + 8) >> 2] = e.axes.length;
|
|
HEAP32[(eventStruct + 12) >> 2] = e.buttons.length;
|
|
stringToUTF8(e.id, eventStruct + 1304, 64);
|
|
stringToUTF8(e.mapping, eventStruct + 1368, 64);
|
|
},
|
|
registerGamepadEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc(1432);
|
|
var gamepadEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var gamepadEvent = JSEvents.gamepadEvent;
|
|
JSEvents.fillGamepadEventData(gamepadEvent, e.gamepad);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: true, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: gamepadEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
registerBeforeUnloadEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
var beforeUnloadEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var confirmationMessage = Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData);
|
|
if (confirmationMessage) {
|
|
confirmationMessage = Pointer_stringify(confirmationMessage);
|
|
}
|
|
if (confirmationMessage) {
|
|
e.preventDefault();
|
|
e.returnValue = confirmationMessage;
|
|
return confirmationMessage;
|
|
}
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: beforeUnloadEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
battery: function () {
|
|
return navigator.battery || navigator.mozBattery || navigator.webkitBattery;
|
|
},
|
|
fillBatteryEventData: function (eventStruct, e) {
|
|
HEAPF64[eventStruct >> 3] = e.chargingTime;
|
|
HEAPF64[(eventStruct + 8) >> 3] = e.dischargingTime;
|
|
HEAPF64[(eventStruct + 16) >> 3] = e.level;
|
|
HEAP32[(eventStruct + 24) >> 2] = e.charging;
|
|
},
|
|
registerBatteryEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.batteryEvent) JSEvents.batteryEvent = _malloc(32);
|
|
var batteryEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
var batteryEvent = JSEvents.batteryEvent;
|
|
JSEvents.fillBatteryEventData(batteryEvent, JSEvents.battery());
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, batteryEvent, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: batteryEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
registerWebGlEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!target) target = Module["canvas"];
|
|
var webGlEventHandlerFunc = function (event) {
|
|
var e = event || window.event;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData)) e.preventDefault();
|
|
};
|
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: webGlEventHandlerFunc, useCapture: useCapture };
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},
|
|
};
|
|
var __currentFullscreenStrategy = {};
|
|
function _emscripten_exit_fullscreen() {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
JSEvents.removeDeferredCalls(JSEvents.requestFullscreen);
|
|
if (document.exitFullscreen) {
|
|
document.exitFullscreen();
|
|
} else if (document.msExitFullscreen) {
|
|
document.msExitFullscreen();
|
|
} else if (document.mozCancelFullScreen) {
|
|
document.mozCancelFullScreen();
|
|
} else if (document.webkitExitFullscreen) {
|
|
document.webkitExitFullscreen();
|
|
} else {
|
|
return -1;
|
|
}
|
|
if (__currentFullscreenStrategy.canvasResizedCallback) {
|
|
Module["dynCall_iiii"](__currentFullscreenStrategy.canvasResizedCallback, 37, 0, __currentFullscreenStrategy.canvasResizedCallbackUserData);
|
|
}
|
|
return 0;
|
|
}
|
|
function _emscripten_exit_pointerlock() {
|
|
JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
|
|
if (document.exitPointerLock) {
|
|
document.exitPointerLock();
|
|
} else if (document.msExitPointerLock) {
|
|
document.msExitPointerLock();
|
|
} else if (document.mozExitPointerLock) {
|
|
document.mozExitPointerLock();
|
|
} else if (document.webkitExitPointerLock) {
|
|
document.webkitExitPointerLock();
|
|
} else {
|
|
return -1;
|
|
}
|
|
return 0;
|
|
}
|
|
function _emscripten_get_fullscreen_status(fullscreenStatus) {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
JSEvents.fillFullscreenChangeEventData(fullscreenStatus);
|
|
return 0;
|
|
}
|
|
function __emscripten_sample_gamepad_data() {
|
|
if (!JSEvents.numGamepadsConnected) return;
|
|
if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
|
|
JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null;
|
|
JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
|
|
}
|
|
}
|
|
function _emscripten_get_gamepad_status(index, gamepadState) {
|
|
__emscripten_sample_gamepad_data();
|
|
if (!JSEvents.lastGamepadState) return -1;
|
|
if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
|
|
if (!JSEvents.lastGamepadState[index]) return -7;
|
|
JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
|
|
return 0;
|
|
}
|
|
function _emscripten_get_main_loop_timing(mode, value) {
|
|
if (mode) HEAP32[mode >> 2] = Browser.mainLoop.timingMode;
|
|
if (value) HEAP32[value >> 2] = Browser.mainLoop.timingValue;
|
|
}
|
|
function _emscripten_get_num_gamepads() {
|
|
if (!JSEvents.numGamepadsConnected) return 0;
|
|
__emscripten_sample_gamepad_data();
|
|
if (!JSEvents.lastGamepadState) return -1;
|
|
return JSEvents.lastGamepadState.length;
|
|
}
|
|
function _emscripten_has_threading_support() {
|
|
return 0;
|
|
}
|
|
function _emscripten_html5_remove_all_event_listeners() {
|
|
JSEvents.removeAllEventListeners();
|
|
}
|
|
function _emscripten_is_webgl_context_lost(target) {
|
|
if (!Module.ctx) return true;
|
|
return Module.ctx.isContextLost();
|
|
}
|
|
function __reallyNegative(x) {
|
|
return x < 0 || (x === 0 && 1 / x === -Infinity);
|
|
}
|
|
function __formatString(format, varargs) {
|
|
assert((varargs & 3) === 0);
|
|
var textIndex = format;
|
|
var argIndex = varargs;
|
|
function prepVararg(ptr, type) {
|
|
if (type === "double" || type === "i64") {
|
|
if (ptr & 7) {
|
|
assert((ptr & 7) === 4);
|
|
ptr += 4;
|
|
}
|
|
} else {
|
|
assert((ptr & 3) === 0);
|
|
}
|
|
return ptr;
|
|
}
|
|
function getNextArg(type) {
|
|
var ret;
|
|
argIndex = prepVararg(argIndex, type);
|
|
if (type === "double") {
|
|
ret = HEAPF64[argIndex >> 3];
|
|
argIndex += 8;
|
|
} else if (type == "i64") {
|
|
ret = [HEAP32[argIndex >> 2], HEAP32[(argIndex + 4) >> 2]];
|
|
argIndex += 8;
|
|
} else {
|
|
assert((argIndex & 3) === 0);
|
|
type = "i32";
|
|
ret = HEAP32[argIndex >> 2];
|
|
argIndex += 4;
|
|
}
|
|
return ret;
|
|
}
|
|
var ret = [];
|
|
var curr, next, currArg;
|
|
while (1) {
|
|
var startTextIndex = textIndex;
|
|
curr = HEAP8[textIndex >> 0];
|
|
if (curr === 0) break;
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
if (curr == 37) {
|
|
var flagAlwaysSigned = false;
|
|
var flagLeftAlign = false;
|
|
var flagAlternative = false;
|
|
var flagZeroPad = false;
|
|
var flagPadSign = false;
|
|
flagsLoop: while (1) {
|
|
switch (next) {
|
|
case 43:
|
|
flagAlwaysSigned = true;
|
|
break;
|
|
case 45:
|
|
flagLeftAlign = true;
|
|
break;
|
|
case 35:
|
|
flagAlternative = true;
|
|
break;
|
|
case 48:
|
|
if (flagZeroPad) {
|
|
break flagsLoop;
|
|
} else {
|
|
flagZeroPad = true;
|
|
break;
|
|
}
|
|
case 32:
|
|
flagPadSign = true;
|
|
break;
|
|
default:
|
|
break flagsLoop;
|
|
}
|
|
textIndex++;
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
}
|
|
var width = 0;
|
|
if (next == 42) {
|
|
width = getNextArg("i32");
|
|
textIndex++;
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
} else {
|
|
while (next >= 48 && next <= 57) {
|
|
width = width * 10 + (next - 48);
|
|
textIndex++;
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
}
|
|
}
|
|
var precisionSet = false,
|
|
precision = -1;
|
|
if (next == 46) {
|
|
precision = 0;
|
|
precisionSet = true;
|
|
textIndex++;
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
if (next == 42) {
|
|
precision = getNextArg("i32");
|
|
textIndex++;
|
|
} else {
|
|
while (1) {
|
|
var precisionChr = HEAP8[(textIndex + 1) >> 0];
|
|
if (precisionChr < 48 || precisionChr > 57) break;
|
|
precision = precision * 10 + (precisionChr - 48);
|
|
textIndex++;
|
|
}
|
|
}
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
}
|
|
if (precision < 0) {
|
|
precision = 6;
|
|
precisionSet = false;
|
|
}
|
|
var argSize;
|
|
switch (String.fromCharCode(next)) {
|
|
case "h":
|
|
var nextNext = HEAP8[(textIndex + 2) >> 0];
|
|
if (nextNext == 104) {
|
|
textIndex++;
|
|
argSize = 1;
|
|
} else {
|
|
argSize = 2;
|
|
}
|
|
break;
|
|
case "l":
|
|
var nextNext = HEAP8[(textIndex + 2) >> 0];
|
|
if (nextNext == 108) {
|
|
textIndex++;
|
|
argSize = 8;
|
|
} else {
|
|
argSize = 4;
|
|
}
|
|
break;
|
|
case "L":
|
|
case "q":
|
|
case "j":
|
|
argSize = 8;
|
|
break;
|
|
case "z":
|
|
case "t":
|
|
case "I":
|
|
argSize = 4;
|
|
break;
|
|
default:
|
|
argSize = null;
|
|
}
|
|
if (argSize) textIndex++;
|
|
next = HEAP8[(textIndex + 1) >> 0];
|
|
switch (String.fromCharCode(next)) {
|
|
case "d":
|
|
case "i":
|
|
case "u":
|
|
case "o":
|
|
case "x":
|
|
case "X":
|
|
case "p": {
|
|
var signed = next == 100 || next == 105;
|
|
argSize = argSize || 4;
|
|
currArg = getNextArg("i" + argSize * 8);
|
|
var origArg = currArg;
|
|
var argText;
|
|
if (argSize == 8) {
|
|
currArg = makeBigInt(currArg[0], currArg[1], next == 117);
|
|
}
|
|
if (argSize <= 4) {
|
|
var limit = Math.pow(256, argSize) - 1;
|
|
currArg = (signed ? reSign : unSign)(currArg & limit, argSize * 8);
|
|
}
|
|
var currAbsArg = Math.abs(currArg);
|
|
var prefix = "";
|
|
if (next == 100 || next == 105) {
|
|
if (argSize == 8 && typeof i64Math === "object") argText = i64Math.stringify(origArg[0], origArg[1], null);
|
|
else argText = reSign(currArg, 8 * argSize, 1).toString(10);
|
|
} else if (next == 117) {
|
|
if (argSize == 8 && typeof i64Math === "object") argText = i64Math.stringify(origArg[0], origArg[1], true);
|
|
else argText = unSign(currArg, 8 * argSize, 1).toString(10);
|
|
currArg = Math.abs(currArg);
|
|
} else if (next == 111) {
|
|
argText = (flagAlternative ? "0" : "") + currAbsArg.toString(8);
|
|
} else if (next == 120 || next == 88) {
|
|
prefix = flagAlternative && currArg != 0 ? "0x" : "";
|
|
if (argSize == 8 && typeof i64Math === "object") {
|
|
if (origArg[1]) {
|
|
argText = (origArg[1] >>> 0).toString(16);
|
|
var lower = (origArg[0] >>> 0).toString(16);
|
|
while (lower.length < 8) lower = "0" + lower;
|
|
argText += lower;
|
|
} else {
|
|
argText = (origArg[0] >>> 0).toString(16);
|
|
}
|
|
} else if (currArg < 0) {
|
|
currArg = -currArg;
|
|
argText = (currAbsArg - 1).toString(16);
|
|
var buffer = [];
|
|
for (var i = 0; i < argText.length; i++) {
|
|
buffer.push((15 - parseInt(argText[i], 16)).toString(16));
|
|
}
|
|
argText = buffer.join("");
|
|
while (argText.length < argSize * 2) argText = "f" + argText;
|
|
} else {
|
|
argText = currAbsArg.toString(16);
|
|
}
|
|
if (next == 88) {
|
|
prefix = prefix.toUpperCase();
|
|
argText = argText.toUpperCase();
|
|
}
|
|
} else if (next == 112) {
|
|
if (currAbsArg === 0) {
|
|
argText = "(nil)";
|
|
} else {
|
|
prefix = "0x";
|
|
argText = currAbsArg.toString(16);
|
|
}
|
|
}
|
|
if (precisionSet) {
|
|
while (argText.length < precision) {
|
|
argText = "0" + argText;
|
|
}
|
|
}
|
|
if (currArg >= 0) {
|
|
if (flagAlwaysSigned) {
|
|
prefix = "+" + prefix;
|
|
} else if (flagPadSign) {
|
|
prefix = " " + prefix;
|
|
}
|
|
}
|
|
if (argText.charAt(0) == "-") {
|
|
prefix = "-" + prefix;
|
|
argText = argText.substr(1);
|
|
}
|
|
while (prefix.length + argText.length < width) {
|
|
if (flagLeftAlign) {
|
|
argText += " ";
|
|
} else {
|
|
if (flagZeroPad) {
|
|
argText = "0" + argText;
|
|
} else {
|
|
prefix = " " + prefix;
|
|
}
|
|
}
|
|
}
|
|
argText = prefix + argText;
|
|
argText.split("").forEach(function (chr) {
|
|
ret.push(chr.charCodeAt(0));
|
|
});
|
|
break;
|
|
}
|
|
case "f":
|
|
case "F":
|
|
case "e":
|
|
case "E":
|
|
case "g":
|
|
case "G": {
|
|
currArg = getNextArg("double");
|
|
var argText;
|
|
if (isNaN(currArg)) {
|
|
argText = "nan";
|
|
flagZeroPad = false;
|
|
} else if (!isFinite(currArg)) {
|
|
argText = (currArg < 0 ? "-" : "") + "inf";
|
|
flagZeroPad = false;
|
|
} else {
|
|
var isGeneral = false;
|
|
var effectivePrecision = Math.min(precision, 20);
|
|
if (next == 103 || next == 71) {
|
|
isGeneral = true;
|
|
precision = precision || 1;
|
|
var exponent = parseInt(currArg.toExponential(effectivePrecision).split("e")[1], 10);
|
|
if (precision > exponent && exponent >= -4) {
|
|
next = (next == 103 ? "f" : "F").charCodeAt(0);
|
|
precision -= exponent + 1;
|
|
} else {
|
|
next = (next == 103 ? "e" : "E").charCodeAt(0);
|
|
precision--;
|
|
}
|
|
effectivePrecision = Math.min(precision, 20);
|
|
}
|
|
if (next == 101 || next == 69) {
|
|
argText = currArg.toExponential(effectivePrecision);
|
|
if (/[eE][-+]\d$/.test(argText)) {
|
|
argText = argText.slice(0, -1) + "0" + argText.slice(-1);
|
|
}
|
|
} else if (next == 102 || next == 70) {
|
|
argText = currArg.toFixed(effectivePrecision);
|
|
if (currArg === 0 && __reallyNegative(currArg)) {
|
|
argText = "-" + argText;
|
|
}
|
|
}
|
|
var parts = argText.split("e");
|
|
if (isGeneral && !flagAlternative) {
|
|
while (parts[0].length > 1 && parts[0].indexOf(".") != -1 && (parts[0].slice(-1) == "0" || parts[0].slice(-1) == ".")) {
|
|
parts[0] = parts[0].slice(0, -1);
|
|
}
|
|
} else {
|
|
if (flagAlternative && argText.indexOf(".") == -1) parts[0] += ".";
|
|
while (precision > effectivePrecision++) parts[0] += "0";
|
|
}
|
|
argText = parts[0] + (parts.length > 1 ? "e" + parts[1] : "");
|
|
if (next == 69) argText = argText.toUpperCase();
|
|
if (currArg >= 0) {
|
|
if (flagAlwaysSigned) {
|
|
argText = "+" + argText;
|
|
} else if (flagPadSign) {
|
|
argText = " " + argText;
|
|
}
|
|
}
|
|
}
|
|
while (argText.length < width) {
|
|
if (flagLeftAlign) {
|
|
argText += " ";
|
|
} else {
|
|
if (flagZeroPad && (argText[0] == "-" || argText[0] == "+")) {
|
|
argText = argText[0] + "0" + argText.slice(1);
|
|
} else {
|
|
argText = (flagZeroPad ? "0" : " ") + argText;
|
|
}
|
|
}
|
|
}
|
|
if (next < 97) argText = argText.toUpperCase();
|
|
argText.split("").forEach(function (chr) {
|
|
ret.push(chr.charCodeAt(0));
|
|
});
|
|
break;
|
|
}
|
|
case "s": {
|
|
var arg = getNextArg("i8*");
|
|
var argLength = arg ? _strlen(arg) : "(null)".length;
|
|
if (precisionSet) argLength = Math.min(argLength, precision);
|
|
if (!flagLeftAlign) {
|
|
while (argLength < width--) {
|
|
ret.push(32);
|
|
}
|
|
}
|
|
if (arg) {
|
|
for (var i = 0; i < argLength; i++) {
|
|
ret.push(HEAPU8[arg++ >> 0]);
|
|
}
|
|
} else {
|
|
ret = ret.concat(intArrayFromString("(null)".substr(0, argLength), true));
|
|
}
|
|
if (flagLeftAlign) {
|
|
while (argLength < width--) {
|
|
ret.push(32);
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case "c": {
|
|
if (flagLeftAlign) ret.push(getNextArg("i8"));
|
|
while (--width > 0) {
|
|
ret.push(32);
|
|
}
|
|
if (!flagLeftAlign) ret.push(getNextArg("i8"));
|
|
break;
|
|
}
|
|
case "n": {
|
|
var ptr = getNextArg("i32*");
|
|
HEAP32[ptr >> 2] = ret.length;
|
|
break;
|
|
}
|
|
case "%": {
|
|
ret.push(curr);
|
|
break;
|
|
}
|
|
default: {
|
|
for (var i = startTextIndex; i < textIndex + 2; i++) {
|
|
ret.push(HEAP8[i >> 0]);
|
|
}
|
|
}
|
|
}
|
|
textIndex += 2;
|
|
} else {
|
|
ret.push(curr);
|
|
textIndex += 1;
|
|
}
|
|
}
|
|
return ret;
|
|
}
|
|
function __emscripten_traverse_stack(args) {
|
|
if (!args || !args.callee || !args.callee.name) {
|
|
return [null, "", ""];
|
|
}
|
|
var funstr = args.callee.toString();
|
|
var funcname = args.callee.name;
|
|
var str = "(";
|
|
var first = true;
|
|
for (var i in args) {
|
|
var a = args[i];
|
|
if (!first) {
|
|
str += ", ";
|
|
}
|
|
first = false;
|
|
if (typeof a === "number" || typeof a === "string") {
|
|
str += a;
|
|
} else {
|
|
str += "(" + typeof a + ")";
|
|
}
|
|
}
|
|
str += ")";
|
|
var caller = args.callee.caller;
|
|
args = caller ? caller.arguments : [];
|
|
if (first) str = "";
|
|
return [args, funcname, str];
|
|
}
|
|
function _emscripten_get_callstack_js(flags) {
|
|
var callstack = jsStackTrace();
|
|
var iThisFunc = callstack.lastIndexOf("_emscripten_log");
|
|
var iThisFunc2 = callstack.lastIndexOf("_emscripten_get_callstack");
|
|
var iNextLine = callstack.indexOf("\n", Math.max(iThisFunc, iThisFunc2)) + 1;
|
|
callstack = callstack.slice(iNextLine);
|
|
if (flags & 8 && typeof emscripten_source_map === "undefined") {
|
|
warnOnce('Source map information is not available, emscripten_log with EM_LOG_C_STACK will be ignored. Build with "--pre-js $EMSCRIPTEN/src/emscripten-source-map.min.js" linker flag to add source map loading to code.');
|
|
flags ^= 8;
|
|
flags |= 16;
|
|
}
|
|
var stack_args = null;
|
|
if (flags & 128) {
|
|
stack_args = __emscripten_traverse_stack(arguments);
|
|
while (stack_args[1].indexOf("_emscripten_") >= 0) stack_args = __emscripten_traverse_stack(stack_args[0]);
|
|
}
|
|
var lines = callstack.split("\n");
|
|
callstack = "";
|
|
var newFirefoxRe = new RegExp("\\s*(.*?)@(.*?):([0-9]+):([0-9]+)");
|
|
var firefoxRe = new RegExp("\\s*(.*?)@(.*):(.*)(:(.*))?");
|
|
var chromeRe = new RegExp("\\s*at (.*?) \\((.*):(.*):(.*)\\)");
|
|
for (var l in lines) {
|
|
var line = lines[l];
|
|
var jsSymbolName = "";
|
|
var file = "";
|
|
var lineno = 0;
|
|
var column = 0;
|
|
var parts = chromeRe.exec(line);
|
|
if (parts && parts.length == 5) {
|
|
jsSymbolName = parts[1];
|
|
file = parts[2];
|
|
lineno = parts[3];
|
|
column = parts[4];
|
|
} else {
|
|
parts = newFirefoxRe.exec(line);
|
|
if (!parts) parts = firefoxRe.exec(line);
|
|
if (parts && parts.length >= 4) {
|
|
jsSymbolName = parts[1];
|
|
file = parts[2];
|
|
lineno = parts[3];
|
|
column = parts[4] | 0;
|
|
} else {
|
|
callstack += line + "\n";
|
|
continue;
|
|
}
|
|
}
|
|
var cSymbolName = flags & 32 ? demangle(jsSymbolName) : jsSymbolName;
|
|
if (!cSymbolName) {
|
|
cSymbolName = jsSymbolName;
|
|
}
|
|
var haveSourceMap = false;
|
|
if (flags & 8) {
|
|
var orig = emscripten_source_map.originalPositionFor({ line: lineno, column: column });
|
|
haveSourceMap = orig && orig.source;
|
|
if (haveSourceMap) {
|
|
if (flags & 64) {
|
|
orig.source = orig.source.substring(orig.source.replace(/\\/g, "/").lastIndexOf("/") + 1);
|
|
}
|
|
callstack += " at " + cSymbolName + " (" + orig.source + ":" + orig.line + ":" + orig.column + ")\n";
|
|
}
|
|
}
|
|
if (flags & 16 || !haveSourceMap) {
|
|
if (flags & 64) {
|
|
file = file.substring(file.replace(/\\/g, "/").lastIndexOf("/") + 1);
|
|
}
|
|
callstack += (haveSourceMap ? " = " + jsSymbolName : " at " + cSymbolName) + " (" + file + ":" + lineno + ":" + column + ")\n";
|
|
}
|
|
if (flags & 128 && stack_args[0]) {
|
|
if (stack_args[1] == jsSymbolName && stack_args[2].length > 0) {
|
|
callstack = callstack.replace(/\s+$/, "");
|
|
callstack += " with values: " + stack_args[1] + stack_args[2] + "\n";
|
|
}
|
|
stack_args = __emscripten_traverse_stack(stack_args[0]);
|
|
}
|
|
}
|
|
callstack = callstack.replace(/\s+$/, "");
|
|
return callstack;
|
|
}
|
|
function _emscripten_log_js(flags, str) {
|
|
if (flags & 24) {
|
|
str = str.replace(/\s+$/, "");
|
|
str += (str.length > 0 ? "\n" : "") + _emscripten_get_callstack_js(flags);
|
|
}
|
|
if (flags & 1) {
|
|
if (flags & 4) {
|
|
console.error(str);
|
|
} else if (flags & 2) {
|
|
console.warn(str);
|
|
} else {
|
|
console.log(str);
|
|
}
|
|
} else if (flags & 6) {
|
|
err(str);
|
|
} else {
|
|
out(str);
|
|
}
|
|
}
|
|
function _emscripten_log(flags, varargs) {
|
|
var format = HEAP32[varargs >> 2];
|
|
varargs += 4;
|
|
var str = "";
|
|
if (format) {
|
|
var result = __formatString(format, varargs);
|
|
for (var i = 0; i < result.length; ++i) {
|
|
str += String.fromCharCode(result[i]);
|
|
}
|
|
}
|
|
_emscripten_log_js(flags, str);
|
|
}
|
|
function _longjmp(env, value) {
|
|
Module["setThrew"](env, value || 1);
|
|
throw "longjmp";
|
|
}
|
|
function _emscripten_longjmp(env, value) {
|
|
_longjmp(env, value);
|
|
}
|
|
function _emscripten_num_logical_cores() {
|
|
return 1;
|
|
}
|
|
function __setLetterbox(element, topBottom, leftRight) {
|
|
if (JSEvents.isInternetExplorer()) {
|
|
element.style.marginLeft = element.style.marginRight = leftRight + "px";
|
|
element.style.marginTop = element.style.marginBottom = topBottom + "px";
|
|
} else {
|
|
element.style.paddingLeft = element.style.paddingRight = leftRight + "px";
|
|
element.style.paddingTop = element.style.paddingBottom = topBottom + "px";
|
|
}
|
|
}
|
|
function __emscripten_do_request_fullscreen(target, strategy) {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
if (!JSEvents.fullscreenEnabled()) return -3;
|
|
if (!target) target = "#canvas";
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
if (!target.requestFullscreen && !target.msRequestFullscreen && !target.mozRequestFullScreen && !target.mozRequestFullscreen && !target.webkitRequestFullscreen) {
|
|
return -3;
|
|
}
|
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
|
|
if (!canPerformRequests) {
|
|
if (strategy.deferUntilInEventHandler) {
|
|
JSEvents.deferCall(JSEvents.requestFullscreen, 1, [target, strategy]);
|
|
return 1;
|
|
} else {
|
|
return -2;
|
|
}
|
|
}
|
|
return JSEvents.requestFullscreen(target, strategy);
|
|
}
|
|
function _emscripten_request_fullscreen(target, deferUntilInEventHandler) {
|
|
var strategy = {};
|
|
strategy.scaleMode = 0;
|
|
strategy.canvasResolutionScaleMode = 0;
|
|
strategy.filteringMode = 0;
|
|
strategy.deferUntilInEventHandler = deferUntilInEventHandler;
|
|
strategy.canvasResizedCallbackTargetThread = 2;
|
|
return __emscripten_do_request_fullscreen(target, strategy);
|
|
}
|
|
function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
|
|
if (!target) target = "#canvas";
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
|
|
return -1;
|
|
}
|
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
|
|
if (!canPerformRequests) {
|
|
if (deferUntilInEventHandler) {
|
|
JSEvents.deferCall(JSEvents.requestPointerLock, 2, [target]);
|
|
return 1;
|
|
} else {
|
|
return -2;
|
|
}
|
|
}
|
|
return JSEvents.requestPointerLock(target);
|
|
}
|
|
function _emscripten_set_blur_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerFocusEventCallback(target, userData, useCapture, callbackfunc, 12, "blur", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_dblclick_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 7, "dblclick", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_devicemotion_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerDeviceMotionEventCallback(window, userData, useCapture, callbackfunc, 17, "devicemotion", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_deviceorientation_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerDeviceOrientationEventCallback(window, userData, useCapture, callbackfunc, 16, "deviceorientation", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_focus_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerFocusEventCallback(target, userData, useCapture, callbackfunc, 13, "focus", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
if (!target) target = document;
|
|
else {
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
}
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread);
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange", targetThread);
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread);
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
|
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
|
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_keydown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 2, "keydown", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_keyup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 3, "keyup", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_mousedown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 5, "mousedown", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_mousemove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 8, "mousemove", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_mouseup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 6, "mouseup", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread);
|
|
return 0;
|
|
}
|
|
function _emscripten_set_wheel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
target = JSEvents.findEventTarget(target);
|
|
if (typeof target.onwheel !== "undefined") {
|
|
JSEvents.registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "wheel", targetThread);
|
|
return 0;
|
|
} else if (typeof target.onmousewheel !== "undefined") {
|
|
JSEvents.registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "mousewheel", targetThread);
|
|
return 0;
|
|
} else {
|
|
return -1;
|
|
}
|
|
}
|
|
var GL = {
|
|
counter: 1,
|
|
lastError: 0,
|
|
buffers: [],
|
|
mappedBuffers: {},
|
|
programs: [],
|
|
framebuffers: [],
|
|
renderbuffers: [],
|
|
textures: [],
|
|
uniforms: [],
|
|
shaders: [],
|
|
vaos: [],
|
|
contexts: [],
|
|
currentContext: null,
|
|
offscreenCanvases: {},
|
|
timerQueriesEXT: [],
|
|
queries: [],
|
|
samplers: [],
|
|
transformFeedbacks: [],
|
|
syncs: [],
|
|
byteSizeByTypeRoot: 5120,
|
|
byteSizeByType: [1, 1, 2, 2, 4, 4, 4, 2, 3, 4, 8],
|
|
programInfos: {},
|
|
stringCache: {},
|
|
stringiCache: {},
|
|
tempFixedLengthArray: [],
|
|
packAlignment: 4,
|
|
unpackAlignment: 4,
|
|
init: function () {
|
|
GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
|
|
for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
|
|
GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i + 1);
|
|
}
|
|
for (var i = 0; i < 32; i++) {
|
|
GL.tempFixedLengthArray.push(new Array(i));
|
|
}
|
|
},
|
|
recordError: function recordError(errorCode) {
|
|
if (!GL.lastError) {
|
|
GL.lastError = errorCode;
|
|
}
|
|
},
|
|
getNewId: function (table) {
|
|
var ret = GL.counter++;
|
|
for (var i = table.length; i < ret; i++) {
|
|
table[i] = null;
|
|
}
|
|
return ret;
|
|
},
|
|
MINI_TEMP_BUFFER_SIZE: 256,
|
|
miniTempBuffer: null,
|
|
miniTempBufferViews: [0],
|
|
getSource: function (shader, count, string, length) {
|
|
var source = "";
|
|
for (var i = 0; i < count; ++i) {
|
|
var frag;
|
|
if (length) {
|
|
var len = HEAP32[(length + i * 4) >> 2];
|
|
if (len < 0) {
|
|
frag = Pointer_stringify(HEAP32[(string + i * 4) >> 2]);
|
|
} else {
|
|
frag = Pointer_stringify(HEAP32[(string + i * 4) >> 2], len);
|
|
}
|
|
} else {
|
|
frag = Pointer_stringify(HEAP32[(string + i * 4) >> 2]);
|
|
}
|
|
source += frag;
|
|
}
|
|
return source;
|
|
},
|
|
createContext: function (canvas, webGLContextAttributes) {
|
|
if (typeof webGLContextAttributes["majorVersion"] === "undefined" && typeof webGLContextAttributes["minorVersion"] === "undefined") {
|
|
if (typeof WebGL2RenderingContext !== "undefined") webGLContextAttributes["majorVersion"] = 2;
|
|
else webGLContextAttributes["majorVersion"] = 1;
|
|
webGLContextAttributes["minorVersion"] = 0;
|
|
}
|
|
var ctx;
|
|
var errorInfo = "?";
|
|
function onContextCreationError(event) {
|
|
errorInfo = event.statusMessage || errorInfo;
|
|
}
|
|
webGLContextAttributes["powerPreference"] = "high-performance";
|
|
try {
|
|
canvas.addEventListener("webglcontextcreationerror", onContextCreationError, false);
|
|
try {
|
|
if (webGLContextAttributes["majorVersion"] == 1 && webGLContextAttributes["minorVersion"] == 0) {
|
|
ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
|
|
} else if (webGLContextAttributes["majorVersion"] == 2 && webGLContextAttributes["minorVersion"] == 0) {
|
|
ctx = canvas.getContext("webgl2", webGLContextAttributes);
|
|
} else {
|
|
throw "Unsupported WebGL context version " + majorVersion + "." + minorVersion + "!";
|
|
}
|
|
} finally {
|
|
canvas.removeEventListener("webglcontextcreationerror", onContextCreationError, false);
|
|
}
|
|
if (!ctx) throw ":(";
|
|
} catch (e) {
|
|
out("Could not create canvas: " + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
|
|
return 0;
|
|
}
|
|
if (!ctx) return 0;
|
|
var context = GL.registerContext(ctx, webGLContextAttributes);
|
|
return context;
|
|
},
|
|
registerContext: function (ctx, webGLContextAttributes) {
|
|
var handle = _malloc(8);
|
|
HEAP32[handle >> 2] = webGLContextAttributes["explicitSwapControl"];
|
|
var context = { handle: handle, attributes: webGLContextAttributes, version: webGLContextAttributes["majorVersion"], GLctx: ctx };
|
|
function getChromeVersion() {
|
|
var raw = navigator.userAgent.match(/Chrom(e|ium)\/([0-9]+)\./);
|
|
return raw ? parseInt(raw[2], 10) : false;
|
|
}
|
|
context.supportsWebGL2EntryPoints = context.version >= 2 && (getChromeVersion() === false || getChromeVersion() >= 58);
|
|
if (ctx.canvas) ctx.canvas.GLctxObject = context;
|
|
GL.contexts[handle] = context;
|
|
if (typeof webGLContextAttributes["enableExtensionsByDefault"] === "undefined" || webGLContextAttributes["enableExtensionsByDefault"]) {
|
|
GL.initExtensions(context);
|
|
}
|
|
if (webGLContextAttributes["renderViaOffscreenBackBuffer"]) {
|
|
return 0;
|
|
}
|
|
return handle;
|
|
},
|
|
makeContextCurrent: function (contextHandle) {
|
|
if (!contextHandle) {
|
|
GLctx = Module.ctx = GL.currentContext = null;
|
|
return true;
|
|
}
|
|
var context = GL.contexts[contextHandle];
|
|
if (!context) {
|
|
return false;
|
|
}
|
|
GLctx = Module.ctx = context.GLctx;
|
|
GL.currentContext = context;
|
|
return true;
|
|
},
|
|
getContext: function (contextHandle) {
|
|
return GL.contexts[contextHandle];
|
|
},
|
|
deleteContext: function (contextHandle) {
|
|
if (!contextHandle) return;
|
|
if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
|
|
if (typeof JSEvents === "object") JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);
|
|
if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined;
|
|
_free(GL.contexts[contextHandle]);
|
|
GL.contexts[contextHandle] = null;
|
|
},
|
|
initExtensions: function (context) {
|
|
if (!context) context = GL.currentContext;
|
|
if (context.initExtensionsDone) return;
|
|
context.initExtensionsDone = true;
|
|
var GLctx = context.GLctx;
|
|
context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
|
|
if (context.version < 2) {
|
|
var instancedArraysExt = GLctx.getExtension("ANGLE_instanced_arrays");
|
|
if (instancedArraysExt) {
|
|
GLctx["vertexAttribDivisor"] = function (index, divisor) {
|
|
instancedArraysExt["vertexAttribDivisorANGLE"](index, divisor);
|
|
};
|
|
GLctx["drawArraysInstanced"] = function (mode, first, count, primcount) {
|
|
instancedArraysExt["drawArraysInstancedANGLE"](mode, first, count, primcount);
|
|
};
|
|
GLctx["drawElementsInstanced"] = function (mode, count, type, indices, primcount) {
|
|
instancedArraysExt["drawElementsInstancedANGLE"](mode, count, type, indices, primcount);
|
|
};
|
|
}
|
|
var vaoExt = GLctx.getExtension("OES_vertex_array_object");
|
|
if (vaoExt) {
|
|
GLctx["createVertexArray"] = function () {
|
|
return vaoExt["createVertexArrayOES"]();
|
|
};
|
|
GLctx["deleteVertexArray"] = function (vao) {
|
|
vaoExt["deleteVertexArrayOES"](vao);
|
|
};
|
|
GLctx["bindVertexArray"] = function (vao) {
|
|
vaoExt["bindVertexArrayOES"](vao);
|
|
};
|
|
GLctx["isVertexArray"] = function (vao) {
|
|
return vaoExt["isVertexArrayOES"](vao);
|
|
};
|
|
}
|
|
var drawBuffersExt = GLctx.getExtension("WEBGL_draw_buffers");
|
|
if (drawBuffersExt) {
|
|
GLctx["drawBuffers"] = function (n, bufs) {
|
|
drawBuffersExt["drawBuffersWEBGL"](n, bufs);
|
|
};
|
|
}
|
|
}
|
|
GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
|
|
var automaticallyEnabledExtensions = ["OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", "OES_element_index_uint", "EXT_texture_filter_anisotropic", "EXT_frag_depth", "WEBGL_draw_buffers", "ANGLE_instanced_arrays", "OES_texture_float_linear", "OES_texture_half_float_linear", "EXT_blend_minmax", "EXT_shader_texture_lod", "EXT_texture_norm16", "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", "EXT_sRGB", "WEBGL_compressed_texture_etc1", "EXT_disjoint_timer_query", "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_astc", "EXT_color_buffer_float", "WEBGL_compressed_texture_s3tc_srgb", "EXT_disjoint_timer_query_webgl2", "WEBKIT_WEBGL_compressed_texture_pvrtc"];
|
|
var exts = GLctx.getSupportedExtensions();
|
|
if (exts && exts.length > 0) {
|
|
GLctx.getSupportedExtensions().forEach(function (ext) {
|
|
if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
|
|
GLctx.getExtension(ext);
|
|
}
|
|
});
|
|
}
|
|
},
|
|
populateUniformTable: function (program) {
|
|
var p = GL.programs[program];
|
|
GL.programInfos[program] = { uniforms: {}, maxUniformLength: 0, maxAttributeLength: -1, maxUniformBlockNameLength: -1 };
|
|
var ptable = GL.programInfos[program];
|
|
var utable = ptable.uniforms;
|
|
var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
|
|
for (var i = 0; i < numUniforms; ++i) {
|
|
var u = GLctx.getActiveUniform(p, i);
|
|
var name = u.name;
|
|
ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length + 1);
|
|
if (name.indexOf("]", name.length - 1) !== -1) {
|
|
var ls = name.lastIndexOf("[");
|
|
name = name.slice(0, ls);
|
|
}
|
|
var loc = GLctx.getUniformLocation(p, name);
|
|
if (loc != null) {
|
|
var id = GL.getNewId(GL.uniforms);
|
|
utable[name] = [u.size, id];
|
|
GL.uniforms[id] = loc;
|
|
for (var j = 1; j < u.size; ++j) {
|
|
var n = name + "[" + j + "]";
|
|
loc = GLctx.getUniformLocation(p, n);
|
|
id = GL.getNewId(GL.uniforms);
|
|
GL.uniforms[id] = loc;
|
|
}
|
|
}
|
|
}
|
|
},
|
|
};
|
|
function _emscripten_webgl_do_create_context(target, attributes) {
|
|
var contextAttributes = {};
|
|
contextAttributes["alpha"] = !!HEAP32[attributes >> 2];
|
|
contextAttributes["depth"] = !!HEAP32[(attributes + 4) >> 2];
|
|
contextAttributes["stencil"] = !!HEAP32[(attributes + 8) >> 2];
|
|
contextAttributes["antialias"] = !!HEAP32[(attributes + 12) >> 2];
|
|
contextAttributes["premultipliedAlpha"] = !!HEAP32[(attributes + 16) >> 2];
|
|
contextAttributes["preserveDrawingBuffer"] = !!HEAP32[(attributes + 20) >> 2];
|
|
contextAttributes["preferLowPowerToHighPerformance"] = !!HEAP32[(attributes + 24) >> 2];
|
|
contextAttributes["failIfMajorPerformanceCaveat"] = !!HEAP32[(attributes + 28) >> 2];
|
|
contextAttributes["majorVersion"] = HEAP32[(attributes + 32) >> 2];
|
|
contextAttributes["minorVersion"] = HEAP32[(attributes + 36) >> 2];
|
|
contextAttributes["explicitSwapControl"] = HEAP32[(attributes + 44) >> 2];
|
|
contextAttributes["proxyContextToMainThread"] = HEAP32[(attributes + 48) >> 2];
|
|
contextAttributes["renderViaOffscreenBackBuffer"] = HEAP32[(attributes + 52) >> 2];
|
|
target = Pointer_stringify(target);
|
|
var canvas;
|
|
if ((!target || target === "#canvas") && Module["canvas"]) {
|
|
canvas = Module["canvas"].id && GL.offscreenCanvases[Module["canvas"].id] ? GL.offscreenCanvases[Module["canvas"].id].offscreenCanvas || JSEvents.findEventTarget(Module["canvas"].id) : Module["canvas"];
|
|
} else {
|
|
canvas = GL.offscreenCanvases[target] ? GL.offscreenCanvases[target].offscreenCanvas : JSEvents.findEventTarget(target);
|
|
}
|
|
if (!canvas) {
|
|
return 0;
|
|
}
|
|
if (contextAttributes["explicitSwapControl"]) {
|
|
return 0;
|
|
}
|
|
var contextHandle = GL.createContext(canvas, contextAttributes);
|
|
return contextHandle;
|
|
}
|
|
function _emscripten_webgl_create_context() {
|
|
return _emscripten_webgl_do_create_context.apply(null, arguments);
|
|
}
|
|
function _emscripten_webgl_destroy_context_calling_thread(contextHandle) {
|
|
GL.deleteContext(contextHandle);
|
|
}
|
|
function _emscripten_webgl_destroy_context() {
|
|
return _emscripten_webgl_destroy_context_calling_thread.apply(null, arguments);
|
|
}
|
|
function _emscripten_webgl_enable_extension_calling_thread(contextHandle, extension) {
|
|
var context = GL.getContext(contextHandle);
|
|
var extString = Pointer_stringify(extension);
|
|
if (extString.indexOf("GL_") == 0) extString = extString.substr(3);
|
|
var ext = context.GLctx.getExtension(extString);
|
|
return ext ? 1 : 0;
|
|
}
|
|
function _emscripten_webgl_enable_extension() {
|
|
return _emscripten_webgl_enable_extension_calling_thread.apply(null, arguments);
|
|
}
|
|
function _emscripten_webgl_do_get_current_context() {
|
|
return GL.currentContext ? GL.currentContext.handle : 0;
|
|
}
|
|
function _emscripten_webgl_get_current_context() {
|
|
return _emscripten_webgl_do_get_current_context.apply(null, arguments);
|
|
}
|
|
function _emscripten_webgl_init_context_attributes(attributes) {
|
|
HEAP32[attributes >> 2] = 1;
|
|
HEAP32[(attributes + 4) >> 2] = 1;
|
|
HEAP32[(attributes + 8) >> 2] = 0;
|
|
HEAP32[(attributes + 12) >> 2] = 1;
|
|
HEAP32[(attributes + 16) >> 2] = 1;
|
|
HEAP32[(attributes + 20) >> 2] = 0;
|
|
HEAP32[(attributes + 24) >> 2] = 0;
|
|
HEAP32[(attributes + 28) >> 2] = 0;
|
|
HEAP32[(attributes + 32) >> 2] = 1;
|
|
HEAP32[(attributes + 36) >> 2] = 0;
|
|
HEAP32[(attributes + 40) >> 2] = 1;
|
|
HEAP32[(attributes + 44) >> 2] = 0;
|
|
HEAP32[(attributes + 48) >> 2] = 0;
|
|
HEAP32[(attributes + 52) >> 2] = 0;
|
|
}
|
|
function _emscripten_webgl_make_context_current(contextHandle) {
|
|
var success = GL.makeContextCurrent(contextHandle);
|
|
return success ? 0 : -5;
|
|
}
|
|
function __exit(status) {
|
|
exit(status);
|
|
}
|
|
function _exit(status) {
|
|
__exit(status);
|
|
}
|
|
function _flock(fd, operation) {
|
|
return 0;
|
|
}
|
|
function _getaddrinfo(node, service, hint, out) {
|
|
var addr = 0;
|
|
var port = 0;
|
|
var flags = 0;
|
|
var family = 0;
|
|
var type = 0;
|
|
var proto = 0;
|
|
var ai;
|
|
function allocaddrinfo(family, type, proto, canon, addr, port) {
|
|
var sa, salen, ai;
|
|
var res;
|
|
salen = family === 10 ? 28 : 16;
|
|
addr = family === 10 ? __inet_ntop6_raw(addr) : __inet_ntop4_raw(addr);
|
|
sa = _malloc(salen);
|
|
res = __write_sockaddr(sa, family, addr, port);
|
|
assert(!res.errno);
|
|
ai = _malloc(32);
|
|
HEAP32[(ai + 4) >> 2] = family;
|
|
HEAP32[(ai + 8) >> 2] = type;
|
|
HEAP32[(ai + 12) >> 2] = proto;
|
|
HEAP32[(ai + 24) >> 2] = canon;
|
|
HEAP32[(ai + 20) >> 2] = sa;
|
|
if (family === 10) {
|
|
HEAP32[(ai + 16) >> 2] = 28;
|
|
} else {
|
|
HEAP32[(ai + 16) >> 2] = 16;
|
|
}
|
|
HEAP32[(ai + 28) >> 2] = 0;
|
|
return ai;
|
|
}
|
|
if (hint) {
|
|
flags = HEAP32[hint >> 2];
|
|
family = HEAP32[(hint + 4) >> 2];
|
|
type = HEAP32[(hint + 8) >> 2];
|
|
proto = HEAP32[(hint + 12) >> 2];
|
|
}
|
|
if (type && !proto) {
|
|
proto = type === 2 ? 17 : 6;
|
|
}
|
|
if (!type && proto) {
|
|
type = proto === 17 ? 2 : 1;
|
|
}
|
|
if (proto === 0) {
|
|
proto = 6;
|
|
}
|
|
if (type === 0) {
|
|
type = 1;
|
|
}
|
|
if (!node && !service) {
|
|
return -2;
|
|
}
|
|
if (flags & ~(1 | 2 | 4 | 1024 | 8 | 16 | 32)) {
|
|
return -1;
|
|
}
|
|
if (hint !== 0 && HEAP32[hint >> 2] & 2 && !node) {
|
|
return -1;
|
|
}
|
|
if (flags & 32) {
|
|
return -2;
|
|
}
|
|
if (type !== 0 && type !== 1 && type !== 2) {
|
|
return -7;
|
|
}
|
|
if (family !== 0 && family !== 2 && family !== 10) {
|
|
return -6;
|
|
}
|
|
if (service) {
|
|
service = Pointer_stringify(service);
|
|
port = parseInt(service, 10);
|
|
if (isNaN(port)) {
|
|
if (flags & 1024) {
|
|
return -2;
|
|
}
|
|
return -8;
|
|
}
|
|
}
|
|
if (!node) {
|
|
if (family === 0) {
|
|
family = 2;
|
|
}
|
|
if ((flags & 1) === 0) {
|
|
if (family === 2) {
|
|
addr = _htonl(2130706433);
|
|
} else {
|
|
addr = [0, 0, 0, 1];
|
|
}
|
|
}
|
|
ai = allocaddrinfo(family, type, proto, null, addr, port);
|
|
HEAP32[out >> 2] = ai;
|
|
return 0;
|
|
}
|
|
node = Pointer_stringify(node);
|
|
addr = __inet_pton4_raw(node);
|
|
if (addr !== null) {
|
|
if (family === 0 || family === 2) {
|
|
family = 2;
|
|
} else if (family === 10 && flags & 8) {
|
|
addr = [0, 0, _htonl(65535), addr];
|
|
family = 10;
|
|
} else {
|
|
return -2;
|
|
}
|
|
} else {
|
|
addr = __inet_pton6_raw(node);
|
|
if (addr !== null) {
|
|
if (family === 0 || family === 10) {
|
|
family = 10;
|
|
} else {
|
|
return -2;
|
|
}
|
|
}
|
|
}
|
|
if (addr != null) {
|
|
ai = allocaddrinfo(family, type, proto, node, addr, port);
|
|
HEAP32[out >> 2] = ai;
|
|
return 0;
|
|
}
|
|
if (flags & 4) {
|
|
return -2;
|
|
}
|
|
node = DNS.lookup_name(node);
|
|
addr = __inet_pton4_raw(node);
|
|
if (family === 0) {
|
|
family = 2;
|
|
} else if (family === 10) {
|
|
addr = [0, 0, _htonl(65535), addr];
|
|
}
|
|
ai = allocaddrinfo(family, type, proto, null, addr, port);
|
|
HEAP32[out >> 2] = ai;
|
|
return 0;
|
|
}
|
|
function _getenv(name) {
|
|
if (name === 0) return 0;
|
|
name = Pointer_stringify(name);
|
|
if (!ENV.hasOwnProperty(name)) return 0;
|
|
if (_getenv.ret) _free(_getenv.ret);
|
|
_getenv.ret = allocateUTF8(ENV[name]);
|
|
return _getenv.ret;
|
|
}
|
|
function _getnameinfo(sa, salen, node, nodelen, serv, servlen, flags) {
|
|
var info = __read_sockaddr(sa, salen);
|
|
if (info.errno) {
|
|
return -6;
|
|
}
|
|
var port = info.port;
|
|
var addr = info.addr;
|
|
var overflowed = false;
|
|
if (node && nodelen) {
|
|
var lookup;
|
|
if (flags & 1 || !(lookup = DNS.lookup_addr(addr))) {
|
|
if (flags & 8) {
|
|
return -2;
|
|
}
|
|
} else {
|
|
addr = lookup;
|
|
}
|
|
var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen);
|
|
if (numBytesWrittenExclNull + 1 >= nodelen) {
|
|
overflowed = true;
|
|
}
|
|
}
|
|
if (serv && servlen) {
|
|
port = "" + port;
|
|
var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen);
|
|
if (numBytesWrittenExclNull + 1 >= servlen) {
|
|
overflowed = true;
|
|
}
|
|
}
|
|
if (overflowed) {
|
|
return -12;
|
|
}
|
|
return 0;
|
|
}
|
|
function _getpagesize() {
|
|
return PAGE_SIZE;
|
|
}
|
|
function _getpwuid(uid) {
|
|
return 0;
|
|
}
|
|
function _gettimeofday(ptr) {
|
|
var now = Date.now();
|
|
HEAP32[ptr >> 2] = (now / 1e3) | 0;
|
|
HEAP32[(ptr + 4) >> 2] = ((now % 1e3) * 1e3) | 0;
|
|
return 0;
|
|
}
|
|
function _glActiveTexture(x0) {
|
|
GLctx["activeTexture"](x0);
|
|
}
|
|
function _glAttachShader(program, shader) {
|
|
GLctx.attachShader(GL.programs[program], GL.shaders[shader]);
|
|
}
|
|
function _glBeginQuery(target, id) {
|
|
GLctx["beginQuery"](target, id ? GL.queries[id] : null);
|
|
}
|
|
function _glBeginTransformFeedback(x0) {
|
|
GLctx["beginTransformFeedback"](x0);
|
|
}
|
|
function _glBindAttribLocation(program, index, name) {
|
|
name = Pointer_stringify(name);
|
|
GLctx.bindAttribLocation(GL.programs[program], index, name);
|
|
}
|
|
function _glBindBuffer(target, buffer) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
if (target == 35051) {
|
|
GLctx.currentPixelPackBufferBinding = buffer;
|
|
} else if (target == 35052) {
|
|
GLctx.currentPixelUnpackBufferBinding = buffer;
|
|
}
|
|
GLctx.bindBuffer(target, bufferObj);
|
|
}
|
|
function _glBindBufferBase(target, index, buffer) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
GLctx["bindBufferBase"](target, index, bufferObj);
|
|
}
|
|
function _glBindBufferRange(target, index, buffer, offset, ptrsize) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
GLctx["bindBufferRange"](target, index, bufferObj, offset, ptrsize);
|
|
}
|
|
function _glBindFramebuffer(target, framebuffer) {
|
|
GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
|
|
}
|
|
function _glBindRenderbuffer(target, renderbuffer) {
|
|
GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
|
|
}
|
|
function _glBindSampler(unit, sampler) {
|
|
GLctx["bindSampler"](unit, sampler ? GL.samplers[sampler] : null);
|
|
}
|
|
function _glBindTexture(target, texture) {
|
|
GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
|
|
}
|
|
function _glBindTransformFeedback(target, id) {
|
|
var transformFeedback = id ? GL.transformFeedbacks[id] : null;
|
|
if (id && !transformFeedback) {
|
|
GL.recordError(1282);
|
|
return;
|
|
}
|
|
GLctx["bindTransformFeedback"](target, transformFeedback);
|
|
}
|
|
function _glBindVertexArray(vao) {
|
|
GLctx["bindVertexArray"](GL.vaos[vao]);
|
|
}
|
|
function _glBlendEquation(x0) {
|
|
GLctx["blendEquation"](x0);
|
|
}
|
|
function _glBlendEquationSeparate(x0, x1) {
|
|
GLctx["blendEquationSeparate"](x0, x1);
|
|
}
|
|
function _glBlendFuncSeparate(x0, x1, x2, x3) {
|
|
GLctx["blendFuncSeparate"](x0, x1, x2, x3);
|
|
}
|
|
function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) {
|
|
GLctx["blitFramebuffer"](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9);
|
|
}
|
|
function _glBufferData(target, size, data, usage) {
|
|
if (!data) {
|
|
GLctx.bufferData(target, size, usage);
|
|
} else {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.bufferData(target, HEAPU8, usage, data, size);
|
|
return;
|
|
}
|
|
GLctx.bufferData(target, HEAPU8.subarray(data, data + size), usage);
|
|
}
|
|
}
|
|
function _glBufferSubData(target, offset, size, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.bufferSubData(target, offset, HEAPU8, data, size);
|
|
return;
|
|
}
|
|
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data + size));
|
|
}
|
|
function _glCheckFramebufferStatus(x0) {
|
|
return GLctx["checkFramebufferStatus"](x0);
|
|
}
|
|
function _glClear(x0) {
|
|
GLctx["clear"](x0);
|
|
}
|
|
function _glClearBufferfi(x0, x1, x2, x3) {
|
|
GLctx["clearBufferfi"](x0, x1, x2, x3);
|
|
}
|
|
function _glClearBufferfv(buffer, drawbuffer, value) {
|
|
GLctx["clearBufferfv"](buffer, drawbuffer, HEAPF32, value >> 2);
|
|
}
|
|
function _glClearBufferuiv(buffer, drawbuffer, value) {
|
|
GLctx["clearBufferuiv"](buffer, drawbuffer, HEAPU32, value >> 2);
|
|
}
|
|
function _glClearColor(x0, x1, x2, x3) {
|
|
GLctx["clearColor"](x0, x1, x2, x3);
|
|
}
|
|
function _glClearDepthf(x0) {
|
|
GLctx["clearDepth"](x0);
|
|
}
|
|
function _glClearStencil(x0) {
|
|
GLctx["clearStencil"](x0);
|
|
}
|
|
function _glClientWaitSync(sync, flags, timeoutLo, timeoutHi) {
|
|
timeoutLo = timeoutLo >>> 0;
|
|
timeoutHi = timeoutHi >>> 0;
|
|
var timeout = timeoutLo == 4294967295 && timeoutHi == 4294967295 ? -1 : makeBigInt(timeoutLo, timeoutHi, true);
|
|
return GLctx.clientWaitSync(GL.syncs[sync], flags, timeout);
|
|
}
|
|
function _glColorMask(red, green, blue, alpha) {
|
|
GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
|
|
}
|
|
function _glCompileShader(shader) {
|
|
GLctx.compileShader(GL.shaders[shader]);
|
|
}
|
|
function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, HEAPU8, data, imageSize);
|
|
return;
|
|
}
|
|
GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray(data, data + imageSize) : null);
|
|
}
|
|
function _glCompressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, HEAPU8, data, imageSize);
|
|
} else {
|
|
GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, data ? HEAPU8.subarray(data, data + imageSize) : null);
|
|
}
|
|
}
|
|
function _glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize);
|
|
return;
|
|
}
|
|
GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray(data, data + imageSize) : null);
|
|
}
|
|
function _glCompressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize);
|
|
} else {
|
|
GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, data ? HEAPU8.subarray(data, data + imageSize) : null);
|
|
}
|
|
}
|
|
function _glCopyBufferSubData(x0, x1, x2, x3, x4) {
|
|
GLctx["copyBufferSubData"](x0, x1, x2, x3, x4);
|
|
}
|
|
function _glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) {
|
|
GLctx["copyTexImage2D"](x0, x1, x2, x3, x4, x5, x6, x7);
|
|
}
|
|
function _glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) {
|
|
GLctx["copyTexSubImage2D"](x0, x1, x2, x3, x4, x5, x6, x7);
|
|
}
|
|
function _glCreateProgram() {
|
|
var id = GL.getNewId(GL.programs);
|
|
var program = GLctx.createProgram();
|
|
program.name = id;
|
|
GL.programs[id] = program;
|
|
return id;
|
|
}
|
|
function _glCreateShader(shaderType) {
|
|
var id = GL.getNewId(GL.shaders);
|
|
GL.shaders[id] = GLctx.createShader(shaderType);
|
|
return id;
|
|
}
|
|
function _glCullFace(x0) {
|
|
GLctx["cullFace"](x0);
|
|
}
|
|
function _glDeleteBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(buffers + i * 4) >> 2];
|
|
var buffer = GL.buffers[id];
|
|
if (!buffer) continue;
|
|
GLctx.deleteBuffer(buffer);
|
|
buffer.name = 0;
|
|
GL.buffers[id] = null;
|
|
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
|
|
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
|
|
}
|
|
}
|
|
function _glDeleteFramebuffers(n, framebuffers) {
|
|
for (var i = 0; i < n; ++i) {
|
|
var id = HEAP32[(framebuffers + i * 4) >> 2];
|
|
var framebuffer = GL.framebuffers[id];
|
|
if (!framebuffer) continue;
|
|
GLctx.deleteFramebuffer(framebuffer);
|
|
framebuffer.name = 0;
|
|
GL.framebuffers[id] = null;
|
|
}
|
|
}
|
|
function _glDeleteProgram(id) {
|
|
if (!id) return;
|
|
var program = GL.programs[id];
|
|
if (!program) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
GLctx.deleteProgram(program);
|
|
program.name = 0;
|
|
GL.programs[id] = null;
|
|
GL.programInfos[id] = null;
|
|
}
|
|
function _glDeleteQueries(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(ids + i * 4) >> 2];
|
|
var query = GL.queries[id];
|
|
if (!query) continue;
|
|
GLctx["deleteQuery"](query);
|
|
GL.queries[id] = null;
|
|
}
|
|
}
|
|
function _glDeleteRenderbuffers(n, renderbuffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(renderbuffers + i * 4) >> 2];
|
|
var renderbuffer = GL.renderbuffers[id];
|
|
if (!renderbuffer) continue;
|
|
GLctx.deleteRenderbuffer(renderbuffer);
|
|
renderbuffer.name = 0;
|
|
GL.renderbuffers[id] = null;
|
|
}
|
|
}
|
|
function _glDeleteSamplers(n, samplers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(samplers + i * 4) >> 2];
|
|
var sampler = GL.samplers[id];
|
|
if (!sampler) continue;
|
|
GLctx["deleteSampler"](sampler);
|
|
sampler.name = 0;
|
|
GL.samplers[id] = null;
|
|
}
|
|
}
|
|
function _glDeleteShader(id) {
|
|
if (!id) return;
|
|
var shader = GL.shaders[id];
|
|
if (!shader) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
GLctx.deleteShader(shader);
|
|
GL.shaders[id] = null;
|
|
}
|
|
function _glDeleteSync(id) {
|
|
if (!id) return;
|
|
var sync = GL.syncs[id];
|
|
if (!sync) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
GLctx.deleteSync(sync);
|
|
sync.name = 0;
|
|
GL.syncs[id] = null;
|
|
}
|
|
function _glDeleteTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(textures + i * 4) >> 2];
|
|
var texture = GL.textures[id];
|
|
if (!texture) continue;
|
|
GLctx.deleteTexture(texture);
|
|
texture.name = 0;
|
|
GL.textures[id] = null;
|
|
}
|
|
}
|
|
function _glDeleteTransformFeedbacks(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(ids + i * 4) >> 2];
|
|
var transformFeedback = GL.transformFeedbacks[id];
|
|
if (!transformFeedback) continue;
|
|
GLctx["deleteTransformFeedback"](transformFeedback);
|
|
transformFeedback.name = 0;
|
|
GL.transformFeedbacks[id] = null;
|
|
}
|
|
}
|
|
function _glDeleteVertexArrays(n, vaos) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(vaos + i * 4) >> 2];
|
|
GLctx["deleteVertexArray"](GL.vaos[id]);
|
|
GL.vaos[id] = null;
|
|
}
|
|
}
|
|
function _glDepthFunc(x0) {
|
|
GLctx["depthFunc"](x0);
|
|
}
|
|
function _glDepthMask(flag) {
|
|
GLctx.depthMask(!!flag);
|
|
}
|
|
function _glDetachShader(program, shader) {
|
|
GLctx.detachShader(GL.programs[program], GL.shaders[shader]);
|
|
}
|
|
function _glDisable(x0) {
|
|
GLctx["disable"](x0);
|
|
}
|
|
function _glDisableVertexAttribArray(index) {
|
|
GLctx.disableVertexAttribArray(index);
|
|
}
|
|
function _glDrawArrays(mode, first, count) {
|
|
GLctx.drawArrays(mode, first, count);
|
|
}
|
|
function _glDrawArraysInstanced(mode, first, count, primcount) {
|
|
GLctx["drawArraysInstanced"](mode, first, count, primcount);
|
|
}
|
|
function _glDrawBuffers(n, bufs) {
|
|
var bufArray = GL.tempFixedLengthArray[n];
|
|
for (var i = 0; i < n; i++) {
|
|
bufArray[i] = HEAP32[(bufs + i * 4) >> 2];
|
|
}
|
|
GLctx["drawBuffers"](bufArray);
|
|
}
|
|
function _glDrawElements(mode, count, type, indices) {
|
|
GLctx.drawElements(mode, count, type, indices);
|
|
}
|
|
function _glDrawElementsInstanced(mode, count, type, indices, primcount) {
|
|
GLctx["drawElementsInstanced"](mode, count, type, indices, primcount);
|
|
}
|
|
function _glEnable(x0) {
|
|
GLctx["enable"](x0);
|
|
}
|
|
function _glEnableVertexAttribArray(index) {
|
|
GLctx.enableVertexAttribArray(index);
|
|
}
|
|
function _glEndQuery(x0) {
|
|
GLctx["endQuery"](x0);
|
|
}
|
|
function _glEndTransformFeedback() {
|
|
GLctx["endTransformFeedback"]();
|
|
}
|
|
function _glFenceSync(condition, flags) {
|
|
var sync = GLctx.fenceSync(condition, flags);
|
|
if (sync) {
|
|
var id = GL.getNewId(GL.syncs);
|
|
sync.name = id;
|
|
GL.syncs[id] = sync;
|
|
return id;
|
|
} else {
|
|
return 0;
|
|
}
|
|
}
|
|
function _glFinish() {
|
|
GLctx["finish"]();
|
|
}
|
|
function _glFlush() {
|
|
GLctx["flush"]();
|
|
}
|
|
function emscriptenWebGLGetBufferBinding(target) {
|
|
switch (target) {
|
|
case 34962:
|
|
target = 34964;
|
|
break;
|
|
case 34963:
|
|
target = 34965;
|
|
break;
|
|
case 35051:
|
|
target = 35053;
|
|
break;
|
|
case 35052:
|
|
target = 35055;
|
|
break;
|
|
case 35982:
|
|
target = 35983;
|
|
break;
|
|
case 36662:
|
|
target = 36662;
|
|
break;
|
|
case 36663:
|
|
target = 36663;
|
|
break;
|
|
case 35345:
|
|
target = 35368;
|
|
break;
|
|
}
|
|
var buffer = GLctx.getParameter(target);
|
|
if (buffer) return buffer.name | 0;
|
|
else return 0;
|
|
}
|
|
function emscriptenWebGLValidateMapBufferTarget(target) {
|
|
switch (target) {
|
|
case 34962:
|
|
case 34963:
|
|
case 36662:
|
|
case 36663:
|
|
case 35051:
|
|
case 35052:
|
|
case 35882:
|
|
case 35982:
|
|
case 35345:
|
|
return true;
|
|
default:
|
|
return false;
|
|
}
|
|
}
|
|
function _glFlushMappedBufferRange(target, offset, length) {
|
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) {
|
|
GL.recordError(1280);
|
|
err("GL_INVALID_ENUM in glFlushMappedBufferRange");
|
|
return;
|
|
}
|
|
var mapping = GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)];
|
|
if (!mapping) {
|
|
GL.recordError(1282);
|
|
Module.printError("buffer was never mapped in glFlushMappedBufferRange");
|
|
return;
|
|
}
|
|
if (!(mapping.access & 16)) {
|
|
GL.recordError(1282);
|
|
Module.printError("buffer was not mapped with GL_MAP_FLUSH_EXPLICIT_BIT in glFlushMappedBufferRange");
|
|
return;
|
|
}
|
|
if (offset < 0 || length < 0 || offset + length > mapping.length) {
|
|
GL.recordError(1281);
|
|
Module.printError("invalid range in glFlushMappedBufferRange");
|
|
return;
|
|
}
|
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem + offset, mapping.mem + offset + length));
|
|
}
|
|
function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
|
|
GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]);
|
|
}
|
|
function _glFramebufferTexture2D(target, attachment, textarget, texture, level) {
|
|
GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level);
|
|
}
|
|
function _glFramebufferTextureLayer(target, attachment, texture, level, layer) {
|
|
GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer);
|
|
}
|
|
function _glFrontFace(x0) {
|
|
GLctx["frontFace"](x0);
|
|
}
|
|
function _glGenBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var buffer = GLctx.createBuffer();
|
|
if (!buffer) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(buffers + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.buffers);
|
|
buffer.name = id;
|
|
GL.buffers[id] = buffer;
|
|
HEAP32[(buffers + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenFramebuffers(n, ids) {
|
|
for (var i = 0; i < n; ++i) {
|
|
var framebuffer = GLctx.createFramebuffer();
|
|
if (!framebuffer) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(ids + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.framebuffers);
|
|
framebuffer.name = id;
|
|
GL.framebuffers[id] = framebuffer;
|
|
HEAP32[(ids + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenQueries(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var query = GLctx["createQuery"]();
|
|
if (!query) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(ids + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.queries);
|
|
query.name = id;
|
|
GL.queries[id] = query;
|
|
HEAP32[(ids + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenRenderbuffers(n, renderbuffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var renderbuffer = GLctx.createRenderbuffer();
|
|
if (!renderbuffer) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(renderbuffers + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.renderbuffers);
|
|
renderbuffer.name = id;
|
|
GL.renderbuffers[id] = renderbuffer;
|
|
HEAP32[(renderbuffers + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenSamplers(n, samplers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var sampler = GLctx["createSampler"]();
|
|
if (!sampler) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(samplers + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.samplers);
|
|
sampler.name = id;
|
|
GL.samplers[id] = sampler;
|
|
HEAP32[(samplers + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var texture = GLctx.createTexture();
|
|
if (!texture) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(textures + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.textures);
|
|
texture.name = id;
|
|
GL.textures[id] = texture;
|
|
HEAP32[(textures + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenTransformFeedbacks(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var transformFeedback = GLctx["createTransformFeedback"]();
|
|
if (!transformFeedback) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(ids + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.transformFeedbacks);
|
|
transformFeedback.name = id;
|
|
GL.transformFeedbacks[id] = transformFeedback;
|
|
HEAP32[(ids + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenVertexArrays(n, arrays) {
|
|
for (var i = 0; i < n; i++) {
|
|
var vao = GLctx["createVertexArray"]();
|
|
if (!vao) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[(arrays + i++ * 4) >> 2] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.vaos);
|
|
vao.name = id;
|
|
GL.vaos[id] = vao;
|
|
HEAP32[(arrays + i * 4) >> 2] = id;
|
|
}
|
|
}
|
|
function _glGenerateMipmap(x0) {
|
|
GLctx["generateMipmap"](x0);
|
|
}
|
|
function _glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getActiveAttrib(program, index);
|
|
if (!info) return;
|
|
if (bufSize > 0 && name) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0;
|
|
}
|
|
if (size) HEAP32[size >> 2] = info.size;
|
|
if (type) HEAP32[type >> 2] = info.type;
|
|
}
|
|
function _glGetActiveUniform(program, index, bufSize, length, size, type, name) {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getActiveUniform(program, index);
|
|
if (!info) return;
|
|
if (bufSize > 0 && name) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0;
|
|
}
|
|
if (size) HEAP32[size >> 2] = info.size;
|
|
if (type) HEAP32[type >> 2] = info.type;
|
|
}
|
|
function _glGetActiveUniformBlockName(program, uniformBlockIndex, bufSize, length, uniformBlockName) {
|
|
program = GL.programs[program];
|
|
var result = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex);
|
|
if (!result) return;
|
|
if (uniformBlockName && bufSize > 0) {
|
|
var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0;
|
|
}
|
|
}
|
|
function _glGetActiveUniformBlockiv(program, uniformBlockIndex, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
switch (pname) {
|
|
case 35393:
|
|
var name = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex);
|
|
HEAP32[params >> 2] = name.length + 1;
|
|
return;
|
|
default:
|
|
var result = GLctx["getActiveUniformBlockParameter"](program, uniformBlockIndex, pname);
|
|
if (!result) return;
|
|
if (typeof result == "number") {
|
|
HEAP32[params >> 2] = result;
|
|
} else {
|
|
for (var i = 0; i < result.length; i++) {
|
|
HEAP32[(params + i * 4) >> 2] = result[i];
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function _glGetActiveUniformsiv(program, uniformCount, uniformIndices, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
if (uniformCount > 0 && uniformIndices == 0) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
var ids = [];
|
|
for (var i = 0; i < uniformCount; i++) {
|
|
ids.push(HEAP32[(uniformIndices + i * 4) >> 2]);
|
|
}
|
|
var result = GLctx["getActiveUniforms"](program, ids, pname);
|
|
if (!result) return;
|
|
var len = result.length;
|
|
for (var i = 0; i < len; i++) {
|
|
HEAP32[(params + i * 4) >> 2] = result[i];
|
|
}
|
|
}
|
|
function _glGetAttribLocation(program, name) {
|
|
return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name));
|
|
}
|
|
function _glGetError() {
|
|
if (GL.lastError) {
|
|
var error = GL.lastError;
|
|
GL.lastError = 0;
|
|
return error;
|
|
} else {
|
|
return GLctx.getError();
|
|
}
|
|
}
|
|
function _glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
|
|
var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
|
|
if (result instanceof WebGLRenderbuffer || result instanceof WebGLTexture) {
|
|
result = result.name | 0;
|
|
}
|
|
HEAP32[params >> 2] = result;
|
|
}
|
|
function emscriptenWebGLGetIndexed(target, index, data, type) {
|
|
if (!data) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
var result = GLctx["getIndexedParameter"](target, index);
|
|
var ret;
|
|
switch (typeof result) {
|
|
case "boolean":
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case "number":
|
|
ret = result;
|
|
break;
|
|
case "object":
|
|
if (result === null) {
|
|
switch (target) {
|
|
case 35983:
|
|
case 35368:
|
|
ret = 0;
|
|
break;
|
|
default: {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
}
|
|
} else if (result instanceof WebGLBuffer) {
|
|
ret = result.name | 0;
|
|
} else {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
switch (type) {
|
|
case "Integer64":
|
|
(tempI64 = [ret >>> 0, ((tempDouble = ret), +Math_abs(tempDouble) >= 1 ? (tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0) : 0)]), (HEAP32[data >> 2] = tempI64[0]), (HEAP32[(data + 4) >> 2] = tempI64[1]);
|
|
break;
|
|
case "Integer":
|
|
HEAP32[data >> 2] = ret;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[data >> 2] = ret;
|
|
break;
|
|
case "Boolean":
|
|
HEAP8[data >> 0] = ret ? 1 : 0;
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetIndexed() error, bad type: " + type;
|
|
}
|
|
}
|
|
function _glGetIntegeri_v(target, index, data) {
|
|
emscriptenWebGLGetIndexed(target, index, data, "Integer");
|
|
}
|
|
function emscriptenWebGLGet(name_, p, type) {
|
|
if (!p) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
var ret = undefined;
|
|
switch (name_) {
|
|
case 36346:
|
|
ret = 1;
|
|
break;
|
|
case 36344:
|
|
if (type !== "Integer" && type !== "Integer64") {
|
|
GL.recordError(1280);
|
|
}
|
|
return;
|
|
case 34814:
|
|
case 36345:
|
|
ret = 0;
|
|
break;
|
|
case 34466:
|
|
var formats = GLctx.getParameter(34467);
|
|
ret = formats.length;
|
|
break;
|
|
case 33309:
|
|
if (GLctx.canvas.GLctxObject.version < 2) {
|
|
GL.recordError(1282);
|
|
return;
|
|
}
|
|
var exts = GLctx.getSupportedExtensions();
|
|
ret = 2 * exts.length;
|
|
break;
|
|
case 33307:
|
|
case 33308:
|
|
if (GLctx.canvas.GLctxObject.version < 2) {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
ret = name_ == 33307 ? 3 : 0;
|
|
break;
|
|
}
|
|
if (ret === undefined) {
|
|
var result = GLctx.getParameter(name_);
|
|
switch (typeof result) {
|
|
case "number":
|
|
ret = result;
|
|
break;
|
|
case "boolean":
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case "string":
|
|
GL.recordError(1280);
|
|
return;
|
|
case "object":
|
|
if (result === null) {
|
|
switch (name_) {
|
|
case 34964:
|
|
case 35725:
|
|
case 34965:
|
|
case 36006:
|
|
case 36007:
|
|
case 32873:
|
|
case 34229:
|
|
case 35097:
|
|
case 36389:
|
|
case 34068: {
|
|
ret = 0;
|
|
break;
|
|
}
|
|
default: {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
}
|
|
} else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) {
|
|
for (var i = 0; i < result.length; ++i) {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[(p + i * 4) >> 2] = result[i];
|
|
break;
|
|
case "Float":
|
|
HEAPF32[(p + i * 4) >> 2] = result[i];
|
|
break;
|
|
case "Boolean":
|
|
HEAP8[(p + i) >> 0] = result[i] ? 1 : 0;
|
|
break;
|
|
default:
|
|
throw "internal glGet error, bad type: " + type;
|
|
}
|
|
}
|
|
return;
|
|
} else if (result instanceof WebGLBuffer || result instanceof WebGLProgram || result instanceof WebGLFramebuffer || result instanceof WebGLRenderbuffer || result instanceof WebGLQuery || result instanceof WebGLSampler || result instanceof WebGLSync || result instanceof WebGLTransformFeedback || result instanceof WebGLVertexArrayObject || result instanceof WebGLTexture) {
|
|
ret = result.name | 0;
|
|
} else {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
}
|
|
switch (type) {
|
|
case "Integer64":
|
|
(tempI64 = [ret >>> 0, ((tempDouble = ret), +Math_abs(tempDouble) >= 1 ? (tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0) : 0)]), (HEAP32[p >> 2] = tempI64[0]), (HEAP32[(p + 4) >> 2] = tempI64[1]);
|
|
break;
|
|
case "Integer":
|
|
HEAP32[p >> 2] = ret;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[p >> 2] = ret;
|
|
break;
|
|
case "Boolean":
|
|
HEAP8[p >> 0] = ret ? 1 : 0;
|
|
break;
|
|
default:
|
|
throw "internal glGet error, bad type: " + type;
|
|
}
|
|
}
|
|
function _glGetIntegerv(name_, p) {
|
|
emscriptenWebGLGet(name_, p, "Integer");
|
|
}
|
|
function _glGetInternalformativ(target, internalformat, pname, bufSize, params) {
|
|
if (bufSize < 0) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
var samples = GLctx["getInternalformatParameter"](target, internalformat, 32937);
|
|
if (!samples) {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
switch (pname) {
|
|
case 32937:
|
|
var n = Math.min(bufSize, samples.length);
|
|
for (var i = 0; i < n; i++) {
|
|
var v = samples[i];
|
|
HEAP32[(params + i * 4) >> 2] = v;
|
|
}
|
|
break;
|
|
case 37760:
|
|
if (bufSize > 1) {
|
|
var v = samples.length;
|
|
HEAP32[params >> 2] = v;
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
}
|
|
}
|
|
function _glGetProgramBinary(program, bufSize, length, binaryFormat, binary) {
|
|
GL.recordError(1282);
|
|
}
|
|
function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = "(unknown error)";
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0;
|
|
}
|
|
}
|
|
function _glGetProgramiv(program, pname, p) {
|
|
if (!p) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
if (program >= GL.counter) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
GL.recordError(1282);
|
|
return;
|
|
}
|
|
if (pname == 35716) {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = "(unknown error)";
|
|
HEAP32[p >> 2] = log.length + 1;
|
|
} else if (pname == 35719) {
|
|
HEAP32[p >> 2] = ptable.maxUniformLength;
|
|
} else if (pname == 35722) {
|
|
if (ptable.maxAttributeLength == -1) {
|
|
program = GL.programs[program];
|
|
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
|
|
ptable.maxAttributeLength = 0;
|
|
for (var i = 0; i < numAttribs; ++i) {
|
|
var activeAttrib = GLctx.getActiveAttrib(program, i);
|
|
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length + 1);
|
|
}
|
|
}
|
|
HEAP32[p >> 2] = ptable.maxAttributeLength;
|
|
} else if (pname == 35381) {
|
|
if (ptable.maxUniformBlockNameLength == -1) {
|
|
program = GL.programs[program];
|
|
var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
|
|
ptable.maxUniformBlockNameLength = 0;
|
|
for (var i = 0; i < numBlocks; ++i) {
|
|
var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
|
|
ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length + 1);
|
|
}
|
|
}
|
|
HEAP32[p >> 2] = ptable.maxUniformBlockNameLength;
|
|
} else {
|
|
HEAP32[p >> 2] = GLctx.getProgramParameter(GL.programs[program], pname);
|
|
}
|
|
}
|
|
function _glGetRenderbufferParameteriv(target, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
HEAP32[params >> 2] = GLctx.getRenderbufferParameter(target, pname);
|
|
}
|
|
function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = "(unknown error)";
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0;
|
|
}
|
|
}
|
|
function _glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
|
|
var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
|
|
HEAP32[range >> 2] = result.rangeMin;
|
|
HEAP32[(range + 4) >> 2] = result.rangeMax;
|
|
HEAP32[precision >> 2] = result.precision;
|
|
}
|
|
function _glGetShaderSource(shader, bufSize, length, source) {
|
|
var result = GLctx.getShaderSource(GL.shaders[shader]);
|
|
if (!result) return;
|
|
if (bufSize > 0 && source) {
|
|
var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0;
|
|
}
|
|
}
|
|
function _glGetShaderiv(shader, pname, p) {
|
|
if (!p) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
if (pname == 35716) {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = "(unknown error)";
|
|
HEAP32[p >> 2] = log.length + 1;
|
|
} else if (pname == 35720) {
|
|
var source = GLctx.getShaderSource(GL.shaders[shader]);
|
|
var sourceLength = source === null || source.length == 0 ? 0 : source.length + 1;
|
|
HEAP32[p >> 2] = sourceLength;
|
|
} else {
|
|
HEAP32[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname);
|
|
}
|
|
}
|
|
function _glGetString(name_) {
|
|
if (GL.stringCache[name_]) return GL.stringCache[name_];
|
|
var ret;
|
|
switch (name_) {
|
|
case 7936:
|
|
case 7937:
|
|
case 37445:
|
|
case 37446:
|
|
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), "i8", ALLOC_NORMAL);
|
|
break;
|
|
case 7938:
|
|
var glVersion = GLctx.getParameter(GLctx.VERSION);
|
|
if (GLctx.canvas.GLctxObject.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")";
|
|
else {
|
|
glVersion = "OpenGL ES 2.0 (" + glVersion + ")";
|
|
}
|
|
ret = allocate(intArrayFromString(glVersion), "i8", ALLOC_NORMAL);
|
|
break;
|
|
case 7939:
|
|
var exts = GLctx.getSupportedExtensions();
|
|
var gl_exts = [];
|
|
for (var i = 0; i < exts.length; ++i) {
|
|
gl_exts.push(exts[i]);
|
|
gl_exts.push("GL_" + exts[i]);
|
|
}
|
|
ret = allocate(intArrayFromString(gl_exts.join(" ")), "i8", ALLOC_NORMAL);
|
|
break;
|
|
case 35724:
|
|
var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
|
|
var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
|
|
var ver_num = glslVersion.match(ver_re);
|
|
if (ver_num !== null) {
|
|
if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0";
|
|
glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")";
|
|
}
|
|
ret = allocate(intArrayFromString(glslVersion), "i8", ALLOC_NORMAL);
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return 0;
|
|
}
|
|
GL.stringCache[name_] = ret;
|
|
return ret;
|
|
}
|
|
function _glGetStringi(name, index) {
|
|
if (GLctx.canvas.GLctxObject.version < 2) {
|
|
GL.recordError(1282);
|
|
return 0;
|
|
}
|
|
var stringiCache = GL.stringiCache[name];
|
|
if (stringiCache) {
|
|
if (index < 0 || index >= stringiCache.length) {
|
|
GL.recordError(1281);
|
|
return 0;
|
|
}
|
|
return stringiCache[index];
|
|
}
|
|
switch (name) {
|
|
case 7939:
|
|
var exts = GLctx.getSupportedExtensions();
|
|
var gl_exts = [];
|
|
for (var i = 0; i < exts.length; ++i) {
|
|
gl_exts.push(allocate(intArrayFromString(exts[i]), "i8", ALLOC_NORMAL));
|
|
gl_exts.push(allocate(intArrayFromString("GL_" + exts[i]), "i8", ALLOC_NORMAL));
|
|
}
|
|
stringiCache = GL.stringiCache[name] = gl_exts;
|
|
if (index < 0 || index >= stringiCache.length) {
|
|
GL.recordError(1281);
|
|
return 0;
|
|
}
|
|
return stringiCache[index];
|
|
default:
|
|
GL.recordError(1280);
|
|
return 0;
|
|
}
|
|
}
|
|
function _glGetTexParameteriv(target, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
HEAP32[params >> 2] = GLctx.getTexParameter(target, pname);
|
|
}
|
|
function _glGetUniformBlockIndex(program, uniformBlockName) {
|
|
program = GL.programs[program];
|
|
uniformBlockName = Pointer_stringify(uniformBlockName);
|
|
return GLctx["getUniformBlockIndex"](program, uniformBlockName);
|
|
}
|
|
function _glGetUniformIndices(program, uniformCount, uniformNames, uniformIndices) {
|
|
if (!uniformIndices) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
var names = [];
|
|
for (var i = 0; i < uniformCount; i++) names.push(Pointer_stringify(HEAP32[(uniformNames + i * 4) >> 2]));
|
|
var result = GLctx["getUniformIndices"](program, names);
|
|
if (!result) return;
|
|
var len = result.length;
|
|
for (var i = 0; i < len; i++) {
|
|
HEAP32[(uniformIndices + i * 4) >> 2] = result[i];
|
|
}
|
|
}
|
|
function _glGetUniformLocation(program, name) {
|
|
name = Pointer_stringify(name);
|
|
var arrayOffset = 0;
|
|
if (name.indexOf("]", name.length - 1) !== -1) {
|
|
var ls = name.lastIndexOf("[");
|
|
var arrayIndex = name.slice(ls + 1, -1);
|
|
if (arrayIndex.length > 0) {
|
|
arrayOffset = parseInt(arrayIndex);
|
|
if (arrayOffset < 0) {
|
|
return -1;
|
|
}
|
|
}
|
|
name = name.slice(0, ls);
|
|
}
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
return -1;
|
|
}
|
|
var utable = ptable.uniforms;
|
|
var uniformInfo = utable[name];
|
|
if (uniformInfo && arrayOffset < uniformInfo[0]) {
|
|
return uniformInfo[1] + arrayOffset;
|
|
} else {
|
|
return -1;
|
|
}
|
|
}
|
|
function emscriptenWebGLGetUniform(program, location, params, type) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
|
|
if (typeof data == "number" || typeof data == "boolean") {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[params >> 2] = data;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[params >> 2] = data;
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetUniform() error, bad type: " + type;
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[(params + i * 4) >> 2] = data[i];
|
|
break;
|
|
case "Float":
|
|
HEAPF32[(params + i * 4) >> 2] = data[i];
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetUniform() error, bad type: " + type;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function _glGetUniformiv(program, location, params) {
|
|
emscriptenWebGLGetUniform(program, location, params, "Integer");
|
|
}
|
|
function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return;
|
|
}
|
|
var data = GLctx.getVertexAttrib(index, pname);
|
|
if (pname == 34975) {
|
|
HEAP32[params >> 2] = data["name"];
|
|
} else if (typeof data == "number" || typeof data == "boolean") {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[params >> 2] = data;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[params >> 2] = data;
|
|
break;
|
|
case "FloatToInteger":
|
|
HEAP32[params >> 2] = Math.fround(data);
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetVertexAttrib() error, bad type: " + type;
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[(params + i * 4) >> 2] = data[i];
|
|
break;
|
|
case "Float":
|
|
HEAPF32[(params + i * 4) >> 2] = data[i];
|
|
break;
|
|
case "FloatToInteger":
|
|
HEAP32[(params + i * 4) >> 2] = Math.fround(data[i]);
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetVertexAttrib() error, bad type: " + type;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function _glGetVertexAttribiv(index, pname, params) {
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, "FloatToInteger");
|
|
}
|
|
function _glInvalidateFramebuffer(target, numAttachments, attachments) {
|
|
var list = GL.tempFixedLengthArray[numAttachments];
|
|
for (var i = 0; i < numAttachments; i++) {
|
|
list[i] = HEAP32[(attachments + i * 4) >> 2];
|
|
}
|
|
GLctx["invalidateFramebuffer"](target, list);
|
|
}
|
|
function _glIsEnabled(x0) {
|
|
return GLctx["isEnabled"](x0);
|
|
}
|
|
function _glIsVertexArray(array) {
|
|
var vao = GL.vaos[array];
|
|
if (!vao) return 0;
|
|
return GLctx["isVertexArray"](vao);
|
|
}
|
|
function _glLinkProgram(program) {
|
|
GLctx.linkProgram(GL.programs[program]);
|
|
GL.programInfos[program] = null;
|
|
GL.populateUniformTable(program);
|
|
}
|
|
function _glMapBufferRange(target, offset, length, access) {
|
|
if (access != 26 && access != 10) {
|
|
err("glMapBufferRange is only supported when access is MAP_WRITE|INVALIDATE_BUFFER");
|
|
return 0;
|
|
}
|
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) {
|
|
GL.recordError(1280);
|
|
err("GL_INVALID_ENUM in glMapBufferRange");
|
|
return 0;
|
|
}
|
|
var mem = _malloc(length);
|
|
if (!mem) return 0;
|
|
GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)] = { offset: offset, length: length, mem: mem, access: access };
|
|
return mem;
|
|
}
|
|
function _glPixelStorei(pname, param) {
|
|
if (pname == 3333) {
|
|
GL.packAlignment = param;
|
|
} else if (pname == 3317) {
|
|
GL.unpackAlignment = param;
|
|
}
|
|
GLctx.pixelStorei(pname, param);
|
|
}
|
|
function _glPolygonOffset(x0, x1) {
|
|
GLctx["polygonOffset"](x0, x1);
|
|
}
|
|
function _glProgramBinary(program, binaryFormat, binary, length) {
|
|
GL.recordError(1280);
|
|
}
|
|
function _glProgramParameteri(program, pname, value) {
|
|
GL.recordError(1280);
|
|
}
|
|
function _glReadBuffer(x0) {
|
|
GLctx["readBuffer"](x0);
|
|
}
|
|
function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
|
|
function roundedToNextMultipleOf(x, y) {
|
|
return Math.floor((x + y - 1) / y) * y;
|
|
}
|
|
var plainRowSize = width * sizePerPixel;
|
|
var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
|
|
return height <= 0 ? 0 : (height - 1) * alignedRowSize + plainRowSize;
|
|
}
|
|
function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
|
|
var sizePerPixel;
|
|
var numChannels;
|
|
switch (format) {
|
|
case 6406:
|
|
case 6409:
|
|
case 6402:
|
|
case 6403:
|
|
case 36244:
|
|
numChannels = 1;
|
|
break;
|
|
case 6410:
|
|
case 33319:
|
|
case 33320:
|
|
numChannels = 2;
|
|
break;
|
|
case 6407:
|
|
case 35904:
|
|
case 36248:
|
|
numChannels = 3;
|
|
break;
|
|
case 6408:
|
|
case 35906:
|
|
case 36249:
|
|
numChannels = 4;
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return null;
|
|
}
|
|
switch (type) {
|
|
case 5121:
|
|
case 5120:
|
|
sizePerPixel = numChannels * 1;
|
|
break;
|
|
case 5123:
|
|
case 36193:
|
|
case 5131:
|
|
case 5122:
|
|
sizePerPixel = numChannels * 2;
|
|
break;
|
|
case 5125:
|
|
case 5126:
|
|
case 5124:
|
|
sizePerPixel = numChannels * 4;
|
|
break;
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
sizePerPixel = 4;
|
|
break;
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
sizePerPixel = 2;
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return null;
|
|
}
|
|
var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
|
|
switch (type) {
|
|
case 5120:
|
|
return HEAP8.subarray(pixels, pixels + bytes);
|
|
case 5121:
|
|
return HEAPU8.subarray(pixels, pixels + bytes);
|
|
case 5122:
|
|
return HEAP16.subarray(pixels >> 1, (pixels + bytes) >> 1);
|
|
case 5124:
|
|
return HEAP32.subarray(pixels >> 2, (pixels + bytes) >> 2);
|
|
case 5126:
|
|
return HEAPF32.subarray(pixels >> 2, (pixels + bytes) >> 2);
|
|
case 5125:
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
return HEAPU32.subarray(pixels >> 2, (pixels + bytes) >> 2);
|
|
case 5123:
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
case 36193:
|
|
case 5131:
|
|
return HEAPU16.subarray(pixels >> 1, (pixels + bytes) >> 1);
|
|
default:
|
|
GL.recordError(1280);
|
|
return null;
|
|
}
|
|
}
|
|
function emscriptenWebGLGetHeapForType(type) {
|
|
switch (type) {
|
|
case 5120:
|
|
return HEAP8;
|
|
case 5121:
|
|
return HEAPU8;
|
|
case 5122:
|
|
return HEAP16;
|
|
case 5123:
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
case 36193:
|
|
case 5131:
|
|
return HEAPU16;
|
|
case 5124:
|
|
return HEAP32;
|
|
case 5125:
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
return HEAPU32;
|
|
case 5126:
|
|
return HEAPF32;
|
|
default:
|
|
return null;
|
|
}
|
|
}
|
|
function emscriptenWebGLGetShiftForType(type) {
|
|
switch (type) {
|
|
case 5120:
|
|
case 5121:
|
|
return 0;
|
|
case 5122:
|
|
case 5123:
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
case 36193:
|
|
case 5131:
|
|
return 1;
|
|
case 5124:
|
|
case 5126:
|
|
case 5125:
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
return 2;
|
|
default:
|
|
return 0;
|
|
}
|
|
}
|
|
function _glReadPixels(x, y, width, height, format, type, pixels) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
if (GLctx.currentPixelPackBufferBinding) {
|
|
GLctx.readPixels(x, y, width, height, format, type, pixels);
|
|
} else {
|
|
GLctx.readPixels(x, y, width, height, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type));
|
|
}
|
|
return;
|
|
}
|
|
var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
|
|
if (!pixelData) {
|
|
GL.recordError(1280);
|
|
return;
|
|
}
|
|
GLctx.readPixels(x, y, width, height, format, type, pixelData);
|
|
}
|
|
function _glRenderbufferStorage(x0, x1, x2, x3) {
|
|
GLctx["renderbufferStorage"](x0, x1, x2, x3);
|
|
}
|
|
function _glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) {
|
|
GLctx["renderbufferStorageMultisample"](x0, x1, x2, x3, x4);
|
|
}
|
|
function _glSamplerParameteri(sampler, pname, param) {
|
|
GLctx["samplerParameteri"](sampler ? GL.samplers[sampler] : null, pname, param);
|
|
}
|
|
function _glScissor(x0, x1, x2, x3) {
|
|
GLctx["scissor"](x0, x1, x2, x3);
|
|
}
|
|
function _glShaderSource(shader, count, string, length) {
|
|
var source = GL.getSource(shader, count, string, length);
|
|
GLctx.shaderSource(GL.shaders[shader], source);
|
|
}
|
|
function _glStencilFuncSeparate(x0, x1, x2, x3) {
|
|
GLctx["stencilFuncSeparate"](x0, x1, x2, x3);
|
|
}
|
|
function _glStencilMask(x0) {
|
|
GLctx["stencilMask"](x0);
|
|
}
|
|
function _glStencilOpSeparate(x0, x1, x2, x3) {
|
|
GLctx["stencilOpSeparate"](x0, x1, x2, x3);
|
|
}
|
|
function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels);
|
|
} else if (pixels != 0) {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type));
|
|
} else {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null);
|
|
}
|
|
return;
|
|
}
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
|
|
}
|
|
function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, pixels);
|
|
} else if (pixels != 0) {
|
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type));
|
|
} else {
|
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, null);
|
|
}
|
|
}
|
|
function _glTexParameterf(x0, x1, x2) {
|
|
GLctx["texParameterf"](x0, x1, x2);
|
|
}
|
|
function _glTexParameteri(x0, x1, x2) {
|
|
GLctx["texParameteri"](x0, x1, x2);
|
|
}
|
|
function _glTexParameteriv(target, pname, params) {
|
|
var param = HEAP32[params >> 2];
|
|
GLctx.texParameteri(target, pname, param);
|
|
}
|
|
function _glTexStorage2D(x0, x1, x2, x3, x4) {
|
|
GLctx["texStorage2D"](x0, x1, x2, x3, x4);
|
|
}
|
|
function _glTexStorage3D(x0, x1, x2, x3, x4, x5) {
|
|
GLctx["texStorage3D"](x0, x1, x2, x3, x4, x5);
|
|
}
|
|
function _glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels);
|
|
} else if (pixels != 0) {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type));
|
|
} else {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, null);
|
|
}
|
|
return;
|
|
}
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
|
|
}
|
|
function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels);
|
|
} else if (pixels != 0) {
|
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type));
|
|
} else {
|
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null);
|
|
}
|
|
}
|
|
function _glTransformFeedbackVaryings(program, count, varyings, bufferMode) {
|
|
program = GL.programs[program];
|
|
var vars = [];
|
|
for (var i = 0; i < count; i++) vars.push(Pointer_stringify(HEAP32[(varyings + i * 4) >> 2]));
|
|
GLctx["transformFeedbackVaryings"](program, vars, bufferMode);
|
|
}
|
|
function _glUniform1fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform1fv(GL.uniforms[location], HEAPF32, value >> 2, count);
|
|
return;
|
|
}
|
|
var view;
|
|
if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[count - 1];
|
|
for (var i = 0; i < count; ++i) {
|
|
view[i] = HEAPF32[(value + 4 * i) >> 2];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, (value + count * 4) >> 2);
|
|
}
|
|
GLctx.uniform1fv(GL.uniforms[location], view);
|
|
}
|
|
function _glUniform1i(location, v0) {
|
|
GLctx.uniform1i(GL.uniforms[location], v0);
|
|
}
|
|
function _glUniform1iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32, value >> 2, count);
|
|
return;
|
|
}
|
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 4) >> 2));
|
|
}
|
|
function _glUniform1uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform1uiv(GL.uniforms[location], HEAPU32, value >> 2, count);
|
|
} else {
|
|
GLctx.uniform1uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 4) >> 2));
|
|
}
|
|
}
|
|
function _glUniform2fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform2fv(GL.uniforms[location], HEAPF32, value >> 2, count * 2);
|
|
return;
|
|
}
|
|
var view;
|
|
if (2 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[2 * count - 1];
|
|
for (var i = 0; i < 2 * count; i += 2) {
|
|
view[i] = HEAPF32[(value + 4 * i) >> 2];
|
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, (value + count * 8) >> 2);
|
|
}
|
|
GLctx.uniform2fv(GL.uniforms[location], view);
|
|
}
|
|
function _glUniform2iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32, value >> 2, count * 2);
|
|
return;
|
|
}
|
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 8) >> 2));
|
|
}
|
|
function _glUniform2uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform2uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 2);
|
|
} else {
|
|
GLctx.uniform2uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 8) >> 2));
|
|
}
|
|
}
|
|
function _glUniform3fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform3fv(GL.uniforms[location], HEAPF32, value >> 2, count * 3);
|
|
return;
|
|
}
|
|
var view;
|
|
if (3 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[3 * count - 1];
|
|
for (var i = 0; i < 3 * count; i += 3) {
|
|
view[i] = HEAPF32[(value + 4 * i) >> 2];
|
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2];
|
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, (value + count * 12) >> 2);
|
|
}
|
|
GLctx.uniform3fv(GL.uniforms[location], view);
|
|
}
|
|
function _glUniform3iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32, value >> 2, count * 3);
|
|
return;
|
|
}
|
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 12) >> 2));
|
|
}
|
|
function _glUniform3uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform3uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 3);
|
|
} else {
|
|
GLctx.uniform3uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 12) >> 2));
|
|
}
|
|
}
|
|
function _glUniform4fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform4fv(GL.uniforms[location], HEAPF32, value >> 2, count * 4);
|
|
return;
|
|
}
|
|
var view;
|
|
if (4 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[4 * count - 1];
|
|
for (var i = 0; i < 4 * count; i += 4) {
|
|
view[i] = HEAPF32[(value + 4 * i) >> 2];
|
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2];
|
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2];
|
|
view[i + 3] = HEAPF32[(value + (4 * i + 12)) >> 2];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, (value + count * 16) >> 2);
|
|
}
|
|
GLctx.uniform4fv(GL.uniforms[location], view);
|
|
}
|
|
function _glUniform4iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32, value >> 2, count * 4);
|
|
return;
|
|
}
|
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 16) >> 2));
|
|
}
|
|
function _glUniform4uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform4uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 4);
|
|
} else {
|
|
GLctx.uniform4uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 16) >> 2));
|
|
}
|
|
}
|
|
function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) {
|
|
program = GL.programs[program];
|
|
GLctx["uniformBlockBinding"](program, uniformBlockIndex, uniformBlockBinding);
|
|
}
|
|
function _glUniformMatrix3fv(location, count, transpose, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, HEAPF32, value >> 2, count * 9);
|
|
return;
|
|
}
|
|
var view;
|
|
if (9 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[9 * count - 1];
|
|
for (var i = 0; i < 9 * count; i += 9) {
|
|
view[i] = HEAPF32[(value + 4 * i) >> 2];
|
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2];
|
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2];
|
|
view[i + 3] = HEAPF32[(value + (4 * i + 12)) >> 2];
|
|
view[i + 4] = HEAPF32[(value + (4 * i + 16)) >> 2];
|
|
view[i + 5] = HEAPF32[(value + (4 * i + 20)) >> 2];
|
|
view[i + 6] = HEAPF32[(value + (4 * i + 24)) >> 2];
|
|
view[i + 7] = HEAPF32[(value + (4 * i + 28)) >> 2];
|
|
view[i + 8] = HEAPF32[(value + (4 * i + 32)) >> 2];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, (value + count * 36) >> 2);
|
|
}
|
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
|
|
}
|
|
function _glUniformMatrix4fv(location, count, transpose, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, HEAPF32, value >> 2, count * 16);
|
|
return;
|
|
}
|
|
var view;
|
|
if (16 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[16 * count - 1];
|
|
for (var i = 0; i < 16 * count; i += 16) {
|
|
view[i] = HEAPF32[(value + 4 * i) >> 2];
|
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2];
|
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2];
|
|
view[i + 3] = HEAPF32[(value + (4 * i + 12)) >> 2];
|
|
view[i + 4] = HEAPF32[(value + (4 * i + 16)) >> 2];
|
|
view[i + 5] = HEAPF32[(value + (4 * i + 20)) >> 2];
|
|
view[i + 6] = HEAPF32[(value + (4 * i + 24)) >> 2];
|
|
view[i + 7] = HEAPF32[(value + (4 * i + 28)) >> 2];
|
|
view[i + 8] = HEAPF32[(value + (4 * i + 32)) >> 2];
|
|
view[i + 9] = HEAPF32[(value + (4 * i + 36)) >> 2];
|
|
view[i + 10] = HEAPF32[(value + (4 * i + 40)) >> 2];
|
|
view[i + 11] = HEAPF32[(value + (4 * i + 44)) >> 2];
|
|
view[i + 12] = HEAPF32[(value + (4 * i + 48)) >> 2];
|
|
view[i + 13] = HEAPF32[(value + (4 * i + 52)) >> 2];
|
|
view[i + 14] = HEAPF32[(value + (4 * i + 56)) >> 2];
|
|
view[i + 15] = HEAPF32[(value + (4 * i + 60)) >> 2];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, (value + count * 64) >> 2);
|
|
}
|
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
|
|
}
|
|
function _glUnmapBuffer(target) {
|
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) {
|
|
GL.recordError(1280);
|
|
err("GL_INVALID_ENUM in glUnmapBuffer");
|
|
return 0;
|
|
}
|
|
var buffer = emscriptenWebGLGetBufferBinding(target);
|
|
var mapping = GL.mappedBuffers[buffer];
|
|
if (!mapping) {
|
|
GL.recordError(1282);
|
|
Module.printError("buffer was never mapped in glUnmapBuffer");
|
|
return 0;
|
|
}
|
|
GL.mappedBuffers[buffer] = null;
|
|
if (!(mapping.access & 16))
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8, mapping.mem, mapping.length);
|
|
} else {
|
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem, mapping.mem + mapping.length));
|
|
}
|
|
_free(mapping.mem);
|
|
return 1;
|
|
}
|
|
function _glUseProgram(program) {
|
|
GLctx.useProgram(program ? GL.programs[program] : null);
|
|
}
|
|
function _glValidateProgram(program) {
|
|
GLctx.validateProgram(GL.programs[program]);
|
|
}
|
|
function _glVertexAttrib4f(x0, x1, x2, x3, x4) {
|
|
GLctx["vertexAttrib4f"](x0, x1, x2, x3, x4);
|
|
}
|
|
function _glVertexAttrib4fv(index, v) {
|
|
GLctx.vertexAttrib4f(index, HEAPF32[v >> 2], HEAPF32[(v + 4) >> 2], HEAPF32[(v + 8) >> 2], HEAPF32[(v + 12) >> 2]);
|
|
}
|
|
function _glVertexAttribIPointer(index, size, type, stride, ptr) {
|
|
var cb = GL.currentContext.clientBuffers[index];
|
|
if (!GL.currArrayBuffer) {
|
|
cb.size = size;
|
|
cb.type = type;
|
|
cb.normalized = false;
|
|
cb.stride = stride;
|
|
cb.ptr = ptr;
|
|
cb.clientside = true;
|
|
return;
|
|
}
|
|
cb.clientside = false;
|
|
GLctx.vertexAttribIPointer(index, size, type, stride, ptr);
|
|
}
|
|
function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
|
|
GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
|
|
}
|
|
function _glViewport(x0, x1, x2, x3) {
|
|
GLctx["viewport"](x0, x1, x2, x3);
|
|
}
|
|
var ___tm_current = STATICTOP;
|
|
STATICTOP += 48;
|
|
var ___tm_timezone = allocate(intArrayFromString("GMT"), "i8", ALLOC_STATIC);
|
|
function _gmtime_r(time, tmPtr) {
|
|
var date = new Date(HEAP32[time >> 2] * 1e3);
|
|
HEAP32[tmPtr >> 2] = date.getUTCSeconds();
|
|
HEAP32[(tmPtr + 4) >> 2] = date.getUTCMinutes();
|
|
HEAP32[(tmPtr + 8) >> 2] = date.getUTCHours();
|
|
HEAP32[(tmPtr + 12) >> 2] = date.getUTCDate();
|
|
HEAP32[(tmPtr + 16) >> 2] = date.getUTCMonth();
|
|
HEAP32[(tmPtr + 20) >> 2] = date.getUTCFullYear() - 1900;
|
|
HEAP32[(tmPtr + 24) >> 2] = date.getUTCDay();
|
|
HEAP32[(tmPtr + 36) >> 2] = 0;
|
|
HEAP32[(tmPtr + 32) >> 2] = 0;
|
|
var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
|
|
var yday = ((date.getTime() - start) / (1e3 * 60 * 60 * 24)) | 0;
|
|
HEAP32[(tmPtr + 28) >> 2] = yday;
|
|
HEAP32[(tmPtr + 40) >> 2] = ___tm_timezone;
|
|
return tmPtr;
|
|
}
|
|
function _gmtime(time) {
|
|
return _gmtime_r(time, ___tm_current);
|
|
}
|
|
var _llvm_ceil_f32 = Math_ceil;
|
|
var _llvm_ceil_f64 = Math_ceil;
|
|
function _llvm_copysign_f64(x, y) {
|
|
return y < 0 || (y === 0 && 1 / y < 0) ? -Math_abs(x) : Math_abs(x);
|
|
}
|
|
function _llvm_cttz_i32(x) {
|
|
x = x | 0;
|
|
return (x ? (31 - (Math_clz32(x ^ (x - 1)) | 0)) | 0 : 32) | 0;
|
|
}
|
|
function _llvm_eh_typeid_for(type) {
|
|
return type;
|
|
}
|
|
function _llvm_exp2_f32(x) {
|
|
return Math.pow(2, x);
|
|
}
|
|
var _llvm_fabs_f32 = Math_abs;
|
|
var _llvm_fabs_f64 = Math_abs;
|
|
var _llvm_floor_f32 = Math_floor;
|
|
var _llvm_floor_f64 = Math_floor;
|
|
function _llvm_log10_f32(x) {
|
|
return Math.log(x) / Math.LN10;
|
|
}
|
|
function _llvm_log10_f64() {
|
|
return _llvm_log10_f32.apply(null, arguments);
|
|
}
|
|
function _llvm_log2_f32(x) {
|
|
return Math.log(x) / Math.LN2;
|
|
}
|
|
var _llvm_pow_f64 = Math_pow;
|
|
var _llvm_sqrt_f32 = Math_sqrt;
|
|
function _llvm_trap() {
|
|
abort("trap!");
|
|
}
|
|
var _llvm_trunc_f32 = Math_trunc;
|
|
function _tzset() {
|
|
if (_tzset.called) return;
|
|
_tzset.called = true;
|
|
HEAP32[__get_timezone() >> 2] = new Date().getTimezoneOffset() * 60;
|
|
var currentYear = new Date().getFullYear();
|
|
var winter = new Date(currentYear, 0, 1);
|
|
var summer = new Date(currentYear, 6, 1);
|
|
HEAP32[__get_daylight() >> 2] = Number(winter.getTimezoneOffset() != summer.getTimezoneOffset());
|
|
function extractZone(date) {
|
|
var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
|
|
return match ? match[1] : "GMT";
|
|
}
|
|
var winterName = extractZone(winter);
|
|
var summerName = extractZone(summer);
|
|
var winterNamePtr = allocate(intArrayFromString(winterName), "i8", ALLOC_NORMAL);
|
|
var summerNamePtr = allocate(intArrayFromString(summerName), "i8", ALLOC_NORMAL);
|
|
if (summer.getTimezoneOffset() < winter.getTimezoneOffset()) {
|
|
HEAP32[__get_tzname() >> 2] = winterNamePtr;
|
|
HEAP32[(__get_tzname() + 4) >> 2] = summerNamePtr;
|
|
} else {
|
|
HEAP32[__get_tzname() >> 2] = summerNamePtr;
|
|
HEAP32[(__get_tzname() + 4) >> 2] = winterNamePtr;
|
|
}
|
|
}
|
|
function _localtime_r(time, tmPtr) {
|
|
_tzset();
|
|
var date = new Date(HEAP32[time >> 2] * 1e3);
|
|
HEAP32[tmPtr >> 2] = date.getSeconds();
|
|
HEAP32[(tmPtr + 4) >> 2] = date.getMinutes();
|
|
HEAP32[(tmPtr + 8) >> 2] = date.getHours();
|
|
HEAP32[(tmPtr + 12) >> 2] = date.getDate();
|
|
HEAP32[(tmPtr + 16) >> 2] = date.getMonth();
|
|
HEAP32[(tmPtr + 20) >> 2] = date.getFullYear() - 1900;
|
|
HEAP32[(tmPtr + 24) >> 2] = date.getDay();
|
|
var start = new Date(date.getFullYear(), 0, 1);
|
|
var yday = ((date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24)) | 0;
|
|
HEAP32[(tmPtr + 28) >> 2] = yday;
|
|
HEAP32[(tmPtr + 36) >> 2] = -(date.getTimezoneOffset() * 60);
|
|
var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
|
|
var winterOffset = start.getTimezoneOffset();
|
|
var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0;
|
|
HEAP32[(tmPtr + 32) >> 2] = dst;
|
|
var zonePtr = HEAP32[(__get_tzname() + (dst ? 4 : 0)) >> 2];
|
|
HEAP32[(tmPtr + 40) >> 2] = zonePtr;
|
|
return tmPtr;
|
|
}
|
|
function _localtime(time) {
|
|
return _localtime_r(time, ___tm_current);
|
|
}
|
|
function _emscripten_memcpy_big(dest, src, num) {
|
|
HEAPU8.set(HEAPU8.subarray(src, src + num), dest);
|
|
return dest;
|
|
}
|
|
function _mktime(tmPtr) {
|
|
_tzset();
|
|
var date = new Date(HEAP32[(tmPtr + 20) >> 2] + 1900, HEAP32[(tmPtr + 16) >> 2], HEAP32[(tmPtr + 12) >> 2], HEAP32[(tmPtr + 8) >> 2], HEAP32[(tmPtr + 4) >> 2], HEAP32[tmPtr >> 2], 0);
|
|
var dst = HEAP32[(tmPtr + 32) >> 2];
|
|
var guessedOffset = date.getTimezoneOffset();
|
|
var start = new Date(date.getFullYear(), 0, 1);
|
|
var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
|
|
var winterOffset = start.getTimezoneOffset();
|
|
var dstOffset = Math.min(winterOffset, summerOffset);
|
|
if (dst < 0) {
|
|
HEAP32[(tmPtr + 32) >> 2] = Number(summerOffset != winterOffset && dstOffset == guessedOffset);
|
|
} else if (dst > 0 != (dstOffset == guessedOffset)) {
|
|
var nonDstOffset = Math.max(winterOffset, summerOffset);
|
|
var trueOffset = dst > 0 ? dstOffset : nonDstOffset;
|
|
date.setTime(date.getTime() + (trueOffset - guessedOffset) * 6e4);
|
|
}
|
|
HEAP32[(tmPtr + 24) >> 2] = date.getDay();
|
|
var yday = ((date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24)) | 0;
|
|
HEAP32[(tmPtr + 28) >> 2] = yday;
|
|
return (date.getTime() / 1e3) | 0;
|
|
}
|
|
function _usleep(useconds) {
|
|
var msec = useconds / 1e3;
|
|
if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]) {
|
|
var start = self["performance"]["now"]();
|
|
while (self["performance"]["now"]() - start < msec) {}
|
|
} else {
|
|
var start = Date.now();
|
|
while (Date.now() - start < msec) {}
|
|
}
|
|
return 0;
|
|
}
|
|
function _nanosleep(rqtp, rmtp) {
|
|
var seconds = HEAP32[rqtp >> 2];
|
|
var nanoseconds = HEAP32[(rqtp + 4) >> 2];
|
|
if (rmtp !== 0) {
|
|
HEAP32[rmtp >> 2] = 0;
|
|
HEAP32[(rmtp + 4) >> 2] = 0;
|
|
}
|
|
return _usleep(seconds * 1e6 + nanoseconds / 1e3);
|
|
}
|
|
var PTHREAD_SPECIFIC = {};
|
|
function _pthread_getspecific(key) {
|
|
return PTHREAD_SPECIFIC[key] || 0;
|
|
}
|
|
var PTHREAD_SPECIFIC_NEXT_KEY = 1;
|
|
function _pthread_key_create(key, destructor) {
|
|
if (key == 0) {
|
|
return ERRNO_CODES.EINVAL;
|
|
}
|
|
HEAP32[key >> 2] = PTHREAD_SPECIFIC_NEXT_KEY;
|
|
PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY] = 0;
|
|
PTHREAD_SPECIFIC_NEXT_KEY++;
|
|
return 0;
|
|
}
|
|
function _pthread_once(ptr, func) {
|
|
if (!_pthread_once.seen) _pthread_once.seen = {};
|
|
if (ptr in _pthread_once.seen) return;
|
|
Module["dynCall_v"](func);
|
|
_pthread_once.seen[ptr] = 1;
|
|
}
|
|
function _pthread_setspecific(key, value) {
|
|
if (!(key in PTHREAD_SPECIFIC)) {
|
|
return ERRNO_CODES.EINVAL;
|
|
}
|
|
PTHREAD_SPECIFIC[key] = value;
|
|
return 0;
|
|
}
|
|
function _setenv(envname, envval, overwrite) {
|
|
if (envname === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
var name = Pointer_stringify(envname);
|
|
var val = Pointer_stringify(envval);
|
|
if (name === "" || name.indexOf("=") !== -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
if (ENV.hasOwnProperty(name) && !overwrite) return 0;
|
|
ENV[name] = val;
|
|
___buildEnvironment(__get_environ());
|
|
return 0;
|
|
}
|
|
function _sigaction(signum, act, oldact) {
|
|
return 0;
|
|
}
|
|
function _sigemptyset(set) {
|
|
HEAP32[set >> 2] = 0;
|
|
return 0;
|
|
}
|
|
function __isLeapYear(year) {
|
|
return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
|
|
}
|
|
function __arraySum(array, index) {
|
|
var sum = 0;
|
|
for (var i = 0; i <= index; sum += array[i++]);
|
|
return sum;
|
|
}
|
|
var __MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
|
|
var __MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
|
|
function __addDays(date, days) {
|
|
var newDate = new Date(date.getTime());
|
|
while (days > 0) {
|
|
var leap = __isLeapYear(newDate.getFullYear());
|
|
var currentMonth = newDate.getMonth();
|
|
var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth];
|
|
if (days > daysInCurrentMonth - newDate.getDate()) {
|
|
days -= daysInCurrentMonth - newDate.getDate() + 1;
|
|
newDate.setDate(1);
|
|
if (currentMonth < 11) {
|
|
newDate.setMonth(currentMonth + 1);
|
|
} else {
|
|
newDate.setMonth(0);
|
|
newDate.setFullYear(newDate.getFullYear() + 1);
|
|
}
|
|
} else {
|
|
newDate.setDate(newDate.getDate() + days);
|
|
return newDate;
|
|
}
|
|
}
|
|
return newDate;
|
|
}
|
|
function _strftime(s, maxsize, format, tm) {
|
|
var tm_zone = HEAP32[(tm + 40) >> 2];
|
|
var date = { tm_sec: HEAP32[tm >> 2], tm_min: HEAP32[(tm + 4) >> 2], tm_hour: HEAP32[(tm + 8) >> 2], tm_mday: HEAP32[(tm + 12) >> 2], tm_mon: HEAP32[(tm + 16) >> 2], tm_year: HEAP32[(tm + 20) >> 2], tm_wday: HEAP32[(tm + 24) >> 2], tm_yday: HEAP32[(tm + 28) >> 2], tm_isdst: HEAP32[(tm + 32) >> 2], tm_gmtoff: HEAP32[(tm + 36) >> 2], tm_zone: tm_zone ? Pointer_stringify(tm_zone) : "" };
|
|
var pattern = Pointer_stringify(format);
|
|
var EXPANSION_RULES_1 = { "%c": "%a %b %d %H:%M:%S %Y", "%D": "%m/%d/%y", "%F": "%Y-%m-%d", "%h": "%b", "%r": "%I:%M:%S %p", "%R": "%H:%M", "%T": "%H:%M:%S", "%x": "%m/%d/%y", "%X": "%H:%M:%S" };
|
|
for (var rule in EXPANSION_RULES_1) {
|
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]);
|
|
}
|
|
var WEEKDAYS = ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"];
|
|
var MONTHS = ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"];
|
|
function leadingSomething(value, digits, character) {
|
|
var str = typeof value === "number" ? value.toString() : value || "";
|
|
while (str.length < digits) {
|
|
str = character[0] + str;
|
|
}
|
|
return str;
|
|
}
|
|
function leadingNulls(value, digits) {
|
|
return leadingSomething(value, digits, "0");
|
|
}
|
|
function compareByDay(date1, date2) {
|
|
function sgn(value) {
|
|
return value < 0 ? -1 : value > 0 ? 1 : 0;
|
|
}
|
|
var compare;
|
|
if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) {
|
|
if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) {
|
|
compare = sgn(date1.getDate() - date2.getDate());
|
|
}
|
|
}
|
|
return compare;
|
|
}
|
|
function getFirstWeekStartDate(janFourth) {
|
|
switch (janFourth.getDay()) {
|
|
case 0:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 29);
|
|
case 1:
|
|
return janFourth;
|
|
case 2:
|
|
return new Date(janFourth.getFullYear(), 0, 3);
|
|
case 3:
|
|
return new Date(janFourth.getFullYear(), 0, 2);
|
|
case 4:
|
|
return new Date(janFourth.getFullYear(), 0, 1);
|
|
case 5:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 31);
|
|
case 6:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 30);
|
|
}
|
|
}
|
|
function getWeekBasedYear(date) {
|
|
var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
|
|
var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
|
|
var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4);
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
|
|
if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
|
|
return thisDate.getFullYear() + 1;
|
|
} else {
|
|
return thisDate.getFullYear();
|
|
}
|
|
} else {
|
|
return thisDate.getFullYear() - 1;
|
|
}
|
|
}
|
|
var EXPANSION_RULES_2 = {
|
|
"%a": function (date) {
|
|
return WEEKDAYS[date.tm_wday].substring(0, 3);
|
|
},
|
|
"%A": function (date) {
|
|
return WEEKDAYS[date.tm_wday];
|
|
},
|
|
"%b": function (date) {
|
|
return MONTHS[date.tm_mon].substring(0, 3);
|
|
},
|
|
"%B": function (date) {
|
|
return MONTHS[date.tm_mon];
|
|
},
|
|
"%C": function (date) {
|
|
var year = date.tm_year + 1900;
|
|
return leadingNulls((year / 100) | 0, 2);
|
|
},
|
|
"%d": function (date) {
|
|
return leadingNulls(date.tm_mday, 2);
|
|
},
|
|
"%e": function (date) {
|
|
return leadingSomething(date.tm_mday, 2, " ");
|
|
},
|
|
"%g": function (date) {
|
|
return getWeekBasedYear(date).toString().substring(2);
|
|
},
|
|
"%G": function (date) {
|
|
return getWeekBasedYear(date);
|
|
},
|
|
"%H": function (date) {
|
|
return leadingNulls(date.tm_hour, 2);
|
|
},
|
|
"%I": function (date) {
|
|
var twelveHour = date.tm_hour;
|
|
if (twelveHour == 0) twelveHour = 12;
|
|
else if (twelveHour > 12) twelveHour -= 12;
|
|
return leadingNulls(twelveHour, 2);
|
|
},
|
|
"%j": function (date) {
|
|
return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3);
|
|
},
|
|
"%m": function (date) {
|
|
return leadingNulls(date.tm_mon + 1, 2);
|
|
},
|
|
"%M": function (date) {
|
|
return leadingNulls(date.tm_min, 2);
|
|
},
|
|
"%n": function () {
|
|
return "\n";
|
|
},
|
|
"%p": function (date) {
|
|
if (date.tm_hour >= 0 && date.tm_hour < 12) {
|
|
return "AM";
|
|
} else {
|
|
return "PM";
|
|
}
|
|
},
|
|
"%S": function (date) {
|
|
return leadingNulls(date.tm_sec, 2);
|
|
},
|
|
"%t": function () {
|
|
return "\t";
|
|
},
|
|
"%u": function (date) {
|
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0);
|
|
return day.getDay() || 7;
|
|
},
|
|
"%U": function (date) {
|
|
var janFirst = new Date(date.tm_year + 1900, 0, 1);
|
|
var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7 - janFirst.getDay());
|
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
|
|
if (compareByDay(firstSunday, endDate) < 0) {
|
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
|
|
var firstSundayUntilEndJanuary = 31 - firstSunday.getDate();
|
|
var days = firstSundayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
|
|
return leadingNulls(Math.ceil(days / 7), 2);
|
|
}
|
|
return compareByDay(firstSunday, janFirst) === 0 ? "01" : "00";
|
|
},
|
|
"%V": function (date) {
|
|
var janFourthThisYear = new Date(date.tm_year + 1900, 0, 4);
|
|
var janFourthNextYear = new Date(date.tm_year + 1901, 0, 4);
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
var endDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
|
|
if (compareByDay(endDate, firstWeekStartThisYear) < 0) {
|
|
return "53";
|
|
}
|
|
if (compareByDay(firstWeekStartNextYear, endDate) <= 0) {
|
|
return "01";
|
|
}
|
|
var daysDifference;
|
|
if (firstWeekStartThisYear.getFullYear() < date.tm_year + 1900) {
|
|
daysDifference = date.tm_yday + 32 - firstWeekStartThisYear.getDate();
|
|
} else {
|
|
daysDifference = date.tm_yday + 1 - firstWeekStartThisYear.getDate();
|
|
}
|
|
return leadingNulls(Math.ceil(daysDifference / 7), 2);
|
|
},
|
|
"%w": function (date) {
|
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0);
|
|
return day.getDay();
|
|
},
|
|
"%W": function (date) {
|
|
var janFirst = new Date(date.tm_year, 0, 1);
|
|
var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7 - janFirst.getDay() + 1);
|
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
|
|
if (compareByDay(firstMonday, endDate) < 0) {
|
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
|
|
var firstMondayUntilEndJanuary = 31 - firstMonday.getDate();
|
|
var days = firstMondayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
|
|
return leadingNulls(Math.ceil(days / 7), 2);
|
|
}
|
|
return compareByDay(firstMonday, janFirst) === 0 ? "01" : "00";
|
|
},
|
|
"%y": function (date) {
|
|
return (date.tm_year + 1900).toString().substring(2);
|
|
},
|
|
"%Y": function (date) {
|
|
return date.tm_year + 1900;
|
|
},
|
|
"%z": function (date) {
|
|
var off = date.tm_gmtoff;
|
|
var ahead = off >= 0;
|
|
off = Math.abs(off) / 60;
|
|
off = (off / 60) * 100 + (off % 60);
|
|
return (ahead ? "+" : "-") + String("0000" + off).slice(-4);
|
|
},
|
|
"%Z": function (date) {
|
|
return date.tm_zone;
|
|
},
|
|
"%%": function () {
|
|
return "%";
|
|
},
|
|
};
|
|
for (var rule in EXPANSION_RULES_2) {
|
|
if (pattern.indexOf(rule) >= 0) {
|
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date));
|
|
}
|
|
}
|
|
var bytes = intArrayFromString(pattern, false);
|
|
if (bytes.length > maxsize) {
|
|
return 0;
|
|
}
|
|
writeArrayToMemory(bytes, s);
|
|
return bytes.length - 1;
|
|
}
|
|
function _sysconf(name) {
|
|
switch (name) {
|
|
case 30:
|
|
return PAGE_SIZE;
|
|
case 85:
|
|
var maxHeapSize = 2 * 1024 * 1024 * 1024 - 65536;
|
|
return maxHeapSize / PAGE_SIZE;
|
|
case 132:
|
|
case 133:
|
|
case 12:
|
|
case 137:
|
|
case 138:
|
|
case 15:
|
|
case 235:
|
|
case 16:
|
|
case 17:
|
|
case 18:
|
|
case 19:
|
|
case 20:
|
|
case 149:
|
|
case 13:
|
|
case 10:
|
|
case 236:
|
|
case 153:
|
|
case 9:
|
|
case 21:
|
|
case 22:
|
|
case 159:
|
|
case 154:
|
|
case 14:
|
|
case 77:
|
|
case 78:
|
|
case 139:
|
|
case 80:
|
|
case 81:
|
|
case 82:
|
|
case 68:
|
|
case 67:
|
|
case 164:
|
|
case 11:
|
|
case 29:
|
|
case 47:
|
|
case 48:
|
|
case 95:
|
|
case 52:
|
|
case 51:
|
|
case 46:
|
|
return 200809;
|
|
case 79:
|
|
return 0;
|
|
case 27:
|
|
case 246:
|
|
case 127:
|
|
case 128:
|
|
case 23:
|
|
case 24:
|
|
case 160:
|
|
case 161:
|
|
case 181:
|
|
case 182:
|
|
case 242:
|
|
case 183:
|
|
case 184:
|
|
case 243:
|
|
case 244:
|
|
case 245:
|
|
case 165:
|
|
case 178:
|
|
case 179:
|
|
case 49:
|
|
case 50:
|
|
case 168:
|
|
case 169:
|
|
case 175:
|
|
case 170:
|
|
case 171:
|
|
case 172:
|
|
case 97:
|
|
case 76:
|
|
case 32:
|
|
case 173:
|
|
case 35:
|
|
return -1;
|
|
case 176:
|
|
case 177:
|
|
case 7:
|
|
case 155:
|
|
case 8:
|
|
case 157:
|
|
case 125:
|
|
case 126:
|
|
case 92:
|
|
case 93:
|
|
case 129:
|
|
case 130:
|
|
case 131:
|
|
case 94:
|
|
case 91:
|
|
return 1;
|
|
case 74:
|
|
case 60:
|
|
case 69:
|
|
case 70:
|
|
case 4:
|
|
return 1024;
|
|
case 31:
|
|
case 42:
|
|
case 72:
|
|
return 32;
|
|
case 87:
|
|
case 26:
|
|
case 33:
|
|
return 2147483647;
|
|
case 34:
|
|
case 1:
|
|
return 47839;
|
|
case 38:
|
|
case 36:
|
|
return 99;
|
|
case 43:
|
|
case 37:
|
|
return 2048;
|
|
case 0:
|
|
return 2097152;
|
|
case 3:
|
|
return 65536;
|
|
case 28:
|
|
return 32768;
|
|
case 44:
|
|
return 32767;
|
|
case 75:
|
|
return 16384;
|
|
case 39:
|
|
return 1e3;
|
|
case 89:
|
|
return 700;
|
|
case 71:
|
|
return 256;
|
|
case 40:
|
|
return 255;
|
|
case 2:
|
|
return 100;
|
|
case 180:
|
|
return 64;
|
|
case 25:
|
|
return 20;
|
|
case 5:
|
|
return 16;
|
|
case 6:
|
|
return 6;
|
|
case 73:
|
|
return 4;
|
|
case 84: {
|
|
if (typeof navigator === "object") return navigator["hardwareConcurrency"] || 1;
|
|
return 1;
|
|
}
|
|
}
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
function _time(ptr) {
|
|
var ret = (Date.now() / 1e3) | 0;
|
|
if (ptr) {
|
|
HEAP32[ptr >> 2] = ret;
|
|
}
|
|
return ret;
|
|
}
|
|
function _unsetenv(name) {
|
|
if (name === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
name = Pointer_stringify(name);
|
|
if (name === "" || name.indexOf("=") !== -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
if (ENV.hasOwnProperty(name)) {
|
|
delete ENV[name];
|
|
___buildEnvironment(__get_environ());
|
|
}
|
|
return 0;
|
|
}
|
|
function _utime(path, times) {
|
|
var time;
|
|
if (times) {
|
|
var offset = 4;
|
|
time = HEAP32[(times + offset) >> 2];
|
|
time *= 1e3;
|
|
} else {
|
|
time = Date.now();
|
|
}
|
|
path = Pointer_stringify(path);
|
|
try {
|
|
FS.utime(path, time, time);
|
|
return 0;
|
|
} catch (e) {
|
|
FS.handleFSError(e);
|
|
return -1;
|
|
}
|
|
}
|
|
FS.staticInit();
|
|
__ATINIT__.unshift(function () {
|
|
if (!Module["noFSInit"] && !FS.init.initialized) FS.init();
|
|
});
|
|
__ATMAIN__.push(function () {
|
|
FS.ignorePermissions = false;
|
|
});
|
|
__ATEXIT__.push(function () {
|
|
FS.quit();
|
|
});
|
|
Module["FS_createPath"] = FS.createPath;
|
|
Module["FS_createDataFile"] = FS.createDataFile;
|
|
__ATINIT__.unshift(function () {
|
|
TTY.init();
|
|
});
|
|
__ATEXIT__.push(function () {
|
|
TTY.shutdown();
|
|
});
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
var fs = require("fs");
|
|
var NODEJS_PATH = require("path");
|
|
NODEFS.staticInit();
|
|
}
|
|
__ATINIT__.push(function () {
|
|
SOCKFS.root = FS.mount(SOCKFS, {}, null);
|
|
});
|
|
__ATINIT__.push(function () {
|
|
PIPEFS.root = FS.mount(PIPEFS, {}, null);
|
|
});
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
_emscripten_get_now = function _emscripten_get_now_actual() {
|
|
var t = process["hrtime"]();
|
|
return t[0] * 1e3 + t[1] / 1e6;
|
|
};
|
|
} else if (typeof dateNow !== "undefined") {
|
|
_emscripten_get_now = dateNow;
|
|
} else if (typeof self === "object" && self["performance"] && typeof self["performance"]["now"] === "function") {
|
|
_emscripten_get_now = function () {
|
|
return self["performance"]["now"]();
|
|
};
|
|
} else if (typeof performance === "object" && typeof performance["now"] === "function") {
|
|
_emscripten_get_now = function () {
|
|
return performance["now"]();
|
|
};
|
|
} else {
|
|
_emscripten_get_now = Date.now;
|
|
}
|
|
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) {
|
|
err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead.");
|
|
Module["requestFullScreen"] = Module["requestFullscreen"];
|
|
Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice);
|
|
};
|
|
Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) {
|
|
Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
|
|
};
|
|
Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) {
|
|
Browser.requestAnimationFrame(func);
|
|
};
|
|
Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) {
|
|
Browser.setCanvasSize(width, height, noUpdates);
|
|
};
|
|
Module["pauseMainLoop"] = function Module_pauseMainLoop() {
|
|
Browser.mainLoop.pause();
|
|
};
|
|
Module["resumeMainLoop"] = function Module_resumeMainLoop() {
|
|
Browser.mainLoop.resume();
|
|
};
|
|
Module["getUserMedia"] = function Module_getUserMedia() {
|
|
Browser.getUserMedia();
|
|
};
|
|
Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) {
|
|
return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes);
|
|
};
|
|
JSEvents.staticInit();
|
|
var GLctx;
|
|
GL.init();
|
|
DYNAMICTOP_PTR = staticAlloc(4);
|
|
STACK_BASE = STACKTOP = alignMemory(STATICTOP);
|
|
STACK_MAX = STACK_BASE + TOTAL_STACK;
|
|
DYNAMIC_BASE = alignMemory(STACK_MAX);
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = DYNAMIC_BASE;
|
|
staticSealed = true;
|
|
function intArrayFromString(stringy, dontAddNull, length) {
|
|
var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
|
|
var u8array = new Array(len);
|
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
|
|
if (dontAddNull) u8array.length = numBytesWritten;
|
|
return u8array;
|
|
}
|
|
Module["wasmTableSize"] = 135497;
|
|
Module["wasmMaxTableSize"] = 135497;
|
|
function invoke_dddi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dddi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ddi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ddi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_dfi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dfi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_di(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_di"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_diddi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diddi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_didi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_didi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_dii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dii"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_diii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_diiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_diiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_diiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diiji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_diji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diji"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_dji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dji"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_f(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_f"](index);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fdi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fdi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ff(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ff"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fff(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fff"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ffffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ffffi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fffi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fffifffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffifffi"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ffi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ffi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ffii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ffii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fi(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fi"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fidi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fif(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fif"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiffffii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiffffii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiffffiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiffffiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiffi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fifi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fifi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fifii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fifii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fii"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiif(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiif"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiifi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiifi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiifii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiifii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiiiif(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiif"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_fji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fji"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_i(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_i"](index);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iddi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iddi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_idi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_idii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_idiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_idiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_idiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idiiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ifffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifffi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iffi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iffi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ifi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ifiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ifiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ii(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ii"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiddi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiddi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiddiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiddiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iidii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iidiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iidiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iidiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidiiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iif(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iif"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iifffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifffi"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiffi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiffiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiffiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iifi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iifii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iifiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iii"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiid(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiid"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiidi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiidi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiidii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiidii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiidiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiidiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiif(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiif"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiff"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiifi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiifii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiifiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiifiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiidii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiidii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiifi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifi"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiifii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiifiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiifiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiffiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiffiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiifi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiifi"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiifffiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiifffiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiffiiiiiiiiiffffiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiffiiiiiiiiiffffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiffiiiiiiiiiffffiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23, a24) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiffiiiiiiiiiffffiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23, a24);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiffiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiffiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiij(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiij"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiiji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiji"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiij(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiij"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiiji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiji"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiijii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiijii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiijiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiijjii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiijjii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiijjiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiijjiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiij(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiij"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijji"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijjii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijjii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijjiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijjiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijjiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijjiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiijjiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijjiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iij(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iij"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iiji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiji"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijji"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijjii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijjii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijjiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijjiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iijjiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijjiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ij(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ij"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_iji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iji"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ijii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ijiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ijiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ijj(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijj"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ijji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_j(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_j"](index);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jdi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jdi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jdii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jdii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jfi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jfi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_ji(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ji"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jidi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jidii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jidii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jii"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jiji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiji"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jijii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jijiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jijj(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijj"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jijji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijji"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jji"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jjii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jjii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jjji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jjji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_jjjji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jjjji"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_v(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_v"](index);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vd(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vd"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vdi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vdi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vdiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vdiiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vf(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vf"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vff(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vff"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vffff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vffff"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vfi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vfi"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vi(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vi"](index, a1);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vid(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vid"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vidi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vidiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vidiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vidji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vidji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vif(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vif"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viff(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viff"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifff"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffff(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffff"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifffffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffffi"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffi"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffffii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffffiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffi"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifffii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viffiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifi"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vifiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vii"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viid(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viid"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viidi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viidi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viidii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viidii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viif(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viif"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiff"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifff(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifff"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffffffffiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffffffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifffffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffi"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffffiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifffi"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffi"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiffii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifi"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viifiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viii"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiidi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiidi"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiif(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiif"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiifffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifffi"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiffi"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiifi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifi"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiififfi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiififfi"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiififi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiififi"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiifii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiifiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiif(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiif"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiffffii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiffffii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiifii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiif(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiif"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiffi"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiffii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiffii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiifi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiifi"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiif(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiif"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiifi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiifi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiiiji(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiji"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiijiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiijiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiiji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiji"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiijji(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiijji"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiijjjji(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiijjjji"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viij(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viij"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijiijiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijiijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijijii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijijii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijijiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijj(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijj"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijji"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijjii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijjii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijjiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijjiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viijjji(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijjji"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vij(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vij"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_viji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viji"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijiji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijiji"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijj(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijj"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijji"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijjii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijjii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijjiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijjiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vijjji(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijjji"](index, a1, a2, a3, a4, a5, a6, a7, a8);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vj(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vj"](index, a1, a2);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vji"](index, a1, a2, a3);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjii"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjiii"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjiiii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjiiiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjj(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjj"](index, a1, a2, a3, a4);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjji"](index, a1, a2, a3, a4, a5);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjjii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjjii"](index, a1, a2, a3, a4, a5, a6);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
function invoke_vjjiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjjiii"](index, a1, a2, a3, a4, a5, a6, a7);
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
Module.asmGlobalArg = {};
|
|
Module.asmLibraryArg = { abort: abort, assert: assert, enlargeMemory: enlargeMemory, getTotalMemory: getTotalMemory, abortOnCannotGrowMemory: abortOnCannotGrowMemory, invoke_dddi: invoke_dddi, invoke_ddi: invoke_ddi, invoke_dfi: invoke_dfi, invoke_di: invoke_di, invoke_diddi: invoke_diddi, invoke_didi: invoke_didi, invoke_dii: invoke_dii, invoke_diii: invoke_diii, invoke_diiii: invoke_diiii, invoke_diiiii: invoke_diiiii, invoke_diiji: invoke_diiji, invoke_diji: invoke_diji, invoke_dji: invoke_dji, invoke_f: invoke_f, invoke_fdi: invoke_fdi, invoke_ff: invoke_ff, invoke_fff: invoke_fff, invoke_ffffi: invoke_ffffi, invoke_fffi: invoke_fffi, invoke_fffifffi: invoke_fffifffi, invoke_ffi: invoke_ffi, invoke_ffii: invoke_ffii, invoke_fi: invoke_fi, invoke_fidi: invoke_fidi, invoke_fif: invoke_fif, invoke_fiffffii: invoke_fiffffii, invoke_fiffffiiiiii: invoke_fiffffiiiiii, invoke_fiffi: invoke_fiffi, invoke_fifi: invoke_fifi, invoke_fifii: invoke_fifii, invoke_fii: invoke_fii, invoke_fiif: invoke_fiif, invoke_fiifi: invoke_fiifi, invoke_fiifii: invoke_fiifii, invoke_fiii: invoke_fiii, invoke_fiiii: invoke_fiiii, invoke_fiiiif: invoke_fiiiif, invoke_fiiiii: invoke_fiiiii, invoke_fiiiiii: invoke_fiiiiii, invoke_fji: invoke_fji, invoke_i: invoke_i, invoke_iddi: invoke_iddi, invoke_idi: invoke_idi, invoke_idii: invoke_idii, invoke_idiii: invoke_idiii, invoke_idiiii: invoke_idiiii, invoke_idiiiii: invoke_idiiiii, invoke_ifffi: invoke_ifffi, invoke_iffi: invoke_iffi, invoke_ifi: invoke_ifi, invoke_ifiii: invoke_ifiii, invoke_ifiiii: invoke_ifiiii, invoke_ii: invoke_ii, invoke_iiddi: invoke_iiddi, invoke_iiddiii: invoke_iiddiii, invoke_iidi: invoke_iidi, invoke_iidii: invoke_iidii, invoke_iidiii: invoke_iidiii, invoke_iidiiii: invoke_iidiiii, invoke_iidiiiii: invoke_iidiiiii, invoke_iif: invoke_iif, invoke_iifffi: invoke_iifffi, invoke_iiffi: invoke_iiffi, invoke_iiffiii: invoke_iiffiii, invoke_iifi: invoke_iifi, invoke_iifii: invoke_iifii, invoke_iifiii: invoke_iifiii, invoke_iii: invoke_iii, invoke_iiid: invoke_iiid, invoke_iiidi: invoke_iiidi, invoke_iiidii: invoke_iiidii, invoke_iiidiii: invoke_iiidiii, invoke_iiif: invoke_iiif, invoke_iiiff: invoke_iiiff, invoke_iiifi: invoke_iiifi, invoke_iiifii: invoke_iiifii, invoke_iiifiii: invoke_iiifiii, invoke_iiifiiii: invoke_iiifiiii, invoke_iiii: invoke_iiii, invoke_iiiidii: invoke_iiiidii, invoke_iiiifi: invoke_iiiifi, invoke_iiiifii: invoke_iiiifii, invoke_iiiifiii: invoke_iiiifiii, invoke_iiiifiiii: invoke_iiiifiiii, invoke_iiiii: invoke_iiiii, invoke_iiiiiffiiii: invoke_iiiiiffiiii, invoke_iiiiifi: invoke_iiiiifi, invoke_iiiiii: invoke_iiiiii, invoke_iiiiiifffiiifiii: invoke_iiiiiifffiiifiii, invoke_iiiiiiffiiiiiiiiiffffiii: invoke_iiiiiiffiiiiiiiiiffffiii, invoke_iiiiiiffiiiiiiiiiffffiiii: invoke_iiiiiiffiiiiiiiiiffffiiii, invoke_iiiiiiffiiiiiiiiiiiiiii: invoke_iiiiiiffiiiiiiiiiiiiiii, invoke_iiiiiii: invoke_iiiiiii, invoke_iiiiiiii: invoke_iiiiiiii, invoke_iiiiiiiii: invoke_iiiiiiiii, invoke_iiiiiiiiii: invoke_iiiiiiiiii, invoke_iiiiiiiiiii: invoke_iiiiiiiiiii, invoke_iiiiiiiiiiii: invoke_iiiiiiiiiiii, invoke_iiiiiiiiiiiii: invoke_iiiiiiiiiiiii, invoke_iiiiiiiiiiiiii: invoke_iiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiiiiiiii, invoke_iiiiiiiiiiiiiiiiiiiii: invoke_iiiiiiiiiiiiiiiiiiiii, invoke_iiiiij: invoke_iiiiij, invoke_iiiiiji: invoke_iiiiiji, invoke_iiiij: invoke_iiiij, invoke_iiiiji: invoke_iiiiji, invoke_iiiijii: invoke_iiiijii, invoke_iiiijiii: invoke_iiiijiii, invoke_iiiijjii: invoke_iiiijjii, invoke_iiiijjiiii: invoke_iiiijjiiii, invoke_iiij: invoke_iiij, invoke_iiiji: invoke_iiiji, invoke_iiijii: invoke_iiijii, invoke_iiijiii: invoke_iiijiii, invoke_iiijiiii: invoke_iiijiiii, invoke_iiijiiiii: invoke_iiijiiiii, invoke_iiijiiiiii: invoke_iiijiiiiii, invoke_iiijiiiiiii: invoke_iiijiiiiiii, invoke_iiijji: invoke_iiijji, invoke_iiijjii: invoke_iiijjii, invoke_iiijjiii: invoke_iiijjiii, invoke_iiijjiiii: invoke_iiijjiiii, invoke_iiijjiiiii: invoke_iiijjiiiii, invoke_iiijjiiiiii: invoke_iiijjiiiiii, invoke_iij: invoke_iij, invoke_iiji: invoke_iiji, invoke_iijii: invoke_iijii, invoke_iijiii: invoke_iijiii, invoke_iijiiii: invoke_iijiiii, invoke_iijiiiii: invoke_iijiiiii, invoke_iijji: invoke_iijji, invoke_iijjii: invoke_iijjii, invoke_iijjiii: invoke_iijjiii, invoke_iijjiiii: invoke_iijjiiii, invoke_iijjiiiii: invoke_iijjiiiii, invoke_ij: invoke_ij, invoke_iji: invoke_iji, invoke_ijii: invoke_ijii, invoke_ijiii: invoke_ijiii, invoke_ijiiii: invoke_ijiiii, invoke_ijj: invoke_ijj, invoke_ijji: invoke_ijji, invoke_j: invoke_j, invoke_jdi: invoke_jdi, invoke_jdii: invoke_jdii, invoke_jfi: invoke_jfi, invoke_ji: invoke_ji, invoke_jidi: invoke_jidi, invoke_jidii: invoke_jidii, invoke_jii: invoke_jii, invoke_jiii: invoke_jiii, invoke_jiiii: invoke_jiiii, invoke_jiiiii: invoke_jiiiii, invoke_jiiiiii: invoke_jiiiiii, invoke_jiiiiiii: invoke_jiiiiiii, invoke_jiiiiiiiii: invoke_jiiiiiiiii, invoke_jiiiiiiiiii: invoke_jiiiiiiiiii, invoke_jiiji: invoke_jiiji, invoke_jiji: invoke_jiji, invoke_jijii: invoke_jijii, invoke_jijiii: invoke_jijiii, invoke_jijj: invoke_jijj, invoke_jijji: invoke_jijji, invoke_jji: invoke_jji, invoke_jjii: invoke_jjii, invoke_jjji: invoke_jjji, invoke_jjjji: invoke_jjjji, invoke_v: invoke_v, invoke_vd: invoke_vd, invoke_vdi: invoke_vdi, invoke_vdiiiii: invoke_vdiiiii, invoke_vf: invoke_vf, invoke_vff: invoke_vff, invoke_vffff: invoke_vffff, invoke_vfi: invoke_vfi, invoke_vi: invoke_vi, invoke_vid: invoke_vid, invoke_vidi: invoke_vidi, invoke_vidiii: invoke_vidiii, invoke_vidji: invoke_vidji, invoke_vif: invoke_vif, invoke_viff: invoke_viff, invoke_vifff: invoke_vifff, invoke_viffff: invoke_viffff, invoke_vifffffi: invoke_vifffffi, invoke_viffffi: invoke_viffffi, invoke_viffffii: invoke_viffffii, invoke_viffffiii: invoke_viffffiii, invoke_vifffi: invoke_vifffi, invoke_vifffii: invoke_vifffii, invoke_viffi: invoke_viffi, invoke_viffii: invoke_viffii, invoke_viffiii: invoke_viffiii, invoke_vifi: invoke_vifi, invoke_vifii: invoke_vifii, invoke_vifiiii: invoke_vifiiii, invoke_vii: invoke_vii, invoke_viid: invoke_viid, invoke_viidi: invoke_viidi, invoke_viidii: invoke_viidii, invoke_viif: invoke_viif, invoke_viiff: invoke_viiff, invoke_viifff: invoke_viifff, invoke_viiffffffffi: invoke_viiffffffffi, invoke_viiffffffffiii: invoke_viiffffffffiii, invoke_viifffffffi: invoke_viifffffffi, invoke_viiffffffi: invoke_viiffffffi, invoke_viifffffi: invoke_viifffffi, invoke_viiffffi: invoke_viiffffi, invoke_viiffffiiiiii: invoke_viiffffiiiiii, invoke_viifffi: invoke_viifffi, invoke_viiffi: invoke_viiffi, invoke_viiffii: invoke_viiffii, invoke_viifi: invoke_viifi, invoke_viifii: invoke_viifii, invoke_viifiii: invoke_viifiii, invoke_viifiiii: invoke_viifiiii, invoke_viii: invoke_viii, invoke_viiidi: invoke_viiidi, invoke_viiif: invoke_viiif, invoke_viiifffi: invoke_viiifffi, invoke_viiiffi: invoke_viiiffi, invoke_viiifi: invoke_viiifi, invoke_viiififfi: invoke_viiififfi, invoke_viiififi: invoke_viiififi, invoke_viiifii: invoke_viiifii, invoke_viiifiii: invoke_viiifiii, invoke_viiii: invoke_viiii, invoke_viiiif: invoke_viiiif, invoke_viiiiffffii: invoke_viiiiffffii, invoke_viiiifii: invoke_viiiifii, invoke_viiiii: invoke_viiiii, invoke_viiiiif: invoke_viiiiif, invoke_viiiiiffi: invoke_viiiiiffi, invoke_viiiiiffii: invoke_viiiiiffii, invoke_viiiiifi: invoke_viiiiifi, invoke_viiiiii: invoke_viiiiii, invoke_viiiiiif: invoke_viiiiiif, invoke_viiiiiii: invoke_viiiiiii, invoke_viiiiiiifi: invoke_viiiiiiifi, invoke_viiiiiiii: invoke_viiiiiiii, invoke_viiiiiiiii: invoke_viiiiiiiii, invoke_viiiiiiiiii: invoke_viiiiiiiiii, invoke_viiiiiiiiiii: invoke_viiiiiiiiiii, invoke_viiiiiiiiiiii: invoke_viiiiiiiiiiii, invoke_viiiiiiiiiiiii: invoke_viiiiiiiiiiiii, invoke_viiiiiiiiiiiiii: invoke_viiiiiiiiiiiiii, invoke_viiiiiiiiiiiiiii: invoke_viiiiiiiiiiiiiii, invoke_viiiiiiiiiiiiiiii: invoke_viiiiiiiiiiiiiiii, invoke_viiiiiiiiiiiiiiiii: invoke_viiiiiiiiiiiiiiiii, invoke_viiiiiiiiiiiiiiiiii: invoke_viiiiiiiiiiiiiiiiii, invoke_viiiiiji: invoke_viiiiiji, invoke_viiiijiiii: invoke_viiiijiiii, invoke_viiiji: invoke_viiiji, invoke_viiijji: invoke_viiijji, invoke_viiijjjji: invoke_viiijjjji, invoke_viij: invoke_viij, invoke_viiji: invoke_viiji, invoke_viijii: invoke_viijii, invoke_viijiii: invoke_viijiii, invoke_viijiiii: invoke_viijiiii, invoke_viijiiiii: invoke_viijiiiii, invoke_viijiijiii: invoke_viijiijiii, invoke_viijijii: invoke_viijijii, invoke_viijijiii: invoke_viijijiii, invoke_viijj: invoke_viijj, invoke_viijji: invoke_viijji, invoke_viijjii: invoke_viijjii, invoke_viijjiii: invoke_viijjiii, invoke_viijjiiii: invoke_viijjiiii, invoke_viijjji: invoke_viijjji, invoke_vij: invoke_vij, invoke_viji: invoke_viji, invoke_vijii: invoke_vijii, invoke_vijiii: invoke_vijiii, invoke_vijiiii: invoke_vijiiii, invoke_vijiiiii: invoke_vijiiiii, invoke_vijiji: invoke_vijiji, invoke_vijj: invoke_vijj, invoke_vijji: invoke_vijji, invoke_vijjii: invoke_vijjii, invoke_vijjiii: invoke_vijjiii, invoke_vijjiiii: invoke_vijjiiii, invoke_vijjji: invoke_vijjji, invoke_vj: invoke_vj, invoke_vji: invoke_vji, invoke_vjii: invoke_vjii, invoke_vjiii: invoke_vjiii, invoke_vjiiii: invoke_vjiiii, invoke_vjiiiii: invoke_vjiiiii, invoke_vjiiiiiii: invoke_vjiiiiiii, invoke_vjiiiiiiii: invoke_vjiiiiiiii, invoke_vjj: invoke_vjj, invoke_vjji: invoke_vjji, invoke_vjjii: invoke_vjjii, invoke_vjjiii: invoke_vjjiii, _CopyToClipboardSDK: _CopyToClipboardSDK, _GameplayStartSDK: _GameplayStartSDK, _GameplayStopSDK: _GameplayStopSDK, _GetOverlayHtmlInputFieldValue: _GetOverlayHtmlInputFieldValue, _GetScreenshotSDK: _GetScreenshotSDK, _GetUrlParametersSDK: _GetUrlParametersSDK, _HappyTimeSDK: _HappyTimeSDK, _HideUnityScreenIfHtmlOverlayCant: _HideUnityScreenIfHtmlOverlayCant, _InitSDK: _InitSDK, _InitSDKLite: _InitSDKLite, _IsOverlayDialogHtmlActive: _IsOverlayDialogHtmlActive, _IsOverlayDialogHtmlCanceled: _IsOverlayDialogHtmlCanceled, _IsRunningOnEdgeBrowser: _IsRunningOnEdgeBrowser, _JS_Cursor_SetImage: _JS_Cursor_SetImage, _JS_Cursor_SetShow: _JS_Cursor_SetShow, _JS_Eval_ClearInterval: _JS_Eval_ClearInterval, _JS_Eval_OpenURL: _JS_Eval_OpenURL, _JS_Eval_SetInterval: _JS_Eval_SetInterval, _JS_FileSystem_Initialize: _JS_FileSystem_Initialize, _JS_FileSystem_Sync: _JS_FileSystem_Sync, _JS_Log_Dump: _JS_Log_Dump, _JS_Log_StackTrace: _JS_Log_StackTrace, _JS_Sound_Create_Channel: _JS_Sound_Create_Channel, _JS_Sound_GetLength: _JS_Sound_GetLength, _JS_Sound_GetLoadState: _JS_Sound_GetLoadState, _JS_Sound_Init: _JS_Sound_Init, _JS_Sound_Load: _JS_Sound_Load, _JS_Sound_Load_PCM: _JS_Sound_Load_PCM, _JS_Sound_Play: _JS_Sound_Play, _JS_Sound_ReleaseInstance: _JS_Sound_ReleaseInstance, _JS_Sound_ResumeIfNeeded: _JS_Sound_ResumeIfNeeded, _JS_Sound_Set3D: _JS_Sound_Set3D, _JS_Sound_SetListenerOrientation: _JS_Sound_SetListenerOrientation, _JS_Sound_SetListenerPosition: _JS_Sound_SetListenerPosition, _JS_Sound_SetLoop: _JS_Sound_SetLoop, _JS_Sound_SetLoopPoints: _JS_Sound_SetLoopPoints, _JS_Sound_SetPitch: _JS_Sound_SetPitch, _JS_Sound_SetPosition: _JS_Sound_SetPosition, _JS_Sound_SetVolume: _JS_Sound_SetVolume, _JS_Sound_Stop: _JS_Sound_Stop, _JS_SystemInfo_GetBrowserName: _JS_SystemInfo_GetBrowserName, _JS_SystemInfo_GetBrowserVersionString: _JS_SystemInfo_GetBrowserVersionString, _JS_SystemInfo_GetCanvasClientSize: _JS_SystemInfo_GetCanvasClientSize, _JS_SystemInfo_GetDocumentURL: _JS_SystemInfo_GetDocumentURL, _JS_SystemInfo_GetGPUInfo: _JS_SystemInfo_GetGPUInfo, _JS_SystemInfo_GetLanguage: _JS_SystemInfo_GetLanguage, _JS_SystemInfo_GetMatchWebGLToCanvasSize: _JS_SystemInfo_GetMatchWebGLToCanvasSize, _JS_SystemInfo_GetMemory: _JS_SystemInfo_GetMemory, _JS_SystemInfo_GetOS: _JS_SystemInfo_GetOS, _JS_SystemInfo_GetPreferredDevicePixelRatio: _JS_SystemInfo_GetPreferredDevicePixelRatio, _JS_SystemInfo_GetScreenSize: _JS_SystemInfo_GetScreenSize, _JS_SystemInfo_GetStreamingAssetsURL: _JS_SystemInfo_GetStreamingAssetsURL, _JS_SystemInfo_HasCursorLock: _JS_SystemInfo_HasCursorLock, _JS_SystemInfo_HasFullscreen: _JS_SystemInfo_HasFullscreen, _JS_SystemInfo_HasWebGL: _JS_SystemInfo_HasWebGL, _JS_WebRequest_Abort: _JS_WebRequest_Abort, _JS_WebRequest_Create: _JS_WebRequest_Create, _JS_WebRequest_GetResponseHeaders: _JS_WebRequest_GetResponseHeaders, _JS_WebRequest_Release: _JS_WebRequest_Release, _JS_WebRequest_Send: _JS_WebRequest_Send, _JS_WebRequest_SetProgressHandler: _JS_WebRequest_SetProgressHandler, _JS_WebRequest_SetRequestHeader: _JS_WebRequest_SetRequestHeader, _JS_WebRequest_SetResponseHandler: _JS_WebRequest_SetResponseHandler, _JS_WebRequest_SetTimeout: _JS_WebRequest_SetTimeout, _NativeDialogPrompt: _NativeDialogPrompt, _RequestAdSDK: _RequestAdSDK, _RequestBannersSDK: _RequestBannersSDK, _RequestInviteUrlSDK: _RequestInviteUrlSDK, _SetupOverlayDialogHtml: _SetupOverlayDialogHtml, __ZSt18uncaught_exceptionv: __ZSt18uncaught_exceptionv, ___atomic_compare_exchange_8: ___atomic_compare_exchange_8, ___atomic_fetch_add_8: ___atomic_fetch_add_8, ___buildEnvironment: ___buildEnvironment, ___cxa_allocate_exception: ___cxa_allocate_exception, ___cxa_begin_catch: ___cxa_begin_catch, ___cxa_end_catch: ___cxa_end_catch, ___cxa_find_matching_catch: ___cxa_find_matching_catch, ___cxa_find_matching_catch_2: ___cxa_find_matching_catch_2, ___cxa_find_matching_catch_3: ___cxa_find_matching_catch_3, ___cxa_find_matching_catch_4: ___cxa_find_matching_catch_4, ___cxa_free_exception: ___cxa_free_exception, ___cxa_pure_virtual: ___cxa_pure_virtual, ___cxa_rethrow: ___cxa_rethrow, ___cxa_throw: ___cxa_throw, ___gxx_personality_v0: ___gxx_personality_v0, ___lock: ___lock, ___map_file: ___map_file, ___resumeException: ___resumeException, ___setErrNo: ___setErrNo, ___syscall10: ___syscall10, ___syscall102: ___syscall102, ___syscall122: ___syscall122, ___syscall140: ___syscall140, ___syscall142: ___syscall142, ___syscall145: ___syscall145, ___syscall146: ___syscall146, ___syscall15: ___syscall15, ___syscall168: ___syscall168, ___syscall183: ___syscall183, ___syscall192: ___syscall192, ___syscall193: ___syscall193, ___syscall194: ___syscall194, ___syscall195: ___syscall195, ___syscall196: ___syscall196, ___syscall197: ___syscall197, ___syscall199: ___syscall199, ___syscall202: ___syscall202, ___syscall220: ___syscall220, ___syscall221: ___syscall221, ___syscall268: ___syscall268, ___syscall3: ___syscall3, ___syscall33: ___syscall33, ___syscall38: ___syscall38, ___syscall39: ___syscall39, ___syscall4: ___syscall4, ___syscall40: ___syscall40, ___syscall42: ___syscall42, ___syscall5: ___syscall5, ___syscall54: ___syscall54, ___syscall6: ___syscall6, ___syscall63: ___syscall63, ___syscall77: ___syscall77, ___syscall85: ___syscall85, ___syscall91: ___syscall91, ___unlock: ___unlock, __addDays: __addDays, __arraySum: __arraySum, __emscripten_do_request_fullscreen: __emscripten_do_request_fullscreen, __emscripten_sample_gamepad_data: __emscripten_sample_gamepad_data, __emscripten_traverse_stack: __emscripten_traverse_stack, __exit: __exit, __formatString: __formatString, __inet_ntop4_raw: __inet_ntop4_raw, __inet_ntop6_raw: __inet_ntop6_raw, __inet_pton4_raw: __inet_pton4_raw, __inet_pton6_raw: __inet_pton6_raw, __isLeapYear: __isLeapYear, __read_sockaddr: __read_sockaddr, __reallyNegative: __reallyNegative, __setLetterbox: __setLetterbox, __write_sockaddr: __write_sockaddr, _abort: _abort, _atexit: _atexit, _clock: _clock, _clock_getres: _clock_getres, _clock_gettime: _clock_gettime, _difftime: _difftime, _dlclose: _dlclose, _dlopen: _dlopen, _dlsym: _dlsym, _emscripten_asm_const_i: _emscripten_asm_const_i, _emscripten_asm_const_ii: _emscripten_asm_const_ii, _emscripten_asm_const_sync_on_main_thread_i: _emscripten_asm_const_sync_on_main_thread_i, _emscripten_cancel_main_loop: _emscripten_cancel_main_loop, _emscripten_exit_fullscreen: _emscripten_exit_fullscreen, _emscripten_exit_pointerlock: _emscripten_exit_pointerlock, _emscripten_get_callstack_js: _emscripten_get_callstack_js, _emscripten_get_canvas_element_size: _emscripten_get_canvas_element_size, _emscripten_get_canvas_element_size_calling_thread: _emscripten_get_canvas_element_size_calling_thread, _emscripten_get_canvas_element_size_main_thread: _emscripten_get_canvas_element_size_main_thread, _emscripten_get_fullscreen_status: _emscripten_get_fullscreen_status, _emscripten_get_gamepad_status: _emscripten_get_gamepad_status, _emscripten_get_main_loop_timing: _emscripten_get_main_loop_timing, _emscripten_get_now: _emscripten_get_now, _emscripten_get_now_is_monotonic: _emscripten_get_now_is_monotonic, _emscripten_get_now_res: _emscripten_get_now_res, _emscripten_get_num_gamepads: _emscripten_get_num_gamepads, _emscripten_has_threading_support: _emscripten_has_threading_support, _emscripten_html5_remove_all_event_listeners: _emscripten_html5_remove_all_event_listeners, _emscripten_is_webgl_context_lost: _emscripten_is_webgl_context_lost, _emscripten_log: _emscripten_log, _emscripten_log_js: _emscripten_log_js, _emscripten_longjmp: _emscripten_longjmp, _emscripten_memcpy_big: _emscripten_memcpy_big, _emscripten_num_logical_cores: _emscripten_num_logical_cores, _emscripten_request_fullscreen: _emscripten_request_fullscreen, _emscripten_request_pointerlock: _emscripten_request_pointerlock, _emscripten_set_blur_callback_on_thread: _emscripten_set_blur_callback_on_thread, _emscripten_set_canvas_element_size: _emscripten_set_canvas_element_size, _emscripten_set_canvas_element_size_calling_thread: _emscripten_set_canvas_element_size_calling_thread, _emscripten_set_canvas_element_size_main_thread: _emscripten_set_canvas_element_size_main_thread, _emscripten_set_dblclick_callback_on_thread: _emscripten_set_dblclick_callback_on_thread, _emscripten_set_devicemotion_callback_on_thread: _emscripten_set_devicemotion_callback_on_thread, _emscripten_set_deviceorientation_callback_on_thread: _emscripten_set_deviceorientation_callback_on_thread, _emscripten_set_focus_callback_on_thread: _emscripten_set_focus_callback_on_thread, _emscripten_set_fullscreenchange_callback_on_thread: _emscripten_set_fullscreenchange_callback_on_thread, _emscripten_set_gamepadconnected_callback_on_thread: _emscripten_set_gamepadconnected_callback_on_thread, _emscripten_set_gamepaddisconnected_callback_on_thread: _emscripten_set_gamepaddisconnected_callback_on_thread, _emscripten_set_keydown_callback_on_thread: _emscripten_set_keydown_callback_on_thread, _emscripten_set_keypress_callback_on_thread: _emscripten_set_keypress_callback_on_thread, _emscripten_set_keyup_callback_on_thread: _emscripten_set_keyup_callback_on_thread, _emscripten_set_main_loop: _emscripten_set_main_loop, _emscripten_set_main_loop_timing: _emscripten_set_main_loop_timing, _emscripten_set_mousedown_callback_on_thread: _emscripten_set_mousedown_callback_on_thread, _emscripten_set_mousemove_callback_on_thread: _emscripten_set_mousemove_callback_on_thread, _emscripten_set_mouseup_callback_on_thread: _emscripten_set_mouseup_callback_on_thread, _emscripten_set_touchcancel_callback_on_thread: _emscripten_set_touchcancel_callback_on_thread, _emscripten_set_touchend_callback_on_thread: _emscripten_set_touchend_callback_on_thread, _emscripten_set_touchmove_callback_on_thread: _emscripten_set_touchmove_callback_on_thread, _emscripten_set_touchstart_callback_on_thread: _emscripten_set_touchstart_callback_on_thread, _emscripten_set_wheel_callback_on_thread: _emscripten_set_wheel_callback_on_thread, _emscripten_webgl_create_context: _emscripten_webgl_create_context, _emscripten_webgl_destroy_context: _emscripten_webgl_destroy_context, _emscripten_webgl_destroy_context_calling_thread: _emscripten_webgl_destroy_context_calling_thread, _emscripten_webgl_do_create_context: _emscripten_webgl_do_create_context, _emscripten_webgl_do_get_current_context: _emscripten_webgl_do_get_current_context, _emscripten_webgl_enable_extension: _emscripten_webgl_enable_extension, _emscripten_webgl_enable_extension_calling_thread: _emscripten_webgl_enable_extension_calling_thread, _emscripten_webgl_get_current_context: _emscripten_webgl_get_current_context, _emscripten_webgl_init_context_attributes: _emscripten_webgl_init_context_attributes, _emscripten_webgl_make_context_current: _emscripten_webgl_make_context_current, _exit: _exit, _flock: _flock, _getaddrinfo: _getaddrinfo, _getenv: _getenv, _getnameinfo: _getnameinfo, _getpagesize: _getpagesize, _getpwuid: _getpwuid, _gettimeofday: _gettimeofday, _glActiveTexture: _glActiveTexture, _glAttachShader: _glAttachShader, _glBeginQuery: _glBeginQuery, _glBeginTransformFeedback: _glBeginTransformFeedback, _glBindAttribLocation: _glBindAttribLocation, _glBindBuffer: _glBindBuffer, _glBindBufferBase: _glBindBufferBase, _glBindBufferRange: _glBindBufferRange, _glBindFramebuffer: _glBindFramebuffer, _glBindRenderbuffer: _glBindRenderbuffer, _glBindSampler: _glBindSampler, _glBindTexture: _glBindTexture, _glBindTransformFeedback: _glBindTransformFeedback, _glBindVertexArray: _glBindVertexArray, _glBlendEquation: _glBlendEquation, _glBlendEquationSeparate: _glBlendEquationSeparate, _glBlendFuncSeparate: _glBlendFuncSeparate, _glBlitFramebuffer: _glBlitFramebuffer, _glBufferData: _glBufferData, _glBufferSubData: _glBufferSubData, _glCheckFramebufferStatus: _glCheckFramebufferStatus, _glClear: _glClear, _glClearBufferfi: _glClearBufferfi, _glClearBufferfv: _glClearBufferfv, _glClearBufferuiv: _glClearBufferuiv, _glClearColor: _glClearColor, _glClearDepthf: _glClearDepthf, _glClearStencil: _glClearStencil, _glClientWaitSync: _glClientWaitSync, _glColorMask: _glColorMask, _glCompileShader: _glCompileShader, _glCompressedTexImage2D: _glCompressedTexImage2D, _glCompressedTexImage3D: _glCompressedTexImage3D, _glCompressedTexSubImage2D: _glCompressedTexSubImage2D, _glCompressedTexSubImage3D: _glCompressedTexSubImage3D, _glCopyBufferSubData: _glCopyBufferSubData, _glCopyTexImage2D: _glCopyTexImage2D, _glCopyTexSubImage2D: _glCopyTexSubImage2D, _glCreateProgram: _glCreateProgram, _glCreateShader: _glCreateShader, _glCullFace: _glCullFace, _glDeleteBuffers: _glDeleteBuffers, _glDeleteFramebuffers: _glDeleteFramebuffers, _glDeleteProgram: _glDeleteProgram, _glDeleteQueries: _glDeleteQueries, _glDeleteRenderbuffers: _glDeleteRenderbuffers, _glDeleteSamplers: _glDeleteSamplers, _glDeleteShader: _glDeleteShader, _glDeleteSync: _glDeleteSync, _glDeleteTextures: _glDeleteTextures, _glDeleteTransformFeedbacks: _glDeleteTransformFeedbacks, _glDeleteVertexArrays: _glDeleteVertexArrays, _glDepthFunc: _glDepthFunc, _glDepthMask: _glDepthMask, _glDetachShader: _glDetachShader, _glDisable: _glDisable, _glDisableVertexAttribArray: _glDisableVertexAttribArray, _glDrawArrays: _glDrawArrays, _glDrawArraysInstanced: _glDrawArraysInstanced, _glDrawBuffers: _glDrawBuffers, _glDrawElements: _glDrawElements, _glDrawElementsInstanced: _glDrawElementsInstanced, _glEnable: _glEnable, _glEnableVertexAttribArray: _glEnableVertexAttribArray, _glEndQuery: _glEndQuery, _glEndTransformFeedback: _glEndTransformFeedback, _glFenceSync: _glFenceSync, _glFinish: _glFinish, _glFlush: _glFlush, _glFlushMappedBufferRange: _glFlushMappedBufferRange, _glFramebufferRenderbuffer: _glFramebufferRenderbuffer, _glFramebufferTexture2D: _glFramebufferTexture2D, _glFramebufferTextureLayer: _glFramebufferTextureLayer, _glFrontFace: _glFrontFace, _glGenBuffers: _glGenBuffers, _glGenFramebuffers: _glGenFramebuffers, _glGenQueries: _glGenQueries, _glGenRenderbuffers: _glGenRenderbuffers, _glGenSamplers: _glGenSamplers, _glGenTextures: _glGenTextures, _glGenTransformFeedbacks: _glGenTransformFeedbacks, _glGenVertexArrays: _glGenVertexArrays, _glGenerateMipmap: _glGenerateMipmap, _glGetActiveAttrib: _glGetActiveAttrib, _glGetActiveUniform: _glGetActiveUniform, _glGetActiveUniformBlockName: _glGetActiveUniformBlockName, _glGetActiveUniformBlockiv: _glGetActiveUniformBlockiv, _glGetActiveUniformsiv: _glGetActiveUniformsiv, _glGetAttribLocation: _glGetAttribLocation, _glGetError: _glGetError, _glGetFramebufferAttachmentParameteriv: _glGetFramebufferAttachmentParameteriv, _glGetIntegeri_v: _glGetIntegeri_v, _glGetIntegerv: _glGetIntegerv, _glGetInternalformativ: _glGetInternalformativ, _glGetProgramBinary: _glGetProgramBinary, _glGetProgramInfoLog: _glGetProgramInfoLog, _glGetProgramiv: _glGetProgramiv, _glGetRenderbufferParameteriv: _glGetRenderbufferParameteriv, _glGetShaderInfoLog: _glGetShaderInfoLog, _glGetShaderPrecisionFormat: _glGetShaderPrecisionFormat, _glGetShaderSource: _glGetShaderSource, _glGetShaderiv: _glGetShaderiv, _glGetString: _glGetString, _glGetStringi: _glGetStringi, _glGetTexParameteriv: _glGetTexParameteriv, _glGetUniformBlockIndex: _glGetUniformBlockIndex, _glGetUniformIndices: _glGetUniformIndices, _glGetUniformLocation: _glGetUniformLocation, _glGetUniformiv: _glGetUniformiv, _glGetVertexAttribiv: _glGetVertexAttribiv, _glInvalidateFramebuffer: _glInvalidateFramebuffer, _glIsEnabled: _glIsEnabled, _glIsVertexArray: _glIsVertexArray, _glLinkProgram: _glLinkProgram, _glMapBufferRange: _glMapBufferRange, _glPixelStorei: _glPixelStorei, _glPolygonOffset: _glPolygonOffset, _glProgramBinary: _glProgramBinary, _glProgramParameteri: _glProgramParameteri, _glReadBuffer: _glReadBuffer, _glReadPixels: _glReadPixels, _glRenderbufferStorage: _glRenderbufferStorage, _glRenderbufferStorageMultisample: _glRenderbufferStorageMultisample, _glSamplerParameteri: _glSamplerParameteri, _glScissor: _glScissor, _glShaderSource: _glShaderSource, _glStencilFuncSeparate: _glStencilFuncSeparate, _glStencilMask: _glStencilMask, _glStencilOpSeparate: _glStencilOpSeparate, _glTexImage2D: _glTexImage2D, _glTexImage3D: _glTexImage3D, _glTexParameterf: _glTexParameterf, _glTexParameteri: _glTexParameteri, _glTexParameteriv: _glTexParameteriv, _glTexStorage2D: _glTexStorage2D, _glTexStorage3D: _glTexStorage3D, _glTexSubImage2D: _glTexSubImage2D, _glTexSubImage3D: _glTexSubImage3D, _glTransformFeedbackVaryings: _glTransformFeedbackVaryings, _glUniform1fv: _glUniform1fv, _glUniform1i: _glUniform1i, _glUniform1iv: _glUniform1iv, _glUniform1uiv: _glUniform1uiv, _glUniform2fv: _glUniform2fv, _glUniform2iv: _glUniform2iv, _glUniform2uiv: _glUniform2uiv, _glUniform3fv: _glUniform3fv, _glUniform3iv: _glUniform3iv, _glUniform3uiv: _glUniform3uiv, _glUniform4fv: _glUniform4fv, _glUniform4iv: _glUniform4iv, _glUniform4uiv: _glUniform4uiv, _glUniformBlockBinding: _glUniformBlockBinding, _glUniformMatrix3fv: _glUniformMatrix3fv, _glUniformMatrix4fv: _glUniformMatrix4fv, _glUnmapBuffer: _glUnmapBuffer, _glUseProgram: _glUseProgram, _glValidateProgram: _glValidateProgram, _glVertexAttrib4f: _glVertexAttrib4f, _glVertexAttrib4fv: _glVertexAttrib4fv, _glVertexAttribIPointer: _glVertexAttribIPointer, _glVertexAttribPointer: _glVertexAttribPointer, _glViewport: _glViewport, _gmtime: _gmtime, _gmtime_r: _gmtime_r, _llvm_ceil_f32: _llvm_ceil_f32, _llvm_ceil_f64: _llvm_ceil_f64, _llvm_copysign_f64: _llvm_copysign_f64, _llvm_cttz_i32: _llvm_cttz_i32, _llvm_eh_typeid_for: _llvm_eh_typeid_for, _llvm_exp2_f32: _llvm_exp2_f32, _llvm_fabs_f32: _llvm_fabs_f32, _llvm_fabs_f64: _llvm_fabs_f64, _llvm_floor_f32: _llvm_floor_f32, _llvm_floor_f64: _llvm_floor_f64, _llvm_log10_f32: _llvm_log10_f32, _llvm_log10_f64: _llvm_log10_f64, _llvm_log2_f32: _llvm_log2_f32, _llvm_pow_f64: _llvm_pow_f64, _llvm_sqrt_f32: _llvm_sqrt_f32, _llvm_trap: _llvm_trap, _llvm_trunc_f32: _llvm_trunc_f32, _localtime: _localtime, _localtime_r: _localtime_r, _longjmp: _longjmp, _mktime: _mktime, _nanosleep: _nanosleep, _pthread_getspecific: _pthread_getspecific, _pthread_key_create: _pthread_key_create, _pthread_once: _pthread_once, _pthread_setspecific: _pthread_setspecific, _setenv: _setenv, _sigaction: _sigaction, _sigemptyset: _sigemptyset, _strftime: _strftime, _sysconf: _sysconf, _time: _time, _tzset: _tzset, _unsetenv: _unsetenv, _usleep: _usleep, _utime: _utime, emscriptenWebGLComputeImageSize: emscriptenWebGLComputeImageSize, emscriptenWebGLGet: emscriptenWebGLGet, emscriptenWebGLGetBufferBinding: emscriptenWebGLGetBufferBinding, emscriptenWebGLGetHeapForType: emscriptenWebGLGetHeapForType, emscriptenWebGLGetIndexed: emscriptenWebGLGetIndexed, emscriptenWebGLGetShiftForType: emscriptenWebGLGetShiftForType, emscriptenWebGLGetTexPixelData: emscriptenWebGLGetTexPixelData, emscriptenWebGLGetUniform: emscriptenWebGLGetUniform, emscriptenWebGLGetVertexAttrib: emscriptenWebGLGetVertexAttrib, emscriptenWebGLValidateMapBufferTarget: emscriptenWebGLValidateMapBufferTarget, emscripten_get_canvas_element_size_js: emscripten_get_canvas_element_size_js, emscripten_set_canvas_element_size_js: emscripten_set_canvas_element_size_js, DYNAMICTOP_PTR: DYNAMICTOP_PTR, tempDoublePtr: tempDoublePtr, ABORT: ABORT, STACKTOP: STACKTOP, STACK_MAX: STACK_MAX };
|
|
var asm = Module["asm"](Module.asmGlobalArg, Module.asmLibraryArg, buffer);
|
|
Module["asm"] = asm;
|
|
var _SendMessage = (Module["_SendMessage"] = function () {
|
|
return Module["asm"]["_SendMessage"].apply(null, arguments);
|
|
});
|
|
var _SendMessageFloat = (Module["_SendMessageFloat"] = function () {
|
|
return Module["asm"]["_SendMessageFloat"].apply(null, arguments);
|
|
});
|
|
var _SendMessageString = (Module["_SendMessageString"] = function () {
|
|
return Module["asm"]["_SendMessageString"].apply(null, arguments);
|
|
});
|
|
var _SetFullscreen = (Module["_SetFullscreen"] = function () {
|
|
return Module["asm"]["_SetFullscreen"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AIScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AIScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AccessibilityScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AnimationClip_cpp = (Module["__GLOBAL__sub_I_AnimationClip_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AnimationClip_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AnimationScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AnimationScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AnimationScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AssetBundleFileSystem_cpp = (Module["__GLOBAL__sub_I_AssetBundleFileSystem_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AssetBundleFileSystem_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AssetBundleScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_AudioScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AudioScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_AudioScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_ClothScriptingClasses_cpp = (Module["__GLOBAL__sub_I_ClothScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_ClothScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_DirectorScriptingClasses_cpp = (Module["__GLOBAL__sub_I_DirectorScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_DirectorScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp = (Module["__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_External_Yoga_Yoga_0_cpp = (Module["__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp = (Module["__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_GUITexture_cpp = (Module["__GLOBAL__sub_I_GUITexture_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_GUITexture_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_GfxDeviceNull_cpp = (Module["__GLOBAL__sub_I_GfxDeviceNull_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_GfxDeviceNull_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_GridScriptingClasses_cpp = (Module["__GLOBAL__sub_I_GridScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_GridScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_IMGUIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_IMGUIScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_IMGUIScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_InputLegacyScriptingClasses_cpp = (Module["__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_InputScriptingClasses_cpp = (Module["__GLOBAL__sub_I_InputScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_InputScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_LogAssert_cpp = (Module["__GLOBAL__sub_I_LogAssert_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_LogAssert_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_gc_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_mono_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_os_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_os_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_os_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_utils_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_vm_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Mesh_cpp = (Module["__GLOBAL__sub_I_Mesh_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Mesh_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_0_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_2_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_7_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_7_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_7_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_3_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_3_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_3_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Cloth_0_cpp = (Module["__GLOBAL__sub_I_Modules_Cloth_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Cloth_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Grid_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Grid_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Grid_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_IMGUI_0_cpp = (Module["__GLOBAL__sub_I_Modules_IMGUI_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_IMGUI_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_IMGUI_1_cpp = (Module["__GLOBAL__sub_I_Modules_IMGUI_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_IMGUI_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Input_Private_0_cpp = (Module["__GLOBAL__sub_I_Modules_Input_Private_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Input_Private_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_ParticleSystem_0_cpp = (Module["__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics_0_cpp = (Module["__GLOBAL__sub_I_Modules_Physics_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics_2_cpp = (Module["__GLOBAL__sub_I_Modules_Physics_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Profiler_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp = (Module["__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Subsystems_0_cpp = (Module["__GLOBAL__sub_I_Modules_Subsystems_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Subsystems_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_2_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_3_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_VR_0_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp = (Module["__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Tilemap_0_cpp = (Module["__GLOBAL__sub_I_Modules_Tilemap_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Tilemap_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UI_0_cpp = (Module["__GLOBAL__sub_I_Modules_UI_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UI_1_cpp = (Module["__GLOBAL__sub_I_Modules_UI_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UI_2_cpp = (Module["__GLOBAL__sub_I_Modules_UI_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VFX_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_VFX_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VFX_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_VFX_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp = (Module["__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VR_0_cpp = (Module["__GLOBAL__sub_I_Modules_VR_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VR_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VR_1_cpp = (Module["__GLOBAL__sub_I_Modules_VR_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VR_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp = (Module["__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Stats_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Stats_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Stats_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Tracing_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp = (Module["__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Physics2DScriptingClasses_cpp = (Module["__GLOBAL__sub_I_Physics2DScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Physics2DScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_PhysicsQuery_cpp = (Module["__GLOBAL__sub_I_PhysicsQuery_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_PhysicsQuery_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_PhysicsScriptingClasses_cpp = (Module["__GLOBAL__sub_I_PhysicsScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_PhysicsScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp = (Module["__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp = (Module["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp = (Module["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_PluginInterfaceVR_cpp = (Module["__GLOBAL__sub_I_PluginInterfaceVR_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_PluginInterfaceVR_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp = (Module["__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp = (Module["__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp = (Module["__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Allocator_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Allocator_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Allocator_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Application_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Application_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Application_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_0_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_1_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_2_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_3_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Burst_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Burst_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Burst_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_6_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_6_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_6_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_7_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_7_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_7_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_8_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_8_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_8_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Containers_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Containers_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Containers_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Director_Core_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Director_Core_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Director_Core_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_File_0_cpp = (Module["__GLOBAL__sub_I_Runtime_File_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_File_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Geometry_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Geometry_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Geometry_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_1_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_2_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_3_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_4_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_5_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_10_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_10_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_10_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_11_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_11_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_11_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_4_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_4_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_4_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_5_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_5_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_6_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_6_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_6_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_8_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_8_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_8_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Input_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Input_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Input_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Interfaces_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Interfaces_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Interfaces_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Interfaces_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Interfaces_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Interfaces_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Math_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Math_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Math_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Math_Random_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Math_Random_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Math_Random_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_4_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_4_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_4_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_5_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_5_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Modules_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Modules_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Modules_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_PluginInterface_0_cpp = (Module["__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_PreloadManager_0_cpp = (Module["__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_SceneManager_0_cpp = (Module["__GLOBAL__sub_I_Runtime_SceneManager_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_SceneManager_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp = (Module["__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_3_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_3_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_3_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_3_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_3_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_3_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Transform_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Transform_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Transform_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Transform_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Transform_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Transform_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_2_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_2_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_5_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_5_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_6_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_6_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_6_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_7_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_7_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_7_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_9_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_9_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_9_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Video_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Video_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Video_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp = (Module["__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Shader_cpp = (Module["__GLOBAL__sub_I_Shader_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Shader_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Shadows_cpp = (Module["__GLOBAL__sub_I_Shadows_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Shadows_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_ShapeModule_cpp = (Module["__GLOBAL__sub_I_ShapeModule_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_ShapeModule_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_SubsystemsScriptingClasses_cpp = (Module["__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_SwInterCollision_cpp = (Module["__GLOBAL__sub_I_SwInterCollision_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_SwInterCollision_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_SwSolverKernel_cpp = (Module["__GLOBAL__sub_I_SwSolverKernel_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_SwSolverKernel_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_TemplateInstantiations_cpp = (Module["__GLOBAL__sub_I_TemplateInstantiations_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_TemplateInstantiations_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_TerrainScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TerrainScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_TerrainScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_TextCoreScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TextCoreScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_TextCoreScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_TextRenderingScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_TilemapScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TilemapScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_TilemapScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_UIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UIScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_UIScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_UVModule_cpp = (Module["__GLOBAL__sub_I_UVModule_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_UVModule_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_UnityAdsSettings_cpp = (Module["__GLOBAL__sub_I_UnityAdsSettings_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_UnityAdsSettings_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_VFXScriptingClasses_cpp = (Module["__GLOBAL__sub_I_VFXScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_VFXScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_VRScriptingClasses_cpp = (Module["__GLOBAL__sub_I_VRScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_VRScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_VideoScriptingClasses_cpp = (Module["__GLOBAL__sub_I_VideoScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_VideoScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_VisualEffectAsset_cpp = (Module["__GLOBAL__sub_I_VisualEffectAsset_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_VisualEffectAsset_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_Wind_cpp = (Module["__GLOBAL__sub_I_Wind_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_Wind_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_XRAudio_cpp = (Module["__GLOBAL__sub_I_XRAudio_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRAudio_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_XRPreInit_cpp = (Module["__GLOBAL__sub_I_XRPreInit_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRPreInit_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_XRScriptingClasses_cpp = (Module["__GLOBAL__sub_I_XRScriptingClasses_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRScriptingClasses_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_XRWindowsLocatableCamera_cpp = (Module["__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp = (Module["__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_nvcloth_src_0_cpp = (Module["__GLOBAL__sub_I_nvcloth_src_0_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_nvcloth_src_0_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_nvcloth_src_1_cpp = (Module["__GLOBAL__sub_I_nvcloth_src_1_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_nvcloth_src_1_cpp"].apply(null, arguments);
|
|
});
|
|
var __GLOBAL__sub_I_umbra_cpp = (Module["__GLOBAL__sub_I_umbra_cpp"] = function () {
|
|
return Module["asm"]["__GLOBAL__sub_I_umbra_cpp"].apply(null, arguments);
|
|
});
|
|
var ___cxa_can_catch = (Module["___cxa_can_catch"] = function () {
|
|
return Module["asm"]["___cxa_can_catch"].apply(null, arguments);
|
|
});
|
|
var ___cxa_is_pointer_type = (Module["___cxa_is_pointer_type"] = function () {
|
|
return Module["asm"]["___cxa_is_pointer_type"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init = (Module["___cxx_global_var_init"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_104 = (Module["___cxx_global_var_init_104"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_104"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_131 = (Module["___cxx_global_var_init_131"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_131"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_18 = (Module["___cxx_global_var_init_18"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_18"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_18_1180 = (Module["___cxx_global_var_init_18_1180"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_18_1180"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_19 = (Module["___cxx_global_var_init_19"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_19"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_20 = (Module["___cxx_global_var_init_20"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_20"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_23 = (Module["___cxx_global_var_init_23"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_23"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_3785 = (Module["___cxx_global_var_init_3785"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_3785"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_7754 = (Module["___cxx_global_var_init_7754"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_7754"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_89 = (Module["___cxx_global_var_init_89"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_89"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_8911 = (Module["___cxx_global_var_init_8911"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_8911"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_9 = (Module["___cxx_global_var_init_9"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_9"].apply(null, arguments);
|
|
});
|
|
var ___cxx_global_var_init_9307 = (Module["___cxx_global_var_init_9307"] = function () {
|
|
return Module["asm"]["___cxx_global_var_init_9307"].apply(null, arguments);
|
|
});
|
|
var ___emscripten_environ_constructor = (Module["___emscripten_environ_constructor"] = function () {
|
|
return Module["asm"]["___emscripten_environ_constructor"].apply(null, arguments);
|
|
});
|
|
var ___errno_location = (Module["___errno_location"] = function () {
|
|
return Module["asm"]["___errno_location"].apply(null, arguments);
|
|
});
|
|
var __get_daylight = (Module["__get_daylight"] = function () {
|
|
return Module["asm"]["__get_daylight"].apply(null, arguments);
|
|
});
|
|
var __get_environ = (Module["__get_environ"] = function () {
|
|
return Module["asm"]["__get_environ"].apply(null, arguments);
|
|
});
|
|
var __get_timezone = (Module["__get_timezone"] = function () {
|
|
return Module["asm"]["__get_timezone"].apply(null, arguments);
|
|
});
|
|
var __get_tzname = (Module["__get_tzname"] = function () {
|
|
return Module["asm"]["__get_tzname"].apply(null, arguments);
|
|
});
|
|
var _emscripten_replace_memory = (Module["_emscripten_replace_memory"] = function () {
|
|
return Module["asm"]["_emscripten_replace_memory"].apply(null, arguments);
|
|
});
|
|
var _free = (Module["_free"] = function () {
|
|
return Module["asm"]["_free"].apply(null, arguments);
|
|
});
|
|
var _htonl = (Module["_htonl"] = function () {
|
|
return Module["asm"]["_htonl"].apply(null, arguments);
|
|
});
|
|
var _htons = (Module["_htons"] = function () {
|
|
return Module["asm"]["_htons"].apply(null, arguments);
|
|
});
|
|
var _i64Add = (Module["_i64Add"] = function () {
|
|
return Module["asm"]["_i64Add"].apply(null, arguments);
|
|
});
|
|
var _llvm_bswap_i16 = (Module["_llvm_bswap_i16"] = function () {
|
|
return Module["asm"]["_llvm_bswap_i16"].apply(null, arguments);
|
|
});
|
|
var _llvm_bswap_i32 = (Module["_llvm_bswap_i32"] = function () {
|
|
return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments);
|
|
});
|
|
var _llvm_ctlz_i64 = (Module["_llvm_ctlz_i64"] = function () {
|
|
return Module["asm"]["_llvm_ctlz_i64"].apply(null, arguments);
|
|
});
|
|
var _llvm_ctpop_i32 = (Module["_llvm_ctpop_i32"] = function () {
|
|
return Module["asm"]["_llvm_ctpop_i32"].apply(null, arguments);
|
|
});
|
|
var _llvm_maxnum_f32 = (Module["_llvm_maxnum_f32"] = function () {
|
|
return Module["asm"]["_llvm_maxnum_f32"].apply(null, arguments);
|
|
});
|
|
var _llvm_maxnum_f64 = (Module["_llvm_maxnum_f64"] = function () {
|
|
return Module["asm"]["_llvm_maxnum_f64"].apply(null, arguments);
|
|
});
|
|
var _llvm_minnum_f32 = (Module["_llvm_minnum_f32"] = function () {
|
|
return Module["asm"]["_llvm_minnum_f32"].apply(null, arguments);
|
|
});
|
|
var _llvm_round_f32 = (Module["_llvm_round_f32"] = function () {
|
|
return Module["asm"]["_llvm_round_f32"].apply(null, arguments);
|
|
});
|
|
var _main = (Module["_main"] = function () {
|
|
return Module["asm"]["_main"].apply(null, arguments);
|
|
});
|
|
var _malloc = (Module["_malloc"] = function () {
|
|
return Module["asm"]["_malloc"].apply(null, arguments);
|
|
});
|
|
var _memalign = (Module["_memalign"] = function () {
|
|
return Module["asm"]["_memalign"].apply(null, arguments);
|
|
});
|
|
var _memcpy = (Module["_memcpy"] = function () {
|
|
return Module["asm"]["_memcpy"].apply(null, arguments);
|
|
});
|
|
var _memmove = (Module["_memmove"] = function () {
|
|
return Module["asm"]["_memmove"].apply(null, arguments);
|
|
});
|
|
var _memset = (Module["_memset"] = function () {
|
|
return Module["asm"]["_memset"].apply(null, arguments);
|
|
});
|
|
var _ntohs = (Module["_ntohs"] = function () {
|
|
return Module["asm"]["_ntohs"].apply(null, arguments);
|
|
});
|
|
var _realloc = (Module["_realloc"] = function () {
|
|
return Module["asm"]["_realloc"].apply(null, arguments);
|
|
});
|
|
var _saveSetjmp = (Module["_saveSetjmp"] = function () {
|
|
return Module["asm"]["_saveSetjmp"].apply(null, arguments);
|
|
});
|
|
var _sbrk = (Module["_sbrk"] = function () {
|
|
return Module["asm"]["_sbrk"].apply(null, arguments);
|
|
});
|
|
var _strlen = (Module["_strlen"] = function () {
|
|
return Module["asm"]["_strlen"].apply(null, arguments);
|
|
});
|
|
var _testSetjmp = (Module["_testSetjmp"] = function () {
|
|
return Module["asm"]["_testSetjmp"].apply(null, arguments);
|
|
});
|
|
var establishStackSpace = (Module["establishStackSpace"] = function () {
|
|
return Module["asm"]["establishStackSpace"].apply(null, arguments);
|
|
});
|
|
var getTempRet0 = (Module["getTempRet0"] = function () {
|
|
return Module["asm"]["getTempRet0"].apply(null, arguments);
|
|
});
|
|
var runPostSets = (Module["runPostSets"] = function () {
|
|
return Module["asm"]["runPostSets"].apply(null, arguments);
|
|
});
|
|
var setTempRet0 = (Module["setTempRet0"] = function () {
|
|
return Module["asm"]["setTempRet0"].apply(null, arguments);
|
|
});
|
|
var setThrew = (Module["setThrew"] = function () {
|
|
return Module["asm"]["setThrew"].apply(null, arguments);
|
|
});
|
|
var stackAlloc = (Module["stackAlloc"] = function () {
|
|
return Module["asm"]["stackAlloc"].apply(null, arguments);
|
|
});
|
|
var stackRestore = (Module["stackRestore"] = function () {
|
|
return Module["asm"]["stackRestore"].apply(null, arguments);
|
|
});
|
|
var stackSave = (Module["stackSave"] = function () {
|
|
return Module["asm"]["stackSave"].apply(null, arguments);
|
|
});
|
|
var dynCall_dddi = (Module["dynCall_dddi"] = function () {
|
|
return Module["asm"]["dynCall_dddi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ddi = (Module["dynCall_ddi"] = function () {
|
|
return Module["asm"]["dynCall_ddi"].apply(null, arguments);
|
|
});
|
|
var dynCall_dfi = (Module["dynCall_dfi"] = function () {
|
|
return Module["asm"]["dynCall_dfi"].apply(null, arguments);
|
|
});
|
|
var dynCall_di = (Module["dynCall_di"] = function () {
|
|
return Module["asm"]["dynCall_di"].apply(null, arguments);
|
|
});
|
|
var dynCall_diddi = (Module["dynCall_diddi"] = function () {
|
|
return Module["asm"]["dynCall_diddi"].apply(null, arguments);
|
|
});
|
|
var dynCall_didi = (Module["dynCall_didi"] = function () {
|
|
return Module["asm"]["dynCall_didi"].apply(null, arguments);
|
|
});
|
|
var dynCall_dii = (Module["dynCall_dii"] = function () {
|
|
return Module["asm"]["dynCall_dii"].apply(null, arguments);
|
|
});
|
|
var dynCall_diii = (Module["dynCall_diii"] = function () {
|
|
return Module["asm"]["dynCall_diii"].apply(null, arguments);
|
|
});
|
|
var dynCall_diiii = (Module["dynCall_diiii"] = function () {
|
|
return Module["asm"]["dynCall_diiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_diiiii = (Module["dynCall_diiiii"] = function () {
|
|
return Module["asm"]["dynCall_diiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_diiji = (Module["dynCall_diiji"] = function () {
|
|
return Module["asm"]["dynCall_diiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_diji = (Module["dynCall_diji"] = function () {
|
|
return Module["asm"]["dynCall_diji"].apply(null, arguments);
|
|
});
|
|
var dynCall_dji = (Module["dynCall_dji"] = function () {
|
|
return Module["asm"]["dynCall_dji"].apply(null, arguments);
|
|
});
|
|
var dynCall_f = (Module["dynCall_f"] = function () {
|
|
return Module["asm"]["dynCall_f"].apply(null, arguments);
|
|
});
|
|
var dynCall_fdi = (Module["dynCall_fdi"] = function () {
|
|
return Module["asm"]["dynCall_fdi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ff = (Module["dynCall_ff"] = function () {
|
|
return Module["asm"]["dynCall_ff"].apply(null, arguments);
|
|
});
|
|
var dynCall_fff = (Module["dynCall_fff"] = function () {
|
|
return Module["asm"]["dynCall_fff"].apply(null, arguments);
|
|
});
|
|
var dynCall_ffffi = (Module["dynCall_ffffi"] = function () {
|
|
return Module["asm"]["dynCall_ffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fffi = (Module["dynCall_fffi"] = function () {
|
|
return Module["asm"]["dynCall_fffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fffifffi = (Module["dynCall_fffifffi"] = function () {
|
|
return Module["asm"]["dynCall_fffifffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ffi = (Module["dynCall_ffi"] = function () {
|
|
return Module["asm"]["dynCall_ffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ffii = (Module["dynCall_ffii"] = function () {
|
|
return Module["asm"]["dynCall_ffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fi = (Module["dynCall_fi"] = function () {
|
|
return Module["asm"]["dynCall_fi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fidi = (Module["dynCall_fidi"] = function () {
|
|
return Module["asm"]["dynCall_fidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fif = (Module["dynCall_fif"] = function () {
|
|
return Module["asm"]["dynCall_fif"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiffffii = (Module["dynCall_fiffffii"] = function () {
|
|
return Module["asm"]["dynCall_fiffffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiffffiiiiii = (Module["dynCall_fiffffiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_fiffffiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiffi = (Module["dynCall_fiffi"] = function () {
|
|
return Module["asm"]["dynCall_fiffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fifi = (Module["dynCall_fifi"] = function () {
|
|
return Module["asm"]["dynCall_fifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fifii = (Module["dynCall_fifii"] = function () {
|
|
return Module["asm"]["dynCall_fifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fii = (Module["dynCall_fii"] = function () {
|
|
return Module["asm"]["dynCall_fii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiif = (Module["dynCall_fiif"] = function () {
|
|
return Module["asm"]["dynCall_fiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiifi = (Module["dynCall_fiifi"] = function () {
|
|
return Module["asm"]["dynCall_fiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiifii = (Module["dynCall_fiifii"] = function () {
|
|
return Module["asm"]["dynCall_fiifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiii = (Module["dynCall_fiii"] = function () {
|
|
return Module["asm"]["dynCall_fiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiiii = (Module["dynCall_fiiii"] = function () {
|
|
return Module["asm"]["dynCall_fiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiiiif = (Module["dynCall_fiiiif"] = function () {
|
|
return Module["asm"]["dynCall_fiiiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiiiii = (Module["dynCall_fiiiii"] = function () {
|
|
return Module["asm"]["dynCall_fiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fiiiiii = (Module["dynCall_fiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_fiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_fji = (Module["dynCall_fji"] = function () {
|
|
return Module["asm"]["dynCall_fji"].apply(null, arguments);
|
|
});
|
|
var dynCall_i = (Module["dynCall_i"] = function () {
|
|
return Module["asm"]["dynCall_i"].apply(null, arguments);
|
|
});
|
|
var dynCall_iddi = (Module["dynCall_iddi"] = function () {
|
|
return Module["asm"]["dynCall_iddi"].apply(null, arguments);
|
|
});
|
|
var dynCall_idi = (Module["dynCall_idi"] = function () {
|
|
return Module["asm"]["dynCall_idi"].apply(null, arguments);
|
|
});
|
|
var dynCall_idii = (Module["dynCall_idii"] = function () {
|
|
return Module["asm"]["dynCall_idii"].apply(null, arguments);
|
|
});
|
|
var dynCall_idiii = (Module["dynCall_idiii"] = function () {
|
|
return Module["asm"]["dynCall_idiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_idiiii = (Module["dynCall_idiiii"] = function () {
|
|
return Module["asm"]["dynCall_idiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_idiiiii = (Module["dynCall_idiiiii"] = function () {
|
|
return Module["asm"]["dynCall_idiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ifffi = (Module["dynCall_ifffi"] = function () {
|
|
return Module["asm"]["dynCall_ifffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iffi = (Module["dynCall_iffi"] = function () {
|
|
return Module["asm"]["dynCall_iffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ifi = (Module["dynCall_ifi"] = function () {
|
|
return Module["asm"]["dynCall_ifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ifiii = (Module["dynCall_ifiii"] = function () {
|
|
return Module["asm"]["dynCall_ifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ifiiii = (Module["dynCall_ifiiii"] = function () {
|
|
return Module["asm"]["dynCall_ifiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ii = (Module["dynCall_ii"] = function () {
|
|
return Module["asm"]["dynCall_ii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiddi = (Module["dynCall_iiddi"] = function () {
|
|
return Module["asm"]["dynCall_iiddi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiddiii = (Module["dynCall_iiddiii"] = function () {
|
|
return Module["asm"]["dynCall_iiddiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iidi = (Module["dynCall_iidi"] = function () {
|
|
return Module["asm"]["dynCall_iidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iidii = (Module["dynCall_iidii"] = function () {
|
|
return Module["asm"]["dynCall_iidii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iidiii = (Module["dynCall_iidiii"] = function () {
|
|
return Module["asm"]["dynCall_iidiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iidiiii = (Module["dynCall_iidiiii"] = function () {
|
|
return Module["asm"]["dynCall_iidiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iidiiiii = (Module["dynCall_iidiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iidiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iif = (Module["dynCall_iif"] = function () {
|
|
return Module["asm"]["dynCall_iif"].apply(null, arguments);
|
|
});
|
|
var dynCall_iifffi = (Module["dynCall_iifffi"] = function () {
|
|
return Module["asm"]["dynCall_iifffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiffi = (Module["dynCall_iiffi"] = function () {
|
|
return Module["asm"]["dynCall_iiffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiffiii = (Module["dynCall_iiffiii"] = function () {
|
|
return Module["asm"]["dynCall_iiffiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iifi = (Module["dynCall_iifi"] = function () {
|
|
return Module["asm"]["dynCall_iifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iifii = (Module["dynCall_iifii"] = function () {
|
|
return Module["asm"]["dynCall_iifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iifiii = (Module["dynCall_iifiii"] = function () {
|
|
return Module["asm"]["dynCall_iifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iii = (Module["dynCall_iii"] = function () {
|
|
return Module["asm"]["dynCall_iii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiid = (Module["dynCall_iiid"] = function () {
|
|
return Module["asm"]["dynCall_iiid"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiidi = (Module["dynCall_iiidi"] = function () {
|
|
return Module["asm"]["dynCall_iiidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiidii = (Module["dynCall_iiidii"] = function () {
|
|
return Module["asm"]["dynCall_iiidii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiidiii = (Module["dynCall_iiidiii"] = function () {
|
|
return Module["asm"]["dynCall_iiidiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiif = (Module["dynCall_iiif"] = function () {
|
|
return Module["asm"]["dynCall_iiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiff = (Module["dynCall_iiiff"] = function () {
|
|
return Module["asm"]["dynCall_iiiff"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiifi = (Module["dynCall_iiifi"] = function () {
|
|
return Module["asm"]["dynCall_iiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiifii = (Module["dynCall_iiifii"] = function () {
|
|
return Module["asm"]["dynCall_iiifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiifiii = (Module["dynCall_iiifiii"] = function () {
|
|
return Module["asm"]["dynCall_iiifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiifiiii = (Module["dynCall_iiifiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiifiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiii = (Module["dynCall_iiii"] = function () {
|
|
return Module["asm"]["dynCall_iiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiidii = (Module["dynCall_iiiidii"] = function () {
|
|
return Module["asm"]["dynCall_iiiidii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiifi = (Module["dynCall_iiiifi"] = function () {
|
|
return Module["asm"]["dynCall_iiiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiifii = (Module["dynCall_iiiifii"] = function () {
|
|
return Module["asm"]["dynCall_iiiifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiifiii = (Module["dynCall_iiiifiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiifiiii = (Module["dynCall_iiiifiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiifiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiii = (Module["dynCall_iiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiffiiii = (Module["dynCall_iiiiiffiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiffiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiifi = (Module["dynCall_iiiiifi"] = function () {
|
|
return Module["asm"]["dynCall_iiiiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiii = (Module["dynCall_iiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiifffiiifiii = (Module["dynCall_iiiiiifffiiifiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiifffiiifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiffiiiiiiiiiffffiii = (Module["dynCall_iiiiiiffiiiiiiiiiffffiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiffiiiiiiiiiffffiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiffiiiiiiiiiffffiiii = (Module["dynCall_iiiiiiffiiiiiiiiiffffiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiffiiiiiiiiiffffiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiffiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiffiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiffiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiii = (Module["dynCall_iiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiii = (Module["dynCall_iiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiii = (Module["dynCall_iiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiii = (Module["dynCall_iiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiii = (Module["dynCall_iiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiiiiiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiij = (Module["dynCall_iiiiij"] = function () {
|
|
return Module["asm"]["dynCall_iiiiij"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiiji = (Module["dynCall_iiiiiji"] = function () {
|
|
return Module["asm"]["dynCall_iiiiiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiij = (Module["dynCall_iiiij"] = function () {
|
|
return Module["asm"]["dynCall_iiiij"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiiji = (Module["dynCall_iiiiji"] = function () {
|
|
return Module["asm"]["dynCall_iiiiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiijii = (Module["dynCall_iiiijii"] = function () {
|
|
return Module["asm"]["dynCall_iiiijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiijiii = (Module["dynCall_iiiijiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiijjii = (Module["dynCall_iiiijjii"] = function () {
|
|
return Module["asm"]["dynCall_iiiijjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiijjiiii = (Module["dynCall_iiiijjiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiiijjiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiij = (Module["dynCall_iiij"] = function () {
|
|
return Module["asm"]["dynCall_iiij"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiiji = (Module["dynCall_iiiji"] = function () {
|
|
return Module["asm"]["dynCall_iiiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijii = (Module["dynCall_iiijii"] = function () {
|
|
return Module["asm"]["dynCall_iiijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijiii = (Module["dynCall_iiijiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijiiii = (Module["dynCall_iiijiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijiiiii = (Module["dynCall_iiijiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijiiiiii = (Module["dynCall_iiijiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijiiiiiii = (Module["dynCall_iiijiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijji = (Module["dynCall_iiijji"] = function () {
|
|
return Module["asm"]["dynCall_iiijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijjii = (Module["dynCall_iiijjii"] = function () {
|
|
return Module["asm"]["dynCall_iiijjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijjiii = (Module["dynCall_iiijjiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijjiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijjiiii = (Module["dynCall_iiijjiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijjiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijjiiiii = (Module["dynCall_iiijjiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijjiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiijjiiiiii = (Module["dynCall_iiijjiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iiijjiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iij = (Module["dynCall_iij"] = function () {
|
|
return Module["asm"]["dynCall_iij"].apply(null, arguments);
|
|
});
|
|
var dynCall_iiji = (Module["dynCall_iiji"] = function () {
|
|
return Module["asm"]["dynCall_iiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijii = (Module["dynCall_iijii"] = function () {
|
|
return Module["asm"]["dynCall_iijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijiii = (Module["dynCall_iijiii"] = function () {
|
|
return Module["asm"]["dynCall_iijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijiiii = (Module["dynCall_iijiiii"] = function () {
|
|
return Module["asm"]["dynCall_iijiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijiiiii = (Module["dynCall_iijiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iijiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijji = (Module["dynCall_iijji"] = function () {
|
|
return Module["asm"]["dynCall_iijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijjii = (Module["dynCall_iijjii"] = function () {
|
|
return Module["asm"]["dynCall_iijjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijjiii = (Module["dynCall_iijjiii"] = function () {
|
|
return Module["asm"]["dynCall_iijjiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijjiiii = (Module["dynCall_iijjiiii"] = function () {
|
|
return Module["asm"]["dynCall_iijjiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_iijjiiiii = (Module["dynCall_iijjiiiii"] = function () {
|
|
return Module["asm"]["dynCall_iijjiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ij = (Module["dynCall_ij"] = function () {
|
|
return Module["asm"]["dynCall_ij"].apply(null, arguments);
|
|
});
|
|
var dynCall_iji = (Module["dynCall_iji"] = function () {
|
|
return Module["asm"]["dynCall_iji"].apply(null, arguments);
|
|
});
|
|
var dynCall_ijii = (Module["dynCall_ijii"] = function () {
|
|
return Module["asm"]["dynCall_ijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ijiii = (Module["dynCall_ijiii"] = function () {
|
|
return Module["asm"]["dynCall_ijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ijiiii = (Module["dynCall_ijiiii"] = function () {
|
|
return Module["asm"]["dynCall_ijiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_ijj = (Module["dynCall_ijj"] = function () {
|
|
return Module["asm"]["dynCall_ijj"].apply(null, arguments);
|
|
});
|
|
var dynCall_ijji = (Module["dynCall_ijji"] = function () {
|
|
return Module["asm"]["dynCall_ijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_j = (Module["dynCall_j"] = function () {
|
|
return Module["asm"]["dynCall_j"].apply(null, arguments);
|
|
});
|
|
var dynCall_jdi = (Module["dynCall_jdi"] = function () {
|
|
return Module["asm"]["dynCall_jdi"].apply(null, arguments);
|
|
});
|
|
var dynCall_jdii = (Module["dynCall_jdii"] = function () {
|
|
return Module["asm"]["dynCall_jdii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jfi = (Module["dynCall_jfi"] = function () {
|
|
return Module["asm"]["dynCall_jfi"].apply(null, arguments);
|
|
});
|
|
var dynCall_ji = (Module["dynCall_ji"] = function () {
|
|
return Module["asm"]["dynCall_ji"].apply(null, arguments);
|
|
});
|
|
var dynCall_jidi = (Module["dynCall_jidi"] = function () {
|
|
return Module["asm"]["dynCall_jidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_jidii = (Module["dynCall_jidii"] = function () {
|
|
return Module["asm"]["dynCall_jidii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jii = (Module["dynCall_jii"] = function () {
|
|
return Module["asm"]["dynCall_jii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiii = (Module["dynCall_jiii"] = function () {
|
|
return Module["asm"]["dynCall_jiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiii = (Module["dynCall_jiiii"] = function () {
|
|
return Module["asm"]["dynCall_jiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiiii = (Module["dynCall_jiiiii"] = function () {
|
|
return Module["asm"]["dynCall_jiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiiiii = (Module["dynCall_jiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_jiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiiiiii = (Module["dynCall_jiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_jiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiiiiiiii = (Module["dynCall_jiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_jiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiiiiiiiii = (Module["dynCall_jiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_jiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiiji = (Module["dynCall_jiiji"] = function () {
|
|
return Module["asm"]["dynCall_jiiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_jiji = (Module["dynCall_jiji"] = function () {
|
|
return Module["asm"]["dynCall_jiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_jijii = (Module["dynCall_jijii"] = function () {
|
|
return Module["asm"]["dynCall_jijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jijiii = (Module["dynCall_jijiii"] = function () {
|
|
return Module["asm"]["dynCall_jijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jijj = (Module["dynCall_jijj"] = function () {
|
|
return Module["asm"]["dynCall_jijj"].apply(null, arguments);
|
|
});
|
|
var dynCall_jijji = (Module["dynCall_jijji"] = function () {
|
|
return Module["asm"]["dynCall_jijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_jji = (Module["dynCall_jji"] = function () {
|
|
return Module["asm"]["dynCall_jji"].apply(null, arguments);
|
|
});
|
|
var dynCall_jjii = (Module["dynCall_jjii"] = function () {
|
|
return Module["asm"]["dynCall_jjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_jjji = (Module["dynCall_jjji"] = function () {
|
|
return Module["asm"]["dynCall_jjji"].apply(null, arguments);
|
|
});
|
|
var dynCall_jjjji = (Module["dynCall_jjjji"] = function () {
|
|
return Module["asm"]["dynCall_jjjji"].apply(null, arguments);
|
|
});
|
|
var dynCall_v = (Module["dynCall_v"] = function () {
|
|
return Module["asm"]["dynCall_v"].apply(null, arguments);
|
|
});
|
|
var dynCall_vd = (Module["dynCall_vd"] = function () {
|
|
return Module["asm"]["dynCall_vd"].apply(null, arguments);
|
|
});
|
|
var dynCall_vdi = (Module["dynCall_vdi"] = function () {
|
|
return Module["asm"]["dynCall_vdi"].apply(null, arguments);
|
|
});
|
|
var dynCall_vdiiiii = (Module["dynCall_vdiiiii"] = function () {
|
|
return Module["asm"]["dynCall_vdiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vf = (Module["dynCall_vf"] = function () {
|
|
return Module["asm"]["dynCall_vf"].apply(null, arguments);
|
|
});
|
|
var dynCall_vff = (Module["dynCall_vff"] = function () {
|
|
return Module["asm"]["dynCall_vff"].apply(null, arguments);
|
|
});
|
|
var dynCall_vffff = (Module["dynCall_vffff"] = function () {
|
|
return Module["asm"]["dynCall_vffff"].apply(null, arguments);
|
|
});
|
|
var dynCall_vfi = (Module["dynCall_vfi"] = function () {
|
|
return Module["asm"]["dynCall_vfi"].apply(null, arguments);
|
|
});
|
|
var dynCall_vi = (Module["dynCall_vi"] = function () {
|
|
return Module["asm"]["dynCall_vi"].apply(null, arguments);
|
|
});
|
|
var dynCall_vid = (Module["dynCall_vid"] = function () {
|
|
return Module["asm"]["dynCall_vid"].apply(null, arguments);
|
|
});
|
|
var dynCall_vidi = (Module["dynCall_vidi"] = function () {
|
|
return Module["asm"]["dynCall_vidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_vidiii = (Module["dynCall_vidiii"] = function () {
|
|
return Module["asm"]["dynCall_vidiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vidji = (Module["dynCall_vidji"] = function () {
|
|
return Module["asm"]["dynCall_vidji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vif = (Module["dynCall_vif"] = function () {
|
|
return Module["asm"]["dynCall_vif"].apply(null, arguments);
|
|
});
|
|
var dynCall_viff = (Module["dynCall_viff"] = function () {
|
|
return Module["asm"]["dynCall_viff"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifff = (Module["dynCall_vifff"] = function () {
|
|
return Module["asm"]["dynCall_vifff"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffff = (Module["dynCall_viffff"] = function () {
|
|
return Module["asm"]["dynCall_viffff"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifffffi = (Module["dynCall_vifffffi"] = function () {
|
|
return Module["asm"]["dynCall_vifffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffffi = (Module["dynCall_viffffi"] = function () {
|
|
return Module["asm"]["dynCall_viffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffffii = (Module["dynCall_viffffii"] = function () {
|
|
return Module["asm"]["dynCall_viffffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffffiii = (Module["dynCall_viffffiii"] = function () {
|
|
return Module["asm"]["dynCall_viffffiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifffi = (Module["dynCall_vifffi"] = function () {
|
|
return Module["asm"]["dynCall_vifffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifffii = (Module["dynCall_vifffii"] = function () {
|
|
return Module["asm"]["dynCall_vifffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffi = (Module["dynCall_viffi"] = function () {
|
|
return Module["asm"]["dynCall_viffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffii = (Module["dynCall_viffii"] = function () {
|
|
return Module["asm"]["dynCall_viffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viffiii = (Module["dynCall_viffiii"] = function () {
|
|
return Module["asm"]["dynCall_viffiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifi = (Module["dynCall_vifi"] = function () {
|
|
return Module["asm"]["dynCall_vifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifii = (Module["dynCall_vifii"] = function () {
|
|
return Module["asm"]["dynCall_vifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vifiiii = (Module["dynCall_vifiiii"] = function () {
|
|
return Module["asm"]["dynCall_vifiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vii = (Module["dynCall_vii"] = function () {
|
|
return Module["asm"]["dynCall_vii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viid = (Module["dynCall_viid"] = function () {
|
|
return Module["asm"]["dynCall_viid"].apply(null, arguments);
|
|
});
|
|
var dynCall_viidi = (Module["dynCall_viidi"] = function () {
|
|
return Module["asm"]["dynCall_viidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viidii = (Module["dynCall_viidii"] = function () {
|
|
return Module["asm"]["dynCall_viidii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viif = (Module["dynCall_viif"] = function () {
|
|
return Module["asm"]["dynCall_viif"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiff = (Module["dynCall_viiff"] = function () {
|
|
return Module["asm"]["dynCall_viiff"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifff = (Module["dynCall_viifff"] = function () {
|
|
return Module["asm"]["dynCall_viifff"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffffffffi = (Module["dynCall_viiffffffffi"] = function () {
|
|
return Module["asm"]["dynCall_viiffffffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffffffffiii = (Module["dynCall_viiffffffffiii"] = function () {
|
|
return Module["asm"]["dynCall_viiffffffffiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifffffffi = (Module["dynCall_viifffffffi"] = function () {
|
|
return Module["asm"]["dynCall_viifffffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffffffi = (Module["dynCall_viiffffffi"] = function () {
|
|
return Module["asm"]["dynCall_viiffffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifffffi = (Module["dynCall_viifffffi"] = function () {
|
|
return Module["asm"]["dynCall_viifffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffffi = (Module["dynCall_viiffffi"] = function () {
|
|
return Module["asm"]["dynCall_viiffffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffffiiiiii = (Module["dynCall_viiffffiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiffffiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifffi = (Module["dynCall_viifffi"] = function () {
|
|
return Module["asm"]["dynCall_viifffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffi = (Module["dynCall_viiffi"] = function () {
|
|
return Module["asm"]["dynCall_viiffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiffii = (Module["dynCall_viiffii"] = function () {
|
|
return Module["asm"]["dynCall_viiffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifi = (Module["dynCall_viifi"] = function () {
|
|
return Module["asm"]["dynCall_viifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifii = (Module["dynCall_viifii"] = function () {
|
|
return Module["asm"]["dynCall_viifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifiii = (Module["dynCall_viifiii"] = function () {
|
|
return Module["asm"]["dynCall_viifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viifiiii = (Module["dynCall_viifiiii"] = function () {
|
|
return Module["asm"]["dynCall_viifiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viii = (Module["dynCall_viii"] = function () {
|
|
return Module["asm"]["dynCall_viii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiidi = (Module["dynCall_viiidi"] = function () {
|
|
return Module["asm"]["dynCall_viiidi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiif = (Module["dynCall_viiif"] = function () {
|
|
return Module["asm"]["dynCall_viiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiifffi = (Module["dynCall_viiifffi"] = function () {
|
|
return Module["asm"]["dynCall_viiifffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiffi = (Module["dynCall_viiiffi"] = function () {
|
|
return Module["asm"]["dynCall_viiiffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiifi = (Module["dynCall_viiifi"] = function () {
|
|
return Module["asm"]["dynCall_viiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiififfi = (Module["dynCall_viiififfi"] = function () {
|
|
return Module["asm"]["dynCall_viiififfi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiififi = (Module["dynCall_viiififi"] = function () {
|
|
return Module["asm"]["dynCall_viiififi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiifii = (Module["dynCall_viiifii"] = function () {
|
|
return Module["asm"]["dynCall_viiifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiifiii = (Module["dynCall_viiifiii"] = function () {
|
|
return Module["asm"]["dynCall_viiifiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiii = (Module["dynCall_viiii"] = function () {
|
|
return Module["asm"]["dynCall_viiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiif = (Module["dynCall_viiiif"] = function () {
|
|
return Module["asm"]["dynCall_viiiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiffffii = (Module["dynCall_viiiiffffii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiffffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiifii = (Module["dynCall_viiiifii"] = function () {
|
|
return Module["asm"]["dynCall_viiiifii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiii = (Module["dynCall_viiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiif = (Module["dynCall_viiiiif"] = function () {
|
|
return Module["asm"]["dynCall_viiiiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiffi = (Module["dynCall_viiiiiffi"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiffi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiffii = (Module["dynCall_viiiiiffii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiffii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiifi = (Module["dynCall_viiiiifi"] = function () {
|
|
return Module["asm"]["dynCall_viiiiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiii = (Module["dynCall_viiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiif = (Module["dynCall_viiiiiif"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiif"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiii = (Module["dynCall_viiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiifi = (Module["dynCall_viiiiiiifi"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiifi"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiii = (Module["dynCall_viiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiii = (Module["dynCall_viiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiii = (Module["dynCall_viiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiii = (Module["dynCall_viiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiiiji = (Module["dynCall_viiiiiji"] = function () {
|
|
return Module["asm"]["dynCall_viiiiiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiijiiii = (Module["dynCall_viiiijiiii"] = function () {
|
|
return Module["asm"]["dynCall_viiiijiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiiji = (Module["dynCall_viiiji"] = function () {
|
|
return Module["asm"]["dynCall_viiiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiijji = (Module["dynCall_viiijji"] = function () {
|
|
return Module["asm"]["dynCall_viiijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiijjjji = (Module["dynCall_viiijjjji"] = function () {
|
|
return Module["asm"]["dynCall_viiijjjji"].apply(null, arguments);
|
|
});
|
|
var dynCall_viij = (Module["dynCall_viij"] = function () {
|
|
return Module["asm"]["dynCall_viij"].apply(null, arguments);
|
|
});
|
|
var dynCall_viiji = (Module["dynCall_viiji"] = function () {
|
|
return Module["asm"]["dynCall_viiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijii = (Module["dynCall_viijii"] = function () {
|
|
return Module["asm"]["dynCall_viijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijiii = (Module["dynCall_viijiii"] = function () {
|
|
return Module["asm"]["dynCall_viijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijiiii = (Module["dynCall_viijiiii"] = function () {
|
|
return Module["asm"]["dynCall_viijiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijiiiii = (Module["dynCall_viijiiiii"] = function () {
|
|
return Module["asm"]["dynCall_viijiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijiijiii = (Module["dynCall_viijiijiii"] = function () {
|
|
return Module["asm"]["dynCall_viijiijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijijii = (Module["dynCall_viijijii"] = function () {
|
|
return Module["asm"]["dynCall_viijijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijijiii = (Module["dynCall_viijijiii"] = function () {
|
|
return Module["asm"]["dynCall_viijijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijj = (Module["dynCall_viijj"] = function () {
|
|
return Module["asm"]["dynCall_viijj"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijji = (Module["dynCall_viijji"] = function () {
|
|
return Module["asm"]["dynCall_viijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijjii = (Module["dynCall_viijjii"] = function () {
|
|
return Module["asm"]["dynCall_viijjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijjiii = (Module["dynCall_viijjiii"] = function () {
|
|
return Module["asm"]["dynCall_viijjiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijjiiii = (Module["dynCall_viijjiiii"] = function () {
|
|
return Module["asm"]["dynCall_viijjiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_viijjji = (Module["dynCall_viijjji"] = function () {
|
|
return Module["asm"]["dynCall_viijjji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vij = (Module["dynCall_vij"] = function () {
|
|
return Module["asm"]["dynCall_vij"].apply(null, arguments);
|
|
});
|
|
var dynCall_viji = (Module["dynCall_viji"] = function () {
|
|
return Module["asm"]["dynCall_viji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijii = (Module["dynCall_vijii"] = function () {
|
|
return Module["asm"]["dynCall_vijii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijiii = (Module["dynCall_vijiii"] = function () {
|
|
return Module["asm"]["dynCall_vijiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijiiii = (Module["dynCall_vijiiii"] = function () {
|
|
return Module["asm"]["dynCall_vijiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijiiiii = (Module["dynCall_vijiiiii"] = function () {
|
|
return Module["asm"]["dynCall_vijiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijiji = (Module["dynCall_vijiji"] = function () {
|
|
return Module["asm"]["dynCall_vijiji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijj = (Module["dynCall_vijj"] = function () {
|
|
return Module["asm"]["dynCall_vijj"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijji = (Module["dynCall_vijji"] = function () {
|
|
return Module["asm"]["dynCall_vijji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijjii = (Module["dynCall_vijjii"] = function () {
|
|
return Module["asm"]["dynCall_vijjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijjiii = (Module["dynCall_vijjiii"] = function () {
|
|
return Module["asm"]["dynCall_vijjiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijjiiii = (Module["dynCall_vijjiiii"] = function () {
|
|
return Module["asm"]["dynCall_vijjiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vijjji = (Module["dynCall_vijjji"] = function () {
|
|
return Module["asm"]["dynCall_vijjji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vj = (Module["dynCall_vj"] = function () {
|
|
return Module["asm"]["dynCall_vj"].apply(null, arguments);
|
|
});
|
|
var dynCall_vji = (Module["dynCall_vji"] = function () {
|
|
return Module["asm"]["dynCall_vji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjii = (Module["dynCall_vjii"] = function () {
|
|
return Module["asm"]["dynCall_vjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjiii = (Module["dynCall_vjiii"] = function () {
|
|
return Module["asm"]["dynCall_vjiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjiiii = (Module["dynCall_vjiiii"] = function () {
|
|
return Module["asm"]["dynCall_vjiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjiiiii = (Module["dynCall_vjiiiii"] = function () {
|
|
return Module["asm"]["dynCall_vjiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjiiiiiii = (Module["dynCall_vjiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_vjiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjiiiiiiii = (Module["dynCall_vjiiiiiiii"] = function () {
|
|
return Module["asm"]["dynCall_vjiiiiiiii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjj = (Module["dynCall_vjj"] = function () {
|
|
return Module["asm"]["dynCall_vjj"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjji = (Module["dynCall_vjji"] = function () {
|
|
return Module["asm"]["dynCall_vjji"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjjii = (Module["dynCall_vjjii"] = function () {
|
|
return Module["asm"]["dynCall_vjjii"].apply(null, arguments);
|
|
});
|
|
var dynCall_vjjiii = (Module["dynCall_vjjiii"] = function () {
|
|
return Module["asm"]["dynCall_vjjiii"].apply(null, arguments);
|
|
});
|
|
Module["asm"] = asm;
|
|
Module["ccall"] = ccall;
|
|
Module["cwrap"] = cwrap;
|
|
Module["stackTrace"] = stackTrace;
|
|
Module["addRunDependency"] = addRunDependency;
|
|
Module["removeRunDependency"] = removeRunDependency;
|
|
Module["FS_createPath"] = FS.createPath;
|
|
Module["FS_createDataFile"] = FS.createDataFile;
|
|
function ExitStatus(status) {
|
|
this.name = "ExitStatus";
|
|
this.message = "Program terminated with exit(" + status + ")";
|
|
this.status = status;
|
|
}
|
|
ExitStatus.prototype = new Error();
|
|
ExitStatus.prototype.constructor = ExitStatus;
|
|
var initialStackTop;
|
|
var calledMain = false;
|
|
dependenciesFulfilled = function runCaller() {
|
|
if (!Module["calledRun"]) run();
|
|
if (!Module["calledRun"]) dependenciesFulfilled = runCaller;
|
|
};
|
|
Module["callMain"] = function callMain(args) {
|
|
args = args || [];
|
|
ensureInitRuntime();
|
|
var argc = args.length + 1;
|
|
var argv = stackAlloc((argc + 1) * 4);
|
|
HEAP32[argv >> 2] = allocateUTF8OnStack(Module["thisProgram"]);
|
|
for (var i = 1; i < argc; i++) {
|
|
HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]);
|
|
}
|
|
HEAP32[(argv >> 2) + argc] = 0;
|
|
try {
|
|
var ret = Module["_main"](argc, argv, 0);
|
|
exit(ret, true);
|
|
} catch (e) {
|
|
if (e instanceof ExitStatus) {
|
|
return;
|
|
} else if (e == "SimulateInfiniteLoop") {
|
|
Module["noExitRuntime"] = true;
|
|
return;
|
|
} else {
|
|
var toLog = e;
|
|
if (e && typeof e === "object" && e.stack) {
|
|
toLog = [e, e.stack];
|
|
}
|
|
err("exception thrown: " + toLog);
|
|
Module["quit"](1, e);
|
|
}
|
|
} finally {
|
|
calledMain = true;
|
|
}
|
|
};
|
|
function run(args) {
|
|
args = args || Module["arguments"];
|
|
if (runDependencies > 0) {
|
|
return;
|
|
}
|
|
preRun();
|
|
if (runDependencies > 0) return;
|
|
if (Module["calledRun"]) return;
|
|
function doRun() {
|
|
if (Module["calledRun"]) return;
|
|
Module["calledRun"] = true;
|
|
if (ABORT) return;
|
|
ensureInitRuntime();
|
|
preMain();
|
|
if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"]();
|
|
if (Module["_main"] && shouldRunNow) Module["callMain"](args);
|
|
postRun();
|
|
}
|
|
if (Module["setStatus"]) {
|
|
Module["setStatus"]("Running...");
|
|
setTimeout(function () {
|
|
setTimeout(function () {
|
|
Module["setStatus"]("");
|
|
}, 1);
|
|
doRun();
|
|
}, 1);
|
|
} else {
|
|
doRun();
|
|
}
|
|
}
|
|
Module["run"] = run;
|
|
function exit(status, implicit) {
|
|
if (implicit && Module["noExitRuntime"] && status === 0) {
|
|
return;
|
|
}
|
|
if (Module["noExitRuntime"]) {
|
|
} else {
|
|
ABORT = true;
|
|
EXITSTATUS = status;
|
|
STACKTOP = initialStackTop;
|
|
exitRuntime();
|
|
if (Module["onExit"]) Module["onExit"](status);
|
|
}
|
|
Module["quit"](status, new ExitStatus(status));
|
|
}
|
|
function abort(what) {
|
|
if (Module["onAbort"]) {
|
|
Module["onAbort"](what);
|
|
}
|
|
if (what !== undefined) {
|
|
out(what);
|
|
err(what);
|
|
what = JSON.stringify(what);
|
|
} else {
|
|
what = "";
|
|
}
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
throw "abort(" + what + "). Build with -s ASSERTIONS=1 for more info.";
|
|
}
|
|
Module["abort"] = abort;
|
|
if (Module["preInit"]) {
|
|
if (typeof Module["preInit"] == "function") Module["preInit"] = [Module["preInit"]];
|
|
while (Module["preInit"].length > 0) {
|
|
Module["preInit"].pop()();
|
|
}
|
|
}
|
|
var shouldRunNow = true;
|
|
if (Module["noInitialRun"]) {
|
|
shouldRunNow = false;
|
|
}
|
|
Module["noExitRuntime"] = true;
|
|
run();
|
|
}
|