mirror of
https://gitlab.com/skysthelimit.dev/selenite.git
synced 2025-06-18 19:42:07 -05:00
19271 lines
748 KiB
JavaScript
19271 lines
748 KiB
JavaScript
function unityFramework(Module) {
|
|
var Module = typeof Module !== "undefined" ? Module : {};;
|
|
var stackTraceReference = "(^|\\n)(\\s+at\\s+|)jsStackTrace(\\s+\\(|@)([^\\n]+):\\d+:\\d+(\\)|)(\\n|$)";
|
|
var stackTraceReferenceMatch = jsStackTrace().match(new RegExp(stackTraceReference));
|
|
if (stackTraceReferenceMatch) Module.stackTraceRegExp = new RegExp(stackTraceReference.replace("([^\\n]+)", stackTraceReferenceMatch[4].replace(/[\\^${}[\]().*+?|]/g, "\\$&")).replace("jsStackTrace", "[^\\n]+"));
|
|
var abort = (function(what) {
|
|
if (ABORT) return;
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
if (typeof ENVIRONMENT_IS_PTHREAD !== "undefined" && ENVIRONMENT_IS_PTHREAD) console.error("Pthread aborting at " + (new Error).stack);
|
|
if (what !== undefined) {
|
|
out(what);
|
|
err(what);
|
|
what = JSON.stringify(what)
|
|
} else {
|
|
what = ""
|
|
}
|
|
var message = "abort(" + what + ") at " + stackTrace();
|
|
if (Module.abortHandler && Module.abortHandler(message)) return;
|
|
throw message
|
|
});
|
|
if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) {
|
|
Module["preRun"].push((function() {
|
|
var unityFileSystemInit = Module["unityFileSystemInit"] || (function() {
|
|
FS.mkdir("/idbfs");
|
|
FS.mount(IDBFS, {}, "/idbfs");
|
|
Module.addRunDependency("JS_FileSystem_Mount");
|
|
FS.syncfs(true, (function(err) {
|
|
if (err) console.log("IndexedDB is not available. Data will not persist in cache and PlayerPrefs will not be saved.");
|
|
Module.removeRunDependency("JS_FileSystem_Mount")
|
|
}))
|
|
});
|
|
unityFileSystemInit()
|
|
}))
|
|
}
|
|
Module["SetFullscreen"] = (function(fullscreen) {
|
|
if (typeof runtimeInitialized === "undefined" || !runtimeInitialized) {
|
|
console.log("Runtime not initialized yet.")
|
|
} else if (typeof JSEvents === "undefined") {
|
|
console.log("Player not loaded yet.")
|
|
} else {
|
|
var tmp = JSEvents.canPerformEventHandlerRequests;
|
|
JSEvents.canPerformEventHandlerRequests = (function() {
|
|
return 1
|
|
});
|
|
Module.ccall("SetFullscreen", null, ["number"], [fullscreen]);
|
|
JSEvents.canPerformEventHandlerRequests = tmp
|
|
}
|
|
});
|
|
var MediaDevices = [];
|
|
if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) {
|
|
Module["preRun"].push((function() {
|
|
var enumerateMediaDevices = (function() {
|
|
var getMedia = navigator.getUserMedia || navigator.webkitGetUserMedia || navigator.mozGetUserMedia || navigator.msGetUserMedia;
|
|
if (!getMedia) return;
|
|
|
|
function addDevice(label) {
|
|
label = label ? label : "device #" + MediaDevices.length;
|
|
var device = {
|
|
deviceName: label,
|
|
refCount: 0,
|
|
video: null
|
|
};
|
|
MediaDevices.push(device)
|
|
}
|
|
if (!navigator.mediaDevices || !navigator.mediaDevices.enumerateDevices) {
|
|
if (typeof MediaStreamTrack == "undefined" || typeof MediaStreamTrack.getSources == "undefined") {
|
|
console.log("Media Devices cannot be enumerated on this browser.");
|
|
return
|
|
}
|
|
|
|
function gotSources(sourceInfos) {
|
|
for (var i = 0; i !== sourceInfos.length; ++i) {
|
|
var sourceInfo = sourceInfos[i];
|
|
if (sourceInfo.kind === "video") addDevice(sourceInfo.label)
|
|
}
|
|
}
|
|
MediaStreamTrack.getSources(gotSources)
|
|
}
|
|
navigator.mediaDevices.enumerateDevices().then((function(devices) {
|
|
devices.forEach((function(device) {
|
|
if (device.kind == "videoinput") addDevice(device.label)
|
|
}))
|
|
})).catch((function(err) {
|
|
console.log(err.name + ": " + error.message)
|
|
}))
|
|
});
|
|
enumerateMediaDevices()
|
|
}))
|
|
}
|
|
|
|
function SendMessage(gameObject, func, param) {
|
|
if (param === undefined) Module.ccall("SendMessage", null, ["string", "string"], [gameObject, func]);
|
|
else if (typeof param === "string") Module.ccall("SendMessageString", null, ["string", "string", "string"], [gameObject, func, param]);
|
|
else if (typeof param === "number") Module.ccall("SendMessageFloat", null, ["string", "string", "number"], [gameObject, func, param]);
|
|
else throw "" + param + " is does not have a type which is supported by SendMessage."
|
|
}
|
|
Module["SendMessage"] = SendMessage;
|
|
var moduleOverrides = {};
|
|
var key;
|
|
for (key in Module) {
|
|
if (Module.hasOwnProperty(key)) {
|
|
moduleOverrides[key] = Module[key]
|
|
}
|
|
}
|
|
Module["arguments"] = [];
|
|
Module["thisProgram"] = "./this.program";
|
|
Module["quit"] = (function(status, toThrow) {
|
|
throw toThrow
|
|
});
|
|
Module["preRun"] = [];
|
|
Module["postRun"] = [];
|
|
var ENVIRONMENT_IS_WEB = false;
|
|
var ENVIRONMENT_IS_WORKER = false;
|
|
var ENVIRONMENT_IS_NODE = false;
|
|
var ENVIRONMENT_IS_SHELL = false;
|
|
ENVIRONMENT_IS_WEB = typeof window === "object";
|
|
ENVIRONMENT_IS_WORKER = typeof importScripts === "function";
|
|
ENVIRONMENT_IS_NODE = typeof process === "object" && typeof require === "function" && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
|
|
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
|
|
var scriptDirectory = "";
|
|
|
|
function locateFile(path) {
|
|
if (Module["locateFile"]) {
|
|
return Module["locateFile"](path, scriptDirectory)
|
|
} else {
|
|
return scriptDirectory + path
|
|
}
|
|
}
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
scriptDirectory = __dirname + "/";
|
|
var nodeFS;
|
|
var nodePath;
|
|
Module["read"] = function shell_read(filename, binary) {
|
|
var ret;
|
|
if (!nodeFS) nodeFS = require("fs");
|
|
if (!nodePath) nodePath = require("path");
|
|
filename = nodePath["normalize"](filename);
|
|
ret = nodeFS["readFileSync"](filename);
|
|
return binary ? ret : ret.toString()
|
|
};
|
|
Module["readBinary"] = function readBinary(filename) {
|
|
var ret = Module["read"](filename, true);
|
|
if (!ret.buffer) {
|
|
ret = new Uint8Array(ret)
|
|
}
|
|
assert(ret.buffer);
|
|
return ret
|
|
};
|
|
if (process["argv"].length > 1) {
|
|
Module["thisProgram"] = process["argv"][1].replace(/\\/g, "/")
|
|
}
|
|
Module["arguments"] = process["argv"].slice(2);
|
|
if (typeof module !== "undefined") {
|
|
module["exports"] = Module
|
|
}
|
|
process["on"]("uncaughtException", (function(ex) {
|
|
if (!(ex instanceof ExitStatus)) {
|
|
throw ex
|
|
}
|
|
}));
|
|
process["on"]("unhandledRejection", (function(reason, p) {
|
|
process["exit"](1)
|
|
}));
|
|
Module["quit"] = (function(status) {
|
|
process["exit"](status)
|
|
});
|
|
Module["inspect"] = (function() {
|
|
return "[Emscripten Module object]"
|
|
})
|
|
} else if (ENVIRONMENT_IS_SHELL) {
|
|
if (typeof read != "undefined") {
|
|
Module["read"] = function shell_read(f) {
|
|
return read(f)
|
|
}
|
|
}
|
|
Module["readBinary"] = function readBinary(f) {
|
|
var data;
|
|
if (typeof readbuffer === "function") {
|
|
return new Uint8Array(readbuffer(f))
|
|
}
|
|
data = read(f, "binary");
|
|
assert(typeof data === "object");
|
|
return data
|
|
};
|
|
if (typeof scriptArgs != "undefined") {
|
|
Module["arguments"] = scriptArgs
|
|
} else if (typeof arguments != "undefined") {
|
|
Module["arguments"] = arguments
|
|
}
|
|
if (typeof quit === "function") {
|
|
Module["quit"] = (function(status) {
|
|
quit(status)
|
|
})
|
|
}
|
|
} else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
|
|
if (ENVIRONMENT_IS_WEB) {
|
|
if (document.currentScript) {
|
|
scriptDirectory = document.currentScript.src
|
|
}
|
|
} else {
|
|
scriptDirectory = self.location.href
|
|
}
|
|
if (scriptDirectory.indexOf("blob:") !== 0) {
|
|
scriptDirectory = scriptDirectory.split("/").slice(0, -1).join("/") + "/"
|
|
} else {
|
|
scriptDirectory = ""
|
|
}
|
|
Module["read"] = function shell_read(url) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, false);
|
|
xhr.send(null);
|
|
return xhr.responseText
|
|
};
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module["readBinary"] = function readBinary(url) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, false);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.send(null);
|
|
return new Uint8Array(xhr.response)
|
|
}
|
|
}
|
|
Module["readAsync"] = function readAsync(url, onload, onerror) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, true);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.onload = function xhr_onload() {
|
|
if (xhr.status == 200 || xhr.status == 0 && xhr.response) {
|
|
onload(xhr.response);
|
|
return
|
|
}
|
|
onerror()
|
|
};
|
|
xhr.onerror = onerror;
|
|
xhr.send(null)
|
|
};
|
|
Module["setWindowTitle"] = (function(title) {
|
|
document.title = title
|
|
})
|
|
} else {}
|
|
var out = Module["print"] || (typeof console !== "undefined" ? console.log.bind(console) : typeof print !== "undefined" ? print : null);
|
|
var err = Module["printErr"] || (typeof printErr !== "undefined" ? printErr : typeof console !== "undefined" && console.warn.bind(console) || out);
|
|
for (key in moduleOverrides) {
|
|
if (moduleOverrides.hasOwnProperty(key)) {
|
|
Module[key] = moduleOverrides[key]
|
|
}
|
|
}
|
|
moduleOverrides = undefined;
|
|
var STACK_ALIGN = 16;
|
|
|
|
function staticAlloc(size) {
|
|
var ret = STATICTOP;
|
|
STATICTOP = STATICTOP + size + 15 & -16;
|
|
return ret
|
|
}
|
|
|
|
function dynamicAlloc(size) {
|
|
var ret = HEAP32[DYNAMICTOP_PTR >> 2];
|
|
var end = ret + size + 15 & -16;
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = end;
|
|
if (end >= TOTAL_MEMORY) {
|
|
var success = enlargeMemory();
|
|
if (!success) {
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = ret;
|
|
return 0
|
|
}
|
|
}
|
|
return ret
|
|
}
|
|
|
|
function alignMemory(size, factor) {
|
|
if (!factor) factor = STACK_ALIGN;
|
|
var ret = size = Math.ceil(size / factor) * factor;
|
|
return ret
|
|
}
|
|
|
|
function getNativeTypeSize(type) {
|
|
switch (type) {
|
|
case "i1":
|
|
case "i8":
|
|
return 1;
|
|
case "i16":
|
|
return 2;
|
|
case "i32":
|
|
return 4;
|
|
case "i64":
|
|
return 8;
|
|
case "float":
|
|
return 4;
|
|
case "double":
|
|
return 8;
|
|
default:
|
|
{
|
|
if (type[type.length - 1] === "*") {
|
|
return 4
|
|
} else if (type[0] === "i") {
|
|
var bits = parseInt(type.substr(1));
|
|
assert(bits % 8 === 0);
|
|
return bits / 8
|
|
} else {
|
|
return 0
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
function warnOnce(text) {
|
|
if (!warnOnce.shown) warnOnce.shown = {};
|
|
if (!warnOnce.shown[text]) {
|
|
warnOnce.shown[text] = 1;
|
|
err(text)
|
|
}
|
|
}
|
|
var asm2wasmImports = {
|
|
"f64-rem": (function(x, y) {
|
|
return x % y
|
|
}),
|
|
"debugger": (function() {
|
|
debugger
|
|
})
|
|
};
|
|
var functionPointers = new Array(0);
|
|
var funcWrappers = {};
|
|
|
|
function getFuncWrapper(func, sig) {
|
|
if (!func) return;
|
|
assert(sig);
|
|
if (!funcWrappers[sig]) {
|
|
funcWrappers[sig] = {}
|
|
}
|
|
var sigCache = funcWrappers[sig];
|
|
if (!sigCache[func]) {
|
|
if (sig.length === 1) {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return dynCall(sig, func)
|
|
}
|
|
} else if (sig.length === 2) {
|
|
sigCache[func] = function dynCall_wrapper(arg) {
|
|
return dynCall(sig, func, [arg])
|
|
}
|
|
} else {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return dynCall(sig, func, Array.prototype.slice.call(arguments))
|
|
}
|
|
}
|
|
}
|
|
return sigCache[func]
|
|
}
|
|
|
|
function makeBigInt(low, high, unsigned) {
|
|
return unsigned ? +(low >>> 0) + +(high >>> 0) * 4294967296 : +(low >>> 0) + +(high | 0) * 4294967296
|
|
}
|
|
|
|
function dynCall(sig, ptr, args) {
|
|
if (args && args.length) {
|
|
return Module["dynCall_" + sig].apply(null, [ptr].concat(args))
|
|
} else {
|
|
return Module["dynCall_" + sig].call(null, ptr)
|
|
}
|
|
}
|
|
var GLOBAL_BASE = 1024;
|
|
var ABORT = 0;
|
|
var EXITSTATUS = 0;
|
|
|
|
function assert(condition, text) {
|
|
if (!condition) {
|
|
abort("Assertion failed: " + text)
|
|
}
|
|
}
|
|
|
|
function getCFunc(ident) {
|
|
var func = Module["_" + ident];
|
|
assert(func, "Cannot call unknown function " + ident + ", make sure it is exported");
|
|
return func
|
|
}
|
|
var JSfuncs = {
|
|
"stackSave": (function() {
|
|
stackSave()
|
|
}),
|
|
"stackRestore": (function() {
|
|
stackRestore()
|
|
}),
|
|
"arrayToC": (function(arr) {
|
|
var ret = stackAlloc(arr.length);
|
|
writeArrayToMemory(arr, ret);
|
|
return ret
|
|
}),
|
|
"stringToC": (function(str) {
|
|
var ret = 0;
|
|
if (str !== null && str !== undefined && str !== 0) {
|
|
var len = (str.length << 2) + 1;
|
|
ret = stackAlloc(len);
|
|
stringToUTF8(str, ret, len)
|
|
}
|
|
return ret
|
|
})
|
|
};
|
|
var toC = {
|
|
"string": JSfuncs["stringToC"],
|
|
"array": JSfuncs["arrayToC"]
|
|
};
|
|
|
|
function ccall(ident, returnType, argTypes, args, opts) {
|
|
function convertReturnValue(ret) {
|
|
if (returnType === "string") return Pointer_stringify(ret);
|
|
if (returnType === "boolean") return Boolean(ret);
|
|
return ret
|
|
}
|
|
var func = getCFunc(ident);
|
|
var cArgs = [];
|
|
var stack = 0;
|
|
if (args) {
|
|
for (var i = 0; i < args.length; i++) {
|
|
var converter = toC[argTypes[i]];
|
|
if (converter) {
|
|
if (stack === 0) stack = stackSave();
|
|
cArgs[i] = converter(args[i])
|
|
} else {
|
|
cArgs[i] = args[i]
|
|
}
|
|
}
|
|
}
|
|
var ret = func.apply(null, cArgs);
|
|
ret = convertReturnValue(ret);
|
|
if (stack !== 0) stackRestore(stack);
|
|
return ret
|
|
}
|
|
|
|
function cwrap(ident, returnType, argTypes, opts) {
|
|
argTypes = argTypes || [];
|
|
var numericArgs = argTypes.every((function(type) {
|
|
return type === "number"
|
|
}));
|
|
var numericRet = returnType !== "string";
|
|
if (numericRet && numericArgs && !opts) {
|
|
return getCFunc(ident)
|
|
}
|
|
return (function() {
|
|
return ccall(ident, returnType, argTypes, arguments, opts)
|
|
})
|
|
}
|
|
|
|
function setValue(ptr, value, type, noSafe) {
|
|
type = type || "i8";
|
|
if (type.charAt(type.length - 1) === "*") type = "i32";
|
|
switch (type) {
|
|
case "i1":
|
|
HEAP8[ptr >> 0] = value;
|
|
break;
|
|
case "i8":
|
|
HEAP8[ptr >> 0] = value;
|
|
break;
|
|
case "i16":
|
|
HEAP16[ptr >> 1] = value;
|
|
break;
|
|
case "i32":
|
|
HEAP32[ptr >> 2] = value;
|
|
break;
|
|
case "i64":
|
|
tempI64 = [value >>> 0, (tempDouble = value, +Math_abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[ptr >> 2] = tempI64[0], HEAP32[ptr + 4 >> 2] = tempI64[1];
|
|
break;
|
|
case "float":
|
|
HEAPF32[ptr >> 2] = value;
|
|
break;
|
|
case "double":
|
|
HEAPF64[ptr >> 3] = value;
|
|
break;
|
|
default:
|
|
abort("invalid type for setValue: " + type)
|
|
}
|
|
}
|
|
var ALLOC_NORMAL = 0;
|
|
var ALLOC_STACK = 1;
|
|
var ALLOC_STATIC = 2;
|
|
var ALLOC_NONE = 4;
|
|
|
|
function allocate(slab, types, allocator, ptr) {
|
|
var zeroinit, size;
|
|
if (typeof slab === "number") {
|
|
zeroinit = true;
|
|
size = slab
|
|
} else {
|
|
zeroinit = false;
|
|
size = slab.length
|
|
}
|
|
var singleType = typeof types === "string" ? types : null;
|
|
var ret;
|
|
if (allocator == ALLOC_NONE) {
|
|
ret = ptr
|
|
} else {
|
|
ret = [typeof _malloc === "function" ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length))
|
|
}
|
|
if (zeroinit) {
|
|
var stop;
|
|
ptr = ret;
|
|
assert((ret & 3) == 0);
|
|
stop = ret + (size & ~3);
|
|
for (; ptr < stop; ptr += 4) {
|
|
HEAP32[ptr >> 2] = 0
|
|
}
|
|
stop = ret + size;
|
|
while (ptr < stop) {
|
|
HEAP8[ptr++ >> 0] = 0
|
|
}
|
|
return ret
|
|
}
|
|
if (singleType === "i8") {
|
|
if (slab.subarray || slab.slice) {
|
|
HEAPU8.set(slab, ret)
|
|
} else {
|
|
HEAPU8.set(new Uint8Array(slab), ret)
|
|
}
|
|
return ret
|
|
}
|
|
var i = 0,
|
|
type, typeSize, previousType;
|
|
while (i < size) {
|
|
var curr = slab[i];
|
|
type = singleType || types[i];
|
|
if (type === 0) {
|
|
i++;
|
|
continue
|
|
}
|
|
if (type == "i64") type = "i32";
|
|
setValue(ret + i, curr, type);
|
|
if (previousType !== type) {
|
|
typeSize = getNativeTypeSize(type);
|
|
previousType = type
|
|
}
|
|
i += typeSize
|
|
}
|
|
return ret
|
|
}
|
|
|
|
function getMemory(size) {
|
|
if (!staticSealed) return staticAlloc(size);
|
|
if (!runtimeInitialized) return dynamicAlloc(size);
|
|
return _malloc(size)
|
|
}
|
|
|
|
function Pointer_stringify(ptr, length) {
|
|
if (length === 0 || !ptr) return "";
|
|
var hasUtf = 0;
|
|
var t;
|
|
var i = 0;
|
|
while (1) {
|
|
t = HEAPU8[ptr + i >> 0];
|
|
hasUtf |= t;
|
|
if (t == 0 && !length) break;
|
|
i++;
|
|
if (length && i == length) break
|
|
}
|
|
if (!length) length = i;
|
|
var ret = "";
|
|
if (hasUtf < 128) {
|
|
var MAX_CHUNK = 1024;
|
|
var curr;
|
|
while (length > 0) {
|
|
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
|
|
ret = ret ? ret + curr : curr;
|
|
ptr += MAX_CHUNK;
|
|
length -= MAX_CHUNK
|
|
}
|
|
return ret
|
|
}
|
|
return UTF8ToString(ptr)
|
|
}
|
|
var UTF8Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf8") : undefined;
|
|
|
|
function UTF8ArrayToString(u8Array, idx) {
|
|
var endPtr = idx;
|
|
while (u8Array[endPtr]) ++endPtr;
|
|
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
|
|
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr))
|
|
} else {
|
|
var u0, u1, u2, u3, u4, u5;
|
|
var str = "";
|
|
while (1) {
|
|
u0 = u8Array[idx++];
|
|
if (!u0) return str;
|
|
if (!(u0 & 128)) {
|
|
str += String.fromCharCode(u0);
|
|
continue
|
|
}
|
|
u1 = u8Array[idx++] & 63;
|
|
if ((u0 & 224) == 192) {
|
|
str += String.fromCharCode((u0 & 31) << 6 | u1);
|
|
continue
|
|
}
|
|
u2 = u8Array[idx++] & 63;
|
|
if ((u0 & 240) == 224) {
|
|
u0 = (u0 & 15) << 12 | u1 << 6 | u2
|
|
} else {
|
|
u3 = u8Array[idx++] & 63;
|
|
if ((u0 & 248) == 240) {
|
|
u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | u3
|
|
} else {
|
|
u4 = u8Array[idx++] & 63;
|
|
if ((u0 & 252) == 248) {
|
|
u0 = (u0 & 3) << 24 | u1 << 18 | u2 << 12 | u3 << 6 | u4
|
|
} else {
|
|
u5 = u8Array[idx++] & 63;
|
|
u0 = (u0 & 1) << 30 | u1 << 24 | u2 << 18 | u3 << 12 | u4 << 6 | u5
|
|
}
|
|
}
|
|
}
|
|
if (u0 < 65536) {
|
|
str += String.fromCharCode(u0)
|
|
} else {
|
|
var ch = u0 - 65536;
|
|
str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023)
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
function UTF8ToString(ptr) {
|
|
return UTF8ArrayToString(HEAPU8, ptr)
|
|
}
|
|
|
|
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
|
|
if (!(maxBytesToWrite > 0)) return 0;
|
|
var startIdx = outIdx;
|
|
var endIdx = outIdx + maxBytesToWrite - 1;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
var u = str.charCodeAt(i);
|
|
if (u >= 55296 && u <= 57343) {
|
|
var u1 = str.charCodeAt(++i);
|
|
u = 65536 + ((u & 1023) << 10) | u1 & 1023
|
|
}
|
|
if (u <= 127) {
|
|
if (outIdx >= endIdx) break;
|
|
outU8Array[outIdx++] = u
|
|
} else if (u <= 2047) {
|
|
if (outIdx + 1 >= endIdx) break;
|
|
outU8Array[outIdx++] = 192 | u >> 6;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else if (u <= 65535) {
|
|
if (outIdx + 2 >= endIdx) break;
|
|
outU8Array[outIdx++] = 224 | u >> 12;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else if (u <= 2097151) {
|
|
if (outIdx + 3 >= endIdx) break;
|
|
outU8Array[outIdx++] = 240 | u >> 18;
|
|
outU8Array[outIdx++] = 128 | u >> 12 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else if (u <= 67108863) {
|
|
if (outIdx + 4 >= endIdx) break;
|
|
outU8Array[outIdx++] = 248 | u >> 24;
|
|
outU8Array[outIdx++] = 128 | u >> 18 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 12 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else {
|
|
if (outIdx + 5 >= endIdx) break;
|
|
outU8Array[outIdx++] = 252 | u >> 30;
|
|
outU8Array[outIdx++] = 128 | u >> 24 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 18 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 12 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
}
|
|
}
|
|
outU8Array[outIdx] = 0;
|
|
return outIdx - startIdx
|
|
}
|
|
|
|
function stringToUTF8(str, outPtr, maxBytesToWrite) {
|
|
return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite)
|
|
}
|
|
|
|
function lengthBytesUTF8(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
var u = str.charCodeAt(i);
|
|
if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023;
|
|
if (u <= 127) {
|
|
++len
|
|
} else if (u <= 2047) {
|
|
len += 2
|
|
} else if (u <= 65535) {
|
|
len += 3
|
|
} else if (u <= 2097151) {
|
|
len += 4
|
|
} else if (u <= 67108863) {
|
|
len += 5
|
|
} else {
|
|
len += 6
|
|
}
|
|
}
|
|
return len
|
|
}
|
|
var UTF16Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le") : undefined;
|
|
|
|
function allocateUTF8(str) {
|
|
var size = lengthBytesUTF8(str) + 1;
|
|
var ret = _malloc(size);
|
|
if (ret) stringToUTF8Array(str, HEAP8, ret, size);
|
|
return ret
|
|
}
|
|
|
|
function allocateUTF8OnStack(str) {
|
|
var size = lengthBytesUTF8(str) + 1;
|
|
var ret = stackAlloc(size);
|
|
stringToUTF8Array(str, HEAP8, ret, size);
|
|
return ret
|
|
}
|
|
|
|
function demangle(func) {
|
|
return func
|
|
}
|
|
|
|
function demangleAll(text) {
|
|
var regex = /__Z[\w\d_]+/g;
|
|
return text.replace(regex, (function(x) {
|
|
var y = demangle(x);
|
|
return x === y ? x : x + " [" + y + "]"
|
|
}))
|
|
}
|
|
|
|
function jsStackTrace() {
|
|
var err = new Error;
|
|
if (!err.stack) {
|
|
try {
|
|
throw new Error(0)
|
|
} catch (e) {
|
|
err = e
|
|
}
|
|
if (!err.stack) {
|
|
return "(no stack trace available)"
|
|
}
|
|
}
|
|
return err.stack.toString()
|
|
}
|
|
|
|
function stackTrace() {
|
|
var js = jsStackTrace();
|
|
if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"]();
|
|
return demangleAll(js)
|
|
}
|
|
var PAGE_SIZE = 16384;
|
|
var WASM_PAGE_SIZE = 65536;
|
|
var ASMJS_PAGE_SIZE = 16777216;
|
|
var MIN_TOTAL_MEMORY = 16777216;
|
|
|
|
function alignUp(x, multiple) {
|
|
if (x % multiple > 0) {
|
|
x += multiple - x % multiple
|
|
}
|
|
return x
|
|
}
|
|
var buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
|
|
|
|
function updateGlobalBuffer(buf) {
|
|
Module["buffer"] = buffer = buf
|
|
}
|
|
|
|
function updateGlobalBufferViews() {
|
|
Module["HEAP8"] = HEAP8 = new Int8Array(buffer);
|
|
Module["HEAP16"] = HEAP16 = new Int16Array(buffer);
|
|
Module["HEAP32"] = HEAP32 = new Int32Array(buffer);
|
|
Module["HEAPU8"] = HEAPU8 = new Uint8Array(buffer);
|
|
Module["HEAPU16"] = HEAPU16 = new Uint16Array(buffer);
|
|
Module["HEAPU32"] = HEAPU32 = new Uint32Array(buffer);
|
|
Module["HEAPF32"] = HEAPF32 = new Float32Array(buffer);
|
|
Module["HEAPF64"] = HEAPF64 = new Float64Array(buffer)
|
|
}
|
|
var STATIC_BASE, STATICTOP, staticSealed;
|
|
var STACK_BASE, STACKTOP, STACK_MAX;
|
|
var DYNAMIC_BASE, DYNAMICTOP_PTR;
|
|
STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
|
|
staticSealed = false;
|
|
|
|
function abortOnCannotGrowMemory() {
|
|
abort("Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value " + TOTAL_MEMORY + ", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ")
|
|
}
|
|
if (!Module["reallocBuffer"]) Module["reallocBuffer"] = (function(size) {
|
|
var ret;
|
|
try {
|
|
if (ArrayBuffer.transfer) {
|
|
ret = ArrayBuffer.transfer(buffer, size)
|
|
} else {
|
|
var oldHEAP8 = HEAP8;
|
|
ret = new ArrayBuffer(size);
|
|
var temp = new Int8Array(ret);
|
|
temp.set(oldHEAP8)
|
|
}
|
|
} catch (e) {
|
|
return false
|
|
}
|
|
var success = _emscripten_replace_memory(ret);
|
|
if (!success) return false;
|
|
return ret
|
|
});
|
|
|
|
function enlargeMemory() {
|
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE;
|
|
var LIMIT = 2147483648 - PAGE_MULTIPLE;
|
|
if (HEAP32[DYNAMICTOP_PTR >> 2] > LIMIT) {
|
|
return false
|
|
}
|
|
var OLD_TOTAL_MEMORY = TOTAL_MEMORY;
|
|
TOTAL_MEMORY = Math.max(TOTAL_MEMORY, MIN_TOTAL_MEMORY);
|
|
while (TOTAL_MEMORY < HEAP32[DYNAMICTOP_PTR >> 2]) {
|
|
if (TOTAL_MEMORY <= 536870912) {
|
|
TOTAL_MEMORY = alignUp(2 * TOTAL_MEMORY, PAGE_MULTIPLE)
|
|
} else {
|
|
TOTAL_MEMORY = Math.min(alignUp((3 * TOTAL_MEMORY + 2147483648) / 4, PAGE_MULTIPLE), LIMIT)
|
|
}
|
|
}
|
|
var replacement = Module["reallocBuffer"](TOTAL_MEMORY);
|
|
if (!replacement || replacement.byteLength != TOTAL_MEMORY) {
|
|
TOTAL_MEMORY = OLD_TOTAL_MEMORY;
|
|
return false
|
|
}
|
|
updateGlobalBuffer(replacement);
|
|
updateGlobalBufferViews();
|
|
return true
|
|
}
|
|
var byteLength;
|
|
try {
|
|
byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, "byteLength").get);
|
|
byteLength(new ArrayBuffer(4))
|
|
} catch (e) {
|
|
byteLength = (function(buffer) {
|
|
return buffer.byteLength
|
|
})
|
|
}
|
|
var TOTAL_STACK = Module["TOTAL_STACK"] || 5242880;
|
|
var TOTAL_MEMORY = Module["TOTAL_MEMORY"] || 33554432;
|
|
if (TOTAL_MEMORY < TOTAL_STACK) err("TOTAL_MEMORY should be larger than TOTAL_STACK, was " + TOTAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")");
|
|
if (Module["buffer"]) {
|
|
buffer = Module["buffer"]
|
|
} else {
|
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Memory === "function") {
|
|
Module["wasmMemory"] = new WebAssembly.Memory({
|
|
"initial": TOTAL_MEMORY / WASM_PAGE_SIZE
|
|
});
|
|
buffer = Module["wasmMemory"].buffer
|
|
} else {
|
|
buffer = new ArrayBuffer(TOTAL_MEMORY)
|
|
}
|
|
Module["buffer"] = buffer
|
|
}
|
|
updateGlobalBufferViews();
|
|
|
|
function getTotalMemory() {
|
|
return TOTAL_MEMORY
|
|
}
|
|
|
|
function callRuntimeCallbacks(callbacks) {
|
|
while (callbacks.length > 0) {
|
|
var callback = callbacks.shift();
|
|
if (typeof callback == "function") {
|
|
callback();
|
|
continue
|
|
}
|
|
var func = callback.func;
|
|
if (typeof func === "number") {
|
|
if (callback.arg === undefined) {
|
|
Module["dynCall_v"](func)
|
|
} else {
|
|
Module["dynCall_vi"](func, callback.arg)
|
|
}
|
|
} else {
|
|
func(callback.arg === undefined ? null : callback.arg)
|
|
}
|
|
}
|
|
}
|
|
var __ATPRERUN__ = [];
|
|
var __ATINIT__ = [];
|
|
var __ATMAIN__ = [];
|
|
var __ATEXIT__ = [];
|
|
var __ATPOSTRUN__ = [];
|
|
var runtimeInitialized = false;
|
|
var runtimeExited = false;
|
|
|
|
function preRun() {
|
|
if (Module["preRun"]) {
|
|
if (typeof Module["preRun"] == "function") Module["preRun"] = [Module["preRun"]];
|
|
while (Module["preRun"].length) {
|
|
addOnPreRun(Module["preRun"].shift())
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPRERUN__)
|
|
}
|
|
|
|
function ensureInitRuntime() {
|
|
if (runtimeInitialized) return;
|
|
runtimeInitialized = true;
|
|
callRuntimeCallbacks(__ATINIT__)
|
|
}
|
|
|
|
function preMain() {
|
|
callRuntimeCallbacks(__ATMAIN__)
|
|
}
|
|
|
|
function exitRuntime() {
|
|
callRuntimeCallbacks(__ATEXIT__);
|
|
runtimeExited = true
|
|
}
|
|
|
|
function postRun() {
|
|
if (Module["postRun"]) {
|
|
if (typeof Module["postRun"] == "function") Module["postRun"] = [Module["postRun"]];
|
|
while (Module["postRun"].length) {
|
|
addOnPostRun(Module["postRun"].shift())
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPOSTRUN__)
|
|
}
|
|
|
|
function addOnPreRun(cb) {
|
|
__ATPRERUN__.unshift(cb)
|
|
}
|
|
|
|
function addOnPostRun(cb) {
|
|
__ATPOSTRUN__.unshift(cb)
|
|
}
|
|
|
|
function writeArrayToMemory(array, buffer) {
|
|
HEAP8.set(array, buffer)
|
|
}
|
|
|
|
function writeAsciiToMemory(str, buffer, dontAddNull) {
|
|
for (var i = 0; i < str.length; ++i) {
|
|
HEAP8[buffer++ >> 0] = str.charCodeAt(i)
|
|
}
|
|
if (!dontAddNull) HEAP8[buffer >> 0] = 0
|
|
}
|
|
|
|
function unSign(value, bits, ignore) {
|
|
if (value >= 0) {
|
|
return value
|
|
}
|
|
return bits <= 32 ? 2 * Math.abs(1 << bits - 1) + value : Math.pow(2, bits) + value
|
|
}
|
|
|
|
function reSign(value, bits, ignore) {
|
|
if (value <= 0) {
|
|
return value
|
|
}
|
|
var half = bits <= 32 ? Math.abs(1 << bits - 1) : Math.pow(2, bits - 1);
|
|
if (value >= half && (bits <= 32 || value > half)) {
|
|
value = -2 * half + value
|
|
}
|
|
return value
|
|
}
|
|
var Math_abs = Math.abs;
|
|
var Math_ceil = Math.ceil;
|
|
var Math_floor = Math.floor;
|
|
var Math_pow = Math.pow;
|
|
var Math_min = Math.min;
|
|
var Math_clz32 = Math.clz32;
|
|
var Math_trunc = Math.trunc;
|
|
var runDependencies = 0;
|
|
var runDependencyWatcher = null;
|
|
var dependenciesFulfilled = null;
|
|
|
|
function getUniqueRunDependency(id) {
|
|
return id
|
|
}
|
|
|
|
function addRunDependency(id) {
|
|
runDependencies++;
|
|
if (Module["monitorRunDependencies"]) {
|
|
Module["monitorRunDependencies"](runDependencies)
|
|
}
|
|
}
|
|
|
|
function removeRunDependency(id) {
|
|
runDependencies--;
|
|
if (Module["monitorRunDependencies"]) {
|
|
Module["monitorRunDependencies"](runDependencies)
|
|
}
|
|
if (runDependencies == 0) {
|
|
if (runDependencyWatcher !== null) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null
|
|
}
|
|
if (dependenciesFulfilled) {
|
|
var callback = dependenciesFulfilled;
|
|
dependenciesFulfilled = null;
|
|
callback()
|
|
}
|
|
}
|
|
}
|
|
Module["preloadedImages"] = {};
|
|
Module["preloadedAudios"] = {};
|
|
var dataURIPrefix = "data:application/octet-stream;base64,";
|
|
|
|
function isDataURI(filename) {
|
|
return String.prototype.startsWith ? filename.startsWith(dataURIPrefix) : filename.indexOf(dataURIPrefix) === 0
|
|
}
|
|
|
|
function integrateWasmJS() {
|
|
var wasmTextFile = "build.wast";
|
|
var wasmBinaryFile = "build.wasm";
|
|
var asmjsCodeFile = "build.temp.asm.js";
|
|
if (!isDataURI(wasmTextFile)) {
|
|
wasmTextFile = locateFile(wasmTextFile)
|
|
}
|
|
if (!isDataURI(wasmBinaryFile)) {
|
|
wasmBinaryFile = locateFile(wasmBinaryFile)
|
|
}
|
|
if (!isDataURI(asmjsCodeFile)) {
|
|
asmjsCodeFile = locateFile(asmjsCodeFile)
|
|
}
|
|
var wasmPageSize = 64 * 1024;
|
|
var info = {
|
|
"global": null,
|
|
"env": null,
|
|
"asm2wasm": asm2wasmImports,
|
|
"parent": Module
|
|
};
|
|
var exports = null;
|
|
|
|
function mergeMemory(newBuffer) {
|
|
var oldBuffer = Module["buffer"];
|
|
if (newBuffer.byteLength < oldBuffer.byteLength) {
|
|
err("the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here")
|
|
}
|
|
var oldView = new Int8Array(oldBuffer);
|
|
var newView = new Int8Array(newBuffer);
|
|
newView.set(oldView);
|
|
updateGlobalBuffer(newBuffer);
|
|
updateGlobalBufferViews()
|
|
}
|
|
|
|
function fixImports(imports) {
|
|
return imports
|
|
}
|
|
|
|
function getBinary() {
|
|
try {
|
|
if (Module["wasmBinary"]) {
|
|
return new Uint8Array(Module["wasmBinary"])
|
|
}
|
|
if (Module["readBinary"]) {
|
|
return Module["readBinary"](wasmBinaryFile)
|
|
} else {
|
|
throw "both async and sync fetching of the wasm failed"
|
|
}
|
|
} catch (err) {
|
|
abort(err)
|
|
}
|
|
}
|
|
|
|
function getBinaryPromise() {
|
|
if (!Module["wasmBinary"] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === "function") {
|
|
return fetch(wasmBinaryFile, {
|
|
credentials: "same-origin"
|
|
}).then((function(response) {
|
|
if (!response["ok"]) {
|
|
throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"
|
|
}
|
|
return response["arrayBuffer"]()
|
|
})).catch((function() {
|
|
return getBinary()
|
|
}))
|
|
}
|
|
return new Promise((function(resolve, reject) {
|
|
resolve(getBinary())
|
|
}))
|
|
}
|
|
|
|
function doNativeWasm(global, env, providedBuffer) {
|
|
if (typeof WebAssembly !== "object") {
|
|
err("no native wasm support detected");
|
|
return false
|
|
}
|
|
if (!(Module["wasmMemory"] instanceof WebAssembly.Memory)) {
|
|
err("no native wasm Memory in use");
|
|
return false
|
|
}
|
|
env["memory"] = Module["wasmMemory"];
|
|
info["global"] = {
|
|
"NaN": NaN,
|
|
"Infinity": Infinity
|
|
};
|
|
info["global.Math"] = Math;
|
|
info["env"] = env;
|
|
|
|
function receiveInstance(instance, module) {
|
|
exports = instance.exports;
|
|
if (exports.memory) mergeMemory(exports.memory);
|
|
Module["asm"] = exports;
|
|
Module["usingWasm"] = true;
|
|
removeRunDependency("wasm-instantiate")
|
|
}
|
|
addRunDependency("wasm-instantiate");
|
|
if (Module["instantiateWasm"]) {
|
|
try {
|
|
return Module["instantiateWasm"](info, receiveInstance)
|
|
} catch (e) {
|
|
err("Module.instantiateWasm callback failed with error: " + e);
|
|
return false
|
|
}
|
|
}
|
|
|
|
function receiveInstantiatedSource(output) {
|
|
receiveInstance(output["instance"], output["module"])
|
|
}
|
|
|
|
function instantiateArrayBuffer(receiver) {
|
|
getBinaryPromise().then((function(binary) {
|
|
return WebAssembly.instantiate(binary, info)
|
|
})).then(receiver).catch((function(reason) {
|
|
err("failed to asynchronously prepare wasm: " + reason);
|
|
abort(reason)
|
|
}))
|
|
}
|
|
if (!Module["wasmBinary"] && typeof WebAssembly.instantiateStreaming === "function" && !isDataURI(wasmBinaryFile) && typeof fetch === "function") {
|
|
WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, {
|
|
credentials: "same-origin"
|
|
}), info).then(receiveInstantiatedSource).catch((function(reason) {
|
|
err("wasm streaming compile failed: " + reason);
|
|
err("falling back to ArrayBuffer instantiation");
|
|
instantiateArrayBuffer(receiveInstantiatedSource)
|
|
}))
|
|
} else {
|
|
instantiateArrayBuffer(receiveInstantiatedSource)
|
|
}
|
|
return {}
|
|
}
|
|
Module["asmPreload"] = Module["asm"];
|
|
var asmjsReallocBuffer = Module["reallocBuffer"];
|
|
var wasmReallocBuffer = (function(size) {
|
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE;
|
|
size = alignUp(size, PAGE_MULTIPLE);
|
|
var old = Module["buffer"];
|
|
var oldSize = old.byteLength;
|
|
if (Module["usingWasm"]) {
|
|
try {
|
|
var result = Module["wasmMemory"].grow((size - oldSize) / wasmPageSize);
|
|
if (result !== (-1 | 0)) {
|
|
return Module["buffer"] = Module["wasmMemory"].buffer
|
|
} else {
|
|
return null
|
|
}
|
|
} catch (e) {
|
|
return null
|
|
}
|
|
}
|
|
});
|
|
Module["reallocBuffer"] = (function(size) {
|
|
if (finalMethod === "asmjs") {
|
|
return asmjsReallocBuffer(size)
|
|
} else {
|
|
return wasmReallocBuffer(size)
|
|
}
|
|
});
|
|
var finalMethod = "";
|
|
Module["asm"] = (function(global, env, providedBuffer) {
|
|
env = fixImports(env);
|
|
if (!env["table"]) {
|
|
var TABLE_SIZE = Module["wasmTableSize"];
|
|
if (TABLE_SIZE === undefined) TABLE_SIZE = 1024;
|
|
var MAX_TABLE_SIZE = Module["wasmMaxTableSize"];
|
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Table === "function") {
|
|
if (MAX_TABLE_SIZE !== undefined) {
|
|
env["table"] = new WebAssembly.Table({
|
|
"initial": TABLE_SIZE,
|
|
"maximum": MAX_TABLE_SIZE,
|
|
"element": "anyfunc"
|
|
})
|
|
} else {
|
|
env["table"] = new WebAssembly.Table({
|
|
"initial": TABLE_SIZE,
|
|
element: "anyfunc"
|
|
})
|
|
}
|
|
} else {
|
|
env["table"] = new Array(TABLE_SIZE)
|
|
}
|
|
Module["wasmTable"] = env["table"]
|
|
}
|
|
if (!env["memoryBase"]) {
|
|
env["memoryBase"] = Module["STATIC_BASE"]
|
|
}
|
|
if (!env["tableBase"]) {
|
|
env["tableBase"] = 0
|
|
}
|
|
var exports;
|
|
exports = doNativeWasm(global, env, providedBuffer);
|
|
assert(exports, "no binaryen method succeeded.");
|
|
return exports
|
|
});
|
|
}
|
|
integrateWasmJS();
|
|
var ASM_CONSTS = [(function() {
|
|
return Module.webglContextAttributes.premultipliedAlpha
|
|
}), (function() {
|
|
return Module.webglContextAttributes.preserveDrawingBuffer
|
|
}), (function($0) {
|
|
throw new Error('Internal Unity error: gles::GetProcAddress("' + Pointer_stringify($0) + '") was called but gles::GetProcAddress() is not implemented on Unity WebGL. Please report a bug.')
|
|
}), (function() {
|
|
return typeof Module.shouldQuit != "undefined"
|
|
}), (function() {
|
|
for (var id in Module.intervals) {
|
|
window.clearInterval(id)
|
|
}
|
|
Module.intervals = {};
|
|
for (var i = 0; i < Module.deinitializers.length; i++) {
|
|
Module.deinitializers[i]()
|
|
}
|
|
Module.deinitializers = [];
|
|
if (typeof Module.onQuit == "function") Module.onQuit()
|
|
})];
|
|
|
|
function _emscripten_asm_const_i(code) {
|
|
return ASM_CONSTS[code]()
|
|
}
|
|
|
|
function _emscripten_asm_const_sync_on_main_thread_i(code) {
|
|
return ASM_CONSTS[code]()
|
|
}
|
|
|
|
function _emscripten_asm_const_ii(code, a0) {
|
|
return ASM_CONSTS[code](a0)
|
|
}
|
|
STATIC_BASE = GLOBAL_BASE;
|
|
STATICTOP = STATIC_BASE + 2822e3;
|
|
__ATINIT__.push({
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AIScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_528()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AnimationScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Animation_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Animation_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Animation_7_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AnimationClip_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AudioScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Video_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_3_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_ClothScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Cloth_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_18_1122()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_nvcloth_src_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_nvcloth_src_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_SwInterCollision_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_SwSolverKernel_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Input_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_GfxDeviceNull_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Allocator_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Application_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Burst_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_6_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_7_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_8_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Shadows_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_GUITexture_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Containers_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_File_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Geometry_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_104_4269()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_4_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_6_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_8_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_9_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_10_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_11_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_12_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Interfaces_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Interfaces_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Interfaces_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Jobs_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Jobs_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Math_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Math_Random_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Misc_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Misc_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_130_7666()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Misc_3_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Misc_4_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Misc_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Profiler_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Profiler_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_SceneManager_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_62_8873()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_4_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_9_9378()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_9577()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Transform_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Transform_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Utilities_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_10024()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Utilities_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Utilities_6_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Utilities_7_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Utilities_9_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_AssetBundleFileSystem_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Modules_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_18_10374()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_19_10375()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_20_10376()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Director_Core_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Scripting_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Scripting_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Scripting_3_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Mono_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_TemplateInstantiations_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Serialize_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Serialize_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Mesh_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_LogAssert_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Shader_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_DirectorScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_GridScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Grid_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_3992()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_IMGUIScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_IMGUI_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_23_17()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_IMGUI_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_InputScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Input_Private_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_ParticleSystemGeometryJob_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_NoiseModule_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_ShapeModule_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_UVModule_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Physics2DScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_PhysicsScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Physics_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Physics_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_PhysicsQuery_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_physx_source_physxextensions_src_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Subsystems_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_TerrainScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_89_7101()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_TextCoreScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_TilemapScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Tilemap_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_UIScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_UI_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_UI_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_UI_2_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_umbra_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_UnityAdsSettings_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_VFXScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_VFX_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_VFX_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_VisualEffectAsset_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_VideoScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_Video_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_VideoYUV420Convert_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_VRScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_VR_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_VR_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_PluginInterfaceVR_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Wind_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_XRScriptingClasses_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_XRAudio_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_XRPreInit_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Stats_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_os_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___emscripten_environ_constructor()
|
|
})
|
|
});
|
|
var STATIC_BUMP = 2822e3;
|
|
Module["STATIC_BASE"] = STATIC_BASE;
|
|
Module["STATIC_BUMP"] = STATIC_BUMP;
|
|
var tempDoublePtr = STATICTOP;
|
|
STATICTOP += 16;
|
|
|
|
function _IsMobileBrowser() {
|
|
return /iPhone|iPad|iPod|Android/i.test(navigator.userAgent)
|
|
}
|
|
|
|
function _JS_Cursor_SetImage(ptr, length) {
|
|
var binary = "";
|
|
for (var i = 0; i < length; i++) binary += String.fromCharCode(HEAPU8[ptr + i]);
|
|
Module.canvas.style.cursor = "url(data:image/cur;base64," + btoa(binary) + "),default"
|
|
}
|
|
|
|
function _JS_Cursor_SetShow(show) {
|
|
Module.canvas.style.cursor = show ? "default" : "none"
|
|
}
|
|
|
|
function _JS_Eval_ClearInterval(id) {
|
|
window.clearInterval(id)
|
|
}
|
|
|
|
function _JS_Eval_OpenURL(ptr) {
|
|
var str = Pointer_stringify(ptr);
|
|
window.open(str, "_blank", "")
|
|
}
|
|
|
|
function _JS_Eval_SetInterval(func, arg, millis) {
|
|
Module["noExitRuntime"] = true;
|
|
|
|
function wrapper() {
|
|
getFuncWrapper(func, "vi")(arg)
|
|
}
|
|
return Browser.safeSetInterval(wrapper, millis)
|
|
}
|
|
var fs = {
|
|
numPendingSync: 0,
|
|
syncInternal: 1e3,
|
|
syncInProgress: false,
|
|
sync: (function(onlyPendingSync) {
|
|
if (onlyPendingSync) {
|
|
if (fs.numPendingSync == 0) return
|
|
} else if (fs.syncInProgress) {
|
|
fs.numPendingSync++;
|
|
return
|
|
}
|
|
fs.syncInProgress = true;
|
|
FS.syncfs(false, (function(err) {
|
|
fs.syncInProgress = false
|
|
}));
|
|
fs.numPendingSync = 0
|
|
})
|
|
};
|
|
|
|
function _JS_FileSystem_Initialize() {
|
|
Module.setInterval((function() {
|
|
fs.sync(true)
|
|
}), fs.syncInternal)
|
|
}
|
|
|
|
function _JS_FileSystem_Sync() {
|
|
fs.sync(false)
|
|
}
|
|
|
|
function _JS_Log_Dump(ptr, type) {
|
|
var str = Pointer_stringify(ptr);
|
|
if (typeof dump == "function") dump(str);
|
|
switch (type) {
|
|
case 0:
|
|
case 1:
|
|
case 4:
|
|
console.error(str);
|
|
return;
|
|
case 2:
|
|
console.warn(str);
|
|
return;
|
|
case 3:
|
|
case 5:
|
|
console.log(str);
|
|
return;
|
|
default:
|
|
console.error("Unknown console message type!");
|
|
console.error(str)
|
|
}
|
|
}
|
|
|
|
function _JS_Log_StackTrace(buffer, bufferSize) {
|
|
var trace = stackTrace();
|
|
if (buffer) stringToUTF8(trace, buffer, bufferSize);
|
|
return lengthBytesUTF8(trace)
|
|
}
|
|
var JS_ScreenOrientation_callback = 0;
|
|
|
|
function JS_ScreenOrientation_eventHandler() {
|
|
if (JS_ScreenOrientation_callback) dynCall_viii(JS_ScreenOrientation_callback, window.innerWidth, window.innerHeight, screen.orientation ? screen.orientation.angle : window.orientation)
|
|
}
|
|
|
|
function _JS_ScreenOrientation_DeInit() {
|
|
JS_ScreenOrientation_callback = 0;
|
|
window.removeEventListener("resize", JS_ScreenOrientation_eventHandler);
|
|
if (screen.orientation) {
|
|
screen.orientation.removeEventListener("change", JS_ScreenOrientation_eventHandler)
|
|
}
|
|
}
|
|
|
|
function _JS_ScreenOrientation_Init(callback) {
|
|
if (!JS_ScreenOrientation_callback) {
|
|
if (screen.orientation) {
|
|
screen.orientation.addEventListener("change", JS_ScreenOrientation_eventHandler)
|
|
}
|
|
window.addEventListener("resize", JS_ScreenOrientation_eventHandler);
|
|
JS_ScreenOrientation_callback = callback;
|
|
setTimeout(JS_ScreenOrientation_eventHandler, 0)
|
|
}
|
|
}
|
|
var WEBAudio = {
|
|
audioInstanceIdCounter: 0,
|
|
audioInstances: {},
|
|
audioContext: null,
|
|
audioWebEnabled: 0
|
|
};
|
|
|
|
function _JS_Sound_Create_Channel(callback, userData) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = {
|
|
gain: WEBAudio.audioContext.createGain(),
|
|
panner: WEBAudio.audioContext.createPanner(),
|
|
threeD: false,
|
|
playBuffer: (function(startTime, buffer, startOffset) {
|
|
this.setup();
|
|
this.source.buffer = buffer;
|
|
var chan = this;
|
|
this.source.onended = (function() {
|
|
chan.disconnectSource();
|
|
if (callback) dynCall("vi", callback, [userData])
|
|
});
|
|
this.source.start(startTime, startOffset);
|
|
this.source.playbackStartTime = startTime - startOffset / this.source.playbackRate.value
|
|
}),
|
|
disconnectSource: (function() {
|
|
if (this.source && !this.source.isPausedMockNode) {
|
|
this.source.onended = null;
|
|
this.source.disconnect();
|
|
delete this.source
|
|
}
|
|
}),
|
|
stop: (function(delay) {
|
|
if (channel.source && channel.source.buffer) {
|
|
try {
|
|
channel.source.stop(WEBAudio.audioContext.currentTime + delay)
|
|
} catch (e) {}
|
|
if (delay == 0) {
|
|
channel.disconnectSource()
|
|
}
|
|
}
|
|
}),
|
|
pause: (function() {
|
|
var s = this.source;
|
|
if (!s) return;
|
|
var pausedSource = {
|
|
isPausedMockNode: true,
|
|
loop: s.loop,
|
|
loopStart: s.loopStart,
|
|
loopEnd: s.loopEnd,
|
|
buffer: s.buffer,
|
|
playbackRate: s.playbackRate.value,
|
|
playbackPausedAtPosition: s.estimatePlaybackPosition(),
|
|
setPitch: (function(v) {
|
|
this.playbackRate = v
|
|
})
|
|
};
|
|
this.stop(0);
|
|
this.disconnectSource();
|
|
this.source = pausedSource
|
|
}),
|
|
resume: (function() {
|
|
var pausedSource = this.source;
|
|
if (!pausedSource || !pausedSource.isPausedMockNode) return;
|
|
delete this.source;
|
|
this.setup();
|
|
this.playBuffer(WEBAudio.audioContext.currentTime - Math.min(0, pausedSource.playbackPausedAtPosition), pausedSource.buffer, Math.max(0, pausedSource.playbackPausedAtPosition));
|
|
this.source.loop = pausedSource.loop;
|
|
this.source.loopStart = pausedSource.loopStart;
|
|
this.source.loopEnd = pausedSource.loopEnd;
|
|
this.source.setPitch(pausedSource.playbackRate)
|
|
}),
|
|
setup: (function() {
|
|
if (this.source && !this.source.isPausedMockNode) return;
|
|
this.source = WEBAudio.audioContext.createBufferSource();
|
|
this.source.estimatePlaybackPosition = (function() {
|
|
var t = (WEBAudio.audioContext.currentTime - this.playbackStartTime) * this.playbackRate.value;
|
|
if (this.loop && t >= this.loopStart) {
|
|
t = (t - this.loopStart) % (this.loopEnd - this.loopStart) + this.loopStart
|
|
}
|
|
return t
|
|
});
|
|
this.source.setPitch = (function(newPitch) {
|
|
var curPosition = this.estimatePlaybackPosition();
|
|
if (curPosition >= 0) {
|
|
this.playbackStartTime = WEBAudio.audioContext.currentTime - curPosition / newPitch
|
|
}
|
|
this.playbackRate.value = newPitch
|
|
});
|
|
this.setupPanning()
|
|
}),
|
|
setupPanning: (function() {
|
|
if (this.source.isPausedMockNode) return;
|
|
this.source.disconnect();
|
|
if (this.threeD) {
|
|
this.source.connect(this.panner);
|
|
this.panner.connect(this.gain)
|
|
} else {
|
|
this.panner.disconnect();
|
|
this.source.connect(this.gain)
|
|
}
|
|
})
|
|
};
|
|
channel.panner.rolloffFactor = 0;
|
|
channel.gain.connect(WEBAudio.audioContext.destination);
|
|
WEBAudio.audioInstances[++WEBAudio.audioInstanceIdCounter] = channel;
|
|
return WEBAudio.audioInstanceIdCounter
|
|
}
|
|
|
|
function _JS_Sound_GetLength(bufferInstance) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 0;
|
|
var sound = WEBAudio.audioInstances[bufferInstance];
|
|
var sampleRateRatio = 44100 / sound.buffer.sampleRate;
|
|
return sound.buffer.length * sampleRateRatio
|
|
}
|
|
|
|
function _JS_Sound_GetLoadState(bufferInstance) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 2;
|
|
var sound = WEBAudio.audioInstances[bufferInstance];
|
|
if (sound.error) return 2;
|
|
if (sound.buffer) return 0;
|
|
return 1
|
|
}
|
|
|
|
function _JS_Sound_Init() {
|
|
try {
|
|
window.AudioContext = window.AudioContext || window.webkitAudioContext;
|
|
WEBAudio.audioContext = new AudioContext;
|
|
var tryToResumeAudioContext = (function() {
|
|
if (WEBAudio.audioContext.state === "suspended") WEBAudio.audioContext.resume();
|
|
else Module.clearInterval(resumeInterval)
|
|
});
|
|
var resumeInterval = Module.setInterval(tryToResumeAudioContext, 400);
|
|
WEBAudio.audioWebEnabled = 1
|
|
} catch (e) {
|
|
alert("Web Audio API is not supported in this browser")
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_Load(ptr, length) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 0;
|
|
var sound = {
|
|
buffer: null,
|
|
error: false
|
|
};
|
|
WEBAudio.audioInstances[++WEBAudio.audioInstanceIdCounter] = sound;
|
|
var audioData = HEAPU8.buffer.slice(ptr, ptr + length);
|
|
WEBAudio.audioContext.decodeAudioData(audioData, (function(buffer) {
|
|
sound.buffer = buffer
|
|
}), (function() {
|
|
sound.error = true;
|
|
console.log("Decode error.")
|
|
}));
|
|
return WEBAudio.audioInstanceIdCounter
|
|
}
|
|
|
|
function _JS_Sound_Load_PCM(channels, length, sampleRate, ptr) {
|
|
if (WEBAudio.audioWebEnabled == 0) return 0;
|
|
var sound = {
|
|
buffer: WEBAudio.audioContext.createBuffer(channels, length, sampleRate),
|
|
error: false
|
|
};
|
|
for (var i = 0; i < channels; i++) {
|
|
var offs = (ptr >> 2) + length * i;
|
|
var buffer = sound.buffer;
|
|
var copyToChannel = buffer["copyToChannel"] || (function(source, channelNumber, startInChannel) {
|
|
var clipped = source.subarray(0, Math.min(source.length, this.length - (startInChannel | 0)));
|
|
this.getChannelData(channelNumber | 0).set(clipped, startInChannel | 0)
|
|
});
|
|
copyToChannel.apply(buffer, [HEAPF32.subarray(offs, offs + length), i, 0])
|
|
}
|
|
WEBAudio.audioInstances[++WEBAudio.audioInstanceIdCounter] = sound;
|
|
return WEBAudio.audioInstanceIdCounter
|
|
}
|
|
|
|
function _JS_Sound_Play(bufferInstance, channelInstance, offset, delay) {
|
|
_JS_Sound_Stop(channelInstance, 0);
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var sound = WEBAudio.audioInstances[bufferInstance];
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (sound.buffer) {
|
|
try {
|
|
channel.playBuffer(WEBAudio.audioContext.currentTime + delay, sound.buffer, offset)
|
|
} catch (e) {
|
|
console.error("playBuffer error. Exception: " + e)
|
|
}
|
|
} else console.log("Trying to play sound which is not loaded.")
|
|
}
|
|
|
|
function _JS_Sound_ReleaseInstance(instance) {
|
|
delete WEBAudio.audioInstances[instance]
|
|
}
|
|
|
|
function _JS_Sound_ResumeIfNeeded() {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
if (WEBAudio.audioContext.state === "suspended") WEBAudio.audioContext.resume()
|
|
}
|
|
|
|
function _JS_Sound_Set3D(channelInstance, threeD) {
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (channel.threeD != threeD) {
|
|
channel.threeD = threeD;
|
|
if (!channel.source) {
|
|
channel.setup()
|
|
}
|
|
channel.setupPanning()
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_SetListenerOrientation(x, y, z, xUp, yUp, zUp) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
if (WEBAudio.audioContext.listener.forwardX) {
|
|
WEBAudio.audioContext.listener.forwardX.setValueAtTime(-x, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.forwardY.setValueAtTime(-y, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.forwardZ.setValueAtTime(-z, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.upX.setValueAtTime(xUp, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.upY.setValueAtTime(yUp, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.upZ.setValueAtTime(zUp, WEBAudio.audioContext.currentTime)
|
|
} else {
|
|
WEBAudio.audioContext.listener.setOrientation(-x, -y, -z, xUp, yUp, zUp)
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_SetListenerPosition(x, y, z) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
if (WEBAudio.audioContext.listener.positionX) {
|
|
WEBAudio.audioContext.listener.positionX.setValueAtTime(x, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.positionY.setValueAtTime(y, WEBAudio.audioContext.currentTime);
|
|
WEBAudio.audioContext.listener.positionZ.setValueAtTime(z, WEBAudio.audioContext.currentTime)
|
|
} else {
|
|
WEBAudio.audioContext.listener.setPosition(x, y, z)
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_SetLoop(channelInstance, loop) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (!channel.source) {
|
|
channel.setup()
|
|
}
|
|
channel.source.loop = loop
|
|
}
|
|
|
|
function _JS_Sound_SetLoopPoints(channelInstance, loopStart, loopEnd) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (!channel.source) {
|
|
channel.setup()
|
|
}
|
|
channel.source.loopStart = loopStart;
|
|
channel.source.loopEnd = loopEnd
|
|
}
|
|
|
|
function _JS_Sound_SetPaused(channelInstance, paused) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
var channelCurrentlyPaused = !channel.source || channel.source.isPausedMockNode;
|
|
if (paused != channelCurrentlyPaused) {
|
|
if (paused) channel.pause();
|
|
else channel.resume()
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_SetPitch(channelInstance, v) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
try {
|
|
WEBAudio.audioInstances[channelInstance].source.setPitch(v)
|
|
} catch (e) {
|
|
console.error("Invalid audio pitch " + v + " specified to WebAudio backend!")
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_SetPosition(channelInstance, x, y, z) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
if (channel.x != x || channel.y != y || channel.z != z) {
|
|
channel.panner.setPosition(x, y, z);
|
|
channel.x = x;
|
|
channel.y = y;
|
|
channel.z = z
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_SetVolume(channelInstance, v) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
try {
|
|
WEBAudio.audioInstances[channelInstance].gain.gain.setValueAtTime(v, WEBAudio.audioContext.currentTime)
|
|
} catch (e) {
|
|
console.error("Invalid audio volume " + v + " specified to WebAudio backend!")
|
|
}
|
|
}
|
|
|
|
function _JS_Sound_Stop(channelInstance, delay) {
|
|
if (WEBAudio.audioWebEnabled == 0) return;
|
|
var channel = WEBAudio.audioInstances[channelInstance];
|
|
channel.stop(delay)
|
|
}
|
|
|
|
function _JS_SystemInfo_GetCanvasClientSize(domElementSelector, outWidth, outHeight) {
|
|
var selector = UTF8ToString(domElementSelector);
|
|
var canvas = selector == "#canvas" ? Module["canvas"] : document.querySelector(selector);
|
|
var w = 0,
|
|
h = 0;
|
|
if (canvas) {
|
|
var size = canvas.getBoundingClientRect();
|
|
w = size.width;
|
|
h = size.height
|
|
}
|
|
HEAPF64[outWidth >> 3] = w;
|
|
HEAPF64[outHeight >> 3] = h
|
|
}
|
|
|
|
function _JS_SystemInfo_GetDocumentURL(buffer, bufferSize) {
|
|
if (buffer) stringToUTF8(document.URL, buffer, bufferSize);
|
|
return lengthBytesUTF8(document.URL)
|
|
}
|
|
|
|
function _JS_SystemInfo_GetGPUInfo(buffer, bufferSize) {
|
|
var gpuinfo = Module.SystemInfo.gpu;
|
|
if (buffer) stringToUTF8(gpuinfo, buffer, bufferSize);
|
|
return lengthBytesUTF8(gpuinfo)
|
|
}
|
|
|
|
function _JS_SystemInfo_GetMatchWebGLToCanvasSize() {
|
|
return Module.matchWebGLToCanvasSize || Module.matchWebGLToCanvasSize === undefined
|
|
}
|
|
|
|
function _JS_SystemInfo_GetMemory() {
|
|
return TOTAL_MEMORY / (1024 * 1024)
|
|
}
|
|
|
|
function _JS_SystemInfo_GetOS(buffer, bufferSize) {
|
|
var browser = Module.SystemInfo.os + " " + Module.SystemInfo.osVersion;
|
|
if (buffer) stringToUTF8(browser, buffer, bufferSize);
|
|
return lengthBytesUTF8(browser)
|
|
}
|
|
|
|
function _JS_SystemInfo_GetPreferredDevicePixelRatio() {
|
|
return Module.devicePixelRatio || window.devicePixelRatio || 1
|
|
}
|
|
|
|
function _JS_SystemInfo_GetScreenSize(outWidth, outHeight) {
|
|
HEAPF64[outWidth >> 3] = Module.SystemInfo.width;
|
|
HEAPF64[outHeight >> 3] = Module.SystemInfo.height
|
|
}
|
|
|
|
function _JS_SystemInfo_HasCursorLock() {
|
|
return Module.SystemInfo.hasCursorLock
|
|
}
|
|
|
|
function _JS_SystemInfo_HasFullscreen() {
|
|
return Module.SystemInfo.hasFullscreen
|
|
}
|
|
|
|
function _JS_SystemInfo_HasWebGL() {
|
|
return Module.SystemInfo.hasWebGL
|
|
}
|
|
|
|
function ___atomic_compare_exchange_8(ptr, expected, desiredl, desiredh, weak, success_memmodel, failure_memmodel) {
|
|
var pl = HEAP32[ptr >> 2];
|
|
var ph = HEAP32[ptr + 4 >> 2];
|
|
var el = HEAP32[expected >> 2];
|
|
var eh = HEAP32[expected + 4 >> 2];
|
|
if (pl === el && ph === eh) {
|
|
HEAP32[ptr >> 2] = desiredl;
|
|
HEAP32[ptr + 4 >> 2] = desiredh;
|
|
return 1
|
|
} else {
|
|
HEAP32[expected >> 2] = pl;
|
|
HEAP32[expected + 4 >> 2] = ph;
|
|
return 0
|
|
}
|
|
}
|
|
|
|
function ___atomic_fetch_add_8(ptr, vall, valh, memmodel) {
|
|
var l = HEAP32[ptr >> 2];
|
|
var h = HEAP32[ptr + 4 >> 2];
|
|
HEAP32[ptr >> 2] = _i64Add(l, h, vall, valh);
|
|
HEAP32[ptr + 4 >> 2] = getTempRet0();
|
|
return (setTempRet0(h), l) | 0
|
|
}
|
|
var ENV = {};
|
|
|
|
function ___buildEnvironment(environ) {
|
|
var MAX_ENV_VALUES = 64;
|
|
var TOTAL_ENV_SIZE = 1024;
|
|
var poolPtr;
|
|
var envPtr;
|
|
if (!___buildEnvironment.called) {
|
|
___buildEnvironment.called = true;
|
|
ENV["USER"] = ENV["LOGNAME"] = "web_user";
|
|
ENV["PATH"] = "/";
|
|
ENV["PWD"] = "/";
|
|
ENV["HOME"] = "/home/web_user";
|
|
ENV["LANG"] = "C.UTF-8";
|
|
ENV["_"] = Module["thisProgram"];
|
|
poolPtr = getMemory(TOTAL_ENV_SIZE);
|
|
envPtr = getMemory(MAX_ENV_VALUES * 4);
|
|
HEAP32[envPtr >> 2] = poolPtr;
|
|
HEAP32[environ >> 2] = envPtr
|
|
} else {
|
|
envPtr = HEAP32[environ >> 2];
|
|
poolPtr = HEAP32[envPtr >> 2]
|
|
}
|
|
var strings = [];
|
|
var totalSize = 0;
|
|
for (var key in ENV) {
|
|
if (typeof ENV[key] === "string") {
|
|
var line = key + "=" + ENV[key];
|
|
strings.push(line);
|
|
totalSize += line.length
|
|
}
|
|
}
|
|
if (totalSize > TOTAL_ENV_SIZE) {
|
|
throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")
|
|
}
|
|
var ptrSize = 4;
|
|
for (var i = 0; i < strings.length; i++) {
|
|
var line = strings[i];
|
|
writeAsciiToMemory(line, poolPtr);
|
|
HEAP32[envPtr + i * ptrSize >> 2] = poolPtr;
|
|
poolPtr += line.length + 1
|
|
}
|
|
HEAP32[envPtr + strings.length * ptrSize >> 2] = 0
|
|
}
|
|
|
|
function ___cxa_allocate_exception(size) {
|
|
return _malloc(size)
|
|
}
|
|
|
|
function __ZSt18uncaught_exceptionv() {
|
|
return !!__ZSt18uncaught_exceptionv.uncaught_exception
|
|
}
|
|
var EXCEPTIONS = {
|
|
last: 0,
|
|
caught: [],
|
|
infos: {},
|
|
deAdjust: (function(adjusted) {
|
|
if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted;
|
|
for (var key in EXCEPTIONS.infos) {
|
|
var ptr = +key;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
if (info.adjusted === adjusted) {
|
|
return ptr
|
|
}
|
|
}
|
|
return adjusted
|
|
}),
|
|
addRef: (function(ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
info.refcount++
|
|
}),
|
|
decRef: (function(ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
assert(info.refcount > 0);
|
|
info.refcount--;
|
|
if (info.refcount === 0 && !info.rethrown) {
|
|
if (info.destructor) {
|
|
Module["dynCall_vi"](info.destructor, ptr)
|
|
}
|
|
delete EXCEPTIONS.infos[ptr];
|
|
___cxa_free_exception(ptr)
|
|
}
|
|
}),
|
|
clearRef: (function(ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
info.refcount = 0
|
|
})
|
|
};
|
|
|
|
function ___cxa_begin_catch(ptr) {
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
if (info && !info.caught) {
|
|
info.caught = true;
|
|
__ZSt18uncaught_exceptionv.uncaught_exception--
|
|
}
|
|
if (info) info.rethrown = false;
|
|
EXCEPTIONS.caught.push(ptr);
|
|
EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr));
|
|
return ptr
|
|
}
|
|
|
|
function ___cxa_free_exception(ptr) {
|
|
try {
|
|
return _free(ptr)
|
|
} catch (e) {}
|
|
}
|
|
|
|
function ___cxa_end_catch() {
|
|
Module["setThrew"](0);
|
|
var ptr = EXCEPTIONS.caught.pop();
|
|
if (ptr) {
|
|
EXCEPTIONS.decRef(EXCEPTIONS.deAdjust(ptr));
|
|
EXCEPTIONS.last = 0
|
|
}
|
|
}
|
|
|
|
function ___cxa_find_matching_catch_2() {
|
|
return ___cxa_find_matching_catch.apply(null, arguments)
|
|
}
|
|
|
|
function ___cxa_find_matching_catch_3() {
|
|
return ___cxa_find_matching_catch.apply(null, arguments)
|
|
}
|
|
|
|
function ___cxa_find_matching_catch_4() {
|
|
return ___cxa_find_matching_catch.apply(null, arguments)
|
|
}
|
|
|
|
function ___cxa_pure_virtual() {
|
|
ABORT = true;
|
|
throw "Pure virtual function called!"
|
|
}
|
|
|
|
function ___cxa_rethrow() {
|
|
var ptr = EXCEPTIONS.caught.pop();
|
|
ptr = EXCEPTIONS.deAdjust(ptr);
|
|
if (!EXCEPTIONS.infos[ptr].rethrown) {
|
|
EXCEPTIONS.caught.push(ptr);
|
|
EXCEPTIONS.infos[ptr].rethrown = true
|
|
}
|
|
EXCEPTIONS.last = ptr;
|
|
throw ptr
|
|
}
|
|
|
|
function ___resumeException(ptr) {
|
|
if (!EXCEPTIONS.last) {
|
|
EXCEPTIONS.last = ptr
|
|
}
|
|
throw ptr
|
|
}
|
|
|
|
function ___cxa_find_matching_catch() {
|
|
var thrown = EXCEPTIONS.last;
|
|
if (!thrown) {
|
|
return (setTempRet0(0), 0) | 0
|
|
}
|
|
var info = EXCEPTIONS.infos[thrown];
|
|
var throwntype = info.type;
|
|
if (!throwntype) {
|
|
return (setTempRet0(0), thrown) | 0
|
|
}
|
|
var typeArray = Array.prototype.slice.call(arguments);
|
|
var pointer = Module["___cxa_is_pointer_type"](throwntype);
|
|
if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4);
|
|
HEAP32[___cxa_find_matching_catch.buffer >> 2] = thrown;
|
|
thrown = ___cxa_find_matching_catch.buffer;
|
|
for (var i = 0; i < typeArray.length; i++) {
|
|
if (typeArray[i] && Module["___cxa_can_catch"](typeArray[i], throwntype, thrown)) {
|
|
thrown = HEAP32[thrown >> 2];
|
|
info.adjusted = thrown;
|
|
return (setTempRet0(typeArray[i]), thrown) | 0
|
|
}
|
|
}
|
|
thrown = HEAP32[thrown >> 2];
|
|
return (setTempRet0(throwntype), thrown) | 0
|
|
}
|
|
|
|
function ___cxa_throw(ptr, type, destructor) {
|
|
EXCEPTIONS.infos[ptr] = {
|
|
ptr: ptr,
|
|
adjusted: ptr,
|
|
type: type,
|
|
destructor: destructor,
|
|
refcount: 0,
|
|
caught: false,
|
|
rethrown: false
|
|
};
|
|
EXCEPTIONS.last = ptr;
|
|
if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) {
|
|
__ZSt18uncaught_exceptionv.uncaught_exception = 1
|
|
} else {
|
|
__ZSt18uncaught_exceptionv.uncaught_exception++
|
|
}
|
|
throw ptr
|
|
}
|
|
|
|
function ___gxx_personality_v0() {}
|
|
|
|
function ___lock() {}
|
|
var ERRNO_CODES = {
|
|
EPERM: 1,
|
|
ENOENT: 2,
|
|
ESRCH: 3,
|
|
EINTR: 4,
|
|
EIO: 5,
|
|
ENXIO: 6,
|
|
E2BIG: 7,
|
|
ENOEXEC: 8,
|
|
EBADF: 9,
|
|
ECHILD: 10,
|
|
EAGAIN: 11,
|
|
EWOULDBLOCK: 11,
|
|
ENOMEM: 12,
|
|
EACCES: 13,
|
|
EFAULT: 14,
|
|
ENOTBLK: 15,
|
|
EBUSY: 16,
|
|
EEXIST: 17,
|
|
EXDEV: 18,
|
|
ENODEV: 19,
|
|
ENOTDIR: 20,
|
|
EISDIR: 21,
|
|
EINVAL: 22,
|
|
ENFILE: 23,
|
|
EMFILE: 24,
|
|
ENOTTY: 25,
|
|
ETXTBSY: 26,
|
|
EFBIG: 27,
|
|
ENOSPC: 28,
|
|
ESPIPE: 29,
|
|
EROFS: 30,
|
|
EMLINK: 31,
|
|
EPIPE: 32,
|
|
EDOM: 33,
|
|
ERANGE: 34,
|
|
ENOMSG: 42,
|
|
EIDRM: 43,
|
|
ECHRNG: 44,
|
|
EL2NSYNC: 45,
|
|
EL3HLT: 46,
|
|
EL3RST: 47,
|
|
ELNRNG: 48,
|
|
EUNATCH: 49,
|
|
ENOCSI: 50,
|
|
EL2HLT: 51,
|
|
EDEADLK: 35,
|
|
ENOLCK: 37,
|
|
EBADE: 52,
|
|
EBADR: 53,
|
|
EXFULL: 54,
|
|
ENOANO: 55,
|
|
EBADRQC: 56,
|
|
EBADSLT: 57,
|
|
EDEADLOCK: 35,
|
|
EBFONT: 59,
|
|
ENOSTR: 60,
|
|
ENODATA: 61,
|
|
ETIME: 62,
|
|
ENOSR: 63,
|
|
ENONET: 64,
|
|
ENOPKG: 65,
|
|
EREMOTE: 66,
|
|
ENOLINK: 67,
|
|
EADV: 68,
|
|
ESRMNT: 69,
|
|
ECOMM: 70,
|
|
EPROTO: 71,
|
|
EMULTIHOP: 72,
|
|
EDOTDOT: 73,
|
|
EBADMSG: 74,
|
|
ENOTUNIQ: 76,
|
|
EBADFD: 77,
|
|
EREMCHG: 78,
|
|
ELIBACC: 79,
|
|
ELIBBAD: 80,
|
|
ELIBSCN: 81,
|
|
ELIBMAX: 82,
|
|
ELIBEXEC: 83,
|
|
ENOSYS: 38,
|
|
ENOTEMPTY: 39,
|
|
ENAMETOOLONG: 36,
|
|
ELOOP: 40,
|
|
EOPNOTSUPP: 95,
|
|
EPFNOSUPPORT: 96,
|
|
ECONNRESET: 104,
|
|
ENOBUFS: 105,
|
|
EAFNOSUPPORT: 97,
|
|
EPROTOTYPE: 91,
|
|
ENOTSOCK: 88,
|
|
ENOPROTOOPT: 92,
|
|
ESHUTDOWN: 108,
|
|
ECONNREFUSED: 111,
|
|
EADDRINUSE: 98,
|
|
ECONNABORTED: 103,
|
|
ENETUNREACH: 101,
|
|
ENETDOWN: 100,
|
|
ETIMEDOUT: 110,
|
|
EHOSTDOWN: 112,
|
|
EHOSTUNREACH: 113,
|
|
EINPROGRESS: 115,
|
|
EALREADY: 114,
|
|
EDESTADDRREQ: 89,
|
|
EMSGSIZE: 90,
|
|
EPROTONOSUPPORT: 93,
|
|
ESOCKTNOSUPPORT: 94,
|
|
EADDRNOTAVAIL: 99,
|
|
ENETRESET: 102,
|
|
EISCONN: 106,
|
|
ENOTCONN: 107,
|
|
ETOOMANYREFS: 109,
|
|
EUSERS: 87,
|
|
EDQUOT: 122,
|
|
ESTALE: 116,
|
|
ENOTSUP: 95,
|
|
ENOMEDIUM: 123,
|
|
EILSEQ: 84,
|
|
EOVERFLOW: 75,
|
|
ECANCELED: 125,
|
|
ENOTRECOVERABLE: 131,
|
|
EOWNERDEAD: 130,
|
|
ESTRPIPE: 86
|
|
};
|
|
|
|
function ___setErrNo(value) {
|
|
if (Module["___errno_location"]) HEAP32[Module["___errno_location"]() >> 2] = value;
|
|
return value
|
|
}
|
|
|
|
function ___map_file(pathname, size) {
|
|
___setErrNo(ERRNO_CODES.EPERM);
|
|
return -1
|
|
}
|
|
var ERRNO_MESSAGES = {
|
|
0: "Success",
|
|
1: "Not super-user",
|
|
2: "No such file or directory",
|
|
3: "No such process",
|
|
4: "Interrupted system call",
|
|
5: "I/O error",
|
|
6: "No such device or address",
|
|
7: "Arg list too long",
|
|
8: "Exec format error",
|
|
9: "Bad file number",
|
|
10: "No children",
|
|
11: "No more processes",
|
|
12: "Not enough core",
|
|
13: "Permission denied",
|
|
14: "Bad address",
|
|
15: "Block device required",
|
|
16: "Mount device busy",
|
|
17: "File exists",
|
|
18: "Cross-device link",
|
|
19: "No such device",
|
|
20: "Not a directory",
|
|
21: "Is a directory",
|
|
22: "Invalid argument",
|
|
23: "Too many open files in system",
|
|
24: "Too many open files",
|
|
25: "Not a typewriter",
|
|
26: "Text file busy",
|
|
27: "File too large",
|
|
28: "No space left on device",
|
|
29: "Illegal seek",
|
|
30: "Read only file system",
|
|
31: "Too many links",
|
|
32: "Broken pipe",
|
|
33: "Math arg out of domain of func",
|
|
34: "Math result not representable",
|
|
35: "File locking deadlock error",
|
|
36: "File or path name too long",
|
|
37: "No record locks available",
|
|
38: "Function not implemented",
|
|
39: "Directory not empty",
|
|
40: "Too many symbolic links",
|
|
42: "No message of desired type",
|
|
43: "Identifier removed",
|
|
44: "Channel number out of range",
|
|
45: "Level 2 not synchronized",
|
|
46: "Level 3 halted",
|
|
47: "Level 3 reset",
|
|
48: "Link number out of range",
|
|
49: "Protocol driver not attached",
|
|
50: "No CSI structure available",
|
|
51: "Level 2 halted",
|
|
52: "Invalid exchange",
|
|
53: "Invalid request descriptor",
|
|
54: "Exchange full",
|
|
55: "No anode",
|
|
56: "Invalid request code",
|
|
57: "Invalid slot",
|
|
59: "Bad font file fmt",
|
|
60: "Device not a stream",
|
|
61: "No data (for no delay io)",
|
|
62: "Timer expired",
|
|
63: "Out of streams resources",
|
|
64: "Machine is not on the network",
|
|
65: "Package not installed",
|
|
66: "The object is remote",
|
|
67: "The link has been severed",
|
|
68: "Advertise error",
|
|
69: "Srmount error",
|
|
70: "Communication error on send",
|
|
71: "Protocol error",
|
|
72: "Multihop attempted",
|
|
73: "Cross mount point (not really error)",
|
|
74: "Trying to read unreadable message",
|
|
75: "Value too large for defined data type",
|
|
76: "Given log. name not unique",
|
|
77: "f.d. invalid for this operation",
|
|
78: "Remote address changed",
|
|
79: "Can access a needed shared lib",
|
|
80: "Accessing a corrupted shared lib",
|
|
81: ".lib section in a.out corrupted",
|
|
82: "Attempting to link in too many libs",
|
|
83: "Attempting to exec a shared library",
|
|
84: "Illegal byte sequence",
|
|
86: "Streams pipe error",
|
|
87: "Too many users",
|
|
88: "Socket operation on non-socket",
|
|
89: "Destination address required",
|
|
90: "Message too long",
|
|
91: "Protocol wrong type for socket",
|
|
92: "Protocol not available",
|
|
93: "Unknown protocol",
|
|
94: "Socket type not supported",
|
|
95: "Not supported",
|
|
96: "Protocol family not supported",
|
|
97: "Address family not supported by protocol family",
|
|
98: "Address already in use",
|
|
99: "Address not available",
|
|
100: "Network interface is not configured",
|
|
101: "Network is unreachable",
|
|
102: "Connection reset by network",
|
|
103: "Connection aborted",
|
|
104: "Connection reset by peer",
|
|
105: "No buffer space available",
|
|
106: "Socket is already connected",
|
|
107: "Socket is not connected",
|
|
108: "Can't send after socket shutdown",
|
|
109: "Too many references",
|
|
110: "Connection timed out",
|
|
111: "Connection refused",
|
|
112: "Host is down",
|
|
113: "Host is unreachable",
|
|
114: "Socket already connected",
|
|
115: "Connection already in progress",
|
|
116: "Stale file handle",
|
|
122: "Quota exceeded",
|
|
123: "No medium (in tape drive)",
|
|
125: "Operation canceled",
|
|
130: "Previous owner died",
|
|
131: "State not recoverable"
|
|
};
|
|
var PATH = {
|
|
splitPath: (function(filename) {
|
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
|
|
return splitPathRe.exec(filename).slice(1)
|
|
}),
|
|
normalizeArray: (function(parts, allowAboveRoot) {
|
|
var up = 0;
|
|
for (var i = parts.length - 1; i >= 0; i--) {
|
|
var last = parts[i];
|
|
if (last === ".") {
|
|
parts.splice(i, 1)
|
|
} else if (last === "..") {
|
|
parts.splice(i, 1);
|
|
up++
|
|
} else if (up) {
|
|
parts.splice(i, 1);
|
|
up--
|
|
}
|
|
}
|
|
if (allowAboveRoot) {
|
|
for (; up; up--) {
|
|
parts.unshift("..")
|
|
}
|
|
}
|
|
return parts
|
|
}),
|
|
normalize: (function(path) {
|
|
var isAbsolute = path.charAt(0) === "/",
|
|
trailingSlash = path.substr(-1) === "/";
|
|
path = PATH.normalizeArray(path.split("/").filter((function(p) {
|
|
return !!p
|
|
})), !isAbsolute).join("/");
|
|
if (!path && !isAbsolute) {
|
|
path = "."
|
|
}
|
|
if (path && trailingSlash) {
|
|
path += "/"
|
|
}
|
|
return (isAbsolute ? "/" : "") + path
|
|
}),
|
|
dirname: (function(path) {
|
|
var result = PATH.splitPath(path),
|
|
root = result[0],
|
|
dir = result[1];
|
|
if (!root && !dir) {
|
|
return "."
|
|
}
|
|
if (dir) {
|
|
dir = dir.substr(0, dir.length - 1)
|
|
}
|
|
return root + dir
|
|
}),
|
|
basename: (function(path) {
|
|
if (path === "/") return "/";
|
|
var lastSlash = path.lastIndexOf("/");
|
|
if (lastSlash === -1) return path;
|
|
return path.substr(lastSlash + 1)
|
|
}),
|
|
extname: (function(path) {
|
|
return PATH.splitPath(path)[3]
|
|
}),
|
|
join: (function() {
|
|
var paths = Array.prototype.slice.call(arguments, 0);
|
|
return PATH.normalize(paths.join("/"))
|
|
}),
|
|
join2: (function(l, r) {
|
|
return PATH.normalize(l + "/" + r)
|
|
}),
|
|
resolve: (function() {
|
|
var resolvedPath = "",
|
|
resolvedAbsolute = false;
|
|
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
|
|
var path = i >= 0 ? arguments[i] : FS.cwd();
|
|
if (typeof path !== "string") {
|
|
throw new TypeError("Arguments to path.resolve must be strings")
|
|
} else if (!path) {
|
|
return ""
|
|
}
|
|
resolvedPath = path + "/" + resolvedPath;
|
|
resolvedAbsolute = path.charAt(0) === "/"
|
|
}
|
|
resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter((function(p) {
|
|
return !!p
|
|
})), !resolvedAbsolute).join("/");
|
|
return (resolvedAbsolute ? "/" : "") + resolvedPath || "."
|
|
}),
|
|
relative: (function(from, to) {
|
|
from = PATH.resolve(from).substr(1);
|
|
to = PATH.resolve(to).substr(1);
|
|
|
|
function trim(arr) {
|
|
var start = 0;
|
|
for (; start < arr.length; start++) {
|
|
if (arr[start] !== "") break
|
|
}
|
|
var end = arr.length - 1;
|
|
for (; end >= 0; end--) {
|
|
if (arr[end] !== "") break
|
|
}
|
|
if (start > end) return [];
|
|
return arr.slice(start, end - start + 1)
|
|
}
|
|
var fromParts = trim(from.split("/"));
|
|
var toParts = trim(to.split("/"));
|
|
var length = Math.min(fromParts.length, toParts.length);
|
|
var samePartsLength = length;
|
|
for (var i = 0; i < length; i++) {
|
|
if (fromParts[i] !== toParts[i]) {
|
|
samePartsLength = i;
|
|
break
|
|
}
|
|
}
|
|
var outputParts = [];
|
|
for (var i = samePartsLength; i < fromParts.length; i++) {
|
|
outputParts.push("..")
|
|
}
|
|
outputParts = outputParts.concat(toParts.slice(samePartsLength));
|
|
return outputParts.join("/")
|
|
})
|
|
};
|
|
var TTY = {
|
|
ttys: [],
|
|
init: (function() {}),
|
|
shutdown: (function() {}),
|
|
register: (function(dev, ops) {
|
|
TTY.ttys[dev] = {
|
|
input: [],
|
|
output: [],
|
|
ops: ops
|
|
};
|
|
FS.registerDevice(dev, TTY.stream_ops)
|
|
}),
|
|
stream_ops: {
|
|
open: (function(stream) {
|
|
var tty = TTY.ttys[stream.node.rdev];
|
|
if (!tty) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
stream.tty = tty;
|
|
stream.seekable = false
|
|
}),
|
|
close: (function(stream) {
|
|
stream.tty.ops.flush(stream.tty)
|
|
}),
|
|
flush: (function(stream) {
|
|
stream.tty.ops.flush(stream.tty)
|
|
}),
|
|
read: (function(stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.get_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO)
|
|
}
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = stream.tty.ops.get_char(stream.tty)
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset + i] = result
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return bytesRead
|
|
}),
|
|
write: (function(stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.put_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO)
|
|
}
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
stream.tty.ops.put_char(stream.tty, buffer[offset + i])
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return i
|
|
})
|
|
},
|
|
default_tty_ops: {
|
|
get_char: (function(tty) {
|
|
if (!tty.input.length) {
|
|
var result = null;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
var BUFSIZE = 256;
|
|
var buf = new Buffer(BUFSIZE);
|
|
var bytesRead = 0;
|
|
var isPosixPlatform = process.platform != "win32";
|
|
var fd = process.stdin.fd;
|
|
if (isPosixPlatform) {
|
|
var usingDevice = false;
|
|
try {
|
|
fd = fs.openSync("/dev/stdin", "r");
|
|
usingDevice = true
|
|
} catch (e) {}
|
|
}
|
|
try {
|
|
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null)
|
|
} catch (e) {
|
|
if (e.toString().indexOf("EOF") != -1) bytesRead = 0;
|
|
else throw e
|
|
}
|
|
if (usingDevice) {
|
|
fs.closeSync(fd)
|
|
}
|
|
if (bytesRead > 0) {
|
|
result = buf.slice(0, bytesRead).toString("utf-8")
|
|
} else {
|
|
result = null
|
|
}
|
|
} else if (typeof window != "undefined" && typeof window.prompt == "function") {
|
|
result = window.prompt("Input: ");
|
|
if (result !== null) {
|
|
result += "\n"
|
|
}
|
|
} else if (typeof readline == "function") {
|
|
result = readline();
|
|
if (result !== null) {
|
|
result += "\n"
|
|
}
|
|
}
|
|
if (!result) {
|
|
return null
|
|
}
|
|
tty.input = intArrayFromString(result, true)
|
|
}
|
|
return tty.input.shift()
|
|
}),
|
|
put_char: (function(tty, val) {
|
|
if (val === null || val === 10) {
|
|
out(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
} else {
|
|
if (val != 0) tty.output.push(val)
|
|
}
|
|
}),
|
|
flush: (function(tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
out(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
}
|
|
})
|
|
},
|
|
default_tty1_ops: {
|
|
put_char: (function(tty, val) {
|
|
if (val === null || val === 10) {
|
|
err(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
} else {
|
|
if (val != 0) tty.output.push(val)
|
|
}
|
|
}),
|
|
flush: (function(tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
err(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
}
|
|
})
|
|
}
|
|
};
|
|
var MEMFS = {
|
|
ops_table: null,
|
|
mount: (function(mount) {
|
|
return MEMFS.createNode(null, "/", 16384 | 511, 0)
|
|
}),
|
|
createNode: (function(parent, name, mode, dev) {
|
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (!MEMFS.ops_table) {
|
|
MEMFS.ops_table = {
|
|
dir: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
lookup: MEMFS.node_ops.lookup,
|
|
mknod: MEMFS.node_ops.mknod,
|
|
rename: MEMFS.node_ops.rename,
|
|
unlink: MEMFS.node_ops.unlink,
|
|
rmdir: MEMFS.node_ops.rmdir,
|
|
readdir: MEMFS.node_ops.readdir,
|
|
symlink: MEMFS.node_ops.symlink
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek
|
|
}
|
|
},
|
|
file: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek,
|
|
read: MEMFS.stream_ops.read,
|
|
write: MEMFS.stream_ops.write,
|
|
allocate: MEMFS.stream_ops.allocate,
|
|
mmap: MEMFS.stream_ops.mmap,
|
|
msync: MEMFS.stream_ops.msync
|
|
}
|
|
},
|
|
link: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
readlink: MEMFS.node_ops.readlink
|
|
},
|
|
stream: {}
|
|
},
|
|
chrdev: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: FS.chrdev_stream_ops
|
|
}
|
|
}
|
|
}
|
|
var node = FS.createNode(parent, name, mode, dev);
|
|
if (FS.isDir(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.dir.node;
|
|
node.stream_ops = MEMFS.ops_table.dir.stream;
|
|
node.contents = {}
|
|
} else if (FS.isFile(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.file.node;
|
|
node.stream_ops = MEMFS.ops_table.file.stream;
|
|
node.usedBytes = 0;
|
|
node.contents = null
|
|
} else if (FS.isLink(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.link.node;
|
|
node.stream_ops = MEMFS.ops_table.link.stream
|
|
} else if (FS.isChrdev(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.chrdev.node;
|
|
node.stream_ops = MEMFS.ops_table.chrdev.stream
|
|
}
|
|
node.timestamp = Date.now();
|
|
if (parent) {
|
|
parent.contents[name] = node
|
|
}
|
|
return node
|
|
}),
|
|
getFileDataAsRegularArray: (function(node) {
|
|
if (node.contents && node.contents.subarray) {
|
|
var arr = [];
|
|
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
|
|
return arr
|
|
}
|
|
return node.contents
|
|
}),
|
|
getFileDataAsTypedArray: (function(node) {
|
|
if (!node.contents) return new Uint8Array;
|
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes);
|
|
return new Uint8Array(node.contents)
|
|
}),
|
|
expandFileStorage: (function(node, newCapacity) {
|
|
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
|
|
node.contents = MEMFS.getFileDataAsRegularArray(node);
|
|
node.usedBytes = node.contents.length
|
|
}
|
|
if (!node.contents || node.contents.subarray) {
|
|
var prevCapacity = node.contents ? node.contents.length : 0;
|
|
if (prevCapacity >= newCapacity) return;
|
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
|
|
newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) | 0);
|
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256);
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newCapacity);
|
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0);
|
|
return
|
|
}
|
|
if (!node.contents && newCapacity > 0) node.contents = [];
|
|
while (node.contents.length < newCapacity) node.contents.push(0)
|
|
}),
|
|
resizeFileStorage: (function(node, newSize) {
|
|
if (node.usedBytes == newSize) return;
|
|
if (newSize == 0) {
|
|
node.contents = null;
|
|
node.usedBytes = 0;
|
|
return
|
|
}
|
|
if (!node.contents || node.contents.subarray) {
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(new ArrayBuffer(newSize));
|
|
if (oldContents) {
|
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes)))
|
|
}
|
|
node.usedBytes = newSize;
|
|
return
|
|
}
|
|
if (!node.contents) node.contents = [];
|
|
if (node.contents.length > newSize) node.contents.length = newSize;
|
|
else
|
|
while (node.contents.length < newSize) node.contents.push(0);
|
|
node.usedBytes = newSize
|
|
}),
|
|
node_ops: {
|
|
getattr: (function(node) {
|
|
var attr = {};
|
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
|
|
attr.ino = node.id;
|
|
attr.mode = node.mode;
|
|
attr.nlink = 1;
|
|
attr.uid = 0;
|
|
attr.gid = 0;
|
|
attr.rdev = node.rdev;
|
|
if (FS.isDir(node.mode)) {
|
|
attr.size = 4096
|
|
} else if (FS.isFile(node.mode)) {
|
|
attr.size = node.usedBytes
|
|
} else if (FS.isLink(node.mode)) {
|
|
attr.size = node.link.length
|
|
} else {
|
|
attr.size = 0
|
|
}
|
|
attr.atime = new Date(node.timestamp);
|
|
attr.mtime = new Date(node.timestamp);
|
|
attr.ctime = new Date(node.timestamp);
|
|
attr.blksize = 4096;
|
|
attr.blocks = Math.ceil(attr.size / attr.blksize);
|
|
return attr
|
|
}),
|
|
setattr: (function(node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp
|
|
}
|
|
if (attr.size !== undefined) {
|
|
MEMFS.resizeFileStorage(node, attr.size)
|
|
}
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
throw FS.genericErrors[ERRNO_CODES.ENOENT]
|
|
}),
|
|
mknod: (function(parent, name, mode, dev) {
|
|
return MEMFS.createNode(parent, name, mode, dev)
|
|
}),
|
|
rename: (function(old_node, new_dir, new_name) {
|
|
if (FS.isDir(old_node.mode)) {
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name)
|
|
} catch (e) {}
|
|
if (new_node) {
|
|
for (var i in new_node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)
|
|
}
|
|
}
|
|
}
|
|
delete old_node.parent.contents[old_node.name];
|
|
old_node.name = new_name;
|
|
new_dir.contents[new_name] = old_node;
|
|
old_node.parent = new_dir
|
|
}),
|
|
unlink: (function(parent, name) {
|
|
delete parent.contents[name]
|
|
}),
|
|
rmdir: (function(parent, name) {
|
|
var node = FS.lookupNode(parent, name);
|
|
for (var i in node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)
|
|
}
|
|
delete parent.contents[name]
|
|
}),
|
|
readdir: (function(node) {
|
|
var entries = [".", ".."];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue
|
|
}
|
|
entries.push(key)
|
|
}
|
|
return entries
|
|
}),
|
|
symlink: (function(parent, newname, oldpath) {
|
|
var node = MEMFS.createNode(parent, newname, 511 | 40960, 0);
|
|
node.link = oldpath;
|
|
return node
|
|
}),
|
|
readlink: (function(node) {
|
|
if (!FS.isLink(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return node.link
|
|
})
|
|
},
|
|
stream_ops: {
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= stream.node.usedBytes) return 0;
|
|
var size = Math.min(stream.node.usedBytes - position, length);
|
|
assert(size >= 0);
|
|
if (size > 8 && contents.subarray) {
|
|
buffer.set(contents.subarray(position, position + size), offset)
|
|
} else {
|
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]
|
|
}
|
|
return size
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position, canOwn) {
|
|
if (!length) return 0;
|
|
var node = stream.node;
|
|
node.timestamp = Date.now();
|
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) {
|
|
if (canOwn) {
|
|
node.contents = buffer.subarray(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length
|
|
} else if (node.usedBytes === 0 && position === 0) {
|
|
node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
|
|
node.usedBytes = length;
|
|
return length
|
|
} else if (position + length <= node.usedBytes) {
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
return length
|
|
}
|
|
}
|
|
MEMFS.expandFileStorage(node, position + length);
|
|
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
else {
|
|
for (var i = 0; i < length; i++) {
|
|
node.contents[position + i] = buffer[offset + i]
|
|
}
|
|
}
|
|
node.usedBytes = Math.max(node.usedBytes, position + length);
|
|
return length
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.usedBytes
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return position
|
|
}),
|
|
allocate: (function(stream, offset, length) {
|
|
MEMFS.expandFileStorage(stream.node, offset + length);
|
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length)
|
|
}),
|
|
mmap: (function(stream, buffer, offset, length, position, prot, flags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
var ptr;
|
|
var allocated;
|
|
var contents = stream.node.contents;
|
|
if (!(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer)) {
|
|
allocated = false;
|
|
ptr = contents.byteOffset
|
|
} else {
|
|
if (position > 0 || position + length < stream.node.usedBytes) {
|
|
if (contents.subarray) {
|
|
contents = contents.subarray(position, position + length)
|
|
} else {
|
|
contents = Array.prototype.slice.call(contents, position, position + length)
|
|
}
|
|
}
|
|
allocated = true;
|
|
var fromHeap = buffer.buffer == HEAP8.buffer;
|
|
ptr = _malloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM)
|
|
}(fromHeap ? HEAP8 : buffer).set(contents, ptr)
|
|
}
|
|
return {
|
|
ptr: ptr,
|
|
allocated: allocated
|
|
}
|
|
}),
|
|
msync: (function(stream, buffer, offset, length, mmapFlags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
if (mmapFlags & 2) {
|
|
return 0
|
|
}
|
|
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
|
|
return 0
|
|
})
|
|
}
|
|
};
|
|
var IDBFS = {
|
|
dbs: {},
|
|
indexedDB: (function() {
|
|
if (typeof indexedDB !== "undefined") return indexedDB;
|
|
var ret = null;
|
|
if (typeof window === "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
assert(ret, "IDBFS used, but indexedDB not supported");
|
|
return ret
|
|
}),
|
|
DB_VERSION: 21,
|
|
DB_STORE_NAME: "FILE_DATA",
|
|
mount: (function(mount) {
|
|
return MEMFS.mount.apply(null, arguments)
|
|
}),
|
|
syncfs: (function(mount, populate, callback) {
|
|
IDBFS.getLocalSet(mount, (function(err, local) {
|
|
if (err) return callback(err);
|
|
IDBFS.getRemoteSet(mount, (function(err, remote) {
|
|
if (err) return callback(err);
|
|
var src = populate ? remote : local;
|
|
var dst = populate ? local : remote;
|
|
IDBFS.reconcile(src, dst, callback)
|
|
}))
|
|
}))
|
|
}),
|
|
getDB: (function(name, callback) {
|
|
var db = IDBFS.dbs[name];
|
|
if (db) {
|
|
return callback(null, db)
|
|
}
|
|
var req;
|
|
try {
|
|
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
if (!req) {
|
|
return callback("Unable to connect to IndexedDB")
|
|
}
|
|
req.onupgradeneeded = (function(e) {
|
|
var db = e.target.result;
|
|
var transaction = e.target.transaction;
|
|
var fileStore;
|
|
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
|
|
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME)
|
|
} else {
|
|
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME)
|
|
}
|
|
if (!fileStore.indexNames.contains("timestamp")) {
|
|
fileStore.createIndex("timestamp", "timestamp", {
|
|
unique: false
|
|
})
|
|
}
|
|
});
|
|
req.onsuccess = (function() {
|
|
db = req.result;
|
|
IDBFS.dbs[name] = db;
|
|
callback(null, db)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
getLocalSet: (function(mount, callback) {
|
|
var entries = {};
|
|
|
|
function isRealDir(p) {
|
|
return p !== "." && p !== ".."
|
|
}
|
|
|
|
function toAbsolute(root) {
|
|
return (function(p) {
|
|
return PATH.join2(root, p)
|
|
})
|
|
}
|
|
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
|
|
while (check.length) {
|
|
var path = check.pop();
|
|
var stat;
|
|
try {
|
|
stat = FS.stat(path)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
if (FS.isDir(stat.mode)) {
|
|
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))
|
|
}
|
|
entries[path] = {
|
|
timestamp: stat.mtime
|
|
}
|
|
}
|
|
return callback(null, {
|
|
type: "local",
|
|
entries: entries
|
|
})
|
|
}),
|
|
getRemoteSet: (function(mount, callback) {
|
|
var entries = {};
|
|
IDBFS.getDB(mount.mountpoint, (function(err, db) {
|
|
if (err) return callback(err);
|
|
try {
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readonly");
|
|
transaction.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
});
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
var index = store.index("timestamp");
|
|
index.openKeyCursor().onsuccess = (function(event) {
|
|
var cursor = event.target.result;
|
|
if (!cursor) {
|
|
return callback(null, {
|
|
type: "remote",
|
|
db: db,
|
|
entries: entries
|
|
})
|
|
}
|
|
entries[cursor.primaryKey] = {
|
|
timestamp: cursor.key
|
|
};
|
|
cursor.continue()
|
|
})
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
}))
|
|
}),
|
|
loadLocalEntry: (function(path, callback) {
|
|
var stat, node;
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
node = lookup.node;
|
|
stat = FS.stat(path)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
if (FS.isDir(stat.mode)) {
|
|
return callback(null, {
|
|
timestamp: stat.mtime,
|
|
mode: stat.mode
|
|
})
|
|
} else if (FS.isFile(stat.mode)) {
|
|
node.contents = MEMFS.getFileDataAsTypedArray(node);
|
|
return callback(null, {
|
|
timestamp: stat.mtime,
|
|
mode: stat.mode,
|
|
contents: node.contents
|
|
})
|
|
} else {
|
|
return callback(new Error("node type not supported"))
|
|
}
|
|
}),
|
|
storeLocalEntry: (function(path, entry, callback) {
|
|
try {
|
|
if (FS.isDir(entry.mode)) {
|
|
FS.mkdir(path, entry.mode)
|
|
} else if (FS.isFile(entry.mode)) {
|
|
FS.writeFile(path, entry.contents, {
|
|
canOwn: true
|
|
})
|
|
} else {
|
|
return callback(new Error("node type not supported"))
|
|
}
|
|
FS.chmod(path, entry.mode);
|
|
FS.utime(path, entry.timestamp, entry.timestamp)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
callback(null)
|
|
}),
|
|
removeLocalEntry: (function(path, callback) {
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
var stat = FS.stat(path);
|
|
if (FS.isDir(stat.mode)) {
|
|
FS.rmdir(path)
|
|
} else if (FS.isFile(stat.mode)) {
|
|
FS.unlink(path)
|
|
}
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
callback(null)
|
|
}),
|
|
loadRemoteEntry: (function(store, path, callback) {
|
|
var req = store.get(path);
|
|
req.onsuccess = (function(event) {
|
|
callback(null, event.target.result)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
storeRemoteEntry: (function(store, path, entry, callback) {
|
|
var req = store.put(entry, path);
|
|
req.onsuccess = (function() {
|
|
callback(null)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
removeRemoteEntry: (function(store, path, callback) {
|
|
var req = store.delete(path);
|
|
req.onsuccess = (function() {
|
|
callback(null)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
reconcile: (function(src, dst, callback) {
|
|
var total = 0;
|
|
var create = [];
|
|
Object.keys(src.entries).forEach((function(key) {
|
|
var e = src.entries[key];
|
|
var e2 = dst.entries[key];
|
|
if (!e2 || e.timestamp > e2.timestamp) {
|
|
create.push(key);
|
|
total++
|
|
}
|
|
}));
|
|
var remove = [];
|
|
Object.keys(dst.entries).forEach((function(key) {
|
|
var e = dst.entries[key];
|
|
var e2 = src.entries[key];
|
|
if (!e2) {
|
|
remove.push(key);
|
|
total++
|
|
}
|
|
}));
|
|
if (!total) {
|
|
return callback(null)
|
|
}
|
|
var completed = 0;
|
|
var db = src.type === "remote" ? src.db : dst.db;
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readwrite");
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return callback(err)
|
|
}
|
|
return
|
|
}
|
|
if (++completed >= total) {
|
|
return callback(null)
|
|
}
|
|
}
|
|
transaction.onerror = (function(e) {
|
|
done(this.error);
|
|
e.preventDefault()
|
|
});
|
|
create.sort().forEach((function(path) {
|
|
if (dst.type === "local") {
|
|
IDBFS.loadRemoteEntry(store, path, (function(err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeLocalEntry(path, entry, done)
|
|
}))
|
|
} else {
|
|
IDBFS.loadLocalEntry(path, (function(err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeRemoteEntry(store, path, entry, done)
|
|
}))
|
|
}
|
|
}));
|
|
remove.sort().reverse().forEach((function(path) {
|
|
if (dst.type === "local") {
|
|
IDBFS.removeLocalEntry(path, done)
|
|
} else {
|
|
IDBFS.removeRemoteEntry(store, path, done)
|
|
}
|
|
}))
|
|
})
|
|
};
|
|
var NODEFS = {
|
|
isWindows: false,
|
|
staticInit: (function() {
|
|
NODEFS.isWindows = !!process.platform.match(/^win/);
|
|
var flags = process["binding"]("constants");
|
|
if (flags["fs"]) {
|
|
flags = flags["fs"]
|
|
}
|
|
NODEFS.flagsForNodeMap = {
|
|
"1024": flags["O_APPEND"],
|
|
"64": flags["O_CREAT"],
|
|
"128": flags["O_EXCL"],
|
|
"0": flags["O_RDONLY"],
|
|
"2": flags["O_RDWR"],
|
|
"4096": flags["O_SYNC"],
|
|
"512": flags["O_TRUNC"],
|
|
"1": flags["O_WRONLY"]
|
|
}
|
|
}),
|
|
bufferFrom: (function(arrayBuffer) {
|
|
return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer)
|
|
}),
|
|
mount: (function(mount) {
|
|
assert(ENVIRONMENT_IS_NODE);
|
|
return NODEFS.createNode(null, "/", NODEFS.getMode(mount.opts.root), 0)
|
|
}),
|
|
createNode: (function(parent, name, mode, dev) {
|
|
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.node_ops = NODEFS.node_ops;
|
|
node.stream_ops = NODEFS.stream_ops;
|
|
return node
|
|
}),
|
|
getMode: (function(path) {
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
if (NODEFS.isWindows) {
|
|
stat.mode = stat.mode | (stat.mode & 292) >> 2
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
return stat.mode
|
|
}),
|
|
realPath: (function(node) {
|
|
var parts = [];
|
|
while (node.parent !== node) {
|
|
parts.push(node.name);
|
|
node = node.parent
|
|
}
|
|
parts.push(node.mount.opts.root);
|
|
parts.reverse();
|
|
return PATH.join.apply(null, parts)
|
|
}),
|
|
flagsForNode: (function(flags) {
|
|
flags &= ~2097152;
|
|
flags &= ~2048;
|
|
flags &= ~32768;
|
|
flags &= ~524288;
|
|
var newFlags = 0;
|
|
for (var k in NODEFS.flagsForNodeMap) {
|
|
if (flags & k) {
|
|
newFlags |= NODEFS.flagsForNodeMap[k];
|
|
flags ^= k
|
|
}
|
|
}
|
|
if (!flags) {
|
|
return newFlags
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
}),
|
|
node_ops: {
|
|
getattr: (function(node) {
|
|
var path = NODEFS.realPath(node);
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
if (NODEFS.isWindows && !stat.blksize) {
|
|
stat.blksize = 4096
|
|
}
|
|
if (NODEFS.isWindows && !stat.blocks) {
|
|
stat.blocks = (stat.size + stat.blksize - 1) / stat.blksize | 0
|
|
}
|
|
return {
|
|
dev: stat.dev,
|
|
ino: stat.ino,
|
|
mode: stat.mode,
|
|
nlink: stat.nlink,
|
|
uid: stat.uid,
|
|
gid: stat.gid,
|
|
rdev: stat.rdev,
|
|
size: stat.size,
|
|
atime: stat.atime,
|
|
mtime: stat.mtime,
|
|
ctime: stat.ctime,
|
|
blksize: stat.blksize,
|
|
blocks: stat.blocks
|
|
}
|
|
}),
|
|
setattr: (function(node, attr) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (attr.mode !== undefined) {
|
|
fs.chmodSync(path, attr.mode);
|
|
node.mode = attr.mode
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
var date = new Date(attr.timestamp);
|
|
fs.utimesSync(path, date, date)
|
|
}
|
|
if (attr.size !== undefined) {
|
|
fs.truncateSync(path, attr.size)
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
var mode = NODEFS.getMode(path);
|
|
return NODEFS.createNode(parent, name, mode)
|
|
}),
|
|
mknod: (function(parent, name, mode, dev) {
|
|
var node = NODEFS.createNode(parent, name, mode, dev);
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (FS.isDir(node.mode)) {
|
|
fs.mkdirSync(path, node.mode)
|
|
} else {
|
|
fs.writeFileSync(path, "", {
|
|
mode: node.mode
|
|
})
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
return node
|
|
}),
|
|
rename: (function(oldNode, newDir, newName) {
|
|
var oldPath = NODEFS.realPath(oldNode);
|
|
var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
|
|
try {
|
|
fs.renameSync(oldPath, newPath)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
unlink: (function(parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.unlinkSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
rmdir: (function(parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.rmdirSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
readdir: (function(node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
return fs.readdirSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
symlink: (function(parent, newName, oldPath) {
|
|
var newPath = PATH.join2(NODEFS.realPath(parent), newName);
|
|
try {
|
|
fs.symlinkSync(oldPath, newPath)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
readlink: (function(node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
path = fs.readlinkSync(path);
|
|
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
|
|
return path
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
})
|
|
},
|
|
stream_ops: {
|
|
open: (function(stream) {
|
|
var path = NODEFS.realPath(stream.node);
|
|
try {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags))
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
close: (function(stream) {
|
|
try {
|
|
if (FS.isFile(stream.node.mode) && stream.nfd) {
|
|
fs.closeSync(stream.nfd)
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
if (length === 0) return 0;
|
|
try {
|
|
return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position)
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position) {
|
|
try {
|
|
return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position)
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
try {
|
|
var stat = fs.fstatSync(stream.nfd);
|
|
position += stat.size
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return position
|
|
})
|
|
}
|
|
};
|
|
var WORKERFS = {
|
|
DIR_MODE: 16895,
|
|
FILE_MODE: 33279,
|
|
reader: null,
|
|
mount: (function(mount) {
|
|
assert(ENVIRONMENT_IS_WORKER);
|
|
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync;
|
|
var root = WORKERFS.createNode(null, "/", WORKERFS.DIR_MODE, 0);
|
|
var createdParents = {};
|
|
|
|
function ensureParent(path) {
|
|
var parts = path.split("/");
|
|
var parent = root;
|
|
for (var i = 0; i < parts.length - 1; i++) {
|
|
var curr = parts.slice(0, i + 1).join("/");
|
|
if (!createdParents[curr]) {
|
|
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0)
|
|
}
|
|
parent = createdParents[curr]
|
|
}
|
|
return parent
|
|
}
|
|
|
|
function base(path) {
|
|
var parts = path.split("/");
|
|
return parts[parts.length - 1]
|
|
}
|
|
Array.prototype.forEach.call(mount.opts["files"] || [], (function(file) {
|
|
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate)
|
|
}));
|
|
(mount.opts["blobs"] || []).forEach((function(obj) {
|
|
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"])
|
|
}));
|
|
(mount.opts["packages"] || []).forEach((function(pack) {
|
|
pack["metadata"].files.forEach((function(file) {
|
|
var name = file.filename.substr(1);
|
|
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack["blob"].slice(file.start, file.end))
|
|
}))
|
|
}));
|
|
return root
|
|
}),
|
|
createNode: (function(parent, name, mode, dev, contents, mtime) {
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.mode = mode;
|
|
node.node_ops = WORKERFS.node_ops;
|
|
node.stream_ops = WORKERFS.stream_ops;
|
|
node.timestamp = (mtime || new Date).getTime();
|
|
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
|
|
if (mode === WORKERFS.FILE_MODE) {
|
|
node.size = contents.size;
|
|
node.contents = contents
|
|
} else {
|
|
node.size = 4096;
|
|
node.contents = {}
|
|
}
|
|
if (parent) {
|
|
parent.contents[name] = node
|
|
}
|
|
return node
|
|
}),
|
|
node_ops: {
|
|
getattr: (function(node) {
|
|
return {
|
|
dev: 1,
|
|
ino: undefined,
|
|
mode: node.mode,
|
|
nlink: 1,
|
|
uid: 0,
|
|
gid: 0,
|
|
rdev: undefined,
|
|
size: node.size,
|
|
atime: new Date(node.timestamp),
|
|
mtime: new Date(node.timestamp),
|
|
ctime: new Date(node.timestamp),
|
|
blksize: 4096,
|
|
blocks: Math.ceil(node.size / 4096)
|
|
}
|
|
}),
|
|
setattr: (function(node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp
|
|
}
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}),
|
|
mknod: (function(parent, name, mode, dev) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
rename: (function(oldNode, newDir, newName) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
unlink: (function(parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
rmdir: (function(parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
readdir: (function(node) {
|
|
var entries = [".", ".."];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue
|
|
}
|
|
entries.push(key)
|
|
}
|
|
return entries
|
|
}),
|
|
symlink: (function(parent, newName, oldPath) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
readlink: (function(node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
})
|
|
},
|
|
stream_ops: {
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
if (position >= stream.node.size) return 0;
|
|
var chunk = stream.node.contents.slice(position, position + length);
|
|
var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
|
|
buffer.set(new Uint8Array(ab), offset);
|
|
return chunk.size
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.size
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return position
|
|
})
|
|
}
|
|
};
|
|
STATICTOP += 16;
|
|
STATICTOP += 16;
|
|
STATICTOP += 16;
|
|
var FS = {
|
|
root: null,
|
|
mounts: [],
|
|
devices: {},
|
|
streams: [],
|
|
nextInode: 1,
|
|
nameTable: null,
|
|
currentPath: "/",
|
|
initialized: false,
|
|
ignorePermissions: true,
|
|
trackingDelegate: {},
|
|
tracking: {
|
|
openFlags: {
|
|
READ: 1,
|
|
WRITE: 2
|
|
}
|
|
},
|
|
ErrnoError: null,
|
|
genericErrors: {},
|
|
filesystems: null,
|
|
syncFSRequests: 0,
|
|
handleFSError: (function(e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e + " : " + stackTrace();
|
|
return ___setErrNo(e.errno)
|
|
}),
|
|
lookupPath: (function(path, opts) {
|
|
path = PATH.resolve(FS.cwd(), path);
|
|
opts = opts || {};
|
|
if (!path) return {
|
|
path: "",
|
|
node: null
|
|
};
|
|
var defaults = {
|
|
follow_mount: true,
|
|
recurse_count: 0
|
|
};
|
|
for (var key in defaults) {
|
|
if (opts[key] === undefined) {
|
|
opts[key] = defaults[key]
|
|
}
|
|
}
|
|
if (opts.recurse_count > 8) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP)
|
|
}
|
|
var parts = PATH.normalizeArray(path.split("/").filter((function(p) {
|
|
return !!p
|
|
})), false);
|
|
var current = FS.root;
|
|
var current_path = "/";
|
|
for (var i = 0; i < parts.length; i++) {
|
|
var islast = i === parts.length - 1;
|
|
if (islast && opts.parent) {
|
|
break
|
|
}
|
|
current = FS.lookupNode(current, parts[i]);
|
|
current_path = PATH.join2(current_path, parts[i]);
|
|
if (FS.isMountpoint(current)) {
|
|
if (!islast || islast && opts.follow_mount) {
|
|
current = current.mounted.root
|
|
}
|
|
}
|
|
if (!islast || opts.follow) {
|
|
var count = 0;
|
|
while (FS.isLink(current.mode)) {
|
|
var link = FS.readlink(current_path);
|
|
current_path = PATH.resolve(PATH.dirname(current_path), link);
|
|
var lookup = FS.lookupPath(current_path, {
|
|
recurse_count: opts.recurse_count
|
|
});
|
|
current = lookup.node;
|
|
if (count++ > 40) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP)
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return {
|
|
path: current_path,
|
|
node: current
|
|
}
|
|
}),
|
|
getPath: (function(node) {
|
|
var path;
|
|
while (true) {
|
|
if (FS.isRoot(node)) {
|
|
var mount = node.mount.mountpoint;
|
|
if (!path) return mount;
|
|
return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path
|
|
}
|
|
path = path ? node.name + "/" + path : node.name;
|
|
node = node.parent
|
|
}
|
|
}),
|
|
hashName: (function(parentid, name) {
|
|
var hash = 0;
|
|
for (var i = 0; i < name.length; i++) {
|
|
hash = (hash << 5) - hash + name.charCodeAt(i) | 0
|
|
}
|
|
return (parentid + hash >>> 0) % FS.nameTable.length
|
|
}),
|
|
hashAddNode: (function(node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
node.name_next = FS.nameTable[hash];
|
|
FS.nameTable[hash] = node
|
|
}),
|
|
hashRemoveNode: (function(node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
if (FS.nameTable[hash] === node) {
|
|
FS.nameTable[hash] = node.name_next
|
|
} else {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
if (current.name_next === node) {
|
|
current.name_next = node.name_next;
|
|
break
|
|
}
|
|
current = current.name_next
|
|
}
|
|
}
|
|
}),
|
|
lookupNode: (function(parent, name) {
|
|
var err = FS.mayLookup(parent);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err, parent)
|
|
}
|
|
var hash = FS.hashName(parent.id, name);
|
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
|
|
var nodeName = node.name;
|
|
if (node.parent.id === parent.id && nodeName === name) {
|
|
return node
|
|
}
|
|
}
|
|
return FS.lookup(parent, name)
|
|
}),
|
|
createNode: (function(parent, name, mode, rdev) {
|
|
if (!FS.FSNode) {
|
|
FS.FSNode = (function(parent, name, mode, rdev) {
|
|
if (!parent) {
|
|
parent = this
|
|
}
|
|
this.parent = parent;
|
|
this.mount = parent.mount;
|
|
this.mounted = null;
|
|
this.id = FS.nextInode++;
|
|
this.name = name;
|
|
this.mode = mode;
|
|
this.node_ops = {};
|
|
this.stream_ops = {};
|
|
this.rdev = rdev
|
|
});
|
|
FS.FSNode.prototype = {};
|
|
var readMode = 292 | 73;
|
|
var writeMode = 146;
|
|
Object.defineProperties(FS.FSNode.prototype, {
|
|
read: {
|
|
get: (function() {
|
|
return (this.mode & readMode) === readMode
|
|
}),
|
|
set: (function(val) {
|
|
val ? this.mode |= readMode : this.mode &= ~readMode
|
|
})
|
|
},
|
|
write: {
|
|
get: (function() {
|
|
return (this.mode & writeMode) === writeMode
|
|
}),
|
|
set: (function(val) {
|
|
val ? this.mode |= writeMode : this.mode &= ~writeMode
|
|
})
|
|
},
|
|
isFolder: {
|
|
get: (function() {
|
|
return FS.isDir(this.mode)
|
|
})
|
|
},
|
|
isDevice: {
|
|
get: (function() {
|
|
return FS.isChrdev(this.mode)
|
|
})
|
|
}
|
|
})
|
|
}
|
|
var node = new FS.FSNode(parent, name, mode, rdev);
|
|
FS.hashAddNode(node);
|
|
return node
|
|
}),
|
|
destroyNode: (function(node) {
|
|
FS.hashRemoveNode(node)
|
|
}),
|
|
isRoot: (function(node) {
|
|
return node === node.parent
|
|
}),
|
|
isMountpoint: (function(node) {
|
|
return !!node.mounted
|
|
}),
|
|
isFile: (function(mode) {
|
|
return (mode & 61440) === 32768
|
|
}),
|
|
isDir: (function(mode) {
|
|
return (mode & 61440) === 16384
|
|
}),
|
|
isLink: (function(mode) {
|
|
return (mode & 61440) === 40960
|
|
}),
|
|
isChrdev: (function(mode) {
|
|
return (mode & 61440) === 8192
|
|
}),
|
|
isBlkdev: (function(mode) {
|
|
return (mode & 61440) === 24576
|
|
}),
|
|
isFIFO: (function(mode) {
|
|
return (mode & 61440) === 4096
|
|
}),
|
|
isSocket: (function(mode) {
|
|
return (mode & 49152) === 49152
|
|
}),
|
|
flagModes: {
|
|
"r": 0,
|
|
"rs": 1052672,
|
|
"r+": 2,
|
|
"w": 577,
|
|
"wx": 705,
|
|
"xw": 705,
|
|
"w+": 578,
|
|
"wx+": 706,
|
|
"xw+": 706,
|
|
"a": 1089,
|
|
"ax": 1217,
|
|
"xa": 1217,
|
|
"a+": 1090,
|
|
"ax+": 1218,
|
|
"xa+": 1218
|
|
},
|
|
modeStringToFlags: (function(str) {
|
|
var flags = FS.flagModes[str];
|
|
if (typeof flags === "undefined") {
|
|
throw new Error("Unknown file open mode: " + str)
|
|
}
|
|
return flags
|
|
}),
|
|
flagsToPermissionString: (function(flag) {
|
|
var perms = ["r", "w", "rw"][flag & 3];
|
|
if (flag & 512) {
|
|
perms += "w"
|
|
}
|
|
return perms
|
|
}),
|
|
nodePermissions: (function(node, perms) {
|
|
if (FS.ignorePermissions) {
|
|
return 0
|
|
}
|
|
if (perms.indexOf("r") !== -1 && !(node.mode & 292)) {
|
|
return ERRNO_CODES.EACCES
|
|
} else if (perms.indexOf("w") !== -1 && !(node.mode & 146)) {
|
|
return ERRNO_CODES.EACCES
|
|
} else if (perms.indexOf("x") !== -1 && !(node.mode & 73)) {
|
|
return ERRNO_CODES.EACCES
|
|
}
|
|
return 0
|
|
}),
|
|
mayLookup: (function(dir) {
|
|
var err = FS.nodePermissions(dir, "x");
|
|
if (err) return err;
|
|
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
|
|
return 0
|
|
}),
|
|
mayCreate: (function(dir, name) {
|
|
try {
|
|
var node = FS.lookupNode(dir, name);
|
|
return ERRNO_CODES.EEXIST
|
|
} catch (e) {}
|
|
return FS.nodePermissions(dir, "wx")
|
|
}),
|
|
mayDelete: (function(dir, name, isdir) {
|
|
var node;
|
|
try {
|
|
node = FS.lookupNode(dir, name)
|
|
} catch (e) {
|
|
return e.errno
|
|
}
|
|
var err = FS.nodePermissions(dir, "wx");
|
|
if (err) {
|
|
return err
|
|
}
|
|
if (isdir) {
|
|
if (!FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.ENOTDIR
|
|
}
|
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
|
|
return ERRNO_CODES.EBUSY
|
|
}
|
|
} else {
|
|
if (FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.EISDIR
|
|
}
|
|
}
|
|
return 0
|
|
}),
|
|
mayOpen: (function(node, flags) {
|
|
if (!node) {
|
|
return ERRNO_CODES.ENOENT
|
|
}
|
|
if (FS.isLink(node.mode)) {
|
|
return ERRNO_CODES.ELOOP
|
|
} else if (FS.isDir(node.mode)) {
|
|
if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) {
|
|
return ERRNO_CODES.EISDIR
|
|
}
|
|
}
|
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags))
|
|
}),
|
|
MAX_OPEN_FDS: 4096,
|
|
nextfd: (function(fd_start, fd_end) {
|
|
fd_start = fd_start || 0;
|
|
fd_end = fd_end || FS.MAX_OPEN_FDS;
|
|
for (var fd = fd_start; fd <= fd_end; fd++) {
|
|
if (!FS.streams[fd]) {
|
|
return fd
|
|
}
|
|
}
|
|
throw new FS.ErrnoError(ERRNO_CODES.EMFILE)
|
|
}),
|
|
getStream: (function(fd) {
|
|
return FS.streams[fd]
|
|
}),
|
|
createStream: (function(stream, fd_start, fd_end) {
|
|
if (!FS.FSStream) {
|
|
FS.FSStream = (function() {});
|
|
FS.FSStream.prototype = {};
|
|
Object.defineProperties(FS.FSStream.prototype, {
|
|
object: {
|
|
get: (function() {
|
|
return this.node
|
|
}),
|
|
set: (function(val) {
|
|
this.node = val
|
|
})
|
|
},
|
|
isRead: {
|
|
get: (function() {
|
|
return (this.flags & 2097155) !== 1
|
|
})
|
|
},
|
|
isWrite: {
|
|
get: (function() {
|
|
return (this.flags & 2097155) !== 0
|
|
})
|
|
},
|
|
isAppend: {
|
|
get: (function() {
|
|
return this.flags & 1024
|
|
})
|
|
}
|
|
})
|
|
}
|
|
var newStream = new FS.FSStream;
|
|
for (var p in stream) {
|
|
newStream[p] = stream[p]
|
|
}
|
|
stream = newStream;
|
|
var fd = FS.nextfd(fd_start, fd_end);
|
|
stream.fd = fd;
|
|
FS.streams[fd] = stream;
|
|
return stream
|
|
}),
|
|
closeStream: (function(fd) {
|
|
FS.streams[fd] = null
|
|
}),
|
|
chrdev_stream_ops: {
|
|
open: (function(stream) {
|
|
var device = FS.getDevice(stream.node.rdev);
|
|
stream.stream_ops = device.stream_ops;
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream)
|
|
}
|
|
}),
|
|
llseek: (function() {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
})
|
|
},
|
|
major: (function(dev) {
|
|
return dev >> 8
|
|
}),
|
|
minor: (function(dev) {
|
|
return dev & 255
|
|
}),
|
|
makedev: (function(ma, mi) {
|
|
return ma << 8 | mi
|
|
}),
|
|
registerDevice: (function(dev, ops) {
|
|
FS.devices[dev] = {
|
|
stream_ops: ops
|
|
}
|
|
}),
|
|
getDevice: (function(dev) {
|
|
return FS.devices[dev]
|
|
}),
|
|
getMounts: (function(mount) {
|
|
var mounts = [];
|
|
var check = [mount];
|
|
while (check.length) {
|
|
var m = check.pop();
|
|
mounts.push(m);
|
|
check.push.apply(check, m.mounts)
|
|
}
|
|
return mounts
|
|
}),
|
|
syncfs: (function(populate, callback) {
|
|
if (typeof populate === "function") {
|
|
callback = populate;
|
|
populate = false
|
|
}
|
|
FS.syncFSRequests++;
|
|
if (FS.syncFSRequests > 1) {
|
|
console.log("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work")
|
|
}
|
|
var mounts = FS.getMounts(FS.root.mount);
|
|
var completed = 0;
|
|
|
|
function doCallback(err) {
|
|
assert(FS.syncFSRequests > 0);
|
|
FS.syncFSRequests--;
|
|
return callback(err)
|
|
}
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return doCallback(err)
|
|
}
|
|
return
|
|
}
|
|
if (++completed >= mounts.length) {
|
|
doCallback(null)
|
|
}
|
|
}
|
|
mounts.forEach((function(mount) {
|
|
if (!mount.type.syncfs) {
|
|
return done(null)
|
|
}
|
|
mount.type.syncfs(mount, populate, done)
|
|
}))
|
|
}),
|
|
mount: (function(type, opts, mountpoint) {
|
|
var root = mountpoint === "/";
|
|
var pseudo = !mountpoint;
|
|
var node;
|
|
if (root && FS.root) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
} else if (!root && !pseudo) {
|
|
var lookup = FS.lookupPath(mountpoint, {
|
|
follow_mount: false
|
|
});
|
|
mountpoint = lookup.path;
|
|
node = lookup.node;
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
if (!FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
}
|
|
var mount = {
|
|
type: type,
|
|
opts: opts,
|
|
mountpoint: mountpoint,
|
|
mounts: []
|
|
};
|
|
var mountRoot = type.mount(mount);
|
|
mountRoot.mount = mount;
|
|
mount.root = mountRoot;
|
|
if (root) {
|
|
FS.root = mountRoot
|
|
} else if (node) {
|
|
node.mounted = mount;
|
|
if (node.mount) {
|
|
node.mount.mounts.push(mount)
|
|
}
|
|
}
|
|
return mountRoot
|
|
}),
|
|
unmount: (function(mountpoint) {
|
|
var lookup = FS.lookupPath(mountpoint, {
|
|
follow_mount: false
|
|
});
|
|
if (!FS.isMountpoint(lookup.node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var node = lookup.node;
|
|
var mount = node.mounted;
|
|
var mounts = FS.getMounts(mount);
|
|
Object.keys(FS.nameTable).forEach((function(hash) {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
var next = current.name_next;
|
|
if (mounts.indexOf(current.mount) !== -1) {
|
|
FS.destroyNode(current)
|
|
}
|
|
current = next
|
|
}
|
|
}));
|
|
node.mounted = null;
|
|
var idx = node.mount.mounts.indexOf(mount);
|
|
assert(idx !== -1);
|
|
node.mount.mounts.splice(idx, 1)
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
return parent.node_ops.lookup(parent, name)
|
|
}),
|
|
mknod: (function(path, mode, dev) {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
if (!name || name === "." || name === "..") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var err = FS.mayCreate(parent, name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.mknod) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
return parent.node_ops.mknod(parent, name, mode, dev)
|
|
}),
|
|
create: (function(path, mode) {
|
|
mode = mode !== undefined ? mode : 438;
|
|
mode &= 4095;
|
|
mode |= 32768;
|
|
return FS.mknod(path, mode, 0)
|
|
}),
|
|
mkdir: (function(path, mode) {
|
|
mode = mode !== undefined ? mode : 511;
|
|
mode &= 511 | 512;
|
|
mode |= 16384;
|
|
return FS.mknod(path, mode, 0)
|
|
}),
|
|
mkdirTree: (function(path, mode) {
|
|
var dirs = path.split("/");
|
|
var d = "";
|
|
for (var i = 0; i < dirs.length; ++i) {
|
|
if (!dirs[i]) continue;
|
|
d += "/" + dirs[i];
|
|
try {
|
|
FS.mkdir(d, mode)
|
|
} catch (e) {
|
|
if (e.errno != ERRNO_CODES.EEXIST) throw e
|
|
}
|
|
}
|
|
}),
|
|
mkdev: (function(path, mode, dev) {
|
|
if (typeof dev === "undefined") {
|
|
dev = mode;
|
|
mode = 438
|
|
}
|
|
mode |= 8192;
|
|
return FS.mknod(path, mode, dev)
|
|
}),
|
|
symlink: (function(oldpath, newpath) {
|
|
if (!PATH.resolve(oldpath)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
var lookup = FS.lookupPath(newpath, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
var newname = PATH.basename(newpath);
|
|
var err = FS.mayCreate(parent, newname);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.symlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
return parent.node_ops.symlink(parent, newname, oldpath)
|
|
}),
|
|
rename: (function(old_path, new_path) {
|
|
var old_dirname = PATH.dirname(old_path);
|
|
var new_dirname = PATH.dirname(new_path);
|
|
var old_name = PATH.basename(old_path);
|
|
var new_name = PATH.basename(new_path);
|
|
var lookup, old_dir, new_dir;
|
|
try {
|
|
lookup = FS.lookupPath(old_path, {
|
|
parent: true
|
|
});
|
|
old_dir = lookup.node;
|
|
lookup = FS.lookupPath(new_path, {
|
|
parent: true
|
|
});
|
|
new_dir = lookup.node
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
if (old_dir.mount !== new_dir.mount) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EXDEV)
|
|
}
|
|
var old_node = FS.lookupNode(old_dir, old_name);
|
|
var relative = PATH.relative(old_path, new_dirname);
|
|
if (relative.charAt(0) !== ".") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
relative = PATH.relative(new_path, old_dirname);
|
|
if (relative.charAt(0) !== ".") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)
|
|
}
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name)
|
|
} catch (e) {}
|
|
if (old_node === new_node) {
|
|
return
|
|
}
|
|
var isdir = FS.isDir(old_node.mode);
|
|
var err = FS.mayDelete(old_dir, old_name, isdir);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!old_dir.node_ops.rename) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
if (new_dir !== old_dir) {
|
|
err = FS.nodePermissions(old_dir, "w");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willMovePath"]) {
|
|
FS.trackingDelegate["willMovePath"](old_path, new_path)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message)
|
|
}
|
|
FS.hashRemoveNode(old_node);
|
|
try {
|
|
old_dir.node_ops.rename(old_node, new_dir, new_name)
|
|
} catch (e) {
|
|
throw e
|
|
} finally {
|
|
FS.hashAddNode(old_node)
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["onMovePath"]) FS.trackingDelegate["onMovePath"](old_path, new_path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message)
|
|
}
|
|
}),
|
|
rmdir: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, true);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.rmdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willDeletePath"]) {
|
|
FS.trackingDelegate["willDeletePath"](path)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
parent.node_ops.rmdir(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
}),
|
|
readdir: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
var node = lookup.node;
|
|
if (!node.node_ops.readdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
return node.node_ops.readdir(node)
|
|
}),
|
|
unlink: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, false);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.unlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willDeletePath"]) {
|
|
FS.trackingDelegate["willDeletePath"](path)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
parent.node_ops.unlink(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
}),
|
|
readlink: (function(path) {
|
|
var lookup = FS.lookupPath(path);
|
|
var link = lookup.node;
|
|
if (!link) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (!link.node_ops.readlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link))
|
|
}),
|
|
stat: (function(path, dontFollow) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontFollow
|
|
});
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (!node.node_ops.getattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
return node.node_ops.getattr(node)
|
|
}),
|
|
lstat: (function(path) {
|
|
return FS.stat(path, true)
|
|
}),
|
|
chmod: (function(path, mode, dontFollow) {
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontFollow
|
|
});
|
|
node = lookup.node
|
|
} else {
|
|
node = path
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
mode: mode & 4095 | node.mode & ~4095,
|
|
timestamp: Date.now()
|
|
})
|
|
}),
|
|
lchmod: (function(path, mode) {
|
|
FS.chmod(path, mode, true)
|
|
}),
|
|
fchmod: (function(fd, mode) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
FS.chmod(stream.node, mode)
|
|
}),
|
|
chown: (function(path, uid, gid, dontFollow) {
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontFollow
|
|
});
|
|
node = lookup.node
|
|
} else {
|
|
node = path
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Date.now()
|
|
})
|
|
}),
|
|
lchown: (function(path, uid, gid) {
|
|
FS.chown(path, uid, gid, true)
|
|
}),
|
|
fchown: (function(fd, uid, gid) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
FS.chown(stream.node, uid, gid)
|
|
}),
|
|
truncate: (function(path, len) {
|
|
if (len < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
node = lookup.node
|
|
} else {
|
|
node = path
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR)
|
|
}
|
|
if (!FS.isFile(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var err = FS.nodePermissions(node, "w");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
size: len,
|
|
timestamp: Date.now()
|
|
})
|
|
}),
|
|
ftruncate: (function(fd, len) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
FS.truncate(stream.node, len)
|
|
}),
|
|
utime: (function(path, atime, mtime) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
var node = lookup.node;
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Math.max(atime, mtime)
|
|
})
|
|
}),
|
|
open: (function(path, flags, mode, fd_start, fd_end) {
|
|
if (path === "") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
flags = typeof flags === "string" ? FS.modeStringToFlags(flags) : flags;
|
|
mode = typeof mode === "undefined" ? 438 : mode;
|
|
if (flags & 64) {
|
|
mode = mode & 4095 | 32768
|
|
} else {
|
|
mode = 0
|
|
}
|
|
var node;
|
|
if (typeof path === "object") {
|
|
node = path
|
|
} else {
|
|
path = PATH.normalize(path);
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !(flags & 131072)
|
|
});
|
|
node = lookup.node
|
|
} catch (e) {}
|
|
}
|
|
var created = false;
|
|
if (flags & 64) {
|
|
if (node) {
|
|
if (flags & 128) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EEXIST)
|
|
}
|
|
} else {
|
|
node = FS.mknod(path, mode, 0);
|
|
created = true
|
|
}
|
|
}
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (FS.isChrdev(node.mode)) {
|
|
flags &= ~512
|
|
}
|
|
if (flags & 65536 && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
if (!created) {
|
|
var err = FS.mayOpen(node, flags);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
}
|
|
if (flags & 512) {
|
|
FS.truncate(node, 0)
|
|
}
|
|
flags &= ~(128 | 512);
|
|
var stream = FS.createStream({
|
|
node: node,
|
|
path: FS.getPath(node),
|
|
flags: flags,
|
|
seekable: true,
|
|
position: 0,
|
|
stream_ops: node.stream_ops,
|
|
ungotten: [],
|
|
error: false
|
|
}, fd_start, fd_end);
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream)
|
|
}
|
|
if (Module["logReadFiles"] && !(flags & 1)) {
|
|
if (!FS.readFiles) FS.readFiles = {};
|
|
if (!(path in FS.readFiles)) {
|
|
FS.readFiles[path] = 1;
|
|
err("read file: " + path)
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["onOpenFile"]) {
|
|
var trackingFlags = 0;
|
|
if ((flags & 2097155) !== 1) {
|
|
trackingFlags |= FS.tracking.openFlags.READ
|
|
}
|
|
if ((flags & 2097155) !== 0) {
|
|
trackingFlags |= FS.tracking.openFlags.WRITE
|
|
}
|
|
FS.trackingDelegate["onOpenFile"](path, trackingFlags)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onOpenFile']('" + path + "', flags) threw an exception: " + e.message)
|
|
}
|
|
return stream
|
|
}),
|
|
close: (function(stream) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (stream.getdents) stream.getdents = null;
|
|
try {
|
|
if (stream.stream_ops.close) {
|
|
stream.stream_ops.close(stream)
|
|
}
|
|
} catch (e) {
|
|
throw e
|
|
} finally {
|
|
FS.closeStream(stream.fd)
|
|
}
|
|
stream.fd = null
|
|
}),
|
|
isClosed: (function(stream) {
|
|
return stream.fd === null
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (!stream.seekable || !stream.stream_ops.llseek) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
}
|
|
stream.position = stream.stream_ops.llseek(stream, offset, whence);
|
|
stream.ungotten = [];
|
|
return stream.position
|
|
}),
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR)
|
|
}
|
|
if (!stream.stream_ops.read) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var seeking = typeof position !== "undefined";
|
|
if (!seeking) {
|
|
position = stream.position
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
}
|
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
|
|
if (!seeking) stream.position += bytesRead;
|
|
return bytesRead
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position, canOwn) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR)
|
|
}
|
|
if (!stream.stream_ops.write) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if (stream.flags & 1024) {
|
|
FS.llseek(stream, 0, 2)
|
|
}
|
|
var seeking = typeof position !== "undefined";
|
|
if (!seeking) {
|
|
position = stream.position
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
}
|
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
|
|
if (!seeking) stream.position += bytesWritten;
|
|
try {
|
|
if (stream.path && FS.trackingDelegate["onWriteToFile"]) FS.trackingDelegate["onWriteToFile"](stream.path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onWriteToFile']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
return bytesWritten
|
|
}),
|
|
allocate: (function(stream, offset, length) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (offset < 0 || length <= 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
if (!stream.stream_ops.allocate) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)
|
|
}
|
|
stream.stream_ops.allocate(stream, offset, length)
|
|
}),
|
|
mmap: (function(stream, buffer, offset, length, position, prot, flags) {
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EACCES)
|
|
}
|
|
if (!stream.stream_ops.mmap) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags)
|
|
}),
|
|
msync: (function(stream, buffer, offset, length, mmapFlags) {
|
|
if (!stream || !stream.stream_ops.msync) {
|
|
return 0
|
|
}
|
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags)
|
|
}),
|
|
munmap: (function(stream) {
|
|
return 0
|
|
}),
|
|
ioctl: (function(stream, cmd, arg) {
|
|
if (!stream.stream_ops.ioctl) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY)
|
|
}
|
|
return stream.stream_ops.ioctl(stream, cmd, arg)
|
|
}),
|
|
readFile: (function(path, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || "r";
|
|
opts.encoding = opts.encoding || "binary";
|
|
if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"')
|
|
}
|
|
var ret;
|
|
var stream = FS.open(path, opts.flags);
|
|
var stat = FS.stat(path);
|
|
var length = stat.size;
|
|
var buf = new Uint8Array(length);
|
|
FS.read(stream, buf, 0, length, 0);
|
|
if (opts.encoding === "utf8") {
|
|
ret = UTF8ArrayToString(buf, 0)
|
|
} else if (opts.encoding === "binary") {
|
|
ret = buf
|
|
}
|
|
FS.close(stream);
|
|
return ret
|
|
}),
|
|
writeFile: (function(path, data, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || "w";
|
|
var stream = FS.open(path, opts.flags, opts.mode);
|
|
if (typeof data === "string") {
|
|
var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
|
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
|
|
FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn)
|
|
} else if (ArrayBuffer.isView(data)) {
|
|
FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn)
|
|
} else {
|
|
throw new Error("Unsupported data type")
|
|
}
|
|
FS.close(stream)
|
|
}),
|
|
cwd: (function() {
|
|
return FS.currentPath
|
|
}),
|
|
chdir: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
if (lookup.node === null) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (!FS.isDir(lookup.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
var err = FS.nodePermissions(lookup.node, "x");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
FS.currentPath = lookup.path
|
|
}),
|
|
createDefaultDirectories: (function() {
|
|
FS.mkdir("/tmp");
|
|
FS.mkdir("/home");
|
|
FS.mkdir("/home/web_user")
|
|
}),
|
|
createDefaultDevices: (function() {
|
|
FS.mkdir("/dev");
|
|
FS.registerDevice(FS.makedev(1, 3), {
|
|
read: (function() {
|
|
return 0
|
|
}),
|
|
write: (function(stream, buffer, offset, length, pos) {
|
|
return length
|
|
})
|
|
});
|
|
FS.mkdev("/dev/null", FS.makedev(1, 3));
|
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
|
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
|
|
FS.mkdev("/dev/tty", FS.makedev(5, 0));
|
|
FS.mkdev("/dev/tty1", FS.makedev(6, 0));
|
|
var random_device;
|
|
if (typeof crypto !== "undefined") {
|
|
var randomBuffer = new Uint8Array(1);
|
|
random_device = (function() {
|
|
crypto.getRandomValues(randomBuffer);
|
|
return randomBuffer[0]
|
|
})
|
|
} else if (ENVIRONMENT_IS_NODE) {
|
|
random_device = (function() {
|
|
return require("crypto")["randomBytes"](1)[0]
|
|
})
|
|
} else {
|
|
random_device = (function() {
|
|
return Math.random() * 256 | 0
|
|
})
|
|
}
|
|
FS.createDevice("/dev", "random", random_device);
|
|
FS.createDevice("/dev", "urandom", random_device);
|
|
FS.mkdir("/dev/shm");
|
|
FS.mkdir("/dev/shm/tmp")
|
|
}),
|
|
createSpecialDirectories: (function() {
|
|
FS.mkdir("/proc");
|
|
FS.mkdir("/proc/self");
|
|
FS.mkdir("/proc/self/fd");
|
|
FS.mount({
|
|
mount: (function() {
|
|
var node = FS.createNode("/proc/self", "fd", 16384 | 511, 73);
|
|
node.node_ops = {
|
|
lookup: (function(parent, name) {
|
|
var fd = +name;
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var ret = {
|
|
parent: null,
|
|
mount: {
|
|
mountpoint: "fake"
|
|
},
|
|
node_ops: {
|
|
readlink: (function() {
|
|
return stream.path
|
|
})
|
|
}
|
|
};
|
|
ret.parent = ret;
|
|
return ret
|
|
})
|
|
};
|
|
return node
|
|
})
|
|
}, {}, "/proc/self/fd")
|
|
}),
|
|
createStandardStreams: (function() {
|
|
if (Module["stdin"]) {
|
|
FS.createDevice("/dev", "stdin", Module["stdin"])
|
|
} else {
|
|
FS.symlink("/dev/tty", "/dev/stdin")
|
|
}
|
|
if (Module["stdout"]) {
|
|
FS.createDevice("/dev", "stdout", null, Module["stdout"])
|
|
} else {
|
|
FS.symlink("/dev/tty", "/dev/stdout")
|
|
}
|
|
if (Module["stderr"]) {
|
|
FS.createDevice("/dev", "stderr", null, Module["stderr"])
|
|
} else {
|
|
FS.symlink("/dev/tty1", "/dev/stderr")
|
|
}
|
|
var stdin = FS.open("/dev/stdin", "r");
|
|
assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")");
|
|
var stdout = FS.open("/dev/stdout", "w");
|
|
assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")");
|
|
var stderr = FS.open("/dev/stderr", "w");
|
|
assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")")
|
|
}),
|
|
ensureErrnoError: (function() {
|
|
if (FS.ErrnoError) return;
|
|
FS.ErrnoError = function ErrnoError(errno, node) {
|
|
this.node = node;
|
|
this.setErrno = (function(errno) {
|
|
this.errno = errno;
|
|
for (var key in ERRNO_CODES) {
|
|
if (ERRNO_CODES[key] === errno) {
|
|
this.code = key;
|
|
break
|
|
}
|
|
}
|
|
});
|
|
this.setErrno(errno);
|
|
this.message = ERRNO_MESSAGES[errno];
|
|
if (this.stack) Object.defineProperty(this, "stack", {
|
|
value: (new Error).stack,
|
|
writable: true
|
|
})
|
|
};
|
|
FS.ErrnoError.prototype = new Error;
|
|
FS.ErrnoError.prototype.constructor = FS.ErrnoError;
|
|
[ERRNO_CODES.ENOENT].forEach((function(code) {
|
|
FS.genericErrors[code] = new FS.ErrnoError(code);
|
|
FS.genericErrors[code].stack = "<generic error, no stack>"
|
|
}))
|
|
}),
|
|
staticInit: (function() {
|
|
FS.ensureErrnoError();
|
|
FS.nameTable = new Array(4096);
|
|
FS.mount(MEMFS, {}, "/");
|
|
FS.createDefaultDirectories();
|
|
FS.createDefaultDevices();
|
|
FS.createSpecialDirectories();
|
|
FS.filesystems = {
|
|
"MEMFS": MEMFS,
|
|
"IDBFS": IDBFS,
|
|
"NODEFS": NODEFS,
|
|
"WORKERFS": WORKERFS
|
|
}
|
|
}),
|
|
init: (function(input, output, error) {
|
|
assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");
|
|
FS.init.initialized = true;
|
|
FS.ensureErrnoError();
|
|
Module["stdin"] = input || Module["stdin"];
|
|
Module["stdout"] = output || Module["stdout"];
|
|
Module["stderr"] = error || Module["stderr"];
|
|
FS.createStandardStreams()
|
|
}),
|
|
quit: (function() {
|
|
FS.init.initialized = false;
|
|
var fflush = Module["_fflush"];
|
|
if (fflush) fflush(0);
|
|
for (var i = 0; i < FS.streams.length; i++) {
|
|
var stream = FS.streams[i];
|
|
if (!stream) {
|
|
continue
|
|
}
|
|
FS.close(stream)
|
|
}
|
|
}),
|
|
getMode: (function(canRead, canWrite) {
|
|
var mode = 0;
|
|
if (canRead) mode |= 292 | 73;
|
|
if (canWrite) mode |= 146;
|
|
return mode
|
|
}),
|
|
joinPath: (function(parts, forceRelative) {
|
|
var path = PATH.join.apply(null, parts);
|
|
if (forceRelative && path[0] == "/") path = path.substr(1);
|
|
return path
|
|
}),
|
|
absolutePath: (function(relative, base) {
|
|
return PATH.resolve(base, relative)
|
|
}),
|
|
standardizePath: (function(path) {
|
|
return PATH.normalize(path)
|
|
}),
|
|
findObject: (function(path, dontResolveLastLink) {
|
|
var ret = FS.analyzePath(path, dontResolveLastLink);
|
|
if (ret.exists) {
|
|
return ret.object
|
|
} else {
|
|
___setErrNo(ret.error);
|
|
return null
|
|
}
|
|
}),
|
|
analyzePath: (function(path, dontResolveLastLink) {
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontResolveLastLink
|
|
});
|
|
path = lookup.path
|
|
} catch (e) {}
|
|
var ret = {
|
|
isRoot: false,
|
|
exists: false,
|
|
error: 0,
|
|
name: null,
|
|
path: null,
|
|
object: null,
|
|
parentExists: false,
|
|
parentPath: null,
|
|
parentObject: null
|
|
};
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
ret.parentExists = true;
|
|
ret.parentPath = lookup.path;
|
|
ret.parentObject = lookup.node;
|
|
ret.name = PATH.basename(path);
|
|
lookup = FS.lookupPath(path, {
|
|
follow: !dontResolveLastLink
|
|
});
|
|
ret.exists = true;
|
|
ret.path = lookup.path;
|
|
ret.object = lookup.node;
|
|
ret.name = lookup.node.name;
|
|
ret.isRoot = lookup.path === "/"
|
|
} catch (e) {
|
|
ret.error = e.errno
|
|
}
|
|
return ret
|
|
}),
|
|
createFolder: (function(parent, name, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.mkdir(path, mode)
|
|
}),
|
|
createPath: (function(parent, path, canRead, canWrite) {
|
|
parent = typeof parent === "string" ? parent : FS.getPath(parent);
|
|
var parts = path.split("/").reverse();
|
|
while (parts.length) {
|
|
var part = parts.pop();
|
|
if (!part) continue;
|
|
var current = PATH.join2(parent, part);
|
|
try {
|
|
FS.mkdir(current)
|
|
} catch (e) {}
|
|
parent = current
|
|
}
|
|
return current
|
|
}),
|
|
createFile: (function(parent, name, properties, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.create(path, mode)
|
|
}),
|
|
createDataFile: (function(parent, name, data, canRead, canWrite, canOwn) {
|
|
var path = name ? PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name) : parent;
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
var node = FS.create(path, mode);
|
|
if (data) {
|
|
if (typeof data === "string") {
|
|
var arr = new Array(data.length);
|
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
|
|
data = arr
|
|
}
|
|
FS.chmod(node, mode | 146);
|
|
var stream = FS.open(node, "w");
|
|
FS.write(stream, data, 0, data.length, 0, canOwn);
|
|
FS.close(stream);
|
|
FS.chmod(node, mode)
|
|
}
|
|
return node
|
|
}),
|
|
createDevice: (function(parent, name, input, output) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(!!input, !!output);
|
|
if (!FS.createDevice.major) FS.createDevice.major = 64;
|
|
var dev = FS.makedev(FS.createDevice.major++, 0);
|
|
FS.registerDevice(dev, {
|
|
open: (function(stream) {
|
|
stream.seekable = false
|
|
}),
|
|
close: (function(stream) {
|
|
if (output && output.buffer && output.buffer.length) {
|
|
output(10)
|
|
}
|
|
}),
|
|
read: (function(stream, buffer, offset, length, pos) {
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = input()
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset + i] = result
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return bytesRead
|
|
}),
|
|
write: (function(stream, buffer, offset, length, pos) {
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
output(buffer[offset + i])
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return i
|
|
})
|
|
});
|
|
return FS.mkdev(path, mode, dev)
|
|
}),
|
|
createLink: (function(parent, name, target, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
return FS.symlink(target, path)
|
|
}),
|
|
forceLoadFile: (function(obj) {
|
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
|
|
var success = true;
|
|
if (typeof XMLHttpRequest !== "undefined") {
|
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")
|
|
} else if (Module["read"]) {
|
|
try {
|
|
obj.contents = intArrayFromString(Module["read"](obj.url), true);
|
|
obj.usedBytes = obj.contents.length
|
|
} catch (e) {
|
|
success = false
|
|
}
|
|
} else {
|
|
throw new Error("Cannot load without read() or XMLHttpRequest.")
|
|
}
|
|
if (!success) ___setErrNo(ERRNO_CODES.EIO);
|
|
return success
|
|
}),
|
|
createLazyFile: (function(parent, name, url, canRead, canWrite) {
|
|
function LazyUint8Array() {
|
|
this.lengthKnown = false;
|
|
this.chunks = []
|
|
}
|
|
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
|
|
if (idx > this.length - 1 || idx < 0) {
|
|
return undefined
|
|
}
|
|
var chunkOffset = idx % this.chunkSize;
|
|
var chunkNum = idx / this.chunkSize | 0;
|
|
return this.getter(chunkNum)[chunkOffset]
|
|
};
|
|
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
|
|
this.getter = getter
|
|
};
|
|
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("HEAD", url, false);
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
var datalength = Number(xhr.getResponseHeader("Content-length"));
|
|
var header;
|
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
|
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
|
|
var chunkSize = 1024 * 1024;
|
|
if (!hasByteServing) chunkSize = datalength;
|
|
var doXHR = (function(from, to) {
|
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
|
|
if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!");
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, false);
|
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
|
|
if (typeof Uint8Array != "undefined") xhr.responseType = "arraybuffer";
|
|
if (xhr.overrideMimeType) {
|
|
xhr.overrideMimeType("text/plain; charset=x-user-defined")
|
|
}
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
if (xhr.response !== undefined) {
|
|
return new Uint8Array(xhr.response || [])
|
|
} else {
|
|
return intArrayFromString(xhr.responseText || "", true)
|
|
}
|
|
});
|
|
var lazyArray = this;
|
|
lazyArray.setDataGetter((function(chunkNum) {
|
|
var start = chunkNum * chunkSize;
|
|
var end = (chunkNum + 1) * chunkSize - 1;
|
|
end = Math.min(end, datalength - 1);
|
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") {
|
|
lazyArray.chunks[chunkNum] = doXHR(start, end)
|
|
}
|
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") throw new Error("doXHR failed!");
|
|
return lazyArray.chunks[chunkNum]
|
|
}));
|
|
if (usesGzip || !datalength) {
|
|
chunkSize = datalength = 1;
|
|
datalength = this.getter(0).length;
|
|
chunkSize = datalength;
|
|
console.log("LazyFiles on gzip forces download of the whole file when length is accessed")
|
|
}
|
|
this._length = datalength;
|
|
this._chunkSize = chunkSize;
|
|
this.lengthKnown = true
|
|
};
|
|
if (typeof XMLHttpRequest !== "undefined") {
|
|
if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
|
|
var lazyArray = new LazyUint8Array;
|
|
Object.defineProperties(lazyArray, {
|
|
length: {
|
|
get: (function() {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength()
|
|
}
|
|
return this._length
|
|
})
|
|
},
|
|
chunkSize: {
|
|
get: (function() {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength()
|
|
}
|
|
return this._chunkSize
|
|
})
|
|
}
|
|
});
|
|
var properties = {
|
|
isDevice: false,
|
|
contents: lazyArray
|
|
}
|
|
} else {
|
|
var properties = {
|
|
isDevice: false,
|
|
url: url
|
|
}
|
|
}
|
|
var node = FS.createFile(parent, name, properties, canRead, canWrite);
|
|
if (properties.contents) {
|
|
node.contents = properties.contents
|
|
} else if (properties.url) {
|
|
node.contents = null;
|
|
node.url = properties.url
|
|
}
|
|
Object.defineProperties(node, {
|
|
usedBytes: {
|
|
get: (function() {
|
|
return this.contents.length
|
|
})
|
|
}
|
|
});
|
|
var stream_ops = {};
|
|
var keys = Object.keys(node.stream_ops);
|
|
keys.forEach((function(key) {
|
|
var fn = node.stream_ops[key];
|
|
stream_ops[key] = function forceLoadLazyFile() {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
return fn.apply(null, arguments)
|
|
}
|
|
}));
|
|
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
var contents = stream.node.contents;
|
|
if (position >= contents.length) return 0;
|
|
var size = Math.min(contents.length - position, length);
|
|
assert(size >= 0);
|
|
if (contents.slice) {
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents[position + i]
|
|
}
|
|
} else {
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents.get(position + i)
|
|
}
|
|
}
|
|
return size
|
|
};
|
|
node.stream_ops = stream_ops;
|
|
return node
|
|
}),
|
|
createPreloadedFile: (function(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
|
|
Browser.init();
|
|
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
|
|
var dep = getUniqueRunDependency("cp " + fullname);
|
|
|
|
function processData(byteArray) {
|
|
function finish(byteArray) {
|
|
if (preFinish) preFinish();
|
|
if (!dontCreateFile) {
|
|
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn)
|
|
}
|
|
if (onload) onload();
|
|
removeRunDependency(dep)
|
|
}
|
|
var handled = false;
|
|
Module["preloadPlugins"].forEach((function(plugin) {
|
|
if (handled) return;
|
|
if (plugin["canHandle"](fullname)) {
|
|
plugin["handle"](byteArray, fullname, finish, (function() {
|
|
if (onerror) onerror();
|
|
removeRunDependency(dep)
|
|
}));
|
|
handled = true
|
|
}
|
|
}));
|
|
if (!handled) finish(byteArray)
|
|
}
|
|
addRunDependency(dep);
|
|
if (typeof url == "string") {
|
|
Browser.asyncLoad(url, (function(byteArray) {
|
|
processData(byteArray)
|
|
}), onerror)
|
|
} else {
|
|
processData(url)
|
|
}
|
|
}),
|
|
indexedDB: (function() {
|
|
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB
|
|
}),
|
|
DB_NAME: (function() {
|
|
return "EM_FS_" + window.location.pathname
|
|
}),
|
|
DB_VERSION: 20,
|
|
DB_STORE_NAME: "FILE_DATA",
|
|
saveFilesToDB: (function(paths, onload, onerror) {
|
|
onload = onload || (function() {});
|
|
onerror = onerror || (function() {});
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION)
|
|
} catch (e) {
|
|
return onerror(e)
|
|
}
|
|
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
|
|
console.log("creating db");
|
|
var db = openRequest.result;
|
|
db.createObjectStore(FS.DB_STORE_NAME)
|
|
};
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readwrite");
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0,
|
|
fail = 0,
|
|
total = paths.length;
|
|
|
|
function finish() {
|
|
if (fail == 0) onload();
|
|
else onerror()
|
|
}
|
|
paths.forEach((function(path) {
|
|
var putRequest = files.put(FS.analyzePath(path).object.contents, path);
|
|
putRequest.onsuccess = function putRequest_onsuccess() {
|
|
ok++;
|
|
if (ok + fail == total) finish()
|
|
};
|
|
putRequest.onerror = function putRequest_onerror() {
|
|
fail++;
|
|
if (ok + fail == total) finish()
|
|
}
|
|
}));
|
|
transaction.onerror = onerror
|
|
};
|
|
openRequest.onerror = onerror
|
|
}),
|
|
loadFilesFromDB: (function(paths, onload, onerror) {
|
|
onload = onload || (function() {});
|
|
onerror = onerror || (function() {});
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION)
|
|
} catch (e) {
|
|
return onerror(e)
|
|
}
|
|
openRequest.onupgradeneeded = onerror;
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
try {
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readonly")
|
|
} catch (e) {
|
|
onerror(e);
|
|
return
|
|
}
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0,
|
|
fail = 0,
|
|
total = paths.length;
|
|
|
|
function finish() {
|
|
if (fail == 0) onload();
|
|
else onerror()
|
|
}
|
|
paths.forEach((function(path) {
|
|
var getRequest = files.get(path);
|
|
getRequest.onsuccess = function getRequest_onsuccess() {
|
|
if (FS.analyzePath(path).exists) {
|
|
FS.unlink(path)
|
|
}
|
|
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
|
|
ok++;
|
|
if (ok + fail == total) finish()
|
|
};
|
|
getRequest.onerror = function getRequest_onerror() {
|
|
fail++;
|
|
if (ok + fail == total) finish()
|
|
}
|
|
}));
|
|
transaction.onerror = onerror
|
|
};
|
|
openRequest.onerror = onerror
|
|
})
|
|
};
|
|
var SYSCALLS = {
|
|
DEFAULT_POLLMASK: 5,
|
|
mappings: {},
|
|
umask: 511,
|
|
calculateAt: (function(dirfd, path) {
|
|
if (path[0] !== "/") {
|
|
var dir;
|
|
if (dirfd === -100) {
|
|
dir = FS.cwd()
|
|
} else {
|
|
var dirstream = FS.getStream(dirfd);
|
|
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
dir = dirstream.path
|
|
}
|
|
path = PATH.join2(dir, path)
|
|
}
|
|
return path
|
|
}),
|
|
doStat: (function(func, path, buf) {
|
|
try {
|
|
var stat = func(path)
|
|
} catch (e) {
|
|
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
|
|
return -ERRNO_CODES.ENOTDIR
|
|
}
|
|
throw e
|
|
}
|
|
HEAP32[buf >> 2] = stat.dev;
|
|
HEAP32[buf + 4 >> 2] = 0;
|
|
HEAP32[buf + 8 >> 2] = stat.ino;
|
|
HEAP32[buf + 12 >> 2] = stat.mode;
|
|
HEAP32[buf + 16 >> 2] = stat.nlink;
|
|
HEAP32[buf + 20 >> 2] = stat.uid;
|
|
HEAP32[buf + 24 >> 2] = stat.gid;
|
|
HEAP32[buf + 28 >> 2] = stat.rdev;
|
|
HEAP32[buf + 32 >> 2] = 0;
|
|
HEAP32[buf + 36 >> 2] = stat.size;
|
|
HEAP32[buf + 40 >> 2] = 4096;
|
|
HEAP32[buf + 44 >> 2] = stat.blocks;
|
|
HEAP32[buf + 48 >> 2] = stat.atime.getTime() / 1e3 | 0;
|
|
HEAP32[buf + 52 >> 2] = 0;
|
|
HEAP32[buf + 56 >> 2] = stat.mtime.getTime() / 1e3 | 0;
|
|
HEAP32[buf + 60 >> 2] = 0;
|
|
HEAP32[buf + 64 >> 2] = stat.ctime.getTime() / 1e3 | 0;
|
|
HEAP32[buf + 68 >> 2] = 0;
|
|
HEAP32[buf + 72 >> 2] = stat.ino;
|
|
return 0
|
|
}),
|
|
doMsync: (function(addr, stream, len, flags) {
|
|
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
|
|
FS.msync(stream, buffer, 0, len, flags)
|
|
}),
|
|
doMkdir: (function(path, mode) {
|
|
path = PATH.normalize(path);
|
|
if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1);
|
|
FS.mkdir(path, mode, 0);
|
|
return 0
|
|
}),
|
|
doMknod: (function(path, mode, dev) {
|
|
switch (mode & 61440) {
|
|
case 32768:
|
|
case 8192:
|
|
case 24576:
|
|
case 4096:
|
|
case 49152:
|
|
break;
|
|
default:
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
FS.mknod(path, mode, dev);
|
|
return 0
|
|
}),
|
|
doReadlink: (function(path, buf, bufsize) {
|
|
if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
|
|
var ret = FS.readlink(path);
|
|
var len = Math.min(bufsize, lengthBytesUTF8(ret));
|
|
var endChar = HEAP8[buf + len];
|
|
stringToUTF8(ret, buf, bufsize + 1);
|
|
HEAP8[buf + len] = endChar;
|
|
return len
|
|
}),
|
|
doAccess: (function(path, amode) {
|
|
if (amode & ~7) {
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
var node;
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
node = lookup.node;
|
|
var perms = "";
|
|
if (amode & 4) perms += "r";
|
|
if (amode & 2) perms += "w";
|
|
if (amode & 1) perms += "x";
|
|
if (perms && FS.nodePermissions(node, perms)) {
|
|
return -ERRNO_CODES.EACCES
|
|
}
|
|
return 0
|
|
}),
|
|
doDup: (function(path, flags, suggestFD) {
|
|
var suggest = FS.getStream(suggestFD);
|
|
if (suggest) FS.close(suggest);
|
|
return FS.open(path, flags, 0, suggestFD, suggestFD).fd
|
|
}),
|
|
doReadv: (function(stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[iov + i * 8 >> 2];
|
|
var len = HEAP32[iov + (i * 8 + 4) >> 2];
|
|
var curr = FS.read(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (curr < len) break
|
|
}
|
|
return ret
|
|
}),
|
|
doWritev: (function(stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[iov + i * 8 >> 2];
|
|
var len = HEAP32[iov + (i * 8 + 4) >> 2];
|
|
var curr = FS.write(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr
|
|
}
|
|
return ret
|
|
}),
|
|
varargs: 0,
|
|
get: (function(varargs) {
|
|
SYSCALLS.varargs += 4;
|
|
var ret = HEAP32[SYSCALLS.varargs - 4 >> 2];
|
|
return ret
|
|
}),
|
|
getStr: (function() {
|
|
var ret = Pointer_stringify(SYSCALLS.get());
|
|
return ret
|
|
}),
|
|
getStreamFromFD: (function() {
|
|
var stream = FS.getStream(SYSCALLS.get());
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return stream
|
|
}),
|
|
getSocketFromFD: (function() {
|
|
var socket = SOCKFS.getSocket(SYSCALLS.get());
|
|
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return socket
|
|
}),
|
|
getSocketAddress: (function(allowNull) {
|
|
var addrp = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
if (allowNull && addrp === 0) return null;
|
|
var info = __read_sockaddr(addrp, addrlen);
|
|
if (info.errno) throw new FS.ErrnoError(info.errno);
|
|
info.addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
return info
|
|
}),
|
|
get64: (function() {
|
|
var low = SYSCALLS.get(),
|
|
high = SYSCALLS.get();
|
|
if (low >= 0) assert(high === 0);
|
|
else assert(high === -1);
|
|
return low
|
|
}),
|
|
getZero: (function() {
|
|
assert(SYSCALLS.get() === 0)
|
|
})
|
|
};
|
|
|
|
function ___syscall10(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr();
|
|
FS.unlink(path);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
var SOCKFS = {
|
|
mount: (function(mount) {
|
|
Module["websocket"] = Module["websocket"] && "object" === typeof Module["websocket"] ? Module["websocket"] : {};
|
|
Module["websocket"]._callbacks = {};
|
|
Module["websocket"]["on"] = (function(event, callback) {
|
|
if ("function" === typeof callback) {
|
|
this._callbacks[event] = callback
|
|
}
|
|
return this
|
|
});
|
|
Module["websocket"].emit = (function(event, param) {
|
|
if ("function" === typeof this._callbacks[event]) {
|
|
this._callbacks[event].call(this, param)
|
|
}
|
|
});
|
|
return FS.createNode(null, "/", 16384 | 511, 0)
|
|
}),
|
|
createSocket: (function(family, type, protocol) {
|
|
var streaming = type == 1;
|
|
if (protocol) {
|
|
assert(streaming == (protocol == 6))
|
|
}
|
|
var sock = {
|
|
family: family,
|
|
type: type,
|
|
protocol: protocol,
|
|
server: null,
|
|
error: null,
|
|
peers: {},
|
|
pending: [],
|
|
recv_queue: [],
|
|
sock_ops: SOCKFS.websocket_sock_ops
|
|
};
|
|
var name = SOCKFS.nextname();
|
|
var node = FS.createNode(SOCKFS.root, name, 49152, 0);
|
|
node.sock = sock;
|
|
var stream = FS.createStream({
|
|
path: name,
|
|
node: node,
|
|
flags: FS.modeStringToFlags("r+"),
|
|
seekable: false,
|
|
stream_ops: SOCKFS.stream_ops
|
|
});
|
|
sock.stream = stream;
|
|
return sock
|
|
}),
|
|
getSocket: (function(fd) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream || !FS.isSocket(stream.node.mode)) {
|
|
return null
|
|
}
|
|
return stream.node.sock
|
|
}),
|
|
stream_ops: {
|
|
poll: (function(stream) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.poll(sock)
|
|
}),
|
|
ioctl: (function(stream, request, varargs) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.ioctl(sock, request, varargs)
|
|
}),
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
var sock = stream.node.sock;
|
|
var msg = sock.sock_ops.recvmsg(sock, length);
|
|
if (!msg) {
|
|
return 0
|
|
}
|
|
buffer.set(msg.buffer, offset);
|
|
return msg.buffer.length
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.sendmsg(sock, buffer, offset, length)
|
|
}),
|
|
close: (function(stream) {
|
|
var sock = stream.node.sock;
|
|
sock.sock_ops.close(sock)
|
|
})
|
|
},
|
|
nextname: (function() {
|
|
if (!SOCKFS.nextname.current) {
|
|
SOCKFS.nextname.current = 0
|
|
}
|
|
return "socket[" + SOCKFS.nextname.current++ + "]"
|
|
}),
|
|
websocket_sock_ops: {
|
|
createPeer: (function(sock, addr, port) {
|
|
var ws;
|
|
if (typeof addr === "object") {
|
|
ws = addr;
|
|
addr = null;
|
|
port = null
|
|
}
|
|
if (ws) {
|
|
if (ws._socket) {
|
|
addr = ws._socket.remoteAddress;
|
|
port = ws._socket.remotePort
|
|
} else {
|
|
var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
|
|
if (!result) {
|
|
throw new Error("WebSocket URL must be in the format ws(s)://address:port")
|
|
}
|
|
addr = result[1];
|
|
port = parseInt(result[2], 10)
|
|
}
|
|
} else {
|
|
try {
|
|
var runtimeConfig = Module["websocket"] && "object" === typeof Module["websocket"];
|
|
var url = "ws:#".replace("#", "//");
|
|
if (runtimeConfig) {
|
|
if ("string" === typeof Module["websocket"]["url"]) {
|
|
url = Module["websocket"]["url"]
|
|
}
|
|
}
|
|
if (url === "ws://" || url === "wss://") {
|
|
var parts = addr.split("/");
|
|
url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/")
|
|
}
|
|
var subProtocols = "binary";
|
|
if (runtimeConfig) {
|
|
if ("string" === typeof Module["websocket"]["subprotocol"]) {
|
|
subProtocols = Module["websocket"]["subprotocol"]
|
|
}
|
|
}
|
|
subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */);
|
|
var opts = ENVIRONMENT_IS_NODE ? {
|
|
"protocol": subProtocols.toString()
|
|
} : subProtocols;
|
|
if (runtimeConfig && null === Module["websocket"]["subprotocol"]) {
|
|
subProtocols = "null";
|
|
opts = undefined
|
|
}
|
|
var WebSocketConstructor;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
WebSocketConstructor = require("ws")
|
|
} else if (ENVIRONMENT_IS_WEB) {
|
|
WebSocketConstructor = window["WebSocket"]
|
|
} else {
|
|
WebSocketConstructor = WebSocket
|
|
}
|
|
ws = new WebSocketConstructor(url, opts);
|
|
ws.binaryType = "arraybuffer"
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EHOSTUNREACH)
|
|
}
|
|
}
|
|
var peer = {
|
|
addr: addr,
|
|
port: port,
|
|
socket: ws,
|
|
dgram_send_queue: []
|
|
};
|
|
SOCKFS.websocket_sock_ops.addPeer(sock, peer);
|
|
SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
|
|
if (sock.type === 2 && typeof sock.sport !== "undefined") {
|
|
peer.dgram_send_queue.push(new Uint8Array([255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), (sock.sport & 65280) >> 8, sock.sport & 255]))
|
|
}
|
|
return peer
|
|
}),
|
|
getPeer: (function(sock, addr, port) {
|
|
return sock.peers[addr + ":" + port]
|
|
}),
|
|
addPeer: (function(sock, peer) {
|
|
sock.peers[peer.addr + ":" + peer.port] = peer
|
|
}),
|
|
removePeer: (function(sock, peer) {
|
|
delete sock.peers[peer.addr + ":" + peer.port]
|
|
}),
|
|
handlePeerEvents: (function(sock, peer) {
|
|
var first = true;
|
|
var handleOpen = (function() {
|
|
Module["websocket"].emit("open", sock.stream.fd);
|
|
try {
|
|
var queued = peer.dgram_send_queue.shift();
|
|
while (queued) {
|
|
peer.socket.send(queued);
|
|
queued = peer.dgram_send_queue.shift()
|
|
}
|
|
} catch (e) {
|
|
peer.socket.close()
|
|
}
|
|
});
|
|
|
|
function handleMessage(data) {
|
|
assert(typeof data !== "string" && data.byteLength !== undefined);
|
|
if (data.byteLength == 0) {
|
|
return
|
|
}
|
|
data = new Uint8Array(data);
|
|
var wasfirst = first;
|
|
first = false;
|
|
if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) {
|
|
var newport = data[8] << 8 | data[9];
|
|
SOCKFS.websocket_sock_ops.removePeer(sock, peer);
|
|
peer.port = newport;
|
|
SOCKFS.websocket_sock_ops.addPeer(sock, peer);
|
|
return
|
|
}
|
|
sock.recv_queue.push({
|
|
addr: peer.addr,
|
|
port: peer.port,
|
|
data: data
|
|
});
|
|
Module["websocket"].emit("message", sock.stream.fd)
|
|
}
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
peer.socket.on("open", handleOpen);
|
|
peer.socket.on("message", (function(data, flags) {
|
|
if (!flags.binary) {
|
|
return
|
|
}
|
|
handleMessage((new Uint8Array(data)).buffer)
|
|
}));
|
|
peer.socket.on("close", (function() {
|
|
Module["websocket"].emit("close", sock.stream.fd)
|
|
}));
|
|
peer.socket.on("error", (function(error) {
|
|
sock.error = ERRNO_CODES.ECONNREFUSED;
|
|
Module["websocket"].emit("error", [sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused"])
|
|
}))
|
|
} else {
|
|
peer.socket.onopen = handleOpen;
|
|
peer.socket.onclose = (function() {
|
|
Module["websocket"].emit("close", sock.stream.fd)
|
|
});
|
|
peer.socket.onmessage = function peer_socket_onmessage(event) {
|
|
handleMessage(event.data)
|
|
};
|
|
peer.socket.onerror = (function(error) {
|
|
sock.error = ERRNO_CODES.ECONNREFUSED;
|
|
Module["websocket"].emit("error", [sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused"])
|
|
})
|
|
}
|
|
}),
|
|
poll: (function(sock) {
|
|
if (sock.type === 1 && sock.server) {
|
|
return sock.pending.length ? 64 | 1 : 0
|
|
}
|
|
var mask = 0;
|
|
var dest = sock.type === 1 ? SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null;
|
|
if (sock.recv_queue.length || !dest || dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) {
|
|
mask |= 64 | 1
|
|
}
|
|
if (!dest || dest && dest.socket.readyState === dest.socket.OPEN) {
|
|
mask |= 4
|
|
}
|
|
if (dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) {
|
|
mask |= 16
|
|
}
|
|
return mask
|
|
}),
|
|
ioctl: (function(sock, request, arg) {
|
|
switch (request) {
|
|
case 21531:
|
|
var bytes = 0;
|
|
if (sock.recv_queue.length) {
|
|
bytes = sock.recv_queue[0].data.length
|
|
}
|
|
HEAP32[arg >> 2] = bytes;
|
|
return 0;
|
|
default:
|
|
return ERRNO_CODES.EINVAL
|
|
}
|
|
}),
|
|
close: (function(sock) {
|
|
if (sock.server) {
|
|
try {
|
|
sock.server.close()
|
|
} catch (e) {}
|
|
sock.server = null
|
|
}
|
|
var peers = Object.keys(sock.peers);
|
|
for (var i = 0; i < peers.length; i++) {
|
|
var peer = sock.peers[peers[i]];
|
|
try {
|
|
peer.socket.close()
|
|
} catch (e) {}
|
|
SOCKFS.websocket_sock_ops.removePeer(sock, peer)
|
|
}
|
|
return 0
|
|
}),
|
|
bind: (function(sock, addr, port) {
|
|
if (typeof sock.saddr !== "undefined" || typeof sock.sport !== "undefined") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
sock.saddr = addr;
|
|
sock.sport = port;
|
|
if (sock.type === 2) {
|
|
if (sock.server) {
|
|
sock.server.close();
|
|
sock.server = null
|
|
}
|
|
try {
|
|
sock.sock_ops.listen(sock, 0)
|
|
} catch (e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e;
|
|
if (e.errno !== ERRNO_CODES.EOPNOTSUPP) throw e
|
|
}
|
|
}
|
|
}),
|
|
connect: (function(sock, addr, port) {
|
|
if (sock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)
|
|
}
|
|
if (typeof sock.daddr !== "undefined" && typeof sock.dport !== "undefined") {
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
|
|
if (dest) {
|
|
if (dest.socket.readyState === dest.socket.CONNECTING) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EALREADY)
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISCONN)
|
|
}
|
|
}
|
|
}
|
|
var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
|
|
sock.daddr = peer.addr;
|
|
sock.dport = peer.port;
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINPROGRESS)
|
|
}),
|
|
listen: (function(sock, backlog) {
|
|
if (!ENVIRONMENT_IS_NODE) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)
|
|
}
|
|
if (sock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var WebSocketServer = require("ws").Server;
|
|
var host = sock.saddr;
|
|
sock.server = new WebSocketServer({
|
|
host: host,
|
|
port: sock.sport
|
|
});
|
|
Module["websocket"].emit("listen", sock.stream.fd);
|
|
sock.server.on("connection", (function(ws) {
|
|
if (sock.type === 1) {
|
|
var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
|
|
var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
|
|
newsock.daddr = peer.addr;
|
|
newsock.dport = peer.port;
|
|
sock.pending.push(newsock);
|
|
Module["websocket"].emit("connection", newsock.stream.fd)
|
|
} else {
|
|
SOCKFS.websocket_sock_ops.createPeer(sock, ws);
|
|
Module["websocket"].emit("connection", sock.stream.fd)
|
|
}
|
|
}));
|
|
sock.server.on("closed", (function() {
|
|
Module["websocket"].emit("close", sock.stream.fd);
|
|
sock.server = null
|
|
}));
|
|
sock.server.on("error", (function(error) {
|
|
sock.error = ERRNO_CODES.EHOSTUNREACH;
|
|
Module["websocket"].emit("error", [sock.stream.fd, sock.error, "EHOSTUNREACH: Host is unreachable"])
|
|
}))
|
|
}),
|
|
accept: (function(listensock) {
|
|
if (!listensock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var newsock = listensock.pending.shift();
|
|
newsock.stream.flags = listensock.stream.flags;
|
|
return newsock
|
|
}),
|
|
getname: (function(sock, peer) {
|
|
var addr, port;
|
|
if (peer) {
|
|
if (sock.daddr === undefined || sock.dport === undefined) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)
|
|
}
|
|
addr = sock.daddr;
|
|
port = sock.dport
|
|
} else {
|
|
addr = sock.saddr || 0;
|
|
port = sock.sport || 0
|
|
}
|
|
return {
|
|
addr: addr,
|
|
port: port
|
|
}
|
|
}),
|
|
sendmsg: (function(sock, buffer, offset, length, addr, port) {
|
|
if (sock.type === 2) {
|
|
if (addr === undefined || port === undefined) {
|
|
addr = sock.daddr;
|
|
port = sock.dport
|
|
}
|
|
if (addr === undefined || port === undefined) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EDESTADDRREQ)
|
|
}
|
|
} else {
|
|
addr = sock.daddr;
|
|
port = sock.dport
|
|
}
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
|
|
if (sock.type === 1) {
|
|
if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)
|
|
} else if (dest.socket.readyState === dest.socket.CONNECTING) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
}
|
|
if (ArrayBuffer.isView(buffer)) {
|
|
offset += buffer.byteOffset;
|
|
buffer = buffer.buffer
|
|
}
|
|
var data;
|
|
data = buffer.slice(offset, offset + length);
|
|
if (sock.type === 2) {
|
|
if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
|
|
if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port)
|
|
}
|
|
dest.dgram_send_queue.push(data);
|
|
return length
|
|
}
|
|
}
|
|
try {
|
|
dest.socket.send(data);
|
|
return length
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
}),
|
|
recvmsg: (function(sock, length) {
|
|
if (sock.type === 1 && sock.server) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)
|
|
}
|
|
var queued = sock.recv_queue.shift();
|
|
if (!queued) {
|
|
if (sock.type === 1) {
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
|
|
if (!dest) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)
|
|
} else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
return null
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
}
|
|
var queuedLength = queued.data.byteLength || queued.data.length;
|
|
var queuedOffset = queued.data.byteOffset || 0;
|
|
var queuedBuffer = queued.data.buffer || queued.data;
|
|
var bytesRead = Math.min(length, queuedLength);
|
|
var res = {
|
|
buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
|
|
addr: queued.addr,
|
|
port: queued.port
|
|
};
|
|
if (sock.type === 1 && bytesRead < queuedLength) {
|
|
var bytesRemaining = queuedLength - bytesRead;
|
|
queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
|
|
sock.recv_queue.unshift(queued)
|
|
}
|
|
return res
|
|
})
|
|
}
|
|
};
|
|
|
|
function __inet_pton4_raw(str) {
|
|
var b = str.split(".");
|
|
for (var i = 0; i < 4; i++) {
|
|
var tmp = Number(b[i]);
|
|
if (isNaN(tmp)) return null;
|
|
b[i] = tmp
|
|
}
|
|
return (b[0] | b[1] << 8 | b[2] << 16 | b[3] << 24) >>> 0
|
|
}
|
|
|
|
function __inet_pton6_raw(str) {
|
|
var words;
|
|
var w, offset, z;
|
|
var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;
|
|
var parts = [];
|
|
if (!valid6regx.test(str)) {
|
|
return null
|
|
}
|
|
if (str === "::") {
|
|
return [0, 0, 0, 0, 0, 0, 0, 0]
|
|
}
|
|
if (str.indexOf("::") === 0) {
|
|
str = str.replace("::", "Z:")
|
|
} else {
|
|
str = str.replace("::", ":Z:")
|
|
}
|
|
if (str.indexOf(".") > 0) {
|
|
str = str.replace(new RegExp("[.]", "g"), ":");
|
|
words = str.split(":");
|
|
words[words.length - 4] = parseInt(words[words.length - 4]) + parseInt(words[words.length - 3]) * 256;
|
|
words[words.length - 3] = parseInt(words[words.length - 2]) + parseInt(words[words.length - 1]) * 256;
|
|
words = words.slice(0, words.length - 2)
|
|
} else {
|
|
words = str.split(":")
|
|
}
|
|
offset = 0;
|
|
z = 0;
|
|
for (w = 0; w < words.length; w++) {
|
|
if (typeof words[w] === "string") {
|
|
if (words[w] === "Z") {
|
|
for (z = 0; z < 8 - words.length + 1; z++) {
|
|
parts[w + z] = 0
|
|
}
|
|
offset = z - 1
|
|
} else {
|
|
parts[w + offset] = _htons(parseInt(words[w], 16))
|
|
}
|
|
} else {
|
|
parts[w + offset] = words[w]
|
|
}
|
|
}
|
|
return [parts[1] << 16 | parts[0], parts[3] << 16 | parts[2], parts[5] << 16 | parts[4], parts[7] << 16 | parts[6]]
|
|
}
|
|
var DNS = {
|
|
address_map: {
|
|
id: 1,
|
|
addrs: {},
|
|
names: {}
|
|
},
|
|
lookup_name: (function(name) {
|
|
var res = __inet_pton4_raw(name);
|
|
if (res !== null) {
|
|
return name
|
|
}
|
|
res = __inet_pton6_raw(name);
|
|
if (res !== null) {
|
|
return name
|
|
}
|
|
var addr;
|
|
if (DNS.address_map.addrs[name]) {
|
|
addr = DNS.address_map.addrs[name]
|
|
} else {
|
|
var id = DNS.address_map.id++;
|
|
assert(id < 65535, "exceeded max address mappings of 65535");
|
|
addr = "172.29." + (id & 255) + "." + (id & 65280);
|
|
DNS.address_map.names[addr] = name;
|
|
DNS.address_map.addrs[name] = addr
|
|
}
|
|
return addr
|
|
}),
|
|
lookup_addr: (function(addr) {
|
|
if (DNS.address_map.names[addr]) {
|
|
return DNS.address_map.names[addr]
|
|
}
|
|
return null
|
|
})
|
|
};
|
|
|
|
function __inet_ntop4_raw(addr) {
|
|
return (addr & 255) + "." + (addr >> 8 & 255) + "." + (addr >> 16 & 255) + "." + (addr >> 24 & 255)
|
|
}
|
|
|
|
function __inet_ntop6_raw(ints) {
|
|
var str = "";
|
|
var word = 0;
|
|
var longest = 0;
|
|
var lastzero = 0;
|
|
var zstart = 0;
|
|
var len = 0;
|
|
var i = 0;
|
|
var parts = [ints[0] & 65535, ints[0] >> 16, ints[1] & 65535, ints[1] >> 16, ints[2] & 65535, ints[2] >> 16, ints[3] & 65535, ints[3] >> 16];
|
|
var hasipv4 = true;
|
|
var v4part = "";
|
|
for (i = 0; i < 5; i++) {
|
|
if (parts[i] !== 0) {
|
|
hasipv4 = false;
|
|
break
|
|
}
|
|
}
|
|
if (hasipv4) {
|
|
v4part = __inet_ntop4_raw(parts[6] | parts[7] << 16);
|
|
if (parts[5] === -1) {
|
|
str = "::ffff:";
|
|
str += v4part;
|
|
return str
|
|
}
|
|
if (parts[5] === 0) {
|
|
str = "::";
|
|
if (v4part === "0.0.0.0") v4part = "";
|
|
if (v4part === "0.0.0.1") v4part = "1";
|
|
str += v4part;
|
|
return str
|
|
}
|
|
}
|
|
for (word = 0; word < 8; word++) {
|
|
if (parts[word] === 0) {
|
|
if (word - lastzero > 1) {
|
|
len = 0
|
|
}
|
|
lastzero = word;
|
|
len++
|
|
}
|
|
if (len > longest) {
|
|
longest = len;
|
|
zstart = word - longest + 1
|
|
}
|
|
}
|
|
for (word = 0; word < 8; word++) {
|
|
if (longest > 1) {
|
|
if (parts[word] === 0 && word >= zstart && word < zstart + longest) {
|
|
if (word === zstart) {
|
|
str += ":";
|
|
if (zstart === 0) str += ":"
|
|
}
|
|
continue
|
|
}
|
|
}
|
|
str += Number(_ntohs(parts[word] & 65535)).toString(16);
|
|
str += word < 7 ? ":" : ""
|
|
}
|
|
return str
|
|
}
|
|
|
|
function __read_sockaddr(sa, salen) {
|
|
var family = HEAP16[sa >> 1];
|
|
var port = _ntohs(HEAP16[sa + 2 >> 1]);
|
|
var addr;
|
|
switch (family) {
|
|
case 2:
|
|
if (salen !== 16) {
|
|
return {
|
|
errno: ERRNO_CODES.EINVAL
|
|
}
|
|
}
|
|
addr = HEAP32[sa + 4 >> 2];
|
|
addr = __inet_ntop4_raw(addr);
|
|
break;
|
|
case 10:
|
|
if (salen !== 28) {
|
|
return {
|
|
errno: ERRNO_CODES.EINVAL
|
|
}
|
|
}
|
|
addr = [HEAP32[sa + 8 >> 2], HEAP32[sa + 12 >> 2], HEAP32[sa + 16 >> 2], HEAP32[sa + 20 >> 2]];
|
|
addr = __inet_ntop6_raw(addr);
|
|
break;
|
|
default:
|
|
return {
|
|
errno: ERRNO_CODES.EAFNOSUPPORT
|
|
}
|
|
}
|
|
return {
|
|
family: family,
|
|
addr: addr,
|
|
port: port
|
|
}
|
|
}
|
|
|
|
function __write_sockaddr(sa, family, addr, port) {
|
|
switch (family) {
|
|
case 2:
|
|
addr = __inet_pton4_raw(addr);
|
|
HEAP16[sa >> 1] = family;
|
|
HEAP32[sa + 4 >> 2] = addr;
|
|
HEAP16[sa + 2 >> 1] = _htons(port);
|
|
break;
|
|
case 10:
|
|
addr = __inet_pton6_raw(addr);
|
|
HEAP32[sa >> 2] = family;
|
|
HEAP32[sa + 8 >> 2] = addr[0];
|
|
HEAP32[sa + 12 >> 2] = addr[1];
|
|
HEAP32[sa + 16 >> 2] = addr[2];
|
|
HEAP32[sa + 20 >> 2] = addr[3];
|
|
HEAP16[sa + 2 >> 1] = _htons(port);
|
|
HEAP32[sa + 4 >> 2] = 0;
|
|
HEAP32[sa + 24 >> 2] = 0;
|
|
break;
|
|
default:
|
|
return {
|
|
errno: ERRNO_CODES.EAFNOSUPPORT
|
|
}
|
|
}
|
|
return {}
|
|
}
|
|
|
|
function ___syscall102(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var call = SYSCALLS.get(),
|
|
socketvararg = SYSCALLS.get();
|
|
SYSCALLS.varargs = socketvararg;
|
|
switch (call) {
|
|
case 1:
|
|
{
|
|
var domain = SYSCALLS.get(),
|
|
type = SYSCALLS.get(),
|
|
protocol = SYSCALLS.get();
|
|
var sock = SOCKFS.createSocket(domain, type, protocol);assert(sock.stream.fd < 64);
|
|
return sock.stream.fd
|
|
};
|
|
case 2:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
info = SYSCALLS.getSocketAddress();sock.sock_ops.bind(sock, info.addr, info.port);
|
|
return 0
|
|
};
|
|
case 3:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
info = SYSCALLS.getSocketAddress();sock.sock_ops.connect(sock, info.addr, info.port);
|
|
return 0
|
|
};
|
|
case 4:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
backlog = SYSCALLS.get();sock.sock_ops.listen(sock, backlog);
|
|
return 0
|
|
};
|
|
case 5:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
var newsock = sock.sock_ops.accept(sock);
|
|
if (addr) {
|
|
var res = __write_sockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport);
|
|
assert(!res.errno)
|
|
}
|
|
return newsock.stream.fd
|
|
};
|
|
case 6:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || "0.0.0.0"), sock.sport);assert(!res.errno);
|
|
return 0
|
|
};
|
|
case 7:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
if (!sock.daddr) {
|
|
return -ERRNO_CODES.ENOTCONN
|
|
}
|
|
var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport);assert(!res.errno);
|
|
return 0
|
|
};
|
|
case 11:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
message = SYSCALLS.get(),
|
|
length = SYSCALLS.get(),
|
|
flags = SYSCALLS.get(),
|
|
dest = SYSCALLS.getSocketAddress(true);
|
|
if (!dest) {
|
|
return FS.write(sock.stream, HEAP8, message, length)
|
|
} else {
|
|
return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port)
|
|
}
|
|
};
|
|
case 12:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
len = SYSCALLS.get(),
|
|
flags = SYSCALLS.get(),
|
|
addr = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
var msg = sock.sock_ops.recvmsg(sock, len);
|
|
if (!msg) return 0;
|
|
if (addr) {
|
|
var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port);
|
|
assert(!res.errno)
|
|
}
|
|
HEAPU8.set(msg.buffer, buf);
|
|
return msg.buffer.byteLength
|
|
};
|
|
case 14:
|
|
{
|
|
return -ERRNO_CODES.ENOPROTOOPT
|
|
};
|
|
case 15:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
level = SYSCALLS.get(),
|
|
optname = SYSCALLS.get(),
|
|
optval = SYSCALLS.get(),
|
|
optlen = SYSCALLS.get();
|
|
if (level === 1) {
|
|
if (optname === 4) {
|
|
HEAP32[optval >> 2] = sock.error;
|
|
HEAP32[optlen >> 2] = 4;
|
|
sock.error = null;
|
|
return 0
|
|
}
|
|
}
|
|
return -ERRNO_CODES.ENOPROTOOPT
|
|
};
|
|
case 16:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
message = SYSCALLS.get(),
|
|
flags = SYSCALLS.get();
|
|
var iov = HEAP32[message + 8 >> 2];
|
|
var num = HEAP32[message + 12 >> 2];
|
|
var addr, port;
|
|
var name = HEAP32[message >> 2];
|
|
var namelen = HEAP32[message + 4 >> 2];
|
|
if (name) {
|
|
var info = __read_sockaddr(name, namelen);
|
|
if (info.errno) return -info.errno;
|
|
port = info.port;
|
|
addr = DNS.lookup_addr(info.addr) || info.addr
|
|
}
|
|
var total = 0;
|
|
for (var i = 0; i < num; i++) {
|
|
total += HEAP32[iov + (8 * i + 4) >> 2]
|
|
}
|
|
var view = new Uint8Array(total);
|
|
var offset = 0;
|
|
for (var i = 0; i < num; i++) {
|
|
var iovbase = HEAP32[iov + (8 * i + 0) >> 2];
|
|
var iovlen = HEAP32[iov + (8 * i + 4) >> 2];
|
|
for (var j = 0; j < iovlen; j++) {
|
|
view[offset++] = HEAP8[iovbase + j >> 0]
|
|
}
|
|
}
|
|
return sock.sock_ops.sendmsg(sock, view, 0, total, addr, port)
|
|
};
|
|
case 17:
|
|
{
|
|
var sock = SYSCALLS.getSocketFromFD(),
|
|
message = SYSCALLS.get(),
|
|
flags = SYSCALLS.get();
|
|
var iov = HEAP32[message + 8 >> 2];
|
|
var num = HEAP32[message + 12 >> 2];
|
|
var total = 0;
|
|
for (var i = 0; i < num; i++) {
|
|
total += HEAP32[iov + (8 * i + 4) >> 2]
|
|
}
|
|
var msg = sock.sock_ops.recvmsg(sock, total);
|
|
if (!msg) return 0;
|
|
var name = HEAP32[message >> 2];
|
|
if (name) {
|
|
var res = __write_sockaddr(name, sock.family, DNS.lookup_name(msg.addr), msg.port);
|
|
assert(!res.errno)
|
|
}
|
|
var bytesRead = 0;
|
|
var bytesRemaining = msg.buffer.byteLength;
|
|
for (var i = 0; bytesRemaining > 0 && i < num; i++) {
|
|
var iovbase = HEAP32[iov + (8 * i + 0) >> 2];
|
|
var iovlen = HEAP32[iov + (8 * i + 4) >> 2];
|
|
if (!iovlen) {
|
|
continue
|
|
}
|
|
var length = Math.min(iovlen, bytesRemaining);
|
|
var buf = msg.buffer.subarray(bytesRead, bytesRead + length);
|
|
HEAPU8.set(buf, iovbase + bytesRead);
|
|
bytesRead += length;
|
|
bytesRemaining -= length
|
|
}
|
|
return bytesRead
|
|
};
|
|
default:
|
|
abort("unsupported socketcall syscall " + call)
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall122(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var buf = SYSCALLS.get();
|
|
if (!buf) return -ERRNO_CODES.EFAULT;
|
|
var layout = {
|
|
"sysname": 0,
|
|
"nodename": 65,
|
|
"domainname": 325,
|
|
"machine": 260,
|
|
"version": 195,
|
|
"release": 130,
|
|
"__size__": 390
|
|
};
|
|
|
|
function copyString(element, value) {
|
|
var offset = layout[element];
|
|
writeAsciiToMemory(value, buf + offset)
|
|
}
|
|
copyString("sysname", "Emscripten");
|
|
copyString("nodename", "emscripten");
|
|
copyString("release", "1.0");
|
|
copyString("version", "#1");
|
|
copyString("machine", "x86-JS");
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall140(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
offset_high = SYSCALLS.get(),
|
|
offset_low = SYSCALLS.get(),
|
|
result = SYSCALLS.get(),
|
|
whence = SYSCALLS.get();
|
|
var offset = offset_low;
|
|
FS.llseek(stream, offset, whence);
|
|
HEAP32[result >> 2] = stream.position;
|
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null;
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall142(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var nfds = SYSCALLS.get(),
|
|
readfds = SYSCALLS.get(),
|
|
writefds = SYSCALLS.get(),
|
|
exceptfds = SYSCALLS.get(),
|
|
timeout = SYSCALLS.get();
|
|
assert(nfds <= 64, "nfds must be less than or equal to 64");
|
|
assert(!exceptfds, "exceptfds not supported");
|
|
var total = 0;
|
|
var srcReadLow = readfds ? HEAP32[readfds >> 2] : 0,
|
|
srcReadHigh = readfds ? HEAP32[readfds + 4 >> 2] : 0;
|
|
var srcWriteLow = writefds ? HEAP32[writefds >> 2] : 0,
|
|
srcWriteHigh = writefds ? HEAP32[writefds + 4 >> 2] : 0;
|
|
var srcExceptLow = exceptfds ? HEAP32[exceptfds >> 2] : 0,
|
|
srcExceptHigh = exceptfds ? HEAP32[exceptfds + 4 >> 2] : 0;
|
|
var dstReadLow = 0,
|
|
dstReadHigh = 0;
|
|
var dstWriteLow = 0,
|
|
dstWriteHigh = 0;
|
|
var dstExceptLow = 0,
|
|
dstExceptHigh = 0;
|
|
var allLow = (readfds ? HEAP32[readfds >> 2] : 0) | (writefds ? HEAP32[writefds >> 2] : 0) | (exceptfds ? HEAP32[exceptfds >> 2] : 0);
|
|
var allHigh = (readfds ? HEAP32[readfds + 4 >> 2] : 0) | (writefds ? HEAP32[writefds + 4 >> 2] : 0) | (exceptfds ? HEAP32[exceptfds + 4 >> 2] : 0);
|
|
|
|
function check(fd, low, high, val) {
|
|
return fd < 32 ? low & val : high & val
|
|
}
|
|
for (var fd = 0; fd < nfds; fd++) {
|
|
var mask = 1 << fd % 32;
|
|
if (!check(fd, allLow, allHigh, mask)) {
|
|
continue
|
|
}
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var flags = SYSCALLS.DEFAULT_POLLMASK;
|
|
if (stream.stream_ops.poll) {
|
|
flags = stream.stream_ops.poll(stream)
|
|
}
|
|
if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) {
|
|
fd < 32 ? dstReadLow = dstReadLow | mask : dstReadHigh = dstReadHigh | mask;
|
|
total++
|
|
}
|
|
if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) {
|
|
fd < 32 ? dstWriteLow = dstWriteLow | mask : dstWriteHigh = dstWriteHigh | mask;
|
|
total++
|
|
}
|
|
if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) {
|
|
fd < 32 ? dstExceptLow = dstExceptLow | mask : dstExceptHigh = dstExceptHigh | mask;
|
|
total++
|
|
}
|
|
}
|
|
if (readfds) {
|
|
HEAP32[readfds >> 2] = dstReadLow;
|
|
HEAP32[readfds + 4 >> 2] = dstReadHigh
|
|
}
|
|
if (writefds) {
|
|
HEAP32[writefds >> 2] = dstWriteLow;
|
|
HEAP32[writefds + 4 >> 2] = dstWriteHigh
|
|
}
|
|
if (exceptfds) {
|
|
HEAP32[exceptfds >> 2] = dstExceptLow;
|
|
HEAP32[exceptfds + 4 >> 2] = dstExceptHigh
|
|
}
|
|
return total
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall145(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
iov = SYSCALLS.get(),
|
|
iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doReadv(stream, iov, iovcnt)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall146(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
iov = SYSCALLS.get(),
|
|
iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doWritev(stream, iov, iovcnt)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall15(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
mode = SYSCALLS.get();
|
|
FS.chmod(path, mode);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall183(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var buf = SYSCALLS.get(),
|
|
size = SYSCALLS.get();
|
|
if (size === 0) return -ERRNO_CODES.EINVAL;
|
|
var cwd = FS.cwd();
|
|
var cwdLengthInBytes = lengthBytesUTF8(cwd);
|
|
if (size < cwdLengthInBytes + 1) return -ERRNO_CODES.ERANGE;
|
|
stringToUTF8(cwd, buf, size);
|
|
return buf
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall192(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var addr = SYSCALLS.get(),
|
|
len = SYSCALLS.get(),
|
|
prot = SYSCALLS.get(),
|
|
flags = SYSCALLS.get(),
|
|
fd = SYSCALLS.get(),
|
|
off = SYSCALLS.get();
|
|
off <<= 12;
|
|
var ptr;
|
|
var allocated = false;
|
|
if (fd === -1) {
|
|
ptr = _memalign(PAGE_SIZE, len);
|
|
if (!ptr) return -ERRNO_CODES.ENOMEM;
|
|
_memset(ptr, 0, len);
|
|
allocated = true
|
|
} else {
|
|
var info = FS.getStream(fd);
|
|
if (!info) return -ERRNO_CODES.EBADF;
|
|
var res = FS.mmap(info, HEAPU8, addr, len, off, prot, flags);
|
|
ptr = res.ptr;
|
|
allocated = res.allocated
|
|
}
|
|
SYSCALLS.mappings[ptr] = {
|
|
malloc: ptr,
|
|
len: len,
|
|
allocated: allocated,
|
|
fd: fd,
|
|
flags: flags
|
|
};
|
|
return ptr
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall193(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
zero = SYSCALLS.getZero(),
|
|
length = SYSCALLS.get64();
|
|
FS.truncate(path, length);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall195(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
buf = SYSCALLS.get();
|
|
return SYSCALLS.doStat(FS.stat, path, buf)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall196(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
buf = SYSCALLS.get();
|
|
return SYSCALLS.doStat(FS.lstat, path, buf)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall197(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get();
|
|
return SYSCALLS.doStat(FS.stat, stream.path, buf)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall202(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall199() {
|
|
return ___syscall202.apply(null, arguments)
|
|
}
|
|
|
|
function ___syscall220(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
dirp = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
if (!stream.getdents) {
|
|
stream.getdents = FS.readdir(stream.path)
|
|
}
|
|
var pos = 0;
|
|
while (stream.getdents.length > 0 && pos + 268 <= count) {
|
|
var id;
|
|
var type;
|
|
var name = stream.getdents.pop();
|
|
if (name[0] === ".") {
|
|
id = 1;
|
|
type = 4
|
|
} else {
|
|
var child = FS.lookupNode(stream.node, name);
|
|
id = child.id;
|
|
type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8
|
|
}
|
|
HEAP32[dirp + pos >> 2] = id;
|
|
HEAP32[dirp + pos + 4 >> 2] = stream.position;
|
|
HEAP16[dirp + pos + 8 >> 1] = 268;
|
|
HEAP8[dirp + pos + 10 >> 0] = type;
|
|
stringToUTF8(name, dirp + pos + 11, 256);
|
|
pos += 268
|
|
}
|
|
return pos
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall221(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
cmd = SYSCALLS.get();
|
|
switch (cmd) {
|
|
case 0:
|
|
{
|
|
var arg = SYSCALLS.get();
|
|
if (arg < 0) {
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
var newStream;newStream = FS.open(stream.path, stream.flags, 0, arg);
|
|
return newStream.fd
|
|
};
|
|
case 1:
|
|
case 2:
|
|
return 0;
|
|
case 3:
|
|
return stream.flags;
|
|
case 4:
|
|
{
|
|
var arg = SYSCALLS.get();stream.flags |= arg;
|
|
return 0
|
|
};
|
|
case 12:
|
|
case 12:
|
|
{
|
|
var arg = SYSCALLS.get();
|
|
var offset = 0;HEAP16[arg + offset >> 1] = 2;
|
|
return 0
|
|
};
|
|
case 13:
|
|
case 14:
|
|
case 13:
|
|
case 14:
|
|
return 0;
|
|
case 16:
|
|
case 8:
|
|
return -ERRNO_CODES.EINVAL;
|
|
case 9:
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
default:
|
|
{
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall268(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
size = SYSCALLS.get(),
|
|
buf = SYSCALLS.get();
|
|
assert(size === 64);
|
|
HEAP32[buf + 4 >> 2] = 4096;
|
|
HEAP32[buf + 40 >> 2] = 4096;
|
|
HEAP32[buf + 8 >> 2] = 1e6;
|
|
HEAP32[buf + 12 >> 2] = 5e5;
|
|
HEAP32[buf + 16 >> 2] = 5e5;
|
|
HEAP32[buf + 20 >> 2] = FS.nextInode;
|
|
HEAP32[buf + 24 >> 2] = 1e6;
|
|
HEAP32[buf + 28 >> 2] = 42;
|
|
HEAP32[buf + 44 >> 2] = 2;
|
|
HEAP32[buf + 36 >> 2] = 255;
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall3(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
return FS.read(stream, HEAP8, buf, count)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall33(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
amode = SYSCALLS.get();
|
|
return SYSCALLS.doAccess(path, amode)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall38(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var old_path = SYSCALLS.getStr(),
|
|
new_path = SYSCALLS.getStr();
|
|
FS.rename(old_path, new_path);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall39(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
mode = SYSCALLS.get();
|
|
return SYSCALLS.doMkdir(path, mode)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall4(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
return FS.write(stream, HEAP8, buf, count)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall40(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr();
|
|
FS.rmdir(path);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall5(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var pathname = SYSCALLS.getStr(),
|
|
flags = SYSCALLS.get(),
|
|
mode = SYSCALLS.get();
|
|
var stream = FS.open(pathname, flags, mode);
|
|
return stream.fd
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall54(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
op = SYSCALLS.get();
|
|
switch (op) {
|
|
case 21509:
|
|
case 21505:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
case 21510:
|
|
case 21511:
|
|
case 21512:
|
|
case 21506:
|
|
case 21507:
|
|
case 21508:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
case 21519:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
var argp = SYSCALLS.get();HEAP32[argp >> 2] = 0;
|
|
return 0
|
|
};
|
|
case 21520:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return -ERRNO_CODES.EINVAL
|
|
};
|
|
case 21531:
|
|
{
|
|
var argp = SYSCALLS.get();
|
|
return FS.ioctl(stream, op, argp)
|
|
};
|
|
case 21523:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
case 21524:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
default:
|
|
abort("bad ioctl syscall " + op)
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall6(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD();
|
|
FS.close(stream);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall77(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var who = SYSCALLS.get(),
|
|
usage = SYSCALLS.get();
|
|
_memset(usage, 0, 136);
|
|
HEAP32[usage >> 2] = 1;
|
|
HEAP32[usage + 4 >> 2] = 2;
|
|
HEAP32[usage + 8 >> 2] = 3;
|
|
HEAP32[usage + 12 >> 2] = 4;
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall85(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr(),
|
|
buf = SYSCALLS.get(),
|
|
bufsize = SYSCALLS.get();
|
|
return SYSCALLS.doReadlink(path, buf, bufsize)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall91(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var addr = SYSCALLS.get(),
|
|
len = SYSCALLS.get();
|
|
var info = SYSCALLS.mappings[addr];
|
|
if (!info) return 0;
|
|
if (len === info.len) {
|
|
var stream = FS.getStream(info.fd);
|
|
SYSCALLS.doMsync(addr, stream, len, info.flags);
|
|
FS.munmap(stream);
|
|
SYSCALLS.mappings[addr] = null;
|
|
if (info.allocated) {
|
|
_free(info.malloc)
|
|
}
|
|
}
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___unlock() {}
|
|
|
|
function _abort() {
|
|
Module["abort"]()
|
|
}
|
|
|
|
function _atexit(func, arg) {
|
|
__ATEXIT__.unshift({
|
|
func: func,
|
|
arg: arg
|
|
})
|
|
}
|
|
|
|
function _clock() {
|
|
if (_clock.start === undefined) _clock.start = Date.now();
|
|
return (Date.now() - _clock.start) * (1e6 / 1e3) | 0
|
|
}
|
|
|
|
function _emscripten_get_now_res() {
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
return 1
|
|
} else if (typeof dateNow !== "undefined" || (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]) {
|
|
return 1e3
|
|
} else {
|
|
return 1e3 * 1e3
|
|
}
|
|
}
|
|
|
|
function _emscripten_get_now() {
|
|
abort()
|
|
}
|
|
|
|
function _emscripten_get_now_is_monotonic() {
|
|
return ENVIRONMENT_IS_NODE || typeof dateNow !== "undefined" || (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]
|
|
}
|
|
|
|
function _clock_getres(clk_id, res) {
|
|
var nsec;
|
|
if (clk_id === 0) {
|
|
nsec = 1e3 * 1e3
|
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
|
|
nsec = _emscripten_get_now_res()
|
|
} else {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
HEAP32[res >> 2] = nsec / 1e9 | 0;
|
|
HEAP32[res + 4 >> 2] = nsec;
|
|
return 0
|
|
}
|
|
|
|
function _clock_gettime(clk_id, tp) {
|
|
var now;
|
|
if (clk_id === 0) {
|
|
now = Date.now()
|
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
|
|
now = _emscripten_get_now()
|
|
} else {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
HEAP32[tp >> 2] = now / 1e3 | 0;
|
|
HEAP32[tp + 4 >> 2] = now % 1e3 * 1e3 * 1e3 | 0;
|
|
return 0
|
|
}
|
|
|
|
function _difftime(time1, time0) {
|
|
return time1 - time0
|
|
}
|
|
|
|
function _dlclose(handle) {}
|
|
|
|
function _dlerror() {
|
|
return 0
|
|
}
|
|
|
|
function _dlopen(filename, flag) {}
|
|
|
|
function _dlsym(handle, symbol) {
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_main_loop_timing(mode, value) {
|
|
Browser.mainLoop.timingMode = mode;
|
|
Browser.mainLoop.timingValue = value;
|
|
if (!Browser.mainLoop.func) {
|
|
return 1
|
|
}
|
|
if (mode == 0) {
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
|
|
var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now()) | 0;
|
|
setTimeout(Browser.mainLoop.runner, timeUntilNextTick)
|
|
};
|
|
Browser.mainLoop.method = "timeout"
|
|
} else if (mode == 1) {
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
|
|
Browser.requestAnimationFrame(Browser.mainLoop.runner)
|
|
};
|
|
Browser.mainLoop.method = "rAF"
|
|
} else if (mode == 2) {
|
|
if (typeof setImmediate === "undefined") {
|
|
var setImmediates = [];
|
|
var emscriptenMainLoopMessageId = "setimmediate";
|
|
|
|
function Browser_setImmediate_messageHandler(event) {
|
|
if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
|
|
event.stopPropagation();
|
|
setImmediates.shift()()
|
|
}
|
|
}
|
|
addEventListener("message", Browser_setImmediate_messageHandler, true);
|
|
setImmediate = function Browser_emulated_setImmediate(func) {
|
|
setImmediates.push(func);
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
if (Module["setImmediates"] === undefined) Module["setImmediates"] = [];
|
|
Module["setImmediates"].push(func);
|
|
postMessage({
|
|
target: emscriptenMainLoopMessageId
|
|
})
|
|
} else postMessage(emscriptenMainLoopMessageId, "*")
|
|
}
|
|
}
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
|
|
setImmediate(Browser.mainLoop.runner)
|
|
};
|
|
Browser.mainLoop.method = "immediate"
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
|
|
Module["noExitRuntime"] = true;
|
|
assert(!Browser.mainLoop.func, "emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");
|
|
Browser.mainLoop.func = func;
|
|
Browser.mainLoop.arg = arg;
|
|
var browserIterationFunc;
|
|
if (typeof arg !== "undefined") {
|
|
browserIterationFunc = (function() {
|
|
Module["dynCall_vi"](func, arg)
|
|
})
|
|
} else {
|
|
browserIterationFunc = (function() {
|
|
Module["dynCall_v"](func)
|
|
})
|
|
}
|
|
var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
|
|
Browser.mainLoop.runner = function Browser_mainLoop_runner() {
|
|
if (ABORT) return;
|
|
if (Browser.mainLoop.queue.length > 0) {
|
|
var start = Date.now();
|
|
var blocker = Browser.mainLoop.queue.shift();
|
|
blocker.func(blocker.arg);
|
|
if (Browser.mainLoop.remainingBlockers) {
|
|
var remaining = Browser.mainLoop.remainingBlockers;
|
|
var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining);
|
|
if (blocker.counted) {
|
|
Browser.mainLoop.remainingBlockers = next
|
|
} else {
|
|
next = next + .5;
|
|
Browser.mainLoop.remainingBlockers = (8 * remaining + next) / 9
|
|
}
|
|
}
|
|
console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + " ms");
|
|
Browser.mainLoop.updateStatus();
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
setTimeout(Browser.mainLoop.runner, 0);
|
|
return
|
|
}
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
|
|
if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
|
|
Browser.mainLoop.scheduler();
|
|
return
|
|
} else if (Browser.mainLoop.timingMode == 0) {
|
|
Browser.mainLoop.tickStartTime = _emscripten_get_now()
|
|
}
|
|
if (Browser.mainLoop.method === "timeout" && Module.ctx) {
|
|
err("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!");
|
|
Browser.mainLoop.method = ""
|
|
}
|
|
Browser.mainLoop.runIter(browserIterationFunc);
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
if (typeof SDL === "object" && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
|
|
Browser.mainLoop.scheduler()
|
|
};
|
|
if (!noSetTiming) {
|
|
if (fps && fps > 0) _emscripten_set_main_loop_timing(0, 1e3 / fps);
|
|
else _emscripten_set_main_loop_timing(1, 1);
|
|
Browser.mainLoop.scheduler()
|
|
}
|
|
if (simulateInfiniteLoop) {
|
|
throw "SimulateInfiniteLoop"
|
|
}
|
|
}
|
|
var Browser = {
|
|
mainLoop: {
|
|
scheduler: null,
|
|
method: "",
|
|
currentlyRunningMainloop: 0,
|
|
func: null,
|
|
arg: 0,
|
|
timingMode: 0,
|
|
timingValue: 0,
|
|
currentFrameNumber: 0,
|
|
queue: [],
|
|
pause: (function() {
|
|
Browser.mainLoop.scheduler = null;
|
|
Browser.mainLoop.currentlyRunningMainloop++
|
|
}),
|
|
resume: (function() {
|
|
Browser.mainLoop.currentlyRunningMainloop++;
|
|
var timingMode = Browser.mainLoop.timingMode;
|
|
var timingValue = Browser.mainLoop.timingValue;
|
|
var func = Browser.mainLoop.func;
|
|
Browser.mainLoop.func = null;
|
|
_emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true);
|
|
_emscripten_set_main_loop_timing(timingMode, timingValue);
|
|
Browser.mainLoop.scheduler()
|
|
}),
|
|
updateStatus: (function() {
|
|
if (Module["setStatus"]) {
|
|
var message = Module["statusMessage"] || "Please wait...";
|
|
var remaining = Browser.mainLoop.remainingBlockers;
|
|
var expected = Browser.mainLoop.expectedBlockers;
|
|
if (remaining) {
|
|
if (remaining < expected) {
|
|
Module["setStatus"](message + " (" + (expected - remaining) + "/" + expected + ")")
|
|
} else {
|
|
Module["setStatus"](message)
|
|
}
|
|
} else {
|
|
Module["setStatus"]("")
|
|
}
|
|
}
|
|
}),
|
|
runIter: (function(func) {
|
|
if (ABORT) return;
|
|
if (Module["preMainLoop"]) {
|
|
var preRet = Module["preMainLoop"]();
|
|
if (preRet === false) {
|
|
return
|
|
}
|
|
}
|
|
try {
|
|
func()
|
|
} catch (e) {
|
|
if (e instanceof ExitStatus) {
|
|
return
|
|
} else {
|
|
if (e && typeof e === "object" && e.stack) err("exception thrown: " + [e, e.stack]);
|
|
throw e
|
|
}
|
|
}
|
|
if (Module["postMainLoop"]) Module["postMainLoop"]()
|
|
})
|
|
},
|
|
isFullscreen: false,
|
|
pointerLock: false,
|
|
moduleContextCreatedCallbacks: [],
|
|
workers: [],
|
|
init: (function() {
|
|
if (!Module["preloadPlugins"]) Module["preloadPlugins"] = [];
|
|
if (Browser.initted) return;
|
|
Browser.initted = true;
|
|
try {
|
|
new Blob;
|
|
Browser.hasBlobConstructor = true
|
|
} catch (e) {
|
|
Browser.hasBlobConstructor = false;
|
|
console.log("warning: no blob constructor, cannot create blobs with mimetypes")
|
|
}
|
|
Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : !Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null;
|
|
Browser.URLObject = typeof window != "undefined" ? window.URL ? window.URL : window.webkitURL : undefined;
|
|
if (!Module.noImageDecoding && typeof Browser.URLObject === "undefined") {
|
|
console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
|
|
Module.noImageDecoding = true
|
|
}
|
|
var imagePlugin = {};
|
|
imagePlugin["canHandle"] = function imagePlugin_canHandle(name) {
|
|
return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name)
|
|
};
|
|
imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) {
|
|
var b = null;
|
|
if (Browser.hasBlobConstructor) {
|
|
try {
|
|
b = new Blob([byteArray], {
|
|
type: Browser.getMimetype(name)
|
|
});
|
|
if (b.size !== byteArray.length) {
|
|
b = new Blob([(new Uint8Array(byteArray)).buffer], {
|
|
type: Browser.getMimetype(name)
|
|
})
|
|
}
|
|
} catch (e) {
|
|
warnOnce("Blob constructor present but fails: " + e + "; falling back to blob builder")
|
|
}
|
|
}
|
|
if (!b) {
|
|
var bb = new Browser.BlobBuilder;
|
|
bb.append((new Uint8Array(byteArray)).buffer);
|
|
b = bb.getBlob()
|
|
}
|
|
var url = Browser.URLObject.createObjectURL(b);
|
|
var img = new Image;
|
|
img.onload = function img_onload() {
|
|
assert(img.complete, "Image " + name + " could not be decoded");
|
|
var canvas = document.createElement("canvas");
|
|
canvas.width = img.width;
|
|
canvas.height = img.height;
|
|
var ctx = canvas.getContext("2d");
|
|
ctx.drawImage(img, 0, 0);
|
|
Module["preloadedImages"][name] = canvas;
|
|
Browser.URLObject.revokeObjectURL(url);
|
|
if (onload) onload(byteArray)
|
|
};
|
|
img.onerror = function img_onerror(event) {
|
|
console.log("Image " + url + " could not be decoded");
|
|
if (onerror) onerror()
|
|
};
|
|
img.src = url
|
|
};
|
|
Module["preloadPlugins"].push(imagePlugin);
|
|
var audioPlugin = {};
|
|
audioPlugin["canHandle"] = function audioPlugin_canHandle(name) {
|
|
return !Module.noAudioDecoding && name.substr(-4) in {
|
|
".ogg": 1,
|
|
".wav": 1,
|
|
".mp3": 1
|
|
}
|
|
};
|
|
audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) {
|
|
var done = false;
|
|
|
|
function finish(audio) {
|
|
if (done) return;
|
|
done = true;
|
|
Module["preloadedAudios"][name] = audio;
|
|
if (onload) onload(byteArray)
|
|
}
|
|
|
|
function fail() {
|
|
if (done) return;
|
|
done = true;
|
|
Module["preloadedAudios"][name] = new Audio;
|
|
if (onerror) onerror()
|
|
}
|
|
if (Browser.hasBlobConstructor) {
|
|
try {
|
|
var b = new Blob([byteArray], {
|
|
type: Browser.getMimetype(name)
|
|
})
|
|
} catch (e) {
|
|
return fail()
|
|
}
|
|
var url = Browser.URLObject.createObjectURL(b);
|
|
var audio = new Audio;
|
|
audio.addEventListener("canplaythrough", (function() {
|
|
finish(audio)
|
|
}), false);
|
|
audio.onerror = function audio_onerror(event) {
|
|
if (done) return;
|
|
console.log("warning: browser could not fully decode audio " + name + ", trying slower base64 approach");
|
|
|
|
function encode64(data) {
|
|
var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
|
|
var PAD = "=";
|
|
var ret = "";
|
|
var leftchar = 0;
|
|
var leftbits = 0;
|
|
for (var i = 0; i < data.length; i++) {
|
|
leftchar = leftchar << 8 | data[i];
|
|
leftbits += 8;
|
|
while (leftbits >= 6) {
|
|
var curr = leftchar >> leftbits - 6 & 63;
|
|
leftbits -= 6;
|
|
ret += BASE[curr]
|
|
}
|
|
}
|
|
if (leftbits == 2) {
|
|
ret += BASE[(leftchar & 3) << 4];
|
|
ret += PAD + PAD
|
|
} else if (leftbits == 4) {
|
|
ret += BASE[(leftchar & 15) << 2];
|
|
ret += PAD
|
|
}
|
|
return ret
|
|
}
|
|
audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray);
|
|
finish(audio)
|
|
};
|
|
audio.src = url;
|
|
Browser.safeSetTimeout((function() {
|
|
finish(audio)
|
|
}), 1e4)
|
|
} else {
|
|
return fail()
|
|
}
|
|
};
|
|
Module["preloadPlugins"].push(audioPlugin);
|
|
|
|
function pointerLockChange() {
|
|
Browser.pointerLock = document["pointerLockElement"] === Module["canvas"] || document["mozPointerLockElement"] === Module["canvas"] || document["webkitPointerLockElement"] === Module["canvas"] || document["msPointerLockElement"] === Module["canvas"]
|
|
}
|
|
var canvas = Module["canvas"];
|
|
if (canvas) {
|
|
canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || (function() {});
|
|
canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || (function() {});
|
|
canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
|
|
document.addEventListener("pointerlockchange", pointerLockChange, false);
|
|
document.addEventListener("mozpointerlockchange", pointerLockChange, false);
|
|
document.addEventListener("webkitpointerlockchange", pointerLockChange, false);
|
|
document.addEventListener("mspointerlockchange", pointerLockChange, false);
|
|
if (Module["elementPointerLock"]) {
|
|
canvas.addEventListener("click", (function(ev) {
|
|
if (!Browser.pointerLock && Module["canvas"].requestPointerLock) {
|
|
Module["canvas"].requestPointerLock();
|
|
ev.preventDefault()
|
|
}
|
|
}), false)
|
|
}
|
|
}
|
|
}),
|
|
createContext: (function(canvas, useWebGL, setInModule, webGLContextAttributes) {
|
|
if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx;
|
|
var ctx;
|
|
var contextHandle;
|
|
if (useWebGL) {
|
|
var contextAttributes = {
|
|
antialias: false,
|
|
alpha: false
|
|
};
|
|
if (webGLContextAttributes) {
|
|
for (var attribute in webGLContextAttributes) {
|
|
contextAttributes[attribute] = webGLContextAttributes[attribute]
|
|
}
|
|
}
|
|
contextHandle = GL.createContext(canvas, contextAttributes);
|
|
if (contextHandle) {
|
|
ctx = GL.getContext(contextHandle).GLctx
|
|
}
|
|
} else {
|
|
ctx = canvas.getContext("2d")
|
|
}
|
|
if (!ctx) return null;
|
|
if (setInModule) {
|
|
if (!useWebGL) assert(typeof GLctx === "undefined", "cannot set in module if GLctx is used, but we are a non-GL context that would replace it");
|
|
Module.ctx = ctx;
|
|
if (useWebGL) GL.makeContextCurrent(contextHandle);
|
|
Module.useWebGL = useWebGL;
|
|
Browser.moduleContextCreatedCallbacks.forEach((function(callback) {
|
|
callback()
|
|
}));
|
|
Browser.init()
|
|
}
|
|
return ctx
|
|
}),
|
|
destroyContext: (function(canvas, useWebGL, setInModule) {}),
|
|
fullscreenHandlersInstalled: false,
|
|
lockPointer: undefined,
|
|
resizeCanvas: undefined,
|
|
requestFullscreen: (function(lockPointer, resizeCanvas, vrDevice) {
|
|
Browser.lockPointer = lockPointer;
|
|
Browser.resizeCanvas = resizeCanvas;
|
|
Browser.vrDevice = vrDevice;
|
|
if (typeof Browser.lockPointer === "undefined") Browser.lockPointer = true;
|
|
if (typeof Browser.resizeCanvas === "undefined") Browser.resizeCanvas = false;
|
|
if (typeof Browser.vrDevice === "undefined") Browser.vrDevice = null;
|
|
var canvas = Module["canvas"];
|
|
|
|
function fullscreenChange() {
|
|
Browser.isFullscreen = false;
|
|
var canvasContainer = canvas.parentNode;
|
|
if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) {
|
|
canvas.exitFullscreen = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || (function() {});
|
|
canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
|
|
if (Browser.lockPointer) canvas.requestPointerLock();
|
|
Browser.isFullscreen = true;
|
|
if (Browser.resizeCanvas) {
|
|
Browser.setFullscreenCanvasSize()
|
|
} else {
|
|
Browser.updateCanvasDimensions(canvas)
|
|
}
|
|
} else {
|
|
canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
|
|
canvasContainer.parentNode.removeChild(canvasContainer);
|
|
if (Browser.resizeCanvas) {
|
|
Browser.setWindowedCanvasSize()
|
|
} else {
|
|
Browser.updateCanvasDimensions(canvas)
|
|
}
|
|
}
|
|
if (Module["onFullScreen"]) Module["onFullScreen"](Browser.isFullscreen);
|
|
if (Module["onFullscreen"]) Module["onFullscreen"](Browser.isFullscreen)
|
|
}
|
|
if (!Browser.fullscreenHandlersInstalled) {
|
|
Browser.fullscreenHandlersInstalled = true;
|
|
document.addEventListener("fullscreenchange", fullscreenChange, false);
|
|
document.addEventListener("mozfullscreenchange", fullscreenChange, false);
|
|
document.addEventListener("webkitfullscreenchange", fullscreenChange, false);
|
|
document.addEventListener("MSFullscreenChange", fullscreenChange, false)
|
|
}
|
|
var canvasContainer = document.createElement("div");
|
|
canvas.parentNode.insertBefore(canvasContainer, canvas);
|
|
canvasContainer.appendChild(canvas);
|
|
canvasContainer.requestFullscreen = canvasContainer["requestFullscreen"] || canvasContainer["mozRequestFullScreen"] || canvasContainer["msRequestFullscreen"] || (canvasContainer["webkitRequestFullscreen"] ? (function() {
|
|
canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"])
|
|
}) : null) || (canvasContainer["webkitRequestFullScreen"] ? (function() {
|
|
canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"])
|
|
}) : null);
|
|
if (vrDevice) {
|
|
canvasContainer.requestFullscreen({
|
|
vrDisplay: vrDevice
|
|
})
|
|
} else {
|
|
canvasContainer.requestFullscreen()
|
|
}
|
|
}),
|
|
requestFullScreen: (function(lockPointer, resizeCanvas, vrDevice) {
|
|
err("Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.");
|
|
Browser.requestFullScreen = (function(lockPointer, resizeCanvas, vrDevice) {
|
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice)
|
|
});
|
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice)
|
|
}),
|
|
nextRAF: 0,
|
|
fakeRequestAnimationFrame: (function(func) {
|
|
var now = Date.now();
|
|
if (Browser.nextRAF === 0) {
|
|
Browser.nextRAF = now + 1e3 / 60
|
|
} else {
|
|
while (now + 2 >= Browser.nextRAF) {
|
|
Browser.nextRAF += 1e3 / 60
|
|
}
|
|
}
|
|
var delay = Math.max(Browser.nextRAF - now, 0);
|
|
setTimeout(func, delay)
|
|
}),
|
|
requestAnimationFrame: function requestAnimationFrame(func) {
|
|
if (typeof window === "undefined") {
|
|
Browser.fakeRequestAnimationFrame(func)
|
|
} else {
|
|
if (!window.requestAnimationFrame) {
|
|
window.requestAnimationFrame = window["requestAnimationFrame"] || window["mozRequestAnimationFrame"] || window["webkitRequestAnimationFrame"] || window["msRequestAnimationFrame"] || window["oRequestAnimationFrame"] || Browser.fakeRequestAnimationFrame
|
|
}
|
|
window.requestAnimationFrame(func)
|
|
}
|
|
},
|
|
safeCallback: (function(func) {
|
|
return (function() {
|
|
if (!ABORT) return func.apply(null, arguments)
|
|
})
|
|
}),
|
|
allowAsyncCallbacks: true,
|
|
queuedAsyncCallbacks: [],
|
|
pauseAsyncCallbacks: (function() {
|
|
Browser.allowAsyncCallbacks = false
|
|
}),
|
|
resumeAsyncCallbacks: (function() {
|
|
Browser.allowAsyncCallbacks = true;
|
|
if (Browser.queuedAsyncCallbacks.length > 0) {
|
|
var callbacks = Browser.queuedAsyncCallbacks;
|
|
Browser.queuedAsyncCallbacks = [];
|
|
callbacks.forEach((function(func) {
|
|
func()
|
|
}))
|
|
}
|
|
}),
|
|
safeRequestAnimationFrame: (function(func) {
|
|
return Browser.requestAnimationFrame((function() {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func()
|
|
} else {
|
|
Browser.queuedAsyncCallbacks.push(func)
|
|
}
|
|
}))
|
|
}),
|
|
safeSetTimeout: (function(func, timeout) {
|
|
Module["noExitRuntime"] = true;
|
|
return setTimeout((function() {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func()
|
|
} else {
|
|
Browser.queuedAsyncCallbacks.push(func)
|
|
}
|
|
}), timeout)
|
|
}),
|
|
safeSetInterval: (function(func, timeout) {
|
|
Module["noExitRuntime"] = true;
|
|
return setInterval((function() {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func()
|
|
}
|
|
}), timeout)
|
|
}),
|
|
getMimetype: (function(name) {
|
|
return {
|
|
"jpg": "image/jpeg",
|
|
"jpeg": "image/jpeg",
|
|
"png": "image/png",
|
|
"bmp": "image/bmp",
|
|
"ogg": "audio/ogg",
|
|
"wav": "audio/wav",
|
|
"mp3": "audio/mpeg"
|
|
}[name.substr(name.lastIndexOf(".") + 1)]
|
|
}),
|
|
getUserMedia: (function(func) {
|
|
if (!window.getUserMedia) {
|
|
window.getUserMedia = navigator["getUserMedia"] || navigator["mozGetUserMedia"]
|
|
}
|
|
window.getUserMedia(func)
|
|
}),
|
|
getMovementX: (function(event) {
|
|
return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0
|
|
}),
|
|
getMovementY: (function(event) {
|
|
return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0
|
|
}),
|
|
getMouseWheelDelta: (function(event) {
|
|
var delta = 0;
|
|
switch (event.type) {
|
|
case "DOMMouseScroll":
|
|
delta = event.detail;
|
|
break;
|
|
case "mousewheel":
|
|
delta = event.wheelDelta;
|
|
break;
|
|
case "wheel":
|
|
delta = event["deltaY"];
|
|
break;
|
|
default:
|
|
throw "unrecognized mouse wheel event: " + event.type
|
|
}
|
|
return delta
|
|
}),
|
|
mouseX: 0,
|
|
mouseY: 0,
|
|
mouseMovementX: 0,
|
|
mouseMovementY: 0,
|
|
touches: {},
|
|
lastTouches: {},
|
|
calculateMouseEvent: (function(event) {
|
|
if (Browser.pointerLock) {
|
|
if (event.type != "mousemove" && "mozMovementX" in event) {
|
|
Browser.mouseMovementX = Browser.mouseMovementY = 0
|
|
} else {
|
|
Browser.mouseMovementX = Browser.getMovementX(event);
|
|
Browser.mouseMovementY = Browser.getMovementY(event)
|
|
}
|
|
if (typeof SDL != "undefined") {
|
|
Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
|
|
Browser.mouseY = SDL.mouseY + Browser.mouseMovementY
|
|
} else {
|
|
Browser.mouseX += Browser.mouseMovementX;
|
|
Browser.mouseY += Browser.mouseMovementY
|
|
}
|
|
} else {
|
|
var rect = Module["canvas"].getBoundingClientRect();
|
|
var cw = Module["canvas"].width;
|
|
var ch = Module["canvas"].height;
|
|
var scrollX = typeof window.scrollX !== "undefined" ? window.scrollX : window.pageXOffset;
|
|
var scrollY = typeof window.scrollY !== "undefined" ? window.scrollY : window.pageYOffset;
|
|
if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") {
|
|
var touch = event.touch;
|
|
if (touch === undefined) {
|
|
return
|
|
}
|
|
var adjustedX = touch.pageX - (scrollX + rect.left);
|
|
var adjustedY = touch.pageY - (scrollY + rect.top);
|
|
adjustedX = adjustedX * (cw / rect.width);
|
|
adjustedY = adjustedY * (ch / rect.height);
|
|
var coords = {
|
|
x: adjustedX,
|
|
y: adjustedY
|
|
};
|
|
if (event.type === "touchstart") {
|
|
Browser.lastTouches[touch.identifier] = coords;
|
|
Browser.touches[touch.identifier] = coords
|
|
} else if (event.type === "touchend" || event.type === "touchmove") {
|
|
var last = Browser.touches[touch.identifier];
|
|
if (!last) last = coords;
|
|
Browser.lastTouches[touch.identifier] = last;
|
|
Browser.touches[touch.identifier] = coords
|
|
}
|
|
return
|
|
}
|
|
var x = event.pageX - (scrollX + rect.left);
|
|
var y = event.pageY - (scrollY + rect.top);
|
|
x = x * (cw / rect.width);
|
|
y = y * (ch / rect.height);
|
|
Browser.mouseMovementX = x - Browser.mouseX;
|
|
Browser.mouseMovementY = y - Browser.mouseY;
|
|
Browser.mouseX = x;
|
|
Browser.mouseY = y
|
|
}
|
|
}),
|
|
asyncLoad: (function(url, onload, onerror, noRunDep) {
|
|
var dep = !noRunDep ? getUniqueRunDependency("al " + url) : "";
|
|
Module["readAsync"](url, (function(arrayBuffer) {
|
|
assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
|
|
onload(new Uint8Array(arrayBuffer));
|
|
if (dep) removeRunDependency(dep)
|
|
}), (function(event) {
|
|
if (onerror) {
|
|
onerror()
|
|
} else {
|
|
throw 'Loading data file "' + url + '" failed.'
|
|
}
|
|
}));
|
|
if (dep) addRunDependency(dep)
|
|
}),
|
|
resizeListeners: [],
|
|
updateResizeListeners: (function() {
|
|
var canvas = Module["canvas"];
|
|
Browser.resizeListeners.forEach((function(listener) {
|
|
listener(canvas.width, canvas.height)
|
|
}))
|
|
}),
|
|
setCanvasSize: (function(width, height, noUpdates) {
|
|
var canvas = Module["canvas"];
|
|
Browser.updateCanvasDimensions(canvas, width, height);
|
|
if (!noUpdates) Browser.updateResizeListeners()
|
|
}),
|
|
windowedWidth: 0,
|
|
windowedHeight: 0,
|
|
setFullscreenCanvasSize: (function() {
|
|
if (typeof SDL != "undefined") {
|
|
var flags = HEAPU32[SDL.screen >> 2];
|
|
flags = flags | 8388608;
|
|
HEAP32[SDL.screen >> 2] = flags
|
|
}
|
|
Browser.updateCanvasDimensions(Module["canvas"]);
|
|
Browser.updateResizeListeners()
|
|
}),
|
|
setWindowedCanvasSize: (function() {
|
|
if (typeof SDL != "undefined") {
|
|
var flags = HEAPU32[SDL.screen >> 2];
|
|
flags = flags & ~8388608;
|
|
HEAP32[SDL.screen >> 2] = flags
|
|
}
|
|
Browser.updateCanvasDimensions(Module["canvas"]);
|
|
Browser.updateResizeListeners()
|
|
}),
|
|
updateCanvasDimensions: (function(canvas, wNative, hNative) {
|
|
if (wNative && hNative) {
|
|
canvas.widthNative = wNative;
|
|
canvas.heightNative = hNative
|
|
} else {
|
|
wNative = canvas.widthNative;
|
|
hNative = canvas.heightNative
|
|
}
|
|
var w = wNative;
|
|
var h = hNative;
|
|
if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) {
|
|
if (w / h < Module["forcedAspectRatio"]) {
|
|
w = Math.round(h * Module["forcedAspectRatio"])
|
|
} else {
|
|
h = Math.round(w / Module["forcedAspectRatio"])
|
|
}
|
|
}
|
|
if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode && typeof screen != "undefined") {
|
|
var factor = Math.min(screen.width / w, screen.height / h);
|
|
w = Math.round(w * factor);
|
|
h = Math.round(h * factor)
|
|
}
|
|
if (Browser.resizeCanvas) {
|
|
if (canvas.width != w) canvas.width = w;
|
|
if (canvas.height != h) canvas.height = h;
|
|
if (typeof canvas.style != "undefined") {
|
|
canvas.style.removeProperty("width");
|
|
canvas.style.removeProperty("height")
|
|
}
|
|
} else {
|
|
if (canvas.width != wNative) canvas.width = wNative;
|
|
if (canvas.height != hNative) canvas.height = hNative;
|
|
if (typeof canvas.style != "undefined") {
|
|
if (w != wNative || h != hNative) {
|
|
canvas.style.setProperty("width", w + "px", "important");
|
|
canvas.style.setProperty("height", h + "px", "important")
|
|
} else {
|
|
canvas.style.removeProperty("width");
|
|
canvas.style.removeProperty("height")
|
|
}
|
|
}
|
|
}
|
|
}),
|
|
wgetRequests: {},
|
|
nextWgetRequestHandle: 0,
|
|
getNextWgetRequestHandle: (function() {
|
|
var handle = Browser.nextWgetRequestHandle;
|
|
Browser.nextWgetRequestHandle++;
|
|
return handle
|
|
})
|
|
};
|
|
|
|
function _emscripten_cancel_main_loop() {
|
|
Browser.mainLoop.pause();
|
|
Browser.mainLoop.func = null
|
|
}
|
|
|
|
function _emscripten_set_canvas_element_size_calling_thread(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (!canvas) return -4;
|
|
if (canvas.canvasSharedPtr) {
|
|
HEAP32[canvas.canvasSharedPtr >> 2] = width;
|
|
HEAP32[canvas.canvasSharedPtr + 4 >> 2] = height
|
|
}
|
|
if (canvas.offscreenCanvas || !canvas.controlTransferredOffscreen) {
|
|
if (canvas.offscreenCanvas) canvas = canvas.offscreenCanvas;
|
|
var autoResizeViewport = false;
|
|
if (canvas.GLctxObject && canvas.GLctxObject.GLctx) {
|
|
var prevViewport = canvas.GLctxObject.GLctx.getParameter(canvas.GLctxObject.GLctx.VIEWPORT);
|
|
autoResizeViewport = prevViewport[0] === 0 && prevViewport[1] === 0 && prevViewport[2] === canvas.width && prevViewport[3] === canvas.height
|
|
}
|
|
canvas.width = width;
|
|
canvas.height = height;
|
|
if (autoResizeViewport) {
|
|
canvas.GLctxObject.GLctx.viewport(0, 0, width, height)
|
|
}
|
|
} else {
|
|
return -4
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_canvas_element_size_main_thread(target, width, height) {
|
|
return _emscripten_set_canvas_element_size_calling_thread(target, width, height)
|
|
}
|
|
|
|
function _emscripten_set_canvas_element_size(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (canvas) return _emscripten_set_canvas_element_size_calling_thread(target, width, height);
|
|
else return _emscripten_set_canvas_element_size_main_thread(target, width, height)
|
|
}
|
|
|
|
function emscripten_set_canvas_element_size_js(target, width, height) {
|
|
if (typeof target === "string") {
|
|
var stackTop = stackSave();
|
|
var targetInt = stackAlloc(target.length + 1);
|
|
stringToUTF8(target, targetInt, target.length + 1);
|
|
var ret = _emscripten_set_canvas_element_size(targetInt, width, height);
|
|
stackRestore(stackTop);
|
|
return ret
|
|
} else {
|
|
return _emscripten_set_canvas_element_size(target, width, height)
|
|
}
|
|
}
|
|
|
|
function _emscripten_get_canvas_element_size_calling_thread(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (!canvas) return -4;
|
|
if (canvas.canvasSharedPtr) {
|
|
var w = HEAP32[canvas.canvasSharedPtr >> 2];
|
|
var h = HEAP32[canvas.canvasSharedPtr + 4 >> 2];
|
|
HEAP32[width >> 2] = w;
|
|
HEAP32[height >> 2] = h
|
|
} else if (canvas.offscreenCanvas) {
|
|
HEAP32[width >> 2] = canvas.offscreenCanvas.width;
|
|
HEAP32[height >> 2] = canvas.offscreenCanvas.height
|
|
} else if (!canvas.controlTransferredOffscreen) {
|
|
HEAP32[width >> 2] = canvas.width;
|
|
HEAP32[height >> 2] = canvas.height
|
|
} else {
|
|
return -4
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_get_canvas_element_size_main_thread(target, width, height) {
|
|
return _emscripten_get_canvas_element_size_calling_thread(target, width, height)
|
|
}
|
|
|
|
function _emscripten_get_canvas_element_size(target, width, height) {
|
|
var canvas = JSEvents.findCanvasEventTarget(target);
|
|
if (canvas) return _emscripten_get_canvas_element_size_calling_thread(target, width, height);
|
|
else return _emscripten_get_canvas_element_size_main_thread(target, width, height)
|
|
}
|
|
|
|
function emscripten_get_canvas_element_size_js(target) {
|
|
var stackTop = stackSave();
|
|
var w = stackAlloc(8);
|
|
var h = w + 4;
|
|
if (typeof target === "string") {
|
|
var targetInt = stackAlloc(target.length + 1);
|
|
stringToUTF8(target, targetInt, target.length + 1);
|
|
target = targetInt
|
|
}
|
|
var ret = _emscripten_get_canvas_element_size(target, w, h);
|
|
var size = [HEAP32[w >> 2], HEAP32[h >> 2]];
|
|
stackRestore(stackTop);
|
|
return size
|
|
}
|
|
var JSEvents = {
|
|
keyEvent: 0,
|
|
mouseEvent: 0,
|
|
wheelEvent: 0,
|
|
uiEvent: 0,
|
|
focusEvent: 0,
|
|
deviceOrientationEvent: 0,
|
|
deviceMotionEvent: 0,
|
|
fullscreenChangeEvent: 0,
|
|
pointerlockChangeEvent: 0,
|
|
visibilityChangeEvent: 0,
|
|
touchEvent: 0,
|
|
lastGamepadState: null,
|
|
lastGamepadStateFrame: null,
|
|
numGamepadsConnected: 0,
|
|
previousFullscreenElement: null,
|
|
previousScreenX: null,
|
|
previousScreenY: null,
|
|
removeEventListenersRegistered: false,
|
|
_onGamepadConnected: (function() {
|
|
++JSEvents.numGamepadsConnected
|
|
}),
|
|
_onGamepadDisconnected: (function() {
|
|
--JSEvents.numGamepadsConnected
|
|
}),
|
|
staticInit: (function() {
|
|
if (typeof window !== "undefined") {
|
|
window.addEventListener("gamepadconnected", JSEvents._onGamepadConnected);
|
|
window.addEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected);
|
|
var firstState = navigator.getGamepads ? navigator.getGamepads() : navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null;
|
|
if (firstState) {
|
|
JSEvents.numGamepadsConnected = firstState.length
|
|
}
|
|
}
|
|
}),
|
|
removeAllEventListeners: (function() {
|
|
for (var i = JSEvents.eventHandlers.length - 1; i >= 0; --i) {
|
|
JSEvents._removeHandler(i)
|
|
}
|
|
JSEvents.eventHandlers = [];
|
|
JSEvents.deferredCalls = [];
|
|
window.removeEventListener("gamepadconnected", JSEvents._onGamepadConnected);
|
|
window.removeEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected)
|
|
}),
|
|
registerRemoveEventListeners: (function() {
|
|
if (!JSEvents.removeEventListenersRegistered) {
|
|
__ATEXIT__.push(JSEvents.removeAllEventListeners);
|
|
JSEvents.removeEventListenersRegistered = true
|
|
}
|
|
}),
|
|
findEventTarget: (function(target) {
|
|
try {
|
|
if (!target) return window;
|
|
if (typeof target === "number") target = Pointer_stringify(target);
|
|
if (target === "#window") return window;
|
|
else if (target === "#document") return document;
|
|
else if (target === "#screen") return window.screen;
|
|
else if (target === "#canvas") return Module["canvas"];
|
|
return typeof target === "string" ? document.getElementById(target) : target
|
|
} catch (e) {
|
|
return null
|
|
}
|
|
}),
|
|
findCanvasEventTarget: (function(target) {
|
|
if (typeof target === "number") target = Pointer_stringify(target);
|
|
if (!target || target === "#canvas") {
|
|
if (typeof GL !== "undefined" && GL.offscreenCanvases["canvas"]) return GL.offscreenCanvases["canvas"];
|
|
return Module["canvas"]
|
|
}
|
|
if (typeof GL !== "undefined" && GL.offscreenCanvases[target]) return GL.offscreenCanvases[target];
|
|
return JSEvents.findEventTarget(target)
|
|
}),
|
|
deferredCalls: [],
|
|
deferCall: (function(targetFunction, precedence, argsList) {
|
|
function arraysHaveEqualContent(arrA, arrB) {
|
|
if (arrA.length != arrB.length) return false;
|
|
for (var i in arrA) {
|
|
if (arrA[i] != arrB[i]) return false
|
|
}
|
|
return true
|
|
}
|
|
for (var i in JSEvents.deferredCalls) {
|
|
var call = JSEvents.deferredCalls[i];
|
|
if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
|
|
return
|
|
}
|
|
}
|
|
JSEvents.deferredCalls.push({
|
|
targetFunction: targetFunction,
|
|
precedence: precedence,
|
|
argsList: argsList
|
|
});
|
|
JSEvents.deferredCalls.sort((function(x, y) {
|
|
return x.precedence < y.precedence
|
|
}))
|
|
}),
|
|
removeDeferredCalls: (function(targetFunction) {
|
|
for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
|
|
if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
|
|
JSEvents.deferredCalls.splice(i, 1);
|
|
--i
|
|
}
|
|
}
|
|
}),
|
|
canPerformEventHandlerRequests: (function() {
|
|
return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls
|
|
}),
|
|
runDeferredCalls: (function() {
|
|
if (!JSEvents.canPerformEventHandlerRequests()) {
|
|
return
|
|
}
|
|
for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
|
|
var call = JSEvents.deferredCalls[i];
|
|
JSEvents.deferredCalls.splice(i, 1);
|
|
--i;
|
|
call.targetFunction.apply(this, call.argsList)
|
|
}
|
|
}),
|
|
inEventHandler: 0,
|
|
currentEventHandler: null,
|
|
eventHandlers: [],
|
|
isInternetExplorer: (function() {
|
|
return navigator.userAgent.indexOf("MSIE") !== -1 || navigator.appVersion.indexOf("Trident/") > 0
|
|
}),
|
|
removeAllHandlersOnTarget: (function(target, eventTypeString) {
|
|
for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
|
|
if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
|
|
JSEvents._removeHandler(i--)
|
|
}
|
|
}
|
|
}),
|
|
_removeHandler: (function(i) {
|
|
var h = JSEvents.eventHandlers[i];
|
|
h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
|
|
JSEvents.eventHandlers.splice(i, 1)
|
|
}),
|
|
registerOrRemoveHandler: (function(eventHandler) {
|
|
var jsEventHandler = function jsEventHandler(event) {
|
|
++JSEvents.inEventHandler;
|
|
JSEvents.currentEventHandler = eventHandler;
|
|
JSEvents.runDeferredCalls();
|
|
eventHandler.handlerFunc(event);
|
|
JSEvents.runDeferredCalls();
|
|
--JSEvents.inEventHandler
|
|
};
|
|
if (eventHandler.callbackfunc) {
|
|
eventHandler.eventListenerFunc = jsEventHandler;
|
|
eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
|
|
JSEvents.eventHandlers.push(eventHandler);
|
|
JSEvents.registerRemoveEventListeners()
|
|
} else {
|
|
for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
|
|
if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
|
|
JSEvents._removeHandler(i--)
|
|
}
|
|
}
|
|
}
|
|
}),
|
|
registerKeyEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc(164);
|
|
var keyEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var keyEventData = JSEvents.keyEvent;
|
|
stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32);
|
|
stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32);
|
|
HEAP32[keyEventData + 64 >> 2] = e.location;
|
|
HEAP32[keyEventData + 68 >> 2] = e.ctrlKey;
|
|
HEAP32[keyEventData + 72 >> 2] = e.shiftKey;
|
|
HEAP32[keyEventData + 76 >> 2] = e.altKey;
|
|
HEAP32[keyEventData + 80 >> 2] = e.metaKey;
|
|
HEAP32[keyEventData + 84 >> 2] = e.repeat;
|
|
stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32);
|
|
stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32);
|
|
HEAP32[keyEventData + 152 >> 2] = e.charCode;
|
|
HEAP32[keyEventData + 156 >> 2] = e.keyCode;
|
|
HEAP32[keyEventData + 160 >> 2] = e.which;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: keyEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
getBoundingClientRectOrZeros: (function(target) {
|
|
return target.getBoundingClientRect ? target.getBoundingClientRect() : {
|
|
left: 0,
|
|
top: 0
|
|
}
|
|
}),
|
|
fillMouseEventData: (function(eventStruct, e, target) {
|
|
HEAPF64[eventStruct >> 3] = JSEvents.tick();
|
|
HEAP32[eventStruct + 8 >> 2] = e.screenX;
|
|
HEAP32[eventStruct + 12 >> 2] = e.screenY;
|
|
HEAP32[eventStruct + 16 >> 2] = e.clientX;
|
|
HEAP32[eventStruct + 20 >> 2] = e.clientY;
|
|
HEAP32[eventStruct + 24 >> 2] = e.ctrlKey;
|
|
HEAP32[eventStruct + 28 >> 2] = e.shiftKey;
|
|
HEAP32[eventStruct + 32 >> 2] = e.altKey;
|
|
HEAP32[eventStruct + 36 >> 2] = e.metaKey;
|
|
HEAP16[eventStruct + 40 >> 1] = e.button;
|
|
HEAP16[eventStruct + 42 >> 1] = e.buttons;
|
|
HEAP32[eventStruct + 44 >> 2] = e["movementX"];
|
|
HEAP32[eventStruct + 48 >> 2] = e["movementY"];
|
|
if (Module["canvas"]) {
|
|
var rect = Module["canvas"].getBoundingClientRect();
|
|
HEAP32[eventStruct + 60 >> 2] = e.clientX - rect.left;
|
|
HEAP32[eventStruct + 64 >> 2] = e.clientY - rect.top
|
|
} else {
|
|
HEAP32[eventStruct + 60 >> 2] = 0;
|
|
HEAP32[eventStruct + 64 >> 2] = 0
|
|
}
|
|
if (target) {
|
|
var rect = JSEvents.getBoundingClientRectOrZeros(target);
|
|
HEAP32[eventStruct + 52 >> 2] = e.clientX - rect.left;
|
|
HEAP32[eventStruct + 56 >> 2] = e.clientY - rect.top
|
|
} else {
|
|
HEAP32[eventStruct + 52 >> 2] = 0;
|
|
HEAP32[eventStruct + 56 >> 2] = 0
|
|
}
|
|
if (e.type !== "wheel" && e.type !== "mousewheel") {
|
|
JSEvents.previousScreenX = e.screenX;
|
|
JSEvents.previousScreenY = e.screenY
|
|
}
|
|
}),
|
|
registerMouseEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc(72);
|
|
target = JSEvents.findEventTarget(target);
|
|
var mouseEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: eventTypeString != "mousemove" && eventTypeString != "mouseenter" && eventTypeString != "mouseleave",
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: mouseEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
if (JSEvents.isInternetExplorer() && eventTypeString == "mousedown") eventHandler.allowsDeferredCalls = false;
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
registerWheelEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc(104);
|
|
target = JSEvents.findEventTarget(target);
|
|
var wheelHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var wheelEvent = JSEvents.wheelEvent;
|
|
JSEvents.fillMouseEventData(wheelEvent, e, target);
|
|
HEAPF64[wheelEvent + 72 >> 3] = e["deltaX"];
|
|
HEAPF64[wheelEvent + 80 >> 3] = e["deltaY"];
|
|
HEAPF64[wheelEvent + 88 >> 3] = e["deltaZ"];
|
|
HEAP32[wheelEvent + 96 >> 2] = e["deltaMode"];
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault()
|
|
});
|
|
var mouseWheelHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
|
|
HEAPF64[JSEvents.wheelEvent + 72 >> 3] = e["wheelDeltaX"] || 0;
|
|
HEAPF64[JSEvents.wheelEvent + 80 >> 3] = -(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]);
|
|
HEAPF64[JSEvents.wheelEvent + 88 >> 3] = 0;
|
|
HEAP32[JSEvents.wheelEvent + 96 >> 2] = 0;
|
|
var shouldCancel = Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault()
|
|
}
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: true,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: eventTypeString == "wheel" ? wheelHandlerFunc : mouseWheelHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
pageScrollPos: (function() {
|
|
if (window.pageXOffset > 0 || window.pageYOffset > 0) {
|
|
return [window.pageXOffset, window.pageYOffset]
|
|
}
|
|
if (typeof document.documentElement.scrollLeft !== "undefined" || typeof document.documentElement.scrollTop !== "undefined") {
|
|
return [document.documentElement.scrollLeft, document.documentElement.scrollTop]
|
|
}
|
|
return [document.body.scrollLeft | 0, document.body.scrollTop | 0]
|
|
}),
|
|
registerUiEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc(36);
|
|
if (eventTypeString == "scroll" && !target) {
|
|
target = document
|
|
} else {
|
|
target = JSEvents.findEventTarget(target)
|
|
}
|
|
var uiEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
if (e.target != target) {
|
|
return
|
|
}
|
|
var scrollPos = JSEvents.pageScrollPos();
|
|
var uiEvent = JSEvents.uiEvent;
|
|
HEAP32[uiEvent >> 2] = e.detail;
|
|
HEAP32[uiEvent + 4 >> 2] = document.body.clientWidth;
|
|
HEAP32[uiEvent + 8 >> 2] = document.body.clientHeight;
|
|
HEAP32[uiEvent + 12 >> 2] = window.innerWidth;
|
|
HEAP32[uiEvent + 16 >> 2] = window.innerHeight;
|
|
HEAP32[uiEvent + 20 >> 2] = window.outerWidth;
|
|
HEAP32[uiEvent + 24 >> 2] = window.outerHeight;
|
|
HEAP32[uiEvent + 28 >> 2] = scrollPos[0];
|
|
HEAP32[uiEvent + 32 >> 2] = scrollPos[1];
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: uiEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
getNodeNameForTarget: (function(target) {
|
|
if (!target) return "";
|
|
if (target == window) return "#window";
|
|
if (target == window.screen) return "#screen";
|
|
return target && target.nodeName ? target.nodeName : ""
|
|
}),
|
|
registerFocusEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc(256);
|
|
var focusEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var nodeName = JSEvents.getNodeNameForTarget(e.target);
|
|
var id = e.target.id ? e.target.id : "";
|
|
var focusEvent = JSEvents.focusEvent;
|
|
stringToUTF8(nodeName, focusEvent + 0, 128);
|
|
stringToUTF8(id, focusEvent + 128, 128);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: focusEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
tick: (function() {
|
|
if (window["performance"] && window["performance"]["now"]) return window["performance"]["now"]();
|
|
else return Date.now()
|
|
}),
|
|
fillDeviceOrientationEventData: (function(eventStruct, e, target) {
|
|
HEAPF64[eventStruct >> 3] = JSEvents.tick();
|
|
HEAPF64[eventStruct + 8 >> 3] = e.alpha;
|
|
HEAPF64[eventStruct + 16 >> 3] = e.beta;
|
|
HEAPF64[eventStruct + 24 >> 3] = e.gamma;
|
|
HEAP32[eventStruct + 32 >> 2] = e.absolute
|
|
}),
|
|
registerDeviceOrientationEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.deviceOrientationEvent) JSEvents.deviceOrientationEvent = _malloc(40);
|
|
var deviceOrientationEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillDeviceOrientationEventData(JSEvents.deviceOrientationEvent, e, target);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: deviceOrientationEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
fillDeviceMotionEventData: (function(eventStruct, e, target) {
|
|
HEAPF64[eventStruct >> 3] = JSEvents.tick();
|
|
HEAPF64[eventStruct + 8 >> 3] = e.acceleration.x;
|
|
HEAPF64[eventStruct + 16 >> 3] = e.acceleration.y;
|
|
HEAPF64[eventStruct + 24 >> 3] = e.acceleration.z;
|
|
HEAPF64[eventStruct + 32 >> 3] = e.accelerationIncludingGravity.x;
|
|
HEAPF64[eventStruct + 40 >> 3] = e.accelerationIncludingGravity.y;
|
|
HEAPF64[eventStruct + 48 >> 3] = e.accelerationIncludingGravity.z;
|
|
HEAPF64[eventStruct + 56 >> 3] = e.rotationRate.alpha;
|
|
HEAPF64[eventStruct + 64 >> 3] = e.rotationRate.beta;
|
|
HEAPF64[eventStruct + 72 >> 3] = e.rotationRate.gamma
|
|
}),
|
|
registerDeviceMotionEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.deviceMotionEvent) JSEvents.deviceMotionEvent = _malloc(80);
|
|
var deviceMotionEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillDeviceMotionEventData(JSEvents.deviceMotionEvent, e, target);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: deviceMotionEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
screenOrientation: (function() {
|
|
if (!window.screen) return undefined;
|
|
return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation
|
|
}),
|
|
fillOrientationChangeEventData: (function(eventStruct, e) {
|
|
var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
|
|
var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
|
|
var orientationString = JSEvents.screenOrientation();
|
|
var orientation = orientations.indexOf(orientationString);
|
|
if (orientation == -1) {
|
|
orientation = orientations2.indexOf(orientationString)
|
|
}
|
|
HEAP32[eventStruct >> 2] = 1 << orientation;
|
|
HEAP32[eventStruct + 4 >> 2] = window.orientation
|
|
}),
|
|
registerOrientationChangeEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.orientationChangeEvent) JSEvents.orientationChangeEvent = _malloc(8);
|
|
if (!target) {
|
|
target = window.screen
|
|
} else {
|
|
target = JSEvents.findEventTarget(target)
|
|
}
|
|
var orientationChangeEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var orientationChangeEvent = JSEvents.orientationChangeEvent;
|
|
JSEvents.fillOrientationChangeEventData(orientationChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, orientationChangeEvent, userData)) e.preventDefault()
|
|
});
|
|
if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
|
|
eventTypeString = "mozorientationchange"
|
|
}
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: orientationChangeEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
fullscreenEnabled: (function() {
|
|
return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled
|
|
}),
|
|
fillFullscreenChangeEventData: (function(eventStruct, e) {
|
|
var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
|
|
var isFullscreen = !!fullscreenElement;
|
|
HEAP32[eventStruct >> 2] = isFullscreen;
|
|
HEAP32[eventStruct + 4 >> 2] = JSEvents.fullscreenEnabled();
|
|
var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
|
|
var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
|
|
var id = reportedElement && reportedElement.id ? reportedElement.id : "";
|
|
stringToUTF8(nodeName, eventStruct + 8, 128);
|
|
stringToUTF8(id, eventStruct + 136, 128);
|
|
HEAP32[eventStruct + 264 >> 2] = reportedElement ? reportedElement.clientWidth : 0;
|
|
HEAP32[eventStruct + 268 >> 2] = reportedElement ? reportedElement.clientHeight : 0;
|
|
HEAP32[eventStruct + 272 >> 2] = screen.width;
|
|
HEAP32[eventStruct + 276 >> 2] = screen.height;
|
|
if (isFullscreen) {
|
|
JSEvents.previousFullscreenElement = fullscreenElement
|
|
}
|
|
}),
|
|
registerFullscreenChangeEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc(280);
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var fullscreenChangeEventhandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent;
|
|
JSEvents.fillFullscreenChangeEventData(fullscreenChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: fullscreenChangeEventhandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
resizeCanvasForFullscreen: (function(target, strategy) {
|
|
var restoreOldStyle = __registerRestoreOldStyle(target);
|
|
var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
|
|
var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
|
|
var rect = target.getBoundingClientRect();
|
|
var windowedCssWidth = rect.right - rect.left;
|
|
var windowedCssHeight = rect.bottom - rect.top;
|
|
var canvasSize = emscripten_get_canvas_element_size_js(target.id);
|
|
var windowedRttWidth = canvasSize[0];
|
|
var windowedRttHeight = canvasSize[1];
|
|
if (strategy.scaleMode == 3) {
|
|
__setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
|
|
cssWidth = windowedCssWidth;
|
|
cssHeight = windowedCssHeight
|
|
} else if (strategy.scaleMode == 2) {
|
|
if (cssWidth * windowedRttHeight < windowedRttWidth * cssHeight) {
|
|
var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
|
|
__setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
|
|
cssHeight = desiredCssHeight
|
|
} else {
|
|
var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
|
|
__setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
|
|
cssWidth = desiredCssWidth
|
|
}
|
|
}
|
|
if (!target.style.backgroundColor) target.style.backgroundColor = "black";
|
|
if (!document.body.style.backgroundColor) document.body.style.backgroundColor = "black";
|
|
target.style.width = cssWidth + "px";
|
|
target.style.height = cssHeight + "px";
|
|
if (strategy.filteringMode == 1) {
|
|
target.style.imageRendering = "optimizeSpeed";
|
|
target.style.imageRendering = "-moz-crisp-edges";
|
|
target.style.imageRendering = "-o-crisp-edges";
|
|
target.style.imageRendering = "-webkit-optimize-contrast";
|
|
target.style.imageRendering = "optimize-contrast";
|
|
target.style.imageRendering = "crisp-edges";
|
|
target.style.imageRendering = "pixelated"
|
|
}
|
|
var dpiScale = strategy.canvasResolutionScaleMode == 2 ? window.devicePixelRatio : 1;
|
|
if (strategy.canvasResolutionScaleMode != 0) {
|
|
var newWidth = cssWidth * dpiScale | 0;
|
|
var newHeight = cssHeight * dpiScale | 0;
|
|
if (!target.controlTransferredOffscreen) {
|
|
target.width = newWidth;
|
|
target.height = newHeight
|
|
} else {
|
|
emscripten_set_canvas_element_size_js(target.id, newWidth, newHeight)
|
|
}
|
|
if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight)
|
|
}
|
|
return restoreOldStyle
|
|
}),
|
|
requestFullscreen: (function(target, strategy) {
|
|
if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
|
|
JSEvents.resizeCanvasForFullscreen(target, strategy)
|
|
}
|
|
if (target.requestFullscreen) {
|
|
target.requestFullscreen()
|
|
} else if (target.msRequestFullscreen) {
|
|
target.msRequestFullscreen()
|
|
} else if (target.mozRequestFullScreen) {
|
|
target.mozRequestFullScreen()
|
|
} else if (target.mozRequestFullscreen) {
|
|
target.mozRequestFullscreen()
|
|
} else if (target.webkitRequestFullscreen) {
|
|
target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT)
|
|
} else {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") {
|
|
return -1
|
|
} else {
|
|
return -3
|
|
}
|
|
}
|
|
if (strategy.canvasResizedCallback) {
|
|
Module["dynCall_iiii"](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData)
|
|
}
|
|
return 0
|
|
}),
|
|
fillPointerlockChangeEventData: (function(eventStruct, e) {
|
|
var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
|
|
var isPointerlocked = !!pointerLockElement;
|
|
HEAP32[eventStruct >> 2] = isPointerlocked;
|
|
var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
|
|
var id = pointerLockElement && pointerLockElement.id ? pointerLockElement.id : "";
|
|
stringToUTF8(nodeName, eventStruct + 4, 128);
|
|
stringToUTF8(id, eventStruct + 132, 128)
|
|
}),
|
|
registerPointerlockChangeEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc(260);
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var pointerlockChangeEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent;
|
|
JSEvents.fillPointerlockChangeEventData(pointerlockChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: pointerlockChangeEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
registerPointerlockErrorEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var pointerlockErrorEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: pointerlockErrorEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
requestPointerLock: (function(target) {
|
|
if (target.requestPointerLock) {
|
|
target.requestPointerLock()
|
|
} else if (target.mozRequestPointerLock) {
|
|
target.mozRequestPointerLock()
|
|
} else if (target.webkitRequestPointerLock) {
|
|
target.webkitRequestPointerLock()
|
|
} else if (target.msRequestPointerLock) {
|
|
target.msRequestPointerLock()
|
|
} else {
|
|
if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
|
|
return -3
|
|
} else {
|
|
return -1
|
|
}
|
|
}
|
|
return 0
|
|
}),
|
|
fillVisibilityChangeEventData: (function(eventStruct, e) {
|
|
var visibilityStates = ["hidden", "visible", "prerender", "unloaded"];
|
|
var visibilityState = visibilityStates.indexOf(document.visibilityState);
|
|
HEAP32[eventStruct >> 2] = document.hidden;
|
|
HEAP32[eventStruct + 4 >> 2] = visibilityState
|
|
}),
|
|
registerVisibilityChangeEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc(8);
|
|
if (!target) target = document;
|
|
else target = JSEvents.findEventTarget(target);
|
|
var visibilityChangeEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var visibilityChangeEvent = JSEvents.visibilityChangeEvent;
|
|
JSEvents.fillVisibilityChangeEventData(visibilityChangeEvent, e);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: visibilityChangeEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
registerTouchEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc(1684);
|
|
target = JSEvents.findEventTarget(target);
|
|
var touchEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var touches = {};
|
|
for (var i = 0; i < e.touches.length; ++i) {
|
|
var touch = e.touches[i];
|
|
touches[touch.identifier] = touch
|
|
}
|
|
for (var i = 0; i < e.changedTouches.length; ++i) {
|
|
var touch = e.changedTouches[i];
|
|
touches[touch.identifier] = touch;
|
|
touch.changed = true
|
|
}
|
|
for (var i = 0; i < e.targetTouches.length; ++i) {
|
|
var touch = e.targetTouches[i];
|
|
touches[touch.identifier].onTarget = true
|
|
}
|
|
var touchEvent = JSEvents.touchEvent;
|
|
var ptr = touchEvent;
|
|
HEAP32[ptr + 4 >> 2] = e.ctrlKey;
|
|
HEAP32[ptr + 8 >> 2] = e.shiftKey;
|
|
HEAP32[ptr + 12 >> 2] = e.altKey;
|
|
HEAP32[ptr + 16 >> 2] = e.metaKey;
|
|
ptr += 20;
|
|
var canvasRect = Module["canvas"] ? Module["canvas"].getBoundingClientRect() : undefined;
|
|
var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
|
|
var numTouches = 0;
|
|
for (var i in touches) {
|
|
var t = touches[i];
|
|
HEAP32[ptr >> 2] = t.identifier;
|
|
HEAP32[ptr + 4 >> 2] = t.screenX;
|
|
HEAP32[ptr + 8 >> 2] = t.screenY;
|
|
HEAP32[ptr + 12 >> 2] = t.clientX;
|
|
HEAP32[ptr + 16 >> 2] = t.clientY;
|
|
HEAP32[ptr + 20 >> 2] = t.pageX;
|
|
HEAP32[ptr + 24 >> 2] = t.pageY;
|
|
HEAP32[ptr + 28 >> 2] = t.changed;
|
|
HEAP32[ptr + 32 >> 2] = t.onTarget;
|
|
if (canvasRect) {
|
|
HEAP32[ptr + 44 >> 2] = t.clientX - canvasRect.left;
|
|
HEAP32[ptr + 48 >> 2] = t.clientY - canvasRect.top
|
|
} else {
|
|
HEAP32[ptr + 44 >> 2] = 0;
|
|
HEAP32[ptr + 48 >> 2] = 0
|
|
}
|
|
HEAP32[ptr + 36 >> 2] = t.clientX - targetRect.left;
|
|
HEAP32[ptr + 40 >> 2] = t.clientY - targetRect.top;
|
|
ptr += 52;
|
|
if (++numTouches >= 32) {
|
|
break
|
|
}
|
|
}
|
|
HEAP32[touchEvent >> 2] = numTouches;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: eventTypeString == "touchstart" || eventTypeString == "touchend",
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: touchEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
fillGamepadEventData: (function(eventStruct, e) {
|
|
HEAPF64[eventStruct >> 3] = e.timestamp;
|
|
for (var i = 0; i < e.axes.length; ++i) {
|
|
HEAPF64[eventStruct + i * 8 + 16 >> 3] = e.axes[i]
|
|
}
|
|
for (var i = 0; i < e.buttons.length; ++i) {
|
|
if (typeof e.buttons[i] === "object") {
|
|
HEAPF64[eventStruct + i * 8 + 528 >> 3] = e.buttons[i].value
|
|
} else {
|
|
HEAPF64[eventStruct + i * 8 + 528 >> 3] = e.buttons[i]
|
|
}
|
|
}
|
|
for (var i = 0; i < e.buttons.length; ++i) {
|
|
if (typeof e.buttons[i] === "object") {
|
|
HEAP32[eventStruct + i * 4 + 1040 >> 2] = e.buttons[i].pressed
|
|
} else {
|
|
HEAP32[eventStruct + i * 4 + 1040 >> 2] = e.buttons[i] == 1
|
|
}
|
|
}
|
|
HEAP32[eventStruct + 1296 >> 2] = e.connected;
|
|
HEAP32[eventStruct + 1300 >> 2] = e.index;
|
|
HEAP32[eventStruct + 8 >> 2] = e.axes.length;
|
|
HEAP32[eventStruct + 12 >> 2] = e.buttons.length;
|
|
stringToUTF8(e.id, eventStruct + 1304, 64);
|
|
stringToUTF8(e.mapping, eventStruct + 1368, 64)
|
|
}),
|
|
registerGamepadEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc(1432);
|
|
var gamepadEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var gamepadEvent = JSEvents.gamepadEvent;
|
|
JSEvents.fillGamepadEventData(gamepadEvent, e.gamepad);
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: true,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: gamepadEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
registerBeforeUnloadEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
var beforeUnloadEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var confirmationMessage = Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData);
|
|
if (confirmationMessage) {
|
|
confirmationMessage = Pointer_stringify(confirmationMessage)
|
|
}
|
|
if (confirmationMessage) {
|
|
e.preventDefault();
|
|
e.returnValue = confirmationMessage;
|
|
return confirmationMessage
|
|
}
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: beforeUnloadEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
battery: (function() {
|
|
return navigator.battery || navigator.mozBattery || navigator.webkitBattery
|
|
}),
|
|
fillBatteryEventData: (function(eventStruct, e) {
|
|
HEAPF64[eventStruct >> 3] = e.chargingTime;
|
|
HEAPF64[eventStruct + 8 >> 3] = e.dischargingTime;
|
|
HEAPF64[eventStruct + 16 >> 3] = e.level;
|
|
HEAP32[eventStruct + 24 >> 2] = e.charging
|
|
}),
|
|
registerBatteryEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!JSEvents.batteryEvent) JSEvents.batteryEvent = _malloc(32);
|
|
var batteryEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
var batteryEvent = JSEvents.batteryEvent;
|
|
JSEvents.fillBatteryEventData(batteryEvent, JSEvents.battery());
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, batteryEvent, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: batteryEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
}),
|
|
registerWebGlEventCallback: (function(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
|
|
if (!target) target = Module["canvas"];
|
|
var webGlEventHandlerFunc = (function(event) {
|
|
var e = event || window.event;
|
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData)) e.preventDefault()
|
|
});
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: webGlEventHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler)
|
|
})
|
|
};
|
|
var __currentFullscreenStrategy = {};
|
|
|
|
function _emscripten_exit_fullscreen() {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
JSEvents.removeDeferredCalls(JSEvents.requestFullscreen);
|
|
if (document.exitFullscreen) {
|
|
document.exitFullscreen()
|
|
} else if (document.msExitFullscreen) {
|
|
document.msExitFullscreen()
|
|
} else if (document.mozCancelFullScreen) {
|
|
document.mozCancelFullScreen()
|
|
} else if (document.webkitExitFullscreen) {
|
|
document.webkitExitFullscreen()
|
|
} else {
|
|
return -1
|
|
}
|
|
if (__currentFullscreenStrategy.canvasResizedCallback) {
|
|
Module["dynCall_iiii"](__currentFullscreenStrategy.canvasResizedCallback, 37, 0, __currentFullscreenStrategy.canvasResizedCallbackUserData)
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_exit_pointerlock() {
|
|
JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
|
|
if (document.exitPointerLock) {
|
|
document.exitPointerLock()
|
|
} else if (document.msExitPointerLock) {
|
|
document.msExitPointerLock()
|
|
} else if (document.mozExitPointerLock) {
|
|
document.mozExitPointerLock()
|
|
} else if (document.webkitExitPointerLock) {
|
|
document.webkitExitPointerLock()
|
|
} else {
|
|
return -1
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_get_fullscreen_status(fullscreenStatus) {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
JSEvents.fillFullscreenChangeEventData(fullscreenStatus);
|
|
return 0
|
|
}
|
|
|
|
function __emscripten_sample_gamepad_data() {
|
|
if (!JSEvents.numGamepadsConnected) return;
|
|
if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
|
|
JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null;
|
|
JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber
|
|
}
|
|
}
|
|
|
|
function _emscripten_get_gamepad_status(index, gamepadState) {
|
|
__emscripten_sample_gamepad_data();
|
|
if (!JSEvents.lastGamepadState) return -1;
|
|
if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
|
|
if (!JSEvents.lastGamepadState[index]) return -7;
|
|
JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_get_num_gamepads() {
|
|
if (!JSEvents.numGamepadsConnected) return 0;
|
|
__emscripten_sample_gamepad_data();
|
|
if (!JSEvents.lastGamepadState) return -1;
|
|
return JSEvents.lastGamepadState.length
|
|
}
|
|
|
|
function _emscripten_has_threading_support() {
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_html5_remove_all_event_listeners() {
|
|
JSEvents.removeAllEventListeners()
|
|
}
|
|
|
|
function _emscripten_is_webgl_context_lost(target) {
|
|
if (!Module.ctx) return true;
|
|
return Module.ctx.isContextLost()
|
|
}
|
|
|
|
function __reallyNegative(x) {
|
|
return x < 0 || x === 0 && 1 / x === -Infinity
|
|
}
|
|
|
|
function __formatString(format, varargs) {
|
|
assert((varargs & 3) === 0);
|
|
var textIndex = format;
|
|
var argIndex = varargs;
|
|
|
|
function prepVararg(ptr, type) {
|
|
if (type === "double" || type === "i64") {
|
|
if (ptr & 7) {
|
|
assert((ptr & 7) === 4);
|
|
ptr += 4
|
|
}
|
|
} else {
|
|
assert((ptr & 3) === 0)
|
|
}
|
|
return ptr
|
|
}
|
|
|
|
function getNextArg(type) {
|
|
var ret;
|
|
argIndex = prepVararg(argIndex, type);
|
|
if (type === "double") {
|
|
ret = HEAPF64[argIndex >> 3];
|
|
argIndex += 8
|
|
} else if (type == "i64") {
|
|
ret = [HEAP32[argIndex >> 2], HEAP32[argIndex + 4 >> 2]];
|
|
argIndex += 8
|
|
} else {
|
|
assert((argIndex & 3) === 0);
|
|
type = "i32";
|
|
ret = HEAP32[argIndex >> 2];
|
|
argIndex += 4
|
|
}
|
|
return ret
|
|
}
|
|
var ret = [];
|
|
var curr, next, currArg;
|
|
while (1) {
|
|
var startTextIndex = textIndex;
|
|
curr = HEAP8[textIndex >> 0];
|
|
if (curr === 0) break;
|
|
next = HEAP8[textIndex + 1 >> 0];
|
|
if (curr == 37) {
|
|
var flagAlwaysSigned = false;
|
|
var flagLeftAlign = false;
|
|
var flagAlternative = false;
|
|
var flagZeroPad = false;
|
|
var flagPadSign = false;
|
|
flagsLoop: while (1) {
|
|
switch (next) {
|
|
case 43:
|
|
flagAlwaysSigned = true;
|
|
break;
|
|
case 45:
|
|
flagLeftAlign = true;
|
|
break;
|
|
case 35:
|
|
flagAlternative = true;
|
|
break;
|
|
case 48:
|
|
if (flagZeroPad) {
|
|
break flagsLoop
|
|
} else {
|
|
flagZeroPad = true;
|
|
break
|
|
};
|
|
case 32:
|
|
flagPadSign = true;
|
|
break;
|
|
default:
|
|
break flagsLoop
|
|
}
|
|
textIndex++;
|
|
next = HEAP8[textIndex + 1 >> 0]
|
|
}
|
|
var width = 0;
|
|
if (next == 42) {
|
|
width = getNextArg("i32");
|
|
textIndex++;
|
|
next = HEAP8[textIndex + 1 >> 0]
|
|
} else {
|
|
while (next >= 48 && next <= 57) {
|
|
width = width * 10 + (next - 48);
|
|
textIndex++;
|
|
next = HEAP8[textIndex + 1 >> 0]
|
|
}
|
|
}
|
|
var precisionSet = false,
|
|
precision = -1;
|
|
if (next == 46) {
|
|
precision = 0;
|
|
precisionSet = true;
|
|
textIndex++;
|
|
next = HEAP8[textIndex + 1 >> 0];
|
|
if (next == 42) {
|
|
precision = getNextArg("i32");
|
|
textIndex++
|
|
} else {
|
|
while (1) {
|
|
var precisionChr = HEAP8[textIndex + 1 >> 0];
|
|
if (precisionChr < 48 || precisionChr > 57) break;
|
|
precision = precision * 10 + (precisionChr - 48);
|
|
textIndex++
|
|
}
|
|
}
|
|
next = HEAP8[textIndex + 1 >> 0]
|
|
}
|
|
if (precision < 0) {
|
|
precision = 6;
|
|
precisionSet = false
|
|
}
|
|
var argSize;
|
|
switch (String.fromCharCode(next)) {
|
|
case "h":
|
|
var nextNext = HEAP8[textIndex + 2 >> 0];
|
|
if (nextNext == 104) {
|
|
textIndex++;
|
|
argSize = 1
|
|
} else {
|
|
argSize = 2
|
|
}
|
|
break;
|
|
case "l":
|
|
var nextNext = HEAP8[textIndex + 2 >> 0];
|
|
if (nextNext == 108) {
|
|
textIndex++;
|
|
argSize = 8
|
|
} else {
|
|
argSize = 4
|
|
}
|
|
break;
|
|
case "L":
|
|
case "q":
|
|
case "j":
|
|
argSize = 8;
|
|
break;
|
|
case "z":
|
|
case "t":
|
|
case "I":
|
|
argSize = 4;
|
|
break;
|
|
default:
|
|
argSize = null
|
|
}
|
|
if (argSize) textIndex++;
|
|
next = HEAP8[textIndex + 1 >> 0];
|
|
switch (String.fromCharCode(next)) {
|
|
case "d":
|
|
case "i":
|
|
case "u":
|
|
case "o":
|
|
case "x":
|
|
case "X":
|
|
case "p":
|
|
{
|
|
var signed = next == 100 || next == 105;argSize = argSize || 4;currArg = getNextArg("i" + argSize * 8);
|
|
var origArg = currArg;
|
|
var argText;
|
|
if (argSize == 8) {
|
|
currArg = makeBigInt(currArg[0], currArg[1], next == 117)
|
|
}
|
|
if (argSize <= 4) {
|
|
var limit = Math.pow(256, argSize) - 1;
|
|
currArg = (signed ? reSign : unSign)(currArg & limit, argSize * 8)
|
|
}
|
|
var currAbsArg = Math.abs(currArg);
|
|
var prefix = "";
|
|
if (next == 100 || next == 105) {
|
|
if (argSize == 8 && typeof i64Math === "object") argText = i64Math.stringify(origArg[0], origArg[1], null);
|
|
else argText = reSign(currArg, 8 * argSize, 1).toString(10)
|
|
} else if (next == 117) {
|
|
if (argSize == 8 && typeof i64Math === "object") argText = i64Math.stringify(origArg[0], origArg[1], true);
|
|
else argText = unSign(currArg, 8 * argSize, 1).toString(10);
|
|
currArg = Math.abs(currArg)
|
|
} else if (next == 111) {
|
|
argText = (flagAlternative ? "0" : "") + currAbsArg.toString(8)
|
|
} else if (next == 120 || next == 88) {
|
|
prefix = flagAlternative && currArg != 0 ? "0x" : "";
|
|
if (argSize == 8 && typeof i64Math === "object") {
|
|
if (origArg[1]) {
|
|
argText = (origArg[1] >>> 0).toString(16);
|
|
var lower = (origArg[0] >>> 0).toString(16);
|
|
while (lower.length < 8) lower = "0" + lower;
|
|
argText += lower
|
|
} else {
|
|
argText = (origArg[0] >>> 0).toString(16)
|
|
}
|
|
} else if (currArg < 0) {
|
|
currArg = -currArg;
|
|
argText = (currAbsArg - 1).toString(16);
|
|
var buffer = [];
|
|
for (var i = 0; i < argText.length; i++) {
|
|
buffer.push((15 - parseInt(argText[i], 16)).toString(16))
|
|
}
|
|
argText = buffer.join("");
|
|
while (argText.length < argSize * 2) argText = "f" + argText
|
|
} else {
|
|
argText = currAbsArg.toString(16)
|
|
}
|
|
if (next == 88) {
|
|
prefix = prefix.toUpperCase();
|
|
argText = argText.toUpperCase()
|
|
}
|
|
} else if (next == 112) {
|
|
if (currAbsArg === 0) {
|
|
argText = "(nil)"
|
|
} else {
|
|
prefix = "0x";
|
|
argText = currAbsArg.toString(16)
|
|
}
|
|
}
|
|
if (precisionSet) {
|
|
while (argText.length < precision) {
|
|
argText = "0" + argText
|
|
}
|
|
}
|
|
if (currArg >= 0) {
|
|
if (flagAlwaysSigned) {
|
|
prefix = "+" + prefix
|
|
} else if (flagPadSign) {
|
|
prefix = " " + prefix
|
|
}
|
|
}
|
|
if (argText.charAt(0) == "-") {
|
|
prefix = "-" + prefix;
|
|
argText = argText.substr(1)
|
|
}
|
|
while (prefix.length + argText.length < width) {
|
|
if (flagLeftAlign) {
|
|
argText += " "
|
|
} else {
|
|
if (flagZeroPad) {
|
|
argText = "0" + argText
|
|
} else {
|
|
prefix = " " + prefix
|
|
}
|
|
}
|
|
}
|
|
argText = prefix + argText;argText.split("").forEach((function(chr) {
|
|
ret.push(chr.charCodeAt(0))
|
|
}));
|
|
break
|
|
};
|
|
case "f":
|
|
case "F":
|
|
case "e":
|
|
case "E":
|
|
case "g":
|
|
case "G":
|
|
{
|
|
currArg = getNextArg("double");
|
|
var argText;
|
|
if (isNaN(currArg)) {
|
|
argText = "nan";
|
|
flagZeroPad = false
|
|
} else if (!isFinite(currArg)) {
|
|
argText = (currArg < 0 ? "-" : "") + "inf";
|
|
flagZeroPad = false
|
|
} else {
|
|
var isGeneral = false;
|
|
var effectivePrecision = Math.min(precision, 20);
|
|
if (next == 103 || next == 71) {
|
|
isGeneral = true;
|
|
precision = precision || 1;
|
|
var exponent = parseInt(currArg.toExponential(effectivePrecision).split("e")[1], 10);
|
|
if (precision > exponent && exponent >= -4) {
|
|
next = (next == 103 ? "f" : "F").charCodeAt(0);
|
|
precision -= exponent + 1
|
|
} else {
|
|
next = (next == 103 ? "e" : "E").charCodeAt(0);
|
|
precision--
|
|
}
|
|
effectivePrecision = Math.min(precision, 20)
|
|
}
|
|
if (next == 101 || next == 69) {
|
|
argText = currArg.toExponential(effectivePrecision);
|
|
if (/[eE][-+]\d$/.test(argText)) {
|
|
argText = argText.slice(0, -1) + "0" + argText.slice(-1)
|
|
}
|
|
} else if (next == 102 || next == 70) {
|
|
argText = currArg.toFixed(effectivePrecision);
|
|
if (currArg === 0 && __reallyNegative(currArg)) {
|
|
argText = "-" + argText
|
|
}
|
|
}
|
|
var parts = argText.split("e");
|
|
if (isGeneral && !flagAlternative) {
|
|
while (parts[0].length > 1 && parts[0].indexOf(".") != -1 && (parts[0].slice(-1) == "0" || parts[0].slice(-1) == ".")) {
|
|
parts[0] = parts[0].slice(0, -1)
|
|
}
|
|
} else {
|
|
if (flagAlternative && argText.indexOf(".") == -1) parts[0] += ".";
|
|
while (precision > effectivePrecision++) parts[0] += "0"
|
|
}
|
|
argText = parts[0] + (parts.length > 1 ? "e" + parts[1] : "");
|
|
if (next == 69) argText = argText.toUpperCase();
|
|
if (currArg >= 0) {
|
|
if (flagAlwaysSigned) {
|
|
argText = "+" + argText
|
|
} else if (flagPadSign) {
|
|
argText = " " + argText
|
|
}
|
|
}
|
|
}
|
|
while (argText.length < width) {
|
|
if (flagLeftAlign) {
|
|
argText += " "
|
|
} else {
|
|
if (flagZeroPad && (argText[0] == "-" || argText[0] == "+")) {
|
|
argText = argText[0] + "0" + argText.slice(1)
|
|
} else {
|
|
argText = (flagZeroPad ? "0" : " ") + argText
|
|
}
|
|
}
|
|
}
|
|
if (next < 97) argText = argText.toUpperCase();argText.split("").forEach((function(chr) {
|
|
ret.push(chr.charCodeAt(0))
|
|
}));
|
|
break
|
|
};
|
|
case "s":
|
|
{
|
|
var arg = getNextArg("i8*");
|
|
var argLength = arg ? _strlen(arg) : "(null)".length;
|
|
if (precisionSet) argLength = Math.min(argLength, precision);
|
|
if (!flagLeftAlign) {
|
|
while (argLength < width--) {
|
|
ret.push(32)
|
|
}
|
|
}
|
|
if (arg) {
|
|
for (var i = 0; i < argLength; i++) {
|
|
ret.push(HEAPU8[arg++ >> 0])
|
|
}
|
|
} else {
|
|
ret = ret.concat(intArrayFromString("(null)".substr(0, argLength), true))
|
|
}
|
|
if (flagLeftAlign) {
|
|
while (argLength < width--) {
|
|
ret.push(32)
|
|
}
|
|
}
|
|
break
|
|
};
|
|
case "c":
|
|
{
|
|
if (flagLeftAlign) ret.push(getNextArg("i8"));
|
|
while (--width > 0) {
|
|
ret.push(32)
|
|
}
|
|
if (!flagLeftAlign) ret.push(getNextArg("i8"));
|
|
break
|
|
};
|
|
case "n":
|
|
{
|
|
var ptr = getNextArg("i32*");HEAP32[ptr >> 2] = ret.length;
|
|
break
|
|
};
|
|
case "%":
|
|
{
|
|
ret.push(curr);
|
|
break
|
|
};
|
|
default:
|
|
{
|
|
for (var i = startTextIndex; i < textIndex + 2; i++) {
|
|
ret.push(HEAP8[i >> 0])
|
|
}
|
|
}
|
|
}
|
|
textIndex += 2
|
|
} else {
|
|
ret.push(curr);
|
|
textIndex += 1
|
|
}
|
|
}
|
|
return ret
|
|
}
|
|
|
|
function __emscripten_traverse_stack(args) {
|
|
if (!args || !args.callee || !args.callee.name) {
|
|
return [null, "", ""]
|
|
}
|
|
var funstr = args.callee.toString();
|
|
var funcname = args.callee.name;
|
|
var str = "(";
|
|
var first = true;
|
|
for (var i in args) {
|
|
var a = args[i];
|
|
if (!first) {
|
|
str += ", "
|
|
}
|
|
first = false;
|
|
if (typeof a === "number" || typeof a === "string") {
|
|
str += a
|
|
} else {
|
|
str += "(" + typeof a + ")"
|
|
}
|
|
}
|
|
str += ")";
|
|
var caller = args.callee.caller;
|
|
args = caller ? caller.arguments : [];
|
|
if (first) str = "";
|
|
return [args, funcname, str]
|
|
}
|
|
|
|
function _emscripten_get_callstack_js(flags) {
|
|
var callstack = jsStackTrace();
|
|
var iThisFunc = callstack.lastIndexOf("_emscripten_log");
|
|
var iThisFunc2 = callstack.lastIndexOf("_emscripten_get_callstack");
|
|
var iNextLine = callstack.indexOf("\n", Math.max(iThisFunc, iThisFunc2)) + 1;
|
|
callstack = callstack.slice(iNextLine);
|
|
if (flags & 8 && typeof emscripten_source_map === "undefined") {
|
|
warnOnce('Source map information is not available, emscripten_log with EM_LOG_C_STACK will be ignored. Build with "--pre-js $EMSCRIPTEN/src/emscripten-source-map.min.js" linker flag to add source map loading to code.');
|
|
flags ^= 8;
|
|
flags |= 16
|
|
}
|
|
var stack_args = null;
|
|
if (flags & 128) {
|
|
stack_args = __emscripten_traverse_stack(arguments);
|
|
while (stack_args[1].indexOf("_emscripten_") >= 0) stack_args = __emscripten_traverse_stack(stack_args[0])
|
|
}
|
|
var lines = callstack.split("\n");
|
|
callstack = "";
|
|
var newFirefoxRe = new RegExp("\\s*(.*?)@(.*?):([0-9]+):([0-9]+)");
|
|
var firefoxRe = new RegExp("\\s*(.*?)@(.*):(.*)(:(.*))?");
|
|
var chromeRe = new RegExp("\\s*at (.*?) \\((.*):(.*):(.*)\\)");
|
|
for (var l in lines) {
|
|
var line = lines[l];
|
|
var jsSymbolName = "";
|
|
var file = "";
|
|
var lineno = 0;
|
|
var column = 0;
|
|
var parts = chromeRe.exec(line);
|
|
if (parts && parts.length == 5) {
|
|
jsSymbolName = parts[1];
|
|
file = parts[2];
|
|
lineno = parts[3];
|
|
column = parts[4]
|
|
} else {
|
|
parts = newFirefoxRe.exec(line);
|
|
if (!parts) parts = firefoxRe.exec(line);
|
|
if (parts && parts.length >= 4) {
|
|
jsSymbolName = parts[1];
|
|
file = parts[2];
|
|
lineno = parts[3];
|
|
column = parts[4] | 0
|
|
} else {
|
|
callstack += line + "\n";
|
|
continue
|
|
}
|
|
}
|
|
var cSymbolName = flags & 32 ? demangle(jsSymbolName) : jsSymbolName;
|
|
if (!cSymbolName) {
|
|
cSymbolName = jsSymbolName
|
|
}
|
|
var haveSourceMap = false;
|
|
if (flags & 8) {
|
|
var orig = emscripten_source_map.originalPositionFor({
|
|
line: lineno,
|
|
column: column
|
|
});
|
|
haveSourceMap = orig && orig.source;
|
|
if (haveSourceMap) {
|
|
if (flags & 64) {
|
|
orig.source = orig.source.substring(orig.source.replace(/\\/g, "/").lastIndexOf("/") + 1)
|
|
}
|
|
callstack += " at " + cSymbolName + " (" + orig.source + ":" + orig.line + ":" + orig.column + ")\n"
|
|
}
|
|
}
|
|
if (flags & 16 || !haveSourceMap) {
|
|
if (flags & 64) {
|
|
file = file.substring(file.replace(/\\/g, "/").lastIndexOf("/") + 1)
|
|
}
|
|
callstack += (haveSourceMap ? " = " + jsSymbolName : " at " + cSymbolName) + " (" + file + ":" + lineno + ":" + column + ")\n"
|
|
}
|
|
if (flags & 128 && stack_args[0]) {
|
|
if (stack_args[1] == jsSymbolName && stack_args[2].length > 0) {
|
|
callstack = callstack.replace(/\s+$/, "");
|
|
callstack += " with values: " + stack_args[1] + stack_args[2] + "\n"
|
|
}
|
|
stack_args = __emscripten_traverse_stack(stack_args[0])
|
|
}
|
|
}
|
|
callstack = callstack.replace(/\s+$/, "");
|
|
return callstack
|
|
}
|
|
|
|
function _emscripten_log_js(flags, str) {
|
|
if (flags & 24) {
|
|
str = str.replace(/\s+$/, "");
|
|
str += (str.length > 0 ? "\n" : "") + _emscripten_get_callstack_js(flags)
|
|
}
|
|
if (flags & 1) {
|
|
if (flags & 4) {
|
|
console.error(str)
|
|
} else if (flags & 2) {
|
|
console.warn(str)
|
|
} else {
|
|
console.log(str)
|
|
}
|
|
} else if (flags & 6) {
|
|
err(str)
|
|
} else {
|
|
out(str)
|
|
}
|
|
}
|
|
|
|
function _emscripten_log(flags, varargs) {
|
|
var format = HEAP32[varargs >> 2];
|
|
varargs += 4;
|
|
var str = "";
|
|
if (format) {
|
|
var result = __formatString(format, varargs);
|
|
for (var i = 0; i < result.length; ++i) {
|
|
str += String.fromCharCode(result[i])
|
|
}
|
|
}
|
|
_emscripten_log_js(flags, str)
|
|
}
|
|
|
|
function _emscripten_num_logical_cores() {
|
|
return 1
|
|
}
|
|
|
|
function __setLetterbox(element, topBottom, leftRight) {
|
|
if (JSEvents.isInternetExplorer()) {
|
|
element.style.marginLeft = element.style.marginRight = leftRight + "px";
|
|
element.style.marginTop = element.style.marginBottom = topBottom + "px"
|
|
} else {
|
|
element.style.paddingLeft = element.style.paddingRight = leftRight + "px";
|
|
element.style.paddingTop = element.style.paddingBottom = topBottom + "px"
|
|
}
|
|
}
|
|
|
|
function __emscripten_do_request_fullscreen(target, strategy) {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
if (!JSEvents.fullscreenEnabled()) return -3;
|
|
if (!target) target = "#canvas";
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
if (!target.requestFullscreen && !target.msRequestFullscreen && !target.mozRequestFullScreen && !target.mozRequestFullscreen && !target.webkitRequestFullscreen) {
|
|
return -3
|
|
}
|
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
|
|
if (!canPerformRequests) {
|
|
if (strategy.deferUntilInEventHandler) {
|
|
JSEvents.deferCall(JSEvents.requestFullscreen, 1, [target, strategy]);
|
|
return 1
|
|
} else {
|
|
return -2
|
|
}
|
|
}
|
|
return JSEvents.requestFullscreen(target, strategy)
|
|
}
|
|
|
|
function _emscripten_request_fullscreen(target, deferUntilInEventHandler) {
|
|
var strategy = {};
|
|
strategy.scaleMode = 0;
|
|
strategy.canvasResolutionScaleMode = 0;
|
|
strategy.filteringMode = 0;
|
|
strategy.deferUntilInEventHandler = deferUntilInEventHandler;
|
|
strategy.canvasResizedCallbackTargetThread = 2;
|
|
return __emscripten_do_request_fullscreen(target, strategy)
|
|
}
|
|
|
|
function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
|
|
if (!target) target = "#canvas";
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
|
|
return -1
|
|
}
|
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
|
|
if (!canPerformRequests) {
|
|
if (deferUntilInEventHandler) {
|
|
JSEvents.deferCall(JSEvents.requestPointerLock, 2, [target]);
|
|
return 1
|
|
} else {
|
|
return -2
|
|
}
|
|
}
|
|
return JSEvents.requestPointerLock(target)
|
|
}
|
|
|
|
function _emscripten_set_blur_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerFocusEventCallback(target, userData, useCapture, callbackfunc, 12, "blur", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_dblclick_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 7, "dblclick", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_devicemotion_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerDeviceMotionEventCallback(window, userData, useCapture, callbackfunc, 17, "devicemotion", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_deviceorientation_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerDeviceOrientationEventCallback(window, userData, useCapture, callbackfunc, 16, "deviceorientation", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_focus_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerFocusEventCallback(target, userData, useCapture, callbackfunc, 13, "focus", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1;
|
|
if (!target) target = document;
|
|
else {
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4
|
|
}
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread);
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange", targetThread);
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread);
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
|
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
|
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
|
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_keydown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 2, "keydown", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_keyup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 3, "keyup", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_mousedown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 5, "mousedown", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_mousemove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 8, "mousemove", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_mouseup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 6, "mouseup", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread);
|
|
return 0
|
|
}
|
|
|
|
function _emscripten_set_wheel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
|
|
target = JSEvents.findEventTarget(target);
|
|
if (typeof target.onwheel !== "undefined") {
|
|
JSEvents.registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "wheel", targetThread);
|
|
return 0
|
|
} else if (typeof target.onmousewheel !== "undefined") {
|
|
JSEvents.registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "mousewheel", targetThread);
|
|
return 0
|
|
} else {
|
|
return -1
|
|
}
|
|
}
|
|
var GL = {
|
|
counter: 1,
|
|
lastError: 0,
|
|
buffers: [],
|
|
mappedBuffers: {},
|
|
programs: [],
|
|
framebuffers: [],
|
|
renderbuffers: [],
|
|
textures: [],
|
|
uniforms: [],
|
|
shaders: [],
|
|
vaos: [],
|
|
contexts: [],
|
|
currentContext: null,
|
|
offscreenCanvases: {},
|
|
timerQueriesEXT: [],
|
|
queries: [],
|
|
samplers: [],
|
|
transformFeedbacks: [],
|
|
syncs: [],
|
|
byteSizeByTypeRoot: 5120,
|
|
byteSizeByType: [1, 1, 2, 2, 4, 4, 4, 2, 3, 4, 8],
|
|
programInfos: {},
|
|
stringCache: {},
|
|
stringiCache: {},
|
|
tempFixedLengthArray: [],
|
|
packAlignment: 4,
|
|
unpackAlignment: 4,
|
|
init: (function() {
|
|
GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
|
|
for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
|
|
GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i + 1)
|
|
}
|
|
for (var i = 0; i < 32; i++) {
|
|
GL.tempFixedLengthArray.push(new Array(i))
|
|
}
|
|
}),
|
|
recordError: function recordError(errorCode) {
|
|
if (!GL.lastError) {
|
|
GL.lastError = errorCode
|
|
}
|
|
},
|
|
getNewId: (function(table) {
|
|
var ret = GL.counter++;
|
|
for (var i = table.length; i < ret; i++) {
|
|
table[i] = null
|
|
}
|
|
return ret
|
|
}),
|
|
MINI_TEMP_BUFFER_SIZE: 256,
|
|
miniTempBuffer: null,
|
|
miniTempBufferViews: [0],
|
|
getSource: (function(shader, count, string, length) {
|
|
var source = "";
|
|
for (var i = 0; i < count; ++i) {
|
|
var frag;
|
|
if (length) {
|
|
var len = HEAP32[length + i * 4 >> 2];
|
|
if (len < 0) {
|
|
frag = Pointer_stringify(HEAP32[string + i * 4 >> 2])
|
|
} else {
|
|
frag = Pointer_stringify(HEAP32[string + i * 4 >> 2], len)
|
|
}
|
|
} else {
|
|
frag = Pointer_stringify(HEAP32[string + i * 4 >> 2])
|
|
}
|
|
source += frag
|
|
}
|
|
return source
|
|
}),
|
|
createContext: (function(canvas, webGLContextAttributes) {
|
|
if (typeof webGLContextAttributes["majorVersion"] === "undefined" && typeof webGLContextAttributes["minorVersion"] === "undefined") {
|
|
if (typeof WebGL2RenderingContext !== "undefined") webGLContextAttributes["majorVersion"] = 2;
|
|
else webGLContextAttributes["majorVersion"] = 1;
|
|
webGLContextAttributes["minorVersion"] = 0
|
|
}
|
|
var ctx;
|
|
var errorInfo = "?";
|
|
|
|
function onContextCreationError(event) {
|
|
errorInfo = event.statusMessage || errorInfo
|
|
}
|
|
webGLContextAttributes["powerPreference"] = "high-performance";
|
|
try {
|
|
canvas.addEventListener("webglcontextcreationerror", onContextCreationError, false);
|
|
try {
|
|
if (webGLContextAttributes["majorVersion"] == 1 && webGLContextAttributes["minorVersion"] == 0) {
|
|
ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes)
|
|
} else if (webGLContextAttributes["majorVersion"] == 2 && webGLContextAttributes["minorVersion"] == 0) {
|
|
ctx = canvas.getContext("webgl2", webGLContextAttributes)
|
|
} else {
|
|
throw "Unsupported WebGL context version " + majorVersion + "." + minorVersion + "!"
|
|
}
|
|
} finally {
|
|
canvas.removeEventListener("webglcontextcreationerror", onContextCreationError, false)
|
|
}
|
|
if (!ctx) throw ":("
|
|
} catch (e) {
|
|
out("Could not create canvas: " + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
|
|
return 0
|
|
}
|
|
if (!ctx) return 0;
|
|
var context = GL.registerContext(ctx, webGLContextAttributes);
|
|
return context
|
|
}),
|
|
registerContext: (function(ctx, webGLContextAttributes) {
|
|
var handle = _malloc(8);
|
|
HEAP32[handle >> 2] = webGLContextAttributes["explicitSwapControl"];
|
|
var context = {
|
|
handle: handle,
|
|
attributes: webGLContextAttributes,
|
|
version: webGLContextAttributes["majorVersion"],
|
|
GLctx: ctx
|
|
};
|
|
|
|
function getChromeVersion() {
|
|
var raw = navigator.userAgent.match(/Chrom(e|ium)\/([0-9]+)\./);
|
|
return raw ? parseInt(raw[2], 10) : false
|
|
}
|
|
context.supportsWebGL2EntryPoints = context.version >= 2 && (getChromeVersion() === false || getChromeVersion() >= 58);
|
|
if (ctx.canvas) ctx.canvas.GLctxObject = context;
|
|
GL.contexts[handle] = context;
|
|
if (typeof webGLContextAttributes["enableExtensionsByDefault"] === "undefined" || webGLContextAttributes["enableExtensionsByDefault"]) {
|
|
GL.initExtensions(context)
|
|
}
|
|
if (webGLContextAttributes["renderViaOffscreenBackBuffer"]) {
|
|
return 0
|
|
}
|
|
return handle
|
|
}),
|
|
makeContextCurrent: (function(contextHandle) {
|
|
if (!contextHandle) {
|
|
GLctx = Module.ctx = GL.currentContext = null;
|
|
return true
|
|
}
|
|
var context = GL.contexts[contextHandle];
|
|
if (!context) {
|
|
return false
|
|
}
|
|
GLctx = Module.ctx = context.GLctx;
|
|
GL.currentContext = context;
|
|
return true
|
|
}),
|
|
getContext: (function(contextHandle) {
|
|
return GL.contexts[contextHandle]
|
|
}),
|
|
deleteContext: (function(contextHandle) {
|
|
if (!contextHandle) return;
|
|
if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
|
|
if (typeof JSEvents === "object") JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);
|
|
if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined;
|
|
_free(GL.contexts[contextHandle]);
|
|
GL.contexts[contextHandle] = null
|
|
}),
|
|
initExtensions: (function(context) {
|
|
if (!context) context = GL.currentContext;
|
|
if (context.initExtensionsDone) return;
|
|
context.initExtensionsDone = true;
|
|
var GLctx = context.GLctx;
|
|
context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
|
|
if (context.version < 2) {
|
|
var instancedArraysExt = GLctx.getExtension("ANGLE_instanced_arrays");
|
|
if (instancedArraysExt) {
|
|
GLctx["vertexAttribDivisor"] = (function(index, divisor) {
|
|
instancedArraysExt["vertexAttribDivisorANGLE"](index, divisor)
|
|
});
|
|
GLctx["drawArraysInstanced"] = (function(mode, first, count, primcount) {
|
|
instancedArraysExt["drawArraysInstancedANGLE"](mode, first, count, primcount)
|
|
});
|
|
GLctx["drawElementsInstanced"] = (function(mode, count, type, indices, primcount) {
|
|
instancedArraysExt["drawElementsInstancedANGLE"](mode, count, type, indices, primcount)
|
|
})
|
|
}
|
|
var vaoExt = GLctx.getExtension("OES_vertex_array_object");
|
|
if (vaoExt) {
|
|
GLctx["createVertexArray"] = (function() {
|
|
return vaoExt["createVertexArrayOES"]()
|
|
});
|
|
GLctx["deleteVertexArray"] = (function(vao) {
|
|
vaoExt["deleteVertexArrayOES"](vao)
|
|
});
|
|
GLctx["bindVertexArray"] = (function(vao) {
|
|
vaoExt["bindVertexArrayOES"](vao)
|
|
});
|
|
GLctx["isVertexArray"] = (function(vao) {
|
|
return vaoExt["isVertexArrayOES"](vao)
|
|
})
|
|
}
|
|
var drawBuffersExt = GLctx.getExtension("WEBGL_draw_buffers");
|
|
if (drawBuffersExt) {
|
|
GLctx["drawBuffers"] = (function(n, bufs) {
|
|
drawBuffersExt["drawBuffersWEBGL"](n, bufs)
|
|
})
|
|
}
|
|
}
|
|
GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
|
|
var automaticallyEnabledExtensions = ["OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", "OES_element_index_uint", "EXT_texture_filter_anisotropic", "EXT_frag_depth", "WEBGL_draw_buffers", "ANGLE_instanced_arrays", "OES_texture_float_linear", "OES_texture_half_float_linear", "EXT_blend_minmax", "EXT_shader_texture_lod", "EXT_texture_norm16", "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", "EXT_sRGB", "WEBGL_compressed_texture_etc1", "EXT_disjoint_timer_query", "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_astc", "EXT_color_buffer_float", "WEBGL_compressed_texture_s3tc_srgb", "EXT_disjoint_timer_query_webgl2", "WEBKIT_WEBGL_compressed_texture_pvrtc"];
|
|
var exts = GLctx.getSupportedExtensions();
|
|
if (exts && exts.length > 0) {
|
|
GLctx.getSupportedExtensions().forEach((function(ext) {
|
|
if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
|
|
GLctx.getExtension(ext)
|
|
}
|
|
}))
|
|
}
|
|
}),
|
|
populateUniformTable: (function(program) {
|
|
var p = GL.programs[program];
|
|
GL.programInfos[program] = {
|
|
uniforms: {},
|
|
maxUniformLength: 0,
|
|
maxAttributeLength: -1,
|
|
maxUniformBlockNameLength: -1
|
|
};
|
|
var ptable = GL.programInfos[program];
|
|
var utable = ptable.uniforms;
|
|
var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
|
|
for (var i = 0; i < numUniforms; ++i) {
|
|
var u = GLctx.getActiveUniform(p, i);
|
|
var name = u.name;
|
|
ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length + 1);
|
|
if (name.indexOf("]", name.length - 1) !== -1) {
|
|
var ls = name.lastIndexOf("[");
|
|
name = name.slice(0, ls)
|
|
}
|
|
var loc = GLctx.getUniformLocation(p, name);
|
|
if (loc != null) {
|
|
var id = GL.getNewId(GL.uniforms);
|
|
utable[name] = [u.size, id];
|
|
GL.uniforms[id] = loc;
|
|
for (var j = 1; j < u.size; ++j) {
|
|
var n = name + "[" + j + "]";
|
|
loc = GLctx.getUniformLocation(p, n);
|
|
id = GL.getNewId(GL.uniforms);
|
|
GL.uniforms[id] = loc
|
|
}
|
|
}
|
|
}
|
|
})
|
|
};
|
|
|
|
function _emscripten_webgl_do_create_context(target, attributes) {
|
|
var contextAttributes = {};
|
|
contextAttributes["alpha"] = !!HEAP32[attributes >> 2];
|
|
contextAttributes["depth"] = !!HEAP32[attributes + 4 >> 2];
|
|
contextAttributes["stencil"] = !!HEAP32[attributes + 8 >> 2];
|
|
contextAttributes["antialias"] = !!HEAP32[attributes + 12 >> 2];
|
|
contextAttributes["premultipliedAlpha"] = !!HEAP32[attributes + 16 >> 2];
|
|
contextAttributes["preserveDrawingBuffer"] = !!HEAP32[attributes + 20 >> 2];
|
|
contextAttributes["preferLowPowerToHighPerformance"] = !!HEAP32[attributes + 24 >> 2];
|
|
contextAttributes["failIfMajorPerformanceCaveat"] = !!HEAP32[attributes + 28 >> 2];
|
|
contextAttributes["majorVersion"] = HEAP32[attributes + 32 >> 2];
|
|
contextAttributes["minorVersion"] = HEAP32[attributes + 36 >> 2];
|
|
contextAttributes["explicitSwapControl"] = HEAP32[attributes + 44 >> 2];
|
|
contextAttributes["proxyContextToMainThread"] = HEAP32[attributes + 48 >> 2];
|
|
contextAttributes["renderViaOffscreenBackBuffer"] = HEAP32[attributes + 52 >> 2];
|
|
target = Pointer_stringify(target);
|
|
var canvas;
|
|
if ((!target || target === "#canvas") && Module["canvas"]) {
|
|
canvas = Module["canvas"].id && GL.offscreenCanvases[Module["canvas"].id] ? GL.offscreenCanvases[Module["canvas"].id].offscreenCanvas || JSEvents.findEventTarget(Module["canvas"].id) : Module["canvas"]
|
|
} else {
|
|
canvas = GL.offscreenCanvases[target] ? GL.offscreenCanvases[target].offscreenCanvas : JSEvents.findEventTarget(target)
|
|
}
|
|
if (!canvas) {
|
|
return 0
|
|
}
|
|
if (contextAttributes["explicitSwapControl"]) {
|
|
return 0
|
|
}
|
|
var contextHandle = GL.createContext(canvas, contextAttributes);
|
|
return contextHandle
|
|
}
|
|
|
|
function _emscripten_webgl_create_context() {
|
|
return _emscripten_webgl_do_create_context.apply(null, arguments)
|
|
}
|
|
|
|
function _emscripten_webgl_destroy_context_calling_thread(contextHandle) {
|
|
GL.deleteContext(contextHandle)
|
|
}
|
|
|
|
function _emscripten_webgl_destroy_context() {
|
|
return _emscripten_webgl_destroy_context_calling_thread.apply(null, arguments)
|
|
}
|
|
|
|
function _emscripten_webgl_enable_extension_calling_thread(contextHandle, extension) {
|
|
var context = GL.getContext(contextHandle);
|
|
var extString = Pointer_stringify(extension);
|
|
if (extString.indexOf("GL_") == 0) extString = extString.substr(3);
|
|
var ext = context.GLctx.getExtension(extString);
|
|
return ext ? 1 : 0
|
|
}
|
|
|
|
function _emscripten_webgl_enable_extension() {
|
|
return _emscripten_webgl_enable_extension_calling_thread.apply(null, arguments)
|
|
}
|
|
|
|
function _emscripten_webgl_do_get_current_context() {
|
|
return GL.currentContext ? GL.currentContext.handle : 0
|
|
}
|
|
|
|
function _emscripten_webgl_get_current_context() {
|
|
return _emscripten_webgl_do_get_current_context.apply(null, arguments)
|
|
}
|
|
|
|
function _emscripten_webgl_init_context_attributes(attributes) {
|
|
HEAP32[attributes >> 2] = 1;
|
|
HEAP32[attributes + 4 >> 2] = 1;
|
|
HEAP32[attributes + 8 >> 2] = 0;
|
|
HEAP32[attributes + 12 >> 2] = 1;
|
|
HEAP32[attributes + 16 >> 2] = 1;
|
|
HEAP32[attributes + 20 >> 2] = 0;
|
|
HEAP32[attributes + 24 >> 2] = 0;
|
|
HEAP32[attributes + 28 >> 2] = 0;
|
|
HEAP32[attributes + 32 >> 2] = 1;
|
|
HEAP32[attributes + 36 >> 2] = 0;
|
|
HEAP32[attributes + 40 >> 2] = 1;
|
|
HEAP32[attributes + 44 >> 2] = 0;
|
|
HEAP32[attributes + 48 >> 2] = 0;
|
|
HEAP32[attributes + 52 >> 2] = 0
|
|
}
|
|
|
|
function _emscripten_webgl_make_context_current(contextHandle) {
|
|
var success = GL.makeContextCurrent(contextHandle);
|
|
return success ? 0 : -5
|
|
}
|
|
|
|
function __exit(status) {
|
|
exit(status)
|
|
}
|
|
|
|
function _exit(status) {
|
|
__exit(status)
|
|
}
|
|
|
|
function _flock(fd, operation) {
|
|
return 0
|
|
}
|
|
|
|
function _getenv(name) {
|
|
if (name === 0) return 0;
|
|
name = Pointer_stringify(name);
|
|
if (!ENV.hasOwnProperty(name)) return 0;
|
|
if (_getenv.ret) _free(_getenv.ret);
|
|
_getenv.ret = allocateUTF8(ENV[name]);
|
|
return _getenv.ret
|
|
}
|
|
|
|
function _gethostbyname(name) {
|
|
name = Pointer_stringify(name);
|
|
var ret = _malloc(20);
|
|
var nameBuf = _malloc(name.length + 1);
|
|
stringToUTF8(name, nameBuf, name.length + 1);
|
|
HEAP32[ret >> 2] = nameBuf;
|
|
var aliasesBuf = _malloc(4);
|
|
HEAP32[aliasesBuf >> 2] = 0;
|
|
HEAP32[ret + 4 >> 2] = aliasesBuf;
|
|
var afinet = 2;
|
|
HEAP32[ret + 8 >> 2] = afinet;
|
|
HEAP32[ret + 12 >> 2] = 4;
|
|
var addrListBuf = _malloc(12);
|
|
HEAP32[addrListBuf >> 2] = addrListBuf + 8;
|
|
HEAP32[addrListBuf + 4 >> 2] = 0;
|
|
HEAP32[addrListBuf + 8 >> 2] = __inet_pton4_raw(DNS.lookup_name(name));
|
|
HEAP32[ret + 16 >> 2] = addrListBuf;
|
|
return ret
|
|
}
|
|
|
|
function _gethostbyaddr(addr, addrlen, type) {
|
|
if (type !== 2) {
|
|
___setErrNo(ERRNO_CODES.EAFNOSUPPORT);
|
|
return null
|
|
}
|
|
addr = HEAP32[addr >> 2];
|
|
var host = __inet_ntop4_raw(addr);
|
|
var lookup = DNS.lookup_addr(host);
|
|
if (lookup) {
|
|
host = lookup
|
|
}
|
|
var hostp = allocate(intArrayFromString(host), "i8", ALLOC_STACK);
|
|
return _gethostbyname(hostp)
|
|
}
|
|
|
|
function _getpagesize() {
|
|
return PAGE_SIZE
|
|
}
|
|
|
|
function _getpwuid(uid) {
|
|
return 0
|
|
}
|
|
|
|
function _gettimeofday(ptr) {
|
|
var now = Date.now();
|
|
HEAP32[ptr >> 2] = now / 1e3 | 0;
|
|
HEAP32[ptr + 4 >> 2] = now % 1e3 * 1e3 | 0;
|
|
return 0
|
|
}
|
|
|
|
function _glActiveTexture(x0) {
|
|
GLctx["activeTexture"](x0)
|
|
}
|
|
|
|
function _glAttachShader(program, shader) {
|
|
GLctx.attachShader(GL.programs[program], GL.shaders[shader])
|
|
}
|
|
|
|
function _glBeginQuery(target, id) {
|
|
GLctx["beginQuery"](target, id ? GL.queries[id] : null)
|
|
}
|
|
|
|
function _glBeginTransformFeedback(x0) {
|
|
GLctx["beginTransformFeedback"](x0)
|
|
}
|
|
|
|
function _glBindAttribLocation(program, index, name) {
|
|
name = Pointer_stringify(name);
|
|
GLctx.bindAttribLocation(GL.programs[program], index, name)
|
|
}
|
|
|
|
function _glBindBuffer(target, buffer) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
if (target == 35051) {
|
|
GLctx.currentPixelPackBufferBinding = buffer
|
|
} else if (target == 35052) {
|
|
GLctx.currentPixelUnpackBufferBinding = buffer
|
|
}
|
|
GLctx.bindBuffer(target, bufferObj)
|
|
}
|
|
|
|
function _glBindBufferBase(target, index, buffer) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
GLctx["bindBufferBase"](target, index, bufferObj)
|
|
}
|
|
|
|
function _glBindBufferRange(target, index, buffer, offset, ptrsize) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
GLctx["bindBufferRange"](target, index, bufferObj, offset, ptrsize)
|
|
}
|
|
|
|
function _glBindFramebuffer(target, framebuffer) {
|
|
GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null)
|
|
}
|
|
|
|
function _glBindRenderbuffer(target, renderbuffer) {
|
|
GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null)
|
|
}
|
|
|
|
function _glBindSampler(unit, sampler) {
|
|
GLctx["bindSampler"](unit, sampler ? GL.samplers[sampler] : null)
|
|
}
|
|
|
|
function _glBindTexture(target, texture) {
|
|
GLctx.bindTexture(target, texture ? GL.textures[texture] : null)
|
|
}
|
|
|
|
function _glBindTransformFeedback(target, id) {
|
|
var transformFeedback = id ? GL.transformFeedbacks[id] : null;
|
|
if (id && !transformFeedback) {
|
|
GL.recordError(1282);
|
|
return
|
|
}
|
|
GLctx["bindTransformFeedback"](target, transformFeedback)
|
|
}
|
|
|
|
function _glBindVertexArray(vao) {
|
|
GLctx["bindVertexArray"](GL.vaos[vao])
|
|
}
|
|
|
|
function _glBlendEquation(x0) {
|
|
GLctx["blendEquation"](x0)
|
|
}
|
|
|
|
function _glBlendEquationSeparate(x0, x1) {
|
|
GLctx["blendEquationSeparate"](x0, x1)
|
|
}
|
|
|
|
function _glBlendFuncSeparate(x0, x1, x2, x3) {
|
|
GLctx["blendFuncSeparate"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) {
|
|
GLctx["blitFramebuffer"](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9)
|
|
}
|
|
|
|
function _glBufferData(target, size, data, usage) {
|
|
if (!data) {
|
|
GLctx.bufferData(target, size, usage)
|
|
} else {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.bufferData(target, HEAPU8, usage, data, size);
|
|
return
|
|
}
|
|
GLctx.bufferData(target, HEAPU8.subarray(data, data + size), usage)
|
|
}
|
|
}
|
|
|
|
function _glBufferSubData(target, offset, size, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.bufferSubData(target, offset, HEAPU8, data, size);
|
|
return
|
|
}
|
|
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data + size))
|
|
}
|
|
|
|
function _glCheckFramebufferStatus(x0) {
|
|
return GLctx["checkFramebufferStatus"](x0)
|
|
}
|
|
|
|
function _glClear(x0) {
|
|
GLctx["clear"](x0)
|
|
}
|
|
|
|
function _glClearBufferfi(x0, x1, x2, x3) {
|
|
GLctx["clearBufferfi"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glClearBufferfv(buffer, drawbuffer, value) {
|
|
GLctx["clearBufferfv"](buffer, drawbuffer, HEAPF32, value >> 2)
|
|
}
|
|
|
|
function _glClearBufferuiv(buffer, drawbuffer, value) {
|
|
GLctx["clearBufferuiv"](buffer, drawbuffer, HEAPU32, value >> 2)
|
|
}
|
|
|
|
function _glClearColor(x0, x1, x2, x3) {
|
|
GLctx["clearColor"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glClearDepthf(x0) {
|
|
GLctx["clearDepth"](x0)
|
|
}
|
|
|
|
function _glClearStencil(x0) {
|
|
GLctx["clearStencil"](x0)
|
|
}
|
|
|
|
function _glClientWaitSync(sync, flags, timeoutLo, timeoutHi) {
|
|
timeoutLo = timeoutLo >>> 0;
|
|
timeoutHi = timeoutHi >>> 0;
|
|
var timeout = timeoutLo == 4294967295 && timeoutHi == 4294967295 ? -1 : makeBigInt(timeoutLo, timeoutHi, true);
|
|
return GLctx.clientWaitSync(GL.syncs[sync], flags, timeout)
|
|
}
|
|
|
|
function _glColorMask(red, green, blue, alpha) {
|
|
GLctx.colorMask(!!red, !!green, !!blue, !!alpha)
|
|
}
|
|
|
|
function _glCompileShader(shader) {
|
|
GLctx.compileShader(GL.shaders[shader])
|
|
}
|
|
|
|
function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, HEAPU8, data, imageSize);
|
|
return
|
|
}
|
|
GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray(data, data + imageSize) : null)
|
|
}
|
|
|
|
function _glCompressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, HEAPU8, data, imageSize)
|
|
} else {
|
|
GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, data ? HEAPU8.subarray(data, data + imageSize) : null)
|
|
}
|
|
}
|
|
|
|
function _glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize);
|
|
return
|
|
}
|
|
GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray(data, data + imageSize) : null)
|
|
}
|
|
|
|
function _glCompressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize)
|
|
} else {
|
|
GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, data ? HEAPU8.subarray(data, data + imageSize) : null)
|
|
}
|
|
}
|
|
|
|
function _glCopyBufferSubData(x0, x1, x2, x3, x4) {
|
|
GLctx["copyBufferSubData"](x0, x1, x2, x3, x4)
|
|
}
|
|
|
|
function _glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) {
|
|
GLctx["copyTexImage2D"](x0, x1, x2, x3, x4, x5, x6, x7)
|
|
}
|
|
|
|
function _glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) {
|
|
GLctx["copyTexSubImage2D"](x0, x1, x2, x3, x4, x5, x6, x7)
|
|
}
|
|
|
|
function _glCreateProgram() {
|
|
var id = GL.getNewId(GL.programs);
|
|
var program = GLctx.createProgram();
|
|
program.name = id;
|
|
GL.programs[id] = program;
|
|
return id
|
|
}
|
|
|
|
function _glCreateShader(shaderType) {
|
|
var id = GL.getNewId(GL.shaders);
|
|
GL.shaders[id] = GLctx.createShader(shaderType);
|
|
return id
|
|
}
|
|
|
|
function _glCullFace(x0) {
|
|
GLctx["cullFace"](x0)
|
|
}
|
|
|
|
function _glDeleteBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[buffers + i * 4 >> 2];
|
|
var buffer = GL.buffers[id];
|
|
if (!buffer) continue;
|
|
GLctx.deleteBuffer(buffer);
|
|
buffer.name = 0;
|
|
GL.buffers[id] = null;
|
|
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
|
|
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0
|
|
}
|
|
}
|
|
|
|
function _glDeleteFramebuffers(n, framebuffers) {
|
|
for (var i = 0; i < n; ++i) {
|
|
var id = HEAP32[framebuffers + i * 4 >> 2];
|
|
var framebuffer = GL.framebuffers[id];
|
|
if (!framebuffer) continue;
|
|
GLctx.deleteFramebuffer(framebuffer);
|
|
framebuffer.name = 0;
|
|
GL.framebuffers[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDeleteProgram(id) {
|
|
if (!id) return;
|
|
var program = GL.programs[id];
|
|
if (!program) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
GLctx.deleteProgram(program);
|
|
program.name = 0;
|
|
GL.programs[id] = null;
|
|
GL.programInfos[id] = null
|
|
}
|
|
|
|
function _glDeleteQueries(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[ids + i * 4 >> 2];
|
|
var query = GL.queries[id];
|
|
if (!query) continue;
|
|
GLctx["deleteQuery"](query);
|
|
GL.queries[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDeleteRenderbuffers(n, renderbuffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[renderbuffers + i * 4 >> 2];
|
|
var renderbuffer = GL.renderbuffers[id];
|
|
if (!renderbuffer) continue;
|
|
GLctx.deleteRenderbuffer(renderbuffer);
|
|
renderbuffer.name = 0;
|
|
GL.renderbuffers[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDeleteSamplers(n, samplers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[samplers + i * 4 >> 2];
|
|
var sampler = GL.samplers[id];
|
|
if (!sampler) continue;
|
|
GLctx["deleteSampler"](sampler);
|
|
sampler.name = 0;
|
|
GL.samplers[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDeleteShader(id) {
|
|
if (!id) return;
|
|
var shader = GL.shaders[id];
|
|
if (!shader) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
GLctx.deleteShader(shader);
|
|
GL.shaders[id] = null
|
|
}
|
|
|
|
function _glDeleteSync(id) {
|
|
if (!id) return;
|
|
var sync = GL.syncs[id];
|
|
if (!sync) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
GLctx.deleteSync(sync);
|
|
sync.name = 0;
|
|
GL.syncs[id] = null
|
|
}
|
|
|
|
function _glDeleteTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[textures + i * 4 >> 2];
|
|
var texture = GL.textures[id];
|
|
if (!texture) continue;
|
|
GLctx.deleteTexture(texture);
|
|
texture.name = 0;
|
|
GL.textures[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDeleteTransformFeedbacks(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[ids + i * 4 >> 2];
|
|
var transformFeedback = GL.transformFeedbacks[id];
|
|
if (!transformFeedback) continue;
|
|
GLctx["deleteTransformFeedback"](transformFeedback);
|
|
transformFeedback.name = 0;
|
|
GL.transformFeedbacks[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDeleteVertexArrays(n, vaos) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[vaos + i * 4 >> 2];
|
|
GLctx["deleteVertexArray"](GL.vaos[id]);
|
|
GL.vaos[id] = null
|
|
}
|
|
}
|
|
|
|
function _glDepthFunc(x0) {
|
|
GLctx["depthFunc"](x0)
|
|
}
|
|
|
|
function _glDepthMask(flag) {
|
|
GLctx.depthMask(!!flag)
|
|
}
|
|
|
|
function _glDetachShader(program, shader) {
|
|
GLctx.detachShader(GL.programs[program], GL.shaders[shader])
|
|
}
|
|
|
|
function _glDisable(x0) {
|
|
GLctx["disable"](x0)
|
|
}
|
|
|
|
function _glDisableVertexAttribArray(index) {
|
|
GLctx.disableVertexAttribArray(index)
|
|
}
|
|
|
|
function _glDrawArrays(mode, first, count) {
|
|
GLctx.drawArrays(mode, first, count)
|
|
}
|
|
|
|
function _glDrawArraysInstanced(mode, first, count, primcount) {
|
|
GLctx["drawArraysInstanced"](mode, first, count, primcount)
|
|
}
|
|
|
|
function _glDrawBuffers(n, bufs) {
|
|
var bufArray = GL.tempFixedLengthArray[n];
|
|
for (var i = 0; i < n; i++) {
|
|
bufArray[i] = HEAP32[bufs + i * 4 >> 2]
|
|
}
|
|
GLctx["drawBuffers"](bufArray)
|
|
}
|
|
|
|
function _glDrawElements(mode, count, type, indices) {
|
|
GLctx.drawElements(mode, count, type, indices)
|
|
}
|
|
|
|
function _glDrawElementsInstanced(mode, count, type, indices, primcount) {
|
|
GLctx["drawElementsInstanced"](mode, count, type, indices, primcount)
|
|
}
|
|
|
|
function _glEnable(x0) {
|
|
GLctx["enable"](x0)
|
|
}
|
|
|
|
function _glEnableVertexAttribArray(index) {
|
|
GLctx.enableVertexAttribArray(index)
|
|
}
|
|
|
|
function _glEndQuery(x0) {
|
|
GLctx["endQuery"](x0)
|
|
}
|
|
|
|
function _glEndTransformFeedback() {
|
|
GLctx["endTransformFeedback"]()
|
|
}
|
|
|
|
function _glFenceSync(condition, flags) {
|
|
var sync = GLctx.fenceSync(condition, flags);
|
|
if (sync) {
|
|
var id = GL.getNewId(GL.syncs);
|
|
sync.name = id;
|
|
GL.syncs[id] = sync;
|
|
return id
|
|
} else {
|
|
return 0
|
|
}
|
|
}
|
|
|
|
function _glFinish() {
|
|
GLctx["finish"]()
|
|
}
|
|
|
|
function _glFlush() {
|
|
GLctx["flush"]()
|
|
}
|
|
|
|
function emscriptenWebGLGetBufferBinding(target) {
|
|
switch (target) {
|
|
case 34962:
|
|
target = 34964;
|
|
break;
|
|
case 34963:
|
|
target = 34965;
|
|
break;
|
|
case 35051:
|
|
target = 35053;
|
|
break;
|
|
case 35052:
|
|
target = 35055;
|
|
break;
|
|
case 35982:
|
|
target = 35983;
|
|
break;
|
|
case 36662:
|
|
target = 36662;
|
|
break;
|
|
case 36663:
|
|
target = 36663;
|
|
break;
|
|
case 35345:
|
|
target = 35368;
|
|
break
|
|
}
|
|
var buffer = GLctx.getParameter(target);
|
|
if (buffer) return buffer.name | 0;
|
|
else return 0
|
|
}
|
|
|
|
function emscriptenWebGLValidateMapBufferTarget(target) {
|
|
switch (target) {
|
|
case 34962:
|
|
case 34963:
|
|
case 36662:
|
|
case 36663:
|
|
case 35051:
|
|
case 35052:
|
|
case 35882:
|
|
case 35982:
|
|
case 35345:
|
|
return true;
|
|
default:
|
|
return false
|
|
}
|
|
}
|
|
|
|
function _glFlushMappedBufferRange(target, offset, length) {
|
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) {
|
|
GL.recordError(1280);
|
|
err("GL_INVALID_ENUM in glFlushMappedBufferRange");
|
|
return
|
|
}
|
|
var mapping = GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)];
|
|
if (!mapping) {
|
|
GL.recordError(1282);
|
|
Module.printError("buffer was never mapped in glFlushMappedBufferRange");
|
|
return
|
|
}
|
|
if (!(mapping.access & 16)) {
|
|
GL.recordError(1282);
|
|
Module.printError("buffer was not mapped with GL_MAP_FLUSH_EXPLICIT_BIT in glFlushMappedBufferRange");
|
|
return
|
|
}
|
|
if (offset < 0 || length < 0 || offset + length > mapping.length) {
|
|
GL.recordError(1281);
|
|
Module.printError("invalid range in glFlushMappedBufferRange");
|
|
return
|
|
}
|
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem + offset, mapping.mem + offset + length))
|
|
}
|
|
|
|
function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
|
|
GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer])
|
|
}
|
|
|
|
function _glFramebufferTexture2D(target, attachment, textarget, texture, level) {
|
|
GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level)
|
|
}
|
|
|
|
function _glFramebufferTextureLayer(target, attachment, texture, level, layer) {
|
|
GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer)
|
|
}
|
|
|
|
function _glFrontFace(x0) {
|
|
GLctx["frontFace"](x0)
|
|
}
|
|
|
|
function _glGenBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var buffer = GLctx.createBuffer();
|
|
if (!buffer) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[buffers + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.buffers);
|
|
buffer.name = id;
|
|
GL.buffers[id] = buffer;
|
|
HEAP32[buffers + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenFramebuffers(n, ids) {
|
|
for (var i = 0; i < n; ++i) {
|
|
var framebuffer = GLctx.createFramebuffer();
|
|
if (!framebuffer) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[ids + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.framebuffers);
|
|
framebuffer.name = id;
|
|
GL.framebuffers[id] = framebuffer;
|
|
HEAP32[ids + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenQueries(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var query = GLctx["createQuery"]();
|
|
if (!query) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[ids + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.queries);
|
|
query.name = id;
|
|
GL.queries[id] = query;
|
|
HEAP32[ids + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenRenderbuffers(n, renderbuffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var renderbuffer = GLctx.createRenderbuffer();
|
|
if (!renderbuffer) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[renderbuffers + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.renderbuffers);
|
|
renderbuffer.name = id;
|
|
GL.renderbuffers[id] = renderbuffer;
|
|
HEAP32[renderbuffers + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenSamplers(n, samplers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var sampler = GLctx["createSampler"]();
|
|
if (!sampler) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[samplers + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.samplers);
|
|
sampler.name = id;
|
|
GL.samplers[id] = sampler;
|
|
HEAP32[samplers + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var texture = GLctx.createTexture();
|
|
if (!texture) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[textures + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.textures);
|
|
texture.name = id;
|
|
GL.textures[id] = texture;
|
|
HEAP32[textures + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenTransformFeedbacks(n, ids) {
|
|
for (var i = 0; i < n; i++) {
|
|
var transformFeedback = GLctx["createTransformFeedback"]();
|
|
if (!transformFeedback) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[ids + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.transformFeedbacks);
|
|
transformFeedback.name = id;
|
|
GL.transformFeedbacks[id] = transformFeedback;
|
|
HEAP32[ids + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenVertexArrays(n, arrays) {
|
|
for (var i = 0; i < n; i++) {
|
|
var vao = GLctx["createVertexArray"]();
|
|
if (!vao) {
|
|
GL.recordError(1282);
|
|
while (i < n) HEAP32[arrays + i++ * 4 >> 2] = 0;
|
|
return
|
|
}
|
|
var id = GL.getNewId(GL.vaos);
|
|
vao.name = id;
|
|
GL.vaos[id] = vao;
|
|
HEAP32[arrays + i * 4 >> 2] = id
|
|
}
|
|
}
|
|
|
|
function _glGenerateMipmap(x0) {
|
|
GLctx["generateMipmap"](x0)
|
|
}
|
|
|
|
function _glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getActiveAttrib(program, index);
|
|
if (!info) return;
|
|
if (bufSize > 0 && name) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0
|
|
}
|
|
if (size) HEAP32[size >> 2] = info.size;
|
|
if (type) HEAP32[type >> 2] = info.type
|
|
}
|
|
|
|
function _glGetActiveUniform(program, index, bufSize, length, size, type, name) {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getActiveUniform(program, index);
|
|
if (!info) return;
|
|
if (bufSize > 0 && name) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0
|
|
}
|
|
if (size) HEAP32[size >> 2] = info.size;
|
|
if (type) HEAP32[type >> 2] = info.type
|
|
}
|
|
|
|
function _glGetActiveUniformBlockName(program, uniformBlockIndex, bufSize, length, uniformBlockName) {
|
|
program = GL.programs[program];
|
|
var result = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex);
|
|
if (!result) return;
|
|
if (uniformBlockName && bufSize > 0) {
|
|
var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0
|
|
}
|
|
}
|
|
|
|
function _glGetActiveUniformBlockiv(program, uniformBlockIndex, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
program = GL.programs[program];
|
|
switch (pname) {
|
|
case 35393:
|
|
var name = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex);
|
|
HEAP32[params >> 2] = name.length + 1;
|
|
return;
|
|
default:
|
|
var result = GLctx["getActiveUniformBlockParameter"](program, uniformBlockIndex, pname);
|
|
if (!result) return;
|
|
if (typeof result == "number") {
|
|
HEAP32[params >> 2] = result
|
|
} else {
|
|
for (var i = 0; i < result.length; i++) {
|
|
HEAP32[params + i * 4 >> 2] = result[i]
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
function _glGetActiveUniformsiv(program, uniformCount, uniformIndices, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
if (uniformCount > 0 && uniformIndices == 0) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
program = GL.programs[program];
|
|
var ids = [];
|
|
for (var i = 0; i < uniformCount; i++) {
|
|
ids.push(HEAP32[uniformIndices + i * 4 >> 2])
|
|
}
|
|
var result = GLctx["getActiveUniforms"](program, ids, pname);
|
|
if (!result) return;
|
|
var len = result.length;
|
|
for (var i = 0; i < len; i++) {
|
|
HEAP32[params + i * 4 >> 2] = result[i]
|
|
}
|
|
}
|
|
|
|
function _glGetAttribLocation(program, name) {
|
|
return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name))
|
|
}
|
|
|
|
function _glGetError() {
|
|
if (GL.lastError) {
|
|
var error = GL.lastError;
|
|
GL.lastError = 0;
|
|
return error
|
|
} else {
|
|
return GLctx.getError()
|
|
}
|
|
}
|
|
|
|
function _glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
|
|
var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
|
|
if (result instanceof WebGLRenderbuffer || result instanceof WebGLTexture) {
|
|
result = result.name | 0
|
|
}
|
|
HEAP32[params >> 2] = result
|
|
}
|
|
|
|
function emscriptenWebGLGetIndexed(target, index, data, type) {
|
|
if (!data) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var result = GLctx["getIndexedParameter"](target, index);
|
|
var ret;
|
|
switch (typeof result) {
|
|
case "boolean":
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case "number":
|
|
ret = result;
|
|
break;
|
|
case "object":
|
|
if (result === null) {
|
|
switch (target) {
|
|
case 35983:
|
|
case 35368:
|
|
ret = 0;
|
|
break;
|
|
default:
|
|
{
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
}
|
|
} else if (result instanceof WebGLBuffer) {
|
|
ret = result.name | 0
|
|
} else {
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
switch (type) {
|
|
case "Integer64":
|
|
tempI64 = [ret >>> 0, (tempDouble = ret, +Math_abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[data >> 2] = tempI64[0], HEAP32[data + 4 >> 2] = tempI64[1];
|
|
break;
|
|
case "Integer":
|
|
HEAP32[data >> 2] = ret;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[data >> 2] = ret;
|
|
break;
|
|
case "Boolean":
|
|
HEAP8[data >> 0] = ret ? 1 : 0;
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetIndexed() error, bad type: " + type
|
|
}
|
|
}
|
|
|
|
function _glGetIntegeri_v(target, index, data) {
|
|
emscriptenWebGLGetIndexed(target, index, data, "Integer")
|
|
}
|
|
|
|
function emscriptenWebGLGet(name_, p, type) {
|
|
if (!p) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var ret = undefined;
|
|
switch (name_) {
|
|
case 36346:
|
|
ret = 1;
|
|
break;
|
|
case 36344:
|
|
if (type !== "Integer" && type !== "Integer64") {
|
|
GL.recordError(1280)
|
|
}
|
|
return;
|
|
case 34814:
|
|
case 36345:
|
|
ret = 0;
|
|
break;
|
|
case 34466:
|
|
var formats = GLctx.getParameter(34467);
|
|
ret = formats.length;
|
|
break;
|
|
case 33309:
|
|
if (GLctx.canvas.GLctxObject.version < 2) {
|
|
GL.recordError(1282);
|
|
return
|
|
}
|
|
var exts = GLctx.getSupportedExtensions();
|
|
ret = 2 * exts.length;
|
|
break;
|
|
case 33307:
|
|
case 33308:
|
|
if (GLctx.canvas.GLctxObject.version < 2) {
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
ret = name_ == 33307 ? 3 : 0;
|
|
break
|
|
}
|
|
if (ret === undefined) {
|
|
var result = GLctx.getParameter(name_);
|
|
switch (typeof result) {
|
|
case "number":
|
|
ret = result;
|
|
break;
|
|
case "boolean":
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case "string":
|
|
GL.recordError(1280);
|
|
return;
|
|
case "object":
|
|
if (result === null) {
|
|
switch (name_) {
|
|
case 34964:
|
|
case 35725:
|
|
case 34965:
|
|
case 36006:
|
|
case 36007:
|
|
case 32873:
|
|
case 34229:
|
|
case 35097:
|
|
case 36389:
|
|
case 34068:
|
|
{
|
|
ret = 0;
|
|
break
|
|
};
|
|
default:
|
|
{
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
}
|
|
} else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) {
|
|
for (var i = 0; i < result.length; ++i) {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[p + i * 4 >> 2] = result[i];
|
|
break;
|
|
case "Float":
|
|
HEAPF32[p + i * 4 >> 2] = result[i];
|
|
break;
|
|
case "Boolean":
|
|
HEAP8[p + i >> 0] = result[i] ? 1 : 0;
|
|
break;
|
|
default:
|
|
throw "internal glGet error, bad type: " + type
|
|
}
|
|
}
|
|
return
|
|
} else if (result instanceof WebGLBuffer || result instanceof WebGLProgram || result instanceof WebGLFramebuffer || result instanceof WebGLRenderbuffer || result instanceof WebGLQuery || result instanceof WebGLSampler || result instanceof WebGLSync || result instanceof WebGLTransformFeedback || result instanceof WebGLVertexArrayObject || result instanceof WebGLTexture) {
|
|
ret = result.name | 0
|
|
} else {
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
}
|
|
switch (type) {
|
|
case "Integer64":
|
|
tempI64 = [ret >>> 0, (tempDouble = ret, +Math_abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[p >> 2] = tempI64[0], HEAP32[p + 4 >> 2] = tempI64[1];
|
|
break;
|
|
case "Integer":
|
|
HEAP32[p >> 2] = ret;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[p >> 2] = ret;
|
|
break;
|
|
case "Boolean":
|
|
HEAP8[p >> 0] = ret ? 1 : 0;
|
|
break;
|
|
default:
|
|
throw "internal glGet error, bad type: " + type
|
|
}
|
|
}
|
|
|
|
function _glGetIntegerv(name_, p) {
|
|
emscriptenWebGLGet(name_, p, "Integer")
|
|
}
|
|
|
|
function _glGetInternalformativ(target, internalformat, pname, bufSize, params) {
|
|
if (bufSize < 0) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var samples = GLctx["getInternalformatParameter"](target, internalformat, 32937);
|
|
if (!samples) {
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
switch (pname) {
|
|
case 32937:
|
|
var n = Math.min(bufSize, samples.length);
|
|
for (var i = 0; i < n; i++) {
|
|
var v = samples[i];
|
|
HEAP32[params + i * 4 >> 2] = v
|
|
}
|
|
break;
|
|
case 37760:
|
|
if (bufSize > 1) {
|
|
var v = samples.length;
|
|
HEAP32[params >> 2] = v
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(1280)
|
|
}
|
|
}
|
|
|
|
function _glGetProgramBinary(program, bufSize, length, binaryFormat, binary) {
|
|
GL.recordError(1282)
|
|
}
|
|
|
|
function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = "(unknown error)";
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0
|
|
}
|
|
}
|
|
|
|
function _glGetProgramiv(program, pname, p) {
|
|
if (!p) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
if (program >= GL.counter) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
GL.recordError(1282);
|
|
return
|
|
}
|
|
if (pname == 35716) {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = "(unknown error)";
|
|
HEAP32[p >> 2] = log.length + 1
|
|
} else if (pname == 35719) {
|
|
HEAP32[p >> 2] = ptable.maxUniformLength
|
|
} else if (pname == 35722) {
|
|
if (ptable.maxAttributeLength == -1) {
|
|
program = GL.programs[program];
|
|
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
|
|
ptable.maxAttributeLength = 0;
|
|
for (var i = 0; i < numAttribs; ++i) {
|
|
var activeAttrib = GLctx.getActiveAttrib(program, i);
|
|
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length + 1)
|
|
}
|
|
}
|
|
HEAP32[p >> 2] = ptable.maxAttributeLength
|
|
} else if (pname == 35381) {
|
|
if (ptable.maxUniformBlockNameLength == -1) {
|
|
program = GL.programs[program];
|
|
var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
|
|
ptable.maxUniformBlockNameLength = 0;
|
|
for (var i = 0; i < numBlocks; ++i) {
|
|
var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
|
|
ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length + 1)
|
|
}
|
|
}
|
|
HEAP32[p >> 2] = ptable.maxUniformBlockNameLength
|
|
} else {
|
|
HEAP32[p >> 2] = GLctx.getProgramParameter(GL.programs[program], pname)
|
|
}
|
|
}
|
|
|
|
function _glGetQueryObjectuiv(id, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var query = GL.queries[id];
|
|
var param = GLctx["getQueryParameter"](query, pname);
|
|
var ret;
|
|
if (typeof param == "boolean") {
|
|
ret = param ? 1 : 0
|
|
} else {
|
|
ret = param
|
|
}
|
|
HEAP32[params >> 2] = ret
|
|
}
|
|
|
|
function _glGetQueryiv(target, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
HEAP32[params >> 2] = GLctx["getQuery"](target, pname)
|
|
}
|
|
|
|
function _glGetRenderbufferParameteriv(target, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
HEAP32[params >> 2] = GLctx.getRenderbufferParameter(target, pname)
|
|
}
|
|
|
|
function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = "(unknown error)";
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0
|
|
}
|
|
}
|
|
|
|
function _glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
|
|
var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
|
|
HEAP32[range >> 2] = result.rangeMin;
|
|
HEAP32[range + 4 >> 2] = result.rangeMax;
|
|
HEAP32[precision >> 2] = result.precision
|
|
}
|
|
|
|
function _glGetShaderSource(shader, bufSize, length, source) {
|
|
var result = GLctx.getShaderSource(GL.shaders[shader]);
|
|
if (!result) return;
|
|
if (bufSize > 0 && source) {
|
|
var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
|
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull
|
|
} else {
|
|
if (length) HEAP32[length >> 2] = 0
|
|
}
|
|
}
|
|
|
|
function _glGetShaderiv(shader, pname, p) {
|
|
if (!p) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
if (pname == 35716) {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = "(unknown error)";
|
|
HEAP32[p >> 2] = log.length + 1
|
|
} else if (pname == 35720) {
|
|
var source = GLctx.getShaderSource(GL.shaders[shader]);
|
|
var sourceLength = source === null || source.length == 0 ? 0 : source.length + 1;
|
|
HEAP32[p >> 2] = sourceLength
|
|
} else {
|
|
HEAP32[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname)
|
|
}
|
|
}
|
|
|
|
function _glGetString(name_) {
|
|
if (GL.stringCache[name_]) return GL.stringCache[name_];
|
|
var ret;
|
|
switch (name_) {
|
|
case 7936:
|
|
case 7937:
|
|
case 37445:
|
|
case 37446:
|
|
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), "i8", ALLOC_NORMAL);
|
|
break;
|
|
case 7938:
|
|
var glVersion = GLctx.getParameter(GLctx.VERSION);
|
|
if (GLctx.canvas.GLctxObject.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")";
|
|
else {
|
|
glVersion = "OpenGL ES 2.0 (" + glVersion + ")"
|
|
}
|
|
ret = allocate(intArrayFromString(glVersion), "i8", ALLOC_NORMAL);
|
|
break;
|
|
case 7939:
|
|
var exts = GLctx.getSupportedExtensions();
|
|
var gl_exts = [];
|
|
for (var i = 0; i < exts.length; ++i) {
|
|
gl_exts.push(exts[i]);
|
|
gl_exts.push("GL_" + exts[i])
|
|
}
|
|
ret = allocate(intArrayFromString(gl_exts.join(" ")), "i8", ALLOC_NORMAL);
|
|
break;
|
|
case 35724:
|
|
var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
|
|
var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
|
|
var ver_num = glslVersion.match(ver_re);
|
|
if (ver_num !== null) {
|
|
if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0";
|
|
glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")"
|
|
}
|
|
ret = allocate(intArrayFromString(glslVersion), "i8", ALLOC_NORMAL);
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return 0
|
|
}
|
|
GL.stringCache[name_] = ret;
|
|
return ret
|
|
}
|
|
|
|
function _glGetStringi(name, index) {
|
|
if (GLctx.canvas.GLctxObject.version < 2) {
|
|
GL.recordError(1282);
|
|
return 0
|
|
}
|
|
var stringiCache = GL.stringiCache[name];
|
|
if (stringiCache) {
|
|
if (index < 0 || index >= stringiCache.length) {
|
|
GL.recordError(1281);
|
|
return 0
|
|
}
|
|
return stringiCache[index]
|
|
}
|
|
switch (name) {
|
|
case 7939:
|
|
var exts = GLctx.getSupportedExtensions();
|
|
var gl_exts = [];
|
|
for (var i = 0; i < exts.length; ++i) {
|
|
gl_exts.push(allocate(intArrayFromString(exts[i]), "i8", ALLOC_NORMAL));
|
|
gl_exts.push(allocate(intArrayFromString("GL_" + exts[i]), "i8", ALLOC_NORMAL))
|
|
}
|
|
stringiCache = GL.stringiCache[name] = gl_exts;
|
|
if (index < 0 || index >= stringiCache.length) {
|
|
GL.recordError(1281);
|
|
return 0
|
|
}
|
|
return stringiCache[index];
|
|
default:
|
|
GL.recordError(1280);
|
|
return 0
|
|
}
|
|
}
|
|
|
|
function _glGetTexParameteriv(target, pname, params) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
HEAP32[params >> 2] = GLctx.getTexParameter(target, pname)
|
|
}
|
|
|
|
function _glGetUniformBlockIndex(program, uniformBlockName) {
|
|
program = GL.programs[program];
|
|
uniformBlockName = Pointer_stringify(uniformBlockName);
|
|
return GLctx["getUniformBlockIndex"](program, uniformBlockName)
|
|
}
|
|
|
|
function _glGetUniformIndices(program, uniformCount, uniformNames, uniformIndices) {
|
|
if (!uniformIndices) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
program = GL.programs[program];
|
|
var names = [];
|
|
for (var i = 0; i < uniformCount; i++) names.push(Pointer_stringify(HEAP32[uniformNames + i * 4 >> 2]));
|
|
var result = GLctx["getUniformIndices"](program, names);
|
|
if (!result) return;
|
|
var len = result.length;
|
|
for (var i = 0; i < len; i++) {
|
|
HEAP32[uniformIndices + i * 4 >> 2] = result[i]
|
|
}
|
|
}
|
|
|
|
function _glGetUniformLocation(program, name) {
|
|
name = Pointer_stringify(name);
|
|
var arrayOffset = 0;
|
|
if (name.indexOf("]", name.length - 1) !== -1) {
|
|
var ls = name.lastIndexOf("[");
|
|
var arrayIndex = name.slice(ls + 1, -1);
|
|
if (arrayIndex.length > 0) {
|
|
arrayOffset = parseInt(arrayIndex);
|
|
if (arrayOffset < 0) {
|
|
return -1
|
|
}
|
|
}
|
|
name = name.slice(0, ls)
|
|
}
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
return -1
|
|
}
|
|
var utable = ptable.uniforms;
|
|
var uniformInfo = utable[name];
|
|
if (uniformInfo && arrayOffset < uniformInfo[0]) {
|
|
return uniformInfo[1] + arrayOffset
|
|
} else {
|
|
return -1
|
|
}
|
|
}
|
|
|
|
function emscriptenWebGLGetUniform(program, location, params, type) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
|
|
if (typeof data == "number" || typeof data == "boolean") {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[params >> 2] = data;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[params >> 2] = data;
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetUniform() error, bad type: " + type
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[params + i * 4 >> 2] = data[i];
|
|
break;
|
|
case "Float":
|
|
HEAPF32[params + i * 4 >> 2] = data[i];
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetUniform() error, bad type: " + type
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
function _glGetUniformiv(program, location, params) {
|
|
emscriptenWebGLGetUniform(program, location, params, "Integer")
|
|
}
|
|
|
|
function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
|
|
if (!params) {
|
|
GL.recordError(1281);
|
|
return
|
|
}
|
|
var data = GLctx.getVertexAttrib(index, pname);
|
|
if (pname == 34975) {
|
|
HEAP32[params >> 2] = data["name"]
|
|
} else if (typeof data == "number" || typeof data == "boolean") {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[params >> 2] = data;
|
|
break;
|
|
case "Float":
|
|
HEAPF32[params >> 2] = data;
|
|
break;
|
|
case "FloatToInteger":
|
|
HEAP32[params >> 2] = Math.fround(data);
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetVertexAttrib() error, bad type: " + type
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case "Integer":
|
|
HEAP32[params + i * 4 >> 2] = data[i];
|
|
break;
|
|
case "Float":
|
|
HEAPF32[params + i * 4 >> 2] = data[i];
|
|
break;
|
|
case "FloatToInteger":
|
|
HEAP32[params + i * 4 >> 2] = Math.fround(data[i]);
|
|
break;
|
|
default:
|
|
throw "internal emscriptenWebGLGetVertexAttrib() error, bad type: " + type
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
function _glGetVertexAttribiv(index, pname, params) {
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, "FloatToInteger")
|
|
}
|
|
|
|
function _glInvalidateFramebuffer(target, numAttachments, attachments) {
|
|
var list = GL.tempFixedLengthArray[numAttachments];
|
|
for (var i = 0; i < numAttachments; i++) {
|
|
list[i] = HEAP32[attachments + i * 4 >> 2]
|
|
}
|
|
GLctx["invalidateFramebuffer"](target, list)
|
|
}
|
|
|
|
function _glIsEnabled(x0) {
|
|
return GLctx["isEnabled"](x0)
|
|
}
|
|
|
|
function _glIsVertexArray(array) {
|
|
var vao = GL.vaos[array];
|
|
if (!vao) return 0;
|
|
return GLctx["isVertexArray"](vao)
|
|
}
|
|
|
|
function _glLinkProgram(program) {
|
|
GLctx.linkProgram(GL.programs[program]);
|
|
GL.programInfos[program] = null;
|
|
GL.populateUniformTable(program)
|
|
}
|
|
|
|
function _glMapBufferRange(target, offset, length, access) {
|
|
if (access != 26 && access != 10) {
|
|
err("glMapBufferRange is only supported when access is MAP_WRITE|INVALIDATE_BUFFER");
|
|
return 0
|
|
}
|
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) {
|
|
GL.recordError(1280);
|
|
err("GL_INVALID_ENUM in glMapBufferRange");
|
|
return 0
|
|
}
|
|
var mem = _malloc(length);
|
|
if (!mem) return 0;
|
|
GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)] = {
|
|
offset: offset,
|
|
length: length,
|
|
mem: mem,
|
|
access: access
|
|
};
|
|
return mem
|
|
}
|
|
|
|
function _glPixelStorei(pname, param) {
|
|
if (pname == 3333) {
|
|
GL.packAlignment = param
|
|
} else if (pname == 3317) {
|
|
GL.unpackAlignment = param
|
|
}
|
|
GLctx.pixelStorei(pname, param)
|
|
}
|
|
|
|
function _glPolygonOffset(x0, x1) {
|
|
GLctx["polygonOffset"](x0, x1)
|
|
}
|
|
|
|
function _glProgramBinary(program, binaryFormat, binary, length) {
|
|
GL.recordError(1280)
|
|
}
|
|
|
|
function _glProgramParameteri(program, pname, value) {
|
|
GL.recordError(1280)
|
|
}
|
|
|
|
function _glReadBuffer(x0) {
|
|
GLctx["readBuffer"](x0)
|
|
}
|
|
|
|
function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
|
|
function roundedToNextMultipleOf(x, y) {
|
|
return Math.floor((x + y - 1) / y) * y
|
|
}
|
|
var plainRowSize = width * sizePerPixel;
|
|
var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
|
|
return height <= 0 ? 0 : (height - 1) * alignedRowSize + plainRowSize
|
|
}
|
|
|
|
function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
|
|
var sizePerPixel;
|
|
var numChannels;
|
|
switch (format) {
|
|
case 6406:
|
|
case 6409:
|
|
case 6402:
|
|
case 6403:
|
|
case 36244:
|
|
numChannels = 1;
|
|
break;
|
|
case 6410:
|
|
case 33319:
|
|
case 33320:
|
|
numChannels = 2;
|
|
break;
|
|
case 6407:
|
|
case 35904:
|
|
case 36248:
|
|
numChannels = 3;
|
|
break;
|
|
case 6408:
|
|
case 35906:
|
|
case 36249:
|
|
numChannels = 4;
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return null
|
|
}
|
|
switch (type) {
|
|
case 5121:
|
|
case 5120:
|
|
sizePerPixel = numChannels * 1;
|
|
break;
|
|
case 5123:
|
|
case 36193:
|
|
case 5131:
|
|
case 5122:
|
|
sizePerPixel = numChannels * 2;
|
|
break;
|
|
case 5125:
|
|
case 5126:
|
|
case 5124:
|
|
sizePerPixel = numChannels * 4;
|
|
break;
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
sizePerPixel = 4;
|
|
break;
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
sizePerPixel = 2;
|
|
break;
|
|
default:
|
|
GL.recordError(1280);
|
|
return null
|
|
}
|
|
var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
|
|
switch (type) {
|
|
case 5120:
|
|
return HEAP8.subarray(pixels, pixels + bytes);
|
|
case 5121:
|
|
return HEAPU8.subarray(pixels, pixels + bytes);
|
|
case 5122:
|
|
return HEAP16.subarray(pixels >> 1, pixels + bytes >> 1);
|
|
case 5124:
|
|
return HEAP32.subarray(pixels >> 2, pixels + bytes >> 2);
|
|
case 5126:
|
|
return HEAPF32.subarray(pixels >> 2, pixels + bytes >> 2);
|
|
case 5125:
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
return HEAPU32.subarray(pixels >> 2, pixels + bytes >> 2);
|
|
case 5123:
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
case 36193:
|
|
case 5131:
|
|
return HEAPU16.subarray(pixels >> 1, pixels + bytes >> 1);
|
|
default:
|
|
GL.recordError(1280);
|
|
return null
|
|
}
|
|
}
|
|
|
|
function emscriptenWebGLGetHeapForType(type) {
|
|
switch (type) {
|
|
case 5120:
|
|
return HEAP8;
|
|
case 5121:
|
|
return HEAPU8;
|
|
case 5122:
|
|
return HEAP16;
|
|
case 5123:
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
case 36193:
|
|
case 5131:
|
|
return HEAPU16;
|
|
case 5124:
|
|
return HEAP32;
|
|
case 5125:
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
return HEAPU32;
|
|
case 5126:
|
|
return HEAPF32;
|
|
default:
|
|
return null
|
|
}
|
|
}
|
|
|
|
function emscriptenWebGLGetShiftForType(type) {
|
|
switch (type) {
|
|
case 5120:
|
|
case 5121:
|
|
return 0;
|
|
case 5122:
|
|
case 5123:
|
|
case 33635:
|
|
case 32819:
|
|
case 32820:
|
|
case 36193:
|
|
case 5131:
|
|
return 1;
|
|
case 5124:
|
|
case 5126:
|
|
case 5125:
|
|
case 34042:
|
|
case 35902:
|
|
case 33640:
|
|
case 35899:
|
|
case 34042:
|
|
return 2;
|
|
default:
|
|
return 0
|
|
}
|
|
}
|
|
|
|
function _glReadPixels(x, y, width, height, format, type, pixels) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
if (GLctx.currentPixelPackBufferBinding) {
|
|
GLctx.readPixels(x, y, width, height, format, type, pixels)
|
|
} else {
|
|
GLctx.readPixels(x, y, width, height, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type))
|
|
}
|
|
return
|
|
}
|
|
var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
|
|
if (!pixelData) {
|
|
GL.recordError(1280);
|
|
return
|
|
}
|
|
GLctx.readPixels(x, y, width, height, format, type, pixelData)
|
|
}
|
|
|
|
function _glRenderbufferStorage(x0, x1, x2, x3) {
|
|
GLctx["renderbufferStorage"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) {
|
|
GLctx["renderbufferStorageMultisample"](x0, x1, x2, x3, x4)
|
|
}
|
|
|
|
function _glSamplerParameteri(sampler, pname, param) {
|
|
GLctx["samplerParameteri"](sampler ? GL.samplers[sampler] : null, pname, param)
|
|
}
|
|
|
|
function _glScissor(x0, x1, x2, x3) {
|
|
GLctx["scissor"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glShaderSource(shader, count, string, length) {
|
|
var source = GL.getSource(shader, count, string, length);
|
|
GLctx.shaderSource(GL.shaders[shader], source)
|
|
}
|
|
|
|
function _glStencilFuncSeparate(x0, x1, x2, x3) {
|
|
GLctx["stencilFuncSeparate"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glStencilMask(x0) {
|
|
GLctx["stencilMask"](x0)
|
|
}
|
|
|
|
function _glStencilOpSeparate(x0, x1, x2, x3) {
|
|
GLctx["stencilOpSeparate"](x0, x1, x2, x3)
|
|
}
|
|
|
|
function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels)
|
|
} else if (pixels != 0) {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type))
|
|
} else {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null)
|
|
}
|
|
return
|
|
}
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData)
|
|
}
|
|
|
|
function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, pixels)
|
|
} else if (pixels != 0) {
|
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type))
|
|
} else {
|
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, null)
|
|
}
|
|
}
|
|
|
|
function _glTexParameterf(x0, x1, x2) {
|
|
GLctx["texParameterf"](x0, x1, x2)
|
|
}
|
|
|
|
function _glTexParameteri(x0, x1, x2) {
|
|
GLctx["texParameteri"](x0, x1, x2)
|
|
}
|
|
|
|
function _glTexParameteriv(target, pname, params) {
|
|
var param = HEAP32[params >> 2];
|
|
GLctx.texParameteri(target, pname, param)
|
|
}
|
|
|
|
function _glTexStorage2D(x0, x1, x2, x3, x4) {
|
|
GLctx["texStorage2D"](x0, x1, x2, x3, x4)
|
|
}
|
|
|
|
function _glTexStorage3D(x0, x1, x2, x3, x4, x5) {
|
|
GLctx["texStorage3D"](x0, x1, x2, x3, x4, x5)
|
|
}
|
|
|
|
function _glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels)
|
|
} else if (pixels != 0) {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type))
|
|
} else {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, null)
|
|
}
|
|
return
|
|
}
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData)
|
|
}
|
|
|
|
function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels)
|
|
} else if (pixels != 0) {
|
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type))
|
|
} else {
|
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null)
|
|
}
|
|
}
|
|
|
|
function _glTransformFeedbackVaryings(program, count, varyings, bufferMode) {
|
|
program = GL.programs[program];
|
|
var vars = [];
|
|
for (var i = 0; i < count; i++) vars.push(Pointer_stringify(HEAP32[varyings + i * 4 >> 2]));
|
|
GLctx["transformFeedbackVaryings"](program, vars, bufferMode)
|
|
}
|
|
|
|
function _glUniform1fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform1fv(GL.uniforms[location], HEAPF32, value >> 2, count);
|
|
return
|
|
}
|
|
var view;
|
|
if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[count - 1];
|
|
for (var i = 0; i < count; ++i) {
|
|
view[i] = HEAPF32[value + 4 * i >> 2]
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, value + count * 4 >> 2)
|
|
}
|
|
GLctx.uniform1fv(GL.uniforms[location], view)
|
|
}
|
|
|
|
function _glUniform1i(location, v0) {
|
|
GLctx.uniform1i(GL.uniforms[location], v0)
|
|
}
|
|
|
|
function _glUniform1iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32, value >> 2, count);
|
|
return
|
|
}
|
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray(value >> 2, value + count * 4 >> 2))
|
|
}
|
|
|
|
function _glUniform1uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform1uiv(GL.uniforms[location], HEAPU32, value >> 2, count)
|
|
} else {
|
|
GLctx.uniform1uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, value + count * 4 >> 2))
|
|
}
|
|
}
|
|
|
|
function _glUniform2fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform2fv(GL.uniforms[location], HEAPF32, value >> 2, count * 2);
|
|
return
|
|
}
|
|
var view;
|
|
if (2 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[2 * count - 1];
|
|
for (var i = 0; i < 2 * count; i += 2) {
|
|
view[i] = HEAPF32[value + 4 * i >> 2];
|
|
view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, value + count * 8 >> 2)
|
|
}
|
|
GLctx.uniform2fv(GL.uniforms[location], view)
|
|
}
|
|
|
|
function _glUniform2iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32, value >> 2, count * 2);
|
|
return
|
|
}
|
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray(value >> 2, value + count * 8 >> 2))
|
|
}
|
|
|
|
function _glUniform2uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform2uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 2)
|
|
} else {
|
|
GLctx.uniform2uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, value + count * 8 >> 2))
|
|
}
|
|
}
|
|
|
|
function _glUniform3fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform3fv(GL.uniforms[location], HEAPF32, value >> 2, count * 3);
|
|
return
|
|
}
|
|
var view;
|
|
if (3 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[3 * count - 1];
|
|
for (var i = 0; i < 3 * count; i += 3) {
|
|
view[i] = HEAPF32[value + 4 * i >> 2];
|
|
view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2];
|
|
view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2]
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, value + count * 12 >> 2)
|
|
}
|
|
GLctx.uniform3fv(GL.uniforms[location], view)
|
|
}
|
|
|
|
function _glUniform3iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32, value >> 2, count * 3);
|
|
return
|
|
}
|
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray(value >> 2, value + count * 12 >> 2))
|
|
}
|
|
|
|
function _glUniform3uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform3uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 3)
|
|
} else {
|
|
GLctx.uniform3uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, value + count * 12 >> 2))
|
|
}
|
|
}
|
|
|
|
function _glUniform4fv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform4fv(GL.uniforms[location], HEAPF32, value >> 2, count * 4);
|
|
return
|
|
}
|
|
var view;
|
|
if (4 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[4 * count - 1];
|
|
for (var i = 0; i < 4 * count; i += 4) {
|
|
view[i] = HEAPF32[value + 4 * i >> 2];
|
|
view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2];
|
|
view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2];
|
|
view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2]
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, value + count * 16 >> 2)
|
|
}
|
|
GLctx.uniform4fv(GL.uniforms[location], view)
|
|
}
|
|
|
|
function _glUniform4iv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32, value >> 2, count * 4);
|
|
return
|
|
}
|
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray(value >> 2, value + count * 16 >> 2))
|
|
}
|
|
|
|
function _glUniform4uiv(location, count, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniform4uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 4)
|
|
} else {
|
|
GLctx.uniform4uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, value + count * 16 >> 2))
|
|
}
|
|
}
|
|
|
|
function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) {
|
|
program = GL.programs[program];
|
|
GLctx["uniformBlockBinding"](program, uniformBlockIndex, uniformBlockBinding)
|
|
}
|
|
|
|
function _glUniformMatrix3fv(location, count, transpose, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, HEAPF32, value >> 2, count * 9);
|
|
return
|
|
}
|
|
var view;
|
|
if (9 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[9 * count - 1];
|
|
for (var i = 0; i < 9 * count; i += 9) {
|
|
view[i] = HEAPF32[value + 4 * i >> 2];
|
|
view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2];
|
|
view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2];
|
|
view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2];
|
|
view[i + 4] = HEAPF32[value + (4 * i + 16) >> 2];
|
|
view[i + 5] = HEAPF32[value + (4 * i + 20) >> 2];
|
|
view[i + 6] = HEAPF32[value + (4 * i + 24) >> 2];
|
|
view[i + 7] = HEAPF32[value + (4 * i + 28) >> 2];
|
|
view[i + 8] = HEAPF32[value + (4 * i + 32) >> 2]
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, value + count * 36 >> 2)
|
|
}
|
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view)
|
|
}
|
|
|
|
function _glUniformMatrix4fv(location, count, transpose, value) {
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, HEAPF32, value >> 2, count * 16);
|
|
return
|
|
}
|
|
var view;
|
|
if (16 * count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
view = GL.miniTempBufferViews[16 * count - 1];
|
|
for (var i = 0; i < 16 * count; i += 16) {
|
|
view[i] = HEAPF32[value + 4 * i >> 2];
|
|
view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2];
|
|
view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2];
|
|
view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2];
|
|
view[i + 4] = HEAPF32[value + (4 * i + 16) >> 2];
|
|
view[i + 5] = HEAPF32[value + (4 * i + 20) >> 2];
|
|
view[i + 6] = HEAPF32[value + (4 * i + 24) >> 2];
|
|
view[i + 7] = HEAPF32[value + (4 * i + 28) >> 2];
|
|
view[i + 8] = HEAPF32[value + (4 * i + 32) >> 2];
|
|
view[i + 9] = HEAPF32[value + (4 * i + 36) >> 2];
|
|
view[i + 10] = HEAPF32[value + (4 * i + 40) >> 2];
|
|
view[i + 11] = HEAPF32[value + (4 * i + 44) >> 2];
|
|
view[i + 12] = HEAPF32[value + (4 * i + 48) >> 2];
|
|
view[i + 13] = HEAPF32[value + (4 * i + 52) >> 2];
|
|
view[i + 14] = HEAPF32[value + (4 * i + 56) >> 2];
|
|
view[i + 15] = HEAPF32[value + (4 * i + 60) >> 2]
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray(value >> 2, value + count * 64 >> 2)
|
|
}
|
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view)
|
|
}
|
|
|
|
function _glUnmapBuffer(target) {
|
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) {
|
|
GL.recordError(1280);
|
|
err("GL_INVALID_ENUM in glUnmapBuffer");
|
|
return 0
|
|
}
|
|
var buffer = emscriptenWebGLGetBufferBinding(target);
|
|
var mapping = GL.mappedBuffers[buffer];
|
|
if (!mapping) {
|
|
GL.recordError(1282);
|
|
Module.printError("buffer was never mapped in glUnmapBuffer");
|
|
return 0
|
|
}
|
|
GL.mappedBuffers[buffer] = null;
|
|
if (!(mapping.access & 16))
|
|
if (GL.currentContext.supportsWebGL2EntryPoints) {
|
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8, mapping.mem, mapping.length)
|
|
} else {
|
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem, mapping.mem + mapping.length))
|
|
}
|
|
_free(mapping.mem);
|
|
return 1
|
|
}
|
|
|
|
function _glUseProgram(program) {
|
|
GLctx.useProgram(program ? GL.programs[program] : null)
|
|
}
|
|
|
|
function _glValidateProgram(program) {
|
|
GLctx.validateProgram(GL.programs[program])
|
|
}
|
|
|
|
function _glVertexAttrib4f(x0, x1, x2, x3, x4) {
|
|
GLctx["vertexAttrib4f"](x0, x1, x2, x3, x4)
|
|
}
|
|
|
|
function _glVertexAttrib4fv(index, v) {
|
|
GLctx.vertexAttrib4f(index, HEAPF32[v >> 2], HEAPF32[v + 4 >> 2], HEAPF32[v + 8 >> 2], HEAPF32[v + 12 >> 2])
|
|
}
|
|
|
|
function _glVertexAttribIPointer(index, size, type, stride, ptr) {
|
|
var cb = GL.currentContext.clientBuffers[index];
|
|
if (!GL.currArrayBuffer) {
|
|
cb.size = size;
|
|
cb.type = type;
|
|
cb.normalized = false;
|
|
cb.stride = stride;
|
|
cb.ptr = ptr;
|
|
cb.clientside = true;
|
|
return
|
|
}
|
|
cb.clientside = false;
|
|
GLctx.vertexAttribIPointer(index, size, type, stride, ptr)
|
|
}
|
|
|
|
function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
|
|
GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr)
|
|
}
|
|
|
|
function _glViewport(x0, x1, x2, x3) {
|
|
GLctx["viewport"](x0, x1, x2, x3)
|
|
}
|
|
var ___tm_current = STATICTOP;
|
|
STATICTOP += 48;
|
|
var ___tm_timezone = allocate(intArrayFromString("GMT"), "i8", ALLOC_STATIC);
|
|
|
|
function _gmtime_r(time, tmPtr) {
|
|
var date = new Date(HEAP32[time >> 2] * 1e3);
|
|
HEAP32[tmPtr >> 2] = date.getUTCSeconds();
|
|
HEAP32[tmPtr + 4 >> 2] = date.getUTCMinutes();
|
|
HEAP32[tmPtr + 8 >> 2] = date.getUTCHours();
|
|
HEAP32[tmPtr + 12 >> 2] = date.getUTCDate();
|
|
HEAP32[tmPtr + 16 >> 2] = date.getUTCMonth();
|
|
HEAP32[tmPtr + 20 >> 2] = date.getUTCFullYear() - 1900;
|
|
HEAP32[tmPtr + 24 >> 2] = date.getUTCDay();
|
|
HEAP32[tmPtr + 36 >> 2] = 0;
|
|
HEAP32[tmPtr + 32 >> 2] = 0;
|
|
var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
|
|
var yday = (date.getTime() - start) / (1e3 * 60 * 60 * 24) | 0;
|
|
HEAP32[tmPtr + 28 >> 2] = yday;
|
|
HEAP32[tmPtr + 40 >> 2] = ___tm_timezone;
|
|
return tmPtr
|
|
}
|
|
|
|
function _gmtime(time) {
|
|
return _gmtime_r(time, ___tm_current)
|
|
}
|
|
|
|
function _inet_addr(ptr) {
|
|
var addr = __inet_pton4_raw(Pointer_stringify(ptr));
|
|
if (addr === null) {
|
|
return -1
|
|
}
|
|
return addr
|
|
}
|
|
var _llvm_ceil_f32 = Math_ceil;
|
|
var _llvm_ceil_f64 = Math_ceil;
|
|
|
|
function _llvm_copysign_f64(x, y) {
|
|
return y < 0 || y === 0 && 1 / y < 0 ? -Math_abs(x) : Math_abs(x)
|
|
}
|
|
|
|
function _llvm_cttz_i32(x) {
|
|
x = x | 0;
|
|
return (x ? 31 - (Math_clz32(x ^ x - 1) | 0) | 0 : 32) | 0
|
|
}
|
|
|
|
function _llvm_eh_typeid_for(type) {
|
|
return type
|
|
}
|
|
|
|
function _llvm_exp2_f32(x) {
|
|
return Math.pow(2, x)
|
|
}
|
|
var _llvm_fabs_f32 = Math_abs;
|
|
var _llvm_fabs_f64 = Math_abs;
|
|
var _llvm_floor_f32 = Math_floor;
|
|
var _llvm_floor_f64 = Math_floor;
|
|
|
|
function _llvm_log10_f32(x) {
|
|
return Math.log(x) / Math.LN10
|
|
}
|
|
|
|
function _llvm_log2_f32(x) {
|
|
return Math.log(x) / Math.LN2
|
|
}
|
|
var _llvm_pow_f64 = Math_pow;
|
|
|
|
function _llvm_trap() {
|
|
abort("trap!")
|
|
}
|
|
var _llvm_trunc_f32 = Math_trunc;
|
|
|
|
function _tzset() {
|
|
if (_tzset.called) return;
|
|
_tzset.called = true;
|
|
HEAP32[__get_timezone() >> 2] = (new Date).getTimezoneOffset() * 60;
|
|
var currentYear = (new Date).getFullYear();
|
|
var winter = new Date(currentYear, 0, 1);
|
|
var summer = new Date(currentYear, 6, 1);
|
|
HEAP32[__get_daylight() >> 2] = Number(winter.getTimezoneOffset() != summer.getTimezoneOffset());
|
|
|
|
function extractZone(date) {
|
|
var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
|
|
return match ? match[1] : "GMT"
|
|
}
|
|
var winterName = extractZone(winter);
|
|
var summerName = extractZone(summer);
|
|
var winterNamePtr = allocate(intArrayFromString(winterName), "i8", ALLOC_NORMAL);
|
|
var summerNamePtr = allocate(intArrayFromString(summerName), "i8", ALLOC_NORMAL);
|
|
if (summer.getTimezoneOffset() < winter.getTimezoneOffset()) {
|
|
HEAP32[__get_tzname() >> 2] = winterNamePtr;
|
|
HEAP32[__get_tzname() + 4 >> 2] = summerNamePtr
|
|
} else {
|
|
HEAP32[__get_tzname() >> 2] = summerNamePtr;
|
|
HEAP32[__get_tzname() + 4 >> 2] = winterNamePtr
|
|
}
|
|
}
|
|
|
|
function _localtime_r(time, tmPtr) {
|
|
_tzset();
|
|
var date = new Date(HEAP32[time >> 2] * 1e3);
|
|
HEAP32[tmPtr >> 2] = date.getSeconds();
|
|
HEAP32[tmPtr + 4 >> 2] = date.getMinutes();
|
|
HEAP32[tmPtr + 8 >> 2] = date.getHours();
|
|
HEAP32[tmPtr + 12 >> 2] = date.getDate();
|
|
HEAP32[tmPtr + 16 >> 2] = date.getMonth();
|
|
HEAP32[tmPtr + 20 >> 2] = date.getFullYear() - 1900;
|
|
HEAP32[tmPtr + 24 >> 2] = date.getDay();
|
|
var start = new Date(date.getFullYear(), 0, 1);
|
|
var yday = (date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24) | 0;
|
|
HEAP32[tmPtr + 28 >> 2] = yday;
|
|
HEAP32[tmPtr + 36 >> 2] = -(date.getTimezoneOffset() * 60);
|
|
var summerOffset = (new Date(date.getFullYear(), 6, 1)).getTimezoneOffset();
|
|
var winterOffset = start.getTimezoneOffset();
|
|
var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0;
|
|
HEAP32[tmPtr + 32 >> 2] = dst;
|
|
var zonePtr = HEAP32[__get_tzname() + (dst ? 4 : 0) >> 2];
|
|
HEAP32[tmPtr + 40 >> 2] = zonePtr;
|
|
return tmPtr
|
|
}
|
|
|
|
function _localtime(time) {
|
|
return _localtime_r(time, ___tm_current)
|
|
}
|
|
|
|
function _longjmp(env, value) {
|
|
Module["setThrew"](env, value || 1);
|
|
throw "longjmp"
|
|
}
|
|
|
|
function _emscripten_memcpy_big(dest, src, num) {
|
|
HEAPU8.set(HEAPU8.subarray(src, src + num), dest);
|
|
return dest
|
|
}
|
|
|
|
function _mktime(tmPtr) {
|
|
_tzset();
|
|
var date = new Date(HEAP32[tmPtr + 20 >> 2] + 1900, HEAP32[tmPtr + 16 >> 2], HEAP32[tmPtr + 12 >> 2], HEAP32[tmPtr + 8 >> 2], HEAP32[tmPtr + 4 >> 2], HEAP32[tmPtr >> 2], 0);
|
|
var dst = HEAP32[tmPtr + 32 >> 2];
|
|
var guessedOffset = date.getTimezoneOffset();
|
|
var start = new Date(date.getFullYear(), 0, 1);
|
|
var summerOffset = (new Date(date.getFullYear(), 6, 1)).getTimezoneOffset();
|
|
var winterOffset = start.getTimezoneOffset();
|
|
var dstOffset = Math.min(winterOffset, summerOffset);
|
|
if (dst < 0) {
|
|
HEAP32[tmPtr + 32 >> 2] = Number(summerOffset != winterOffset && dstOffset == guessedOffset)
|
|
} else if (dst > 0 != (dstOffset == guessedOffset)) {
|
|
var nonDstOffset = Math.max(winterOffset, summerOffset);
|
|
var trueOffset = dst > 0 ? dstOffset : nonDstOffset;
|
|
date.setTime(date.getTime() + (trueOffset - guessedOffset) * 6e4)
|
|
}
|
|
HEAP32[tmPtr + 24 >> 2] = date.getDay();
|
|
var yday = (date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24) | 0;
|
|
HEAP32[tmPtr + 28 >> 2] = yday;
|
|
return date.getTime() / 1e3 | 0
|
|
}
|
|
|
|
function _usleep(useconds) {
|
|
var msec = useconds / 1e3;
|
|
if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]) {
|
|
var start = self["performance"]["now"]();
|
|
while (self["performance"]["now"]() - start < msec) {}
|
|
} else {
|
|
var start = Date.now();
|
|
while (Date.now() - start < msec) {}
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _nanosleep(rqtp, rmtp) {
|
|
var seconds = HEAP32[rqtp >> 2];
|
|
var nanoseconds = HEAP32[rqtp + 4 >> 2];
|
|
if (rmtp !== 0) {
|
|
HEAP32[rmtp >> 2] = 0;
|
|
HEAP32[rmtp + 4 >> 2] = 0
|
|
}
|
|
return _usleep(seconds * 1e6 + nanoseconds / 1e3)
|
|
}
|
|
|
|
function _pthread_cond_destroy() {
|
|
return 0
|
|
}
|
|
|
|
function _pthread_cond_init() {
|
|
return 0
|
|
}
|
|
|
|
function _pthread_cond_timedwait() {
|
|
return 0
|
|
}
|
|
|
|
function _pthread_cond_wait() {
|
|
return 0
|
|
}
|
|
var PTHREAD_SPECIFIC = {};
|
|
|
|
function _pthread_getspecific(key) {
|
|
return PTHREAD_SPECIFIC[key] || 0
|
|
}
|
|
var PTHREAD_SPECIFIC_NEXT_KEY = 1;
|
|
|
|
function _pthread_key_create(key, destructor) {
|
|
if (key == 0) {
|
|
return ERRNO_CODES.EINVAL
|
|
}
|
|
HEAP32[key >> 2] = PTHREAD_SPECIFIC_NEXT_KEY;
|
|
PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY] = 0;
|
|
PTHREAD_SPECIFIC_NEXT_KEY++;
|
|
return 0
|
|
}
|
|
|
|
function _pthread_key_delete(key) {
|
|
if (key in PTHREAD_SPECIFIC) {
|
|
delete PTHREAD_SPECIFIC[key];
|
|
return 0
|
|
}
|
|
return ERRNO_CODES.EINVAL
|
|
}
|
|
|
|
function _pthread_mutex_destroy() {}
|
|
|
|
function _pthread_mutex_init() {}
|
|
|
|
function _pthread_mutexattr_destroy() {}
|
|
|
|
function _pthread_mutexattr_init() {}
|
|
|
|
function _pthread_mutexattr_setprotocol() {}
|
|
|
|
function _pthread_mutexattr_settype() {}
|
|
|
|
function _pthread_once(ptr, func) {
|
|
if (!_pthread_once.seen) _pthread_once.seen = {};
|
|
if (ptr in _pthread_once.seen) return;
|
|
Module["dynCall_v"](func);
|
|
_pthread_once.seen[ptr] = 1
|
|
}
|
|
|
|
function _pthread_setspecific(key, value) {
|
|
if (!(key in PTHREAD_SPECIFIC)) {
|
|
return ERRNO_CODES.EINVAL
|
|
}
|
|
PTHREAD_SPECIFIC[key] = value;
|
|
return 0
|
|
}
|
|
|
|
function _sched_yield() {
|
|
return 0
|
|
}
|
|
|
|
function _setenv(envname, envval, overwrite) {
|
|
if (envname === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
var name = Pointer_stringify(envname);
|
|
var val = Pointer_stringify(envval);
|
|
if (name === "" || name.indexOf("=") !== -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
if (ENV.hasOwnProperty(name) && !overwrite) return 0;
|
|
ENV[name] = val;
|
|
___buildEnvironment(__get_environ());
|
|
return 0
|
|
}
|
|
|
|
function _sigaction(signum, act, oldact) {
|
|
return 0
|
|
}
|
|
|
|
function _sigemptyset(set) {
|
|
HEAP32[set >> 2] = 0;
|
|
return 0
|
|
}
|
|
|
|
function __isLeapYear(year) {
|
|
return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0)
|
|
}
|
|
|
|
function __arraySum(array, index) {
|
|
var sum = 0;
|
|
for (var i = 0; i <= index; sum += array[i++]);
|
|
return sum
|
|
}
|
|
var __MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
|
|
var __MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
|
|
|
|
function __addDays(date, days) {
|
|
var newDate = new Date(date.getTime());
|
|
while (days > 0) {
|
|
var leap = __isLeapYear(newDate.getFullYear());
|
|
var currentMonth = newDate.getMonth();
|
|
var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth];
|
|
if (days > daysInCurrentMonth - newDate.getDate()) {
|
|
days -= daysInCurrentMonth - newDate.getDate() + 1;
|
|
newDate.setDate(1);
|
|
if (currentMonth < 11) {
|
|
newDate.setMonth(currentMonth + 1)
|
|
} else {
|
|
newDate.setMonth(0);
|
|
newDate.setFullYear(newDate.getFullYear() + 1)
|
|
}
|
|
} else {
|
|
newDate.setDate(newDate.getDate() + days);
|
|
return newDate
|
|
}
|
|
}
|
|
return newDate
|
|
}
|
|
|
|
function _strftime(s, maxsize, format, tm) {
|
|
var tm_zone = HEAP32[tm + 40 >> 2];
|
|
var date = {
|
|
tm_sec: HEAP32[tm >> 2],
|
|
tm_min: HEAP32[tm + 4 >> 2],
|
|
tm_hour: HEAP32[tm + 8 >> 2],
|
|
tm_mday: HEAP32[tm + 12 >> 2],
|
|
tm_mon: HEAP32[tm + 16 >> 2],
|
|
tm_year: HEAP32[tm + 20 >> 2],
|
|
tm_wday: HEAP32[tm + 24 >> 2],
|
|
tm_yday: HEAP32[tm + 28 >> 2],
|
|
tm_isdst: HEAP32[tm + 32 >> 2],
|
|
tm_gmtoff: HEAP32[tm + 36 >> 2],
|
|
tm_zone: tm_zone ? Pointer_stringify(tm_zone) : ""
|
|
};
|
|
var pattern = Pointer_stringify(format);
|
|
var EXPANSION_RULES_1 = {
|
|
"%c": "%a %b %d %H:%M:%S %Y",
|
|
"%D": "%m/%d/%y",
|
|
"%F": "%Y-%m-%d",
|
|
"%h": "%b",
|
|
"%r": "%I:%M:%S %p",
|
|
"%R": "%H:%M",
|
|
"%T": "%H:%M:%S",
|
|
"%x": "%m/%d/%y",
|
|
"%X": "%H:%M:%S"
|
|
};
|
|
for (var rule in EXPANSION_RULES_1) {
|
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule])
|
|
}
|
|
var WEEKDAYS = ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"];
|
|
var MONTHS = ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"];
|
|
|
|
function leadingSomething(value, digits, character) {
|
|
var str = typeof value === "number" ? value.toString() : value || "";
|
|
while (str.length < digits) {
|
|
str = character[0] + str
|
|
}
|
|
return str
|
|
}
|
|
|
|
function leadingNulls(value, digits) {
|
|
return leadingSomething(value, digits, "0")
|
|
}
|
|
|
|
function compareByDay(date1, date2) {
|
|
function sgn(value) {
|
|
return value < 0 ? -1 : value > 0 ? 1 : 0
|
|
}
|
|
var compare;
|
|
if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) {
|
|
if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) {
|
|
compare = sgn(date1.getDate() - date2.getDate())
|
|
}
|
|
}
|
|
return compare
|
|
}
|
|
|
|
function getFirstWeekStartDate(janFourth) {
|
|
switch (janFourth.getDay()) {
|
|
case 0:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 29);
|
|
case 1:
|
|
return janFourth;
|
|
case 2:
|
|
return new Date(janFourth.getFullYear(), 0, 3);
|
|
case 3:
|
|
return new Date(janFourth.getFullYear(), 0, 2);
|
|
case 4:
|
|
return new Date(janFourth.getFullYear(), 0, 1);
|
|
case 5:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 31);
|
|
case 6:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 30)
|
|
}
|
|
}
|
|
|
|
function getWeekBasedYear(date) {
|
|
var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
|
|
var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
|
|
var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4);
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
|
|
if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
|
|
return thisDate.getFullYear() + 1
|
|
} else {
|
|
return thisDate.getFullYear()
|
|
}
|
|
} else {
|
|
return thisDate.getFullYear() - 1
|
|
}
|
|
}
|
|
var EXPANSION_RULES_2 = {
|
|
"%a": (function(date) {
|
|
return WEEKDAYS[date.tm_wday].substring(0, 3)
|
|
}),
|
|
"%A": (function(date) {
|
|
return WEEKDAYS[date.tm_wday]
|
|
}),
|
|
"%b": (function(date) {
|
|
return MONTHS[date.tm_mon].substring(0, 3)
|
|
}),
|
|
"%B": (function(date) {
|
|
return MONTHS[date.tm_mon]
|
|
}),
|
|
"%C": (function(date) {
|
|
var year = date.tm_year + 1900;
|
|
return leadingNulls(year / 100 | 0, 2)
|
|
}),
|
|
"%d": (function(date) {
|
|
return leadingNulls(date.tm_mday, 2)
|
|
}),
|
|
"%e": (function(date) {
|
|
return leadingSomething(date.tm_mday, 2, " ")
|
|
}),
|
|
"%g": (function(date) {
|
|
return getWeekBasedYear(date).toString().substring(2)
|
|
}),
|
|
"%G": (function(date) {
|
|
return getWeekBasedYear(date)
|
|
}),
|
|
"%H": (function(date) {
|
|
return leadingNulls(date.tm_hour, 2)
|
|
}),
|
|
"%I": (function(date) {
|
|
var twelveHour = date.tm_hour;
|
|
if (twelveHour == 0) twelveHour = 12;
|
|
else if (twelveHour > 12) twelveHour -= 12;
|
|
return leadingNulls(twelveHour, 2)
|
|
}),
|
|
"%j": (function(date) {
|
|
return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3)
|
|
}),
|
|
"%m": (function(date) {
|
|
return leadingNulls(date.tm_mon + 1, 2)
|
|
}),
|
|
"%M": (function(date) {
|
|
return leadingNulls(date.tm_min, 2)
|
|
}),
|
|
"%n": (function() {
|
|
return "\n"
|
|
}),
|
|
"%p": (function(date) {
|
|
if (date.tm_hour >= 0 && date.tm_hour < 12) {
|
|
return "AM"
|
|
} else {
|
|
return "PM"
|
|
}
|
|
}),
|
|
"%S": (function(date) {
|
|
return leadingNulls(date.tm_sec, 2)
|
|
}),
|
|
"%t": (function() {
|
|
return "\t"
|
|
}),
|
|
"%u": (function(date) {
|
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0);
|
|
return day.getDay() || 7
|
|
}),
|
|
"%U": (function(date) {
|
|
var janFirst = new Date(date.tm_year + 1900, 0, 1);
|
|
var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7 - janFirst.getDay());
|
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
|
|
if (compareByDay(firstSunday, endDate) < 0) {
|
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
|
|
var firstSundayUntilEndJanuary = 31 - firstSunday.getDate();
|
|
var days = firstSundayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
|
|
return leadingNulls(Math.ceil(days / 7), 2)
|
|
}
|
|
return compareByDay(firstSunday, janFirst) === 0 ? "01" : "00"
|
|
}),
|
|
"%V": (function(date) {
|
|
var janFourthThisYear = new Date(date.tm_year + 1900, 0, 4);
|
|
var janFourthNextYear = new Date(date.tm_year + 1901, 0, 4);
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
var endDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
|
|
if (compareByDay(endDate, firstWeekStartThisYear) < 0) {
|
|
return "53"
|
|
}
|
|
if (compareByDay(firstWeekStartNextYear, endDate) <= 0) {
|
|
return "01"
|
|
}
|
|
var daysDifference;
|
|
if (firstWeekStartThisYear.getFullYear() < date.tm_year + 1900) {
|
|
daysDifference = date.tm_yday + 32 - firstWeekStartThisYear.getDate()
|
|
} else {
|
|
daysDifference = date.tm_yday + 1 - firstWeekStartThisYear.getDate()
|
|
}
|
|
return leadingNulls(Math.ceil(daysDifference / 7), 2)
|
|
}),
|
|
"%w": (function(date) {
|
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0);
|
|
return day.getDay()
|
|
}),
|
|
"%W": (function(date) {
|
|
var janFirst = new Date(date.tm_year, 0, 1);
|
|
var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7 - janFirst.getDay() + 1);
|
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
|
|
if (compareByDay(firstMonday, endDate) < 0) {
|
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
|
|
var firstMondayUntilEndJanuary = 31 - firstMonday.getDate();
|
|
var days = firstMondayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
|
|
return leadingNulls(Math.ceil(days / 7), 2)
|
|
}
|
|
return compareByDay(firstMonday, janFirst) === 0 ? "01" : "00"
|
|
}),
|
|
"%y": (function(date) {
|
|
return (date.tm_year + 1900).toString().substring(2)
|
|
}),
|
|
"%Y": (function(date) {
|
|
return date.tm_year + 1900
|
|
}),
|
|
"%z": (function(date) {
|
|
var off = date.tm_gmtoff;
|
|
var ahead = off >= 0;
|
|
off = Math.abs(off) / 60;
|
|
off = off / 60 * 100 + off % 60;
|
|
return (ahead ? "+" : "-") + String("0000" + off).slice(-4)
|
|
}),
|
|
"%Z": (function(date) {
|
|
return date.tm_zone
|
|
}),
|
|
"%%": (function() {
|
|
return "%"
|
|
})
|
|
};
|
|
for (var rule in EXPANSION_RULES_2) {
|
|
if (pattern.indexOf(rule) >= 0) {
|
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date))
|
|
}
|
|
}
|
|
var bytes = intArrayFromString(pattern, false);
|
|
if (bytes.length > maxsize) {
|
|
return 0
|
|
}
|
|
writeArrayToMemory(bytes, s);
|
|
return bytes.length - 1
|
|
}
|
|
|
|
function _sysconf(name) {
|
|
switch (name) {
|
|
case 30:
|
|
return PAGE_SIZE;
|
|
case 85:
|
|
var maxHeapSize = 2 * 1024 * 1024 * 1024 - 65536;
|
|
return maxHeapSize / PAGE_SIZE;
|
|
case 132:
|
|
case 133:
|
|
case 12:
|
|
case 137:
|
|
case 138:
|
|
case 15:
|
|
case 235:
|
|
case 16:
|
|
case 17:
|
|
case 18:
|
|
case 19:
|
|
case 20:
|
|
case 149:
|
|
case 13:
|
|
case 10:
|
|
case 236:
|
|
case 153:
|
|
case 9:
|
|
case 21:
|
|
case 22:
|
|
case 159:
|
|
case 154:
|
|
case 14:
|
|
case 77:
|
|
case 78:
|
|
case 139:
|
|
case 80:
|
|
case 81:
|
|
case 82:
|
|
case 68:
|
|
case 67:
|
|
case 164:
|
|
case 11:
|
|
case 29:
|
|
case 47:
|
|
case 48:
|
|
case 95:
|
|
case 52:
|
|
case 51:
|
|
case 46:
|
|
return 200809;
|
|
case 79:
|
|
return 0;
|
|
case 27:
|
|
case 246:
|
|
case 127:
|
|
case 128:
|
|
case 23:
|
|
case 24:
|
|
case 160:
|
|
case 161:
|
|
case 181:
|
|
case 182:
|
|
case 242:
|
|
case 183:
|
|
case 184:
|
|
case 243:
|
|
case 244:
|
|
case 245:
|
|
case 165:
|
|
case 178:
|
|
case 179:
|
|
case 49:
|
|
case 50:
|
|
case 168:
|
|
case 169:
|
|
case 175:
|
|
case 170:
|
|
case 171:
|
|
case 172:
|
|
case 97:
|
|
case 76:
|
|
case 32:
|
|
case 173:
|
|
case 35:
|
|
return -1;
|
|
case 176:
|
|
case 177:
|
|
case 7:
|
|
case 155:
|
|
case 8:
|
|
case 157:
|
|
case 125:
|
|
case 126:
|
|
case 92:
|
|
case 93:
|
|
case 129:
|
|
case 130:
|
|
case 131:
|
|
case 94:
|
|
case 91:
|
|
return 1;
|
|
case 74:
|
|
case 60:
|
|
case 69:
|
|
case 70:
|
|
case 4:
|
|
return 1024;
|
|
case 31:
|
|
case 42:
|
|
case 72:
|
|
return 32;
|
|
case 87:
|
|
case 26:
|
|
case 33:
|
|
return 2147483647;
|
|
case 34:
|
|
case 1:
|
|
return 47839;
|
|
case 38:
|
|
case 36:
|
|
return 99;
|
|
case 43:
|
|
case 37:
|
|
return 2048;
|
|
case 0:
|
|
return 2097152;
|
|
case 3:
|
|
return 65536;
|
|
case 28:
|
|
return 32768;
|
|
case 44:
|
|
return 32767;
|
|
case 75:
|
|
return 16384;
|
|
case 39:
|
|
return 1e3;
|
|
case 89:
|
|
return 700;
|
|
case 71:
|
|
return 256;
|
|
case 40:
|
|
return 255;
|
|
case 2:
|
|
return 100;
|
|
case 180:
|
|
return 64;
|
|
case 25:
|
|
return 20;
|
|
case 5:
|
|
return 16;
|
|
case 6:
|
|
return 6;
|
|
case 73:
|
|
return 4;
|
|
case 84:
|
|
{
|
|
if (typeof navigator === "object") return navigator["hardwareConcurrency"] || 1;
|
|
return 1
|
|
}
|
|
}
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
|
|
function _time(ptr) {
|
|
var ret = Date.now() / 1e3 | 0;
|
|
if (ptr) {
|
|
HEAP32[ptr >> 2] = ret
|
|
}
|
|
return ret
|
|
}
|
|
|
|
function _unsetenv(name) {
|
|
if (name === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
name = Pointer_stringify(name);
|
|
if (name === "" || name.indexOf("=") !== -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
if (ENV.hasOwnProperty(name)) {
|
|
delete ENV[name];
|
|
___buildEnvironment(__get_environ())
|
|
}
|
|
return 0
|
|
}
|
|
|
|
function _utime(path, times) {
|
|
var time;
|
|
if (times) {
|
|
var offset = 4;
|
|
time = HEAP32[times + offset >> 2];
|
|
time *= 1e3
|
|
} else {
|
|
time = Date.now()
|
|
}
|
|
path = Pointer_stringify(path);
|
|
try {
|
|
FS.utime(path, time, time);
|
|
return 0
|
|
} catch (e) {
|
|
FS.handleFSError(e);
|
|
return -1
|
|
}
|
|
}
|
|
FS.staticInit();
|
|
__ATINIT__.unshift((function() {
|
|
if (!Module["noFSInit"] && !FS.init.initialized) FS.init()
|
|
}));
|
|
__ATMAIN__.push((function() {
|
|
FS.ignorePermissions = false
|
|
}));
|
|
__ATEXIT__.push((function() {
|
|
FS.quit()
|
|
}));
|
|
Module["FS_createPath"] = FS.createPath;
|
|
Module["FS_createDataFile"] = FS.createDataFile;
|
|
__ATINIT__.unshift((function() {
|
|
TTY.init()
|
|
}));
|
|
__ATEXIT__.push((function() {
|
|
TTY.shutdown()
|
|
}));
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
var fs = require("fs");
|
|
var NODEJS_PATH = require("path");
|
|
NODEFS.staticInit()
|
|
}
|
|
__ATINIT__.push((function() {
|
|
SOCKFS.root = FS.mount(SOCKFS, {}, null)
|
|
}));
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
_emscripten_get_now = function _emscripten_get_now_actual() {
|
|
var t = process["hrtime"]();
|
|
return t[0] * 1e3 + t[1] / 1e6
|
|
}
|
|
} else if (typeof dateNow !== "undefined") {
|
|
_emscripten_get_now = dateNow
|
|
} else if (typeof self === "object" && self["performance"] && typeof self["performance"]["now"] === "function") {
|
|
_emscripten_get_now = (function() {
|
|
return self["performance"]["now"]()
|
|
})
|
|
} else if (typeof performance === "object" && typeof performance["now"] === "function") {
|
|
_emscripten_get_now = (function() {
|
|
return performance["now"]()
|
|
})
|
|
} else {
|
|
_emscripten_get_now = Date.now
|
|
}
|
|
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) {
|
|
err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead.");
|
|
Module["requestFullScreen"] = Module["requestFullscreen"];
|
|
Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice)
|
|
};
|
|
Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) {
|
|
Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice)
|
|
};
|
|
Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) {
|
|
Browser.requestAnimationFrame(func)
|
|
};
|
|
Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) {
|
|
Browser.setCanvasSize(width, height, noUpdates)
|
|
};
|
|
Module["pauseMainLoop"] = function Module_pauseMainLoop() {
|
|
Browser.mainLoop.pause()
|
|
};
|
|
Module["resumeMainLoop"] = function Module_resumeMainLoop() {
|
|
Browser.mainLoop.resume()
|
|
};
|
|
Module["getUserMedia"] = function Module_getUserMedia() {
|
|
Browser.getUserMedia()
|
|
};
|
|
Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) {
|
|
return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes)
|
|
};
|
|
JSEvents.staticInit();
|
|
var GLctx;
|
|
GL.init();
|
|
DYNAMICTOP_PTR = staticAlloc(4);
|
|
STACK_BASE = STACKTOP = alignMemory(STATICTOP);
|
|
STACK_MAX = STACK_BASE + TOTAL_STACK;
|
|
DYNAMIC_BASE = alignMemory(STACK_MAX);
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = DYNAMIC_BASE;
|
|
staticSealed = true;
|
|
|
|
function intArrayFromString(stringy, dontAddNull, length) {
|
|
var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
|
|
var u8array = new Array(len);
|
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
|
|
if (dontAddNull) u8array.length = numBytesWritten;
|
|
return u8array
|
|
}
|
|
Module["wasmTableSize"] = 87909;
|
|
Module["wasmMaxTableSize"] = 87909;
|
|
|
|
function invoke_dddi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dddi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ddi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ddi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_dfi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dfi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_di(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_di"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diddi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diddi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_didi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_didi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_dii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dii"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiidi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diiidi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_diiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_dji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_dji"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_f(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_f"](index)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fdi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fdi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ff(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ff"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fff(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fff"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ffffffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ffffffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fffffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ffffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ffffi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fffi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fffiffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffiffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fffifffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffifffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fffifffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fffifffi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ffi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ffi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fi(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fi"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fif(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fif"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiff(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiff"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiffi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fifi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fifi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fifii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fifii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fii"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiifi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiifi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiifii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiifii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiifi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiifi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiif(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiif"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiiifiifif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiiiifiifif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiiifiiiif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fiiiiiifiiiif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_fji"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_i(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_i"](index)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iddi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iddi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_idi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_idiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_idiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ifffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifffi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iffi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iffi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ifi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ifii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ifiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ifiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ii(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ii"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiddi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiddi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iidii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iidiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iidiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iif(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iif"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiffi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iififii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iififii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifiiiijii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iifiiiijii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iii"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiidiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiidiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiif(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiif"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiififi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiififi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiififii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiififii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiifiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiidi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiidi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiidii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiidii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifffffii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifffffii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiffffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifffiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiffii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiffii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiifiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiifi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiifi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiifiiiiif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiifiiiiif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiifff(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiifff"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiifffiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiifffiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiffiiiiiiiiiffffiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiffiiiiiiiiiffffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiffiiiiiiiiiffffiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23, a24) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiffiiiiiiiiiffffiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22, a23, a24)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiffiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiffiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20, a21, a22)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiifiif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiifiif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiifiif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiifiif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiiji"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiij(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiij"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiiji"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiijii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiijii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiijiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiij(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiij"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiiji"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiijii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiijiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiijiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iij(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iij"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iiji"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iijii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iijiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iijji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijji"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iijjii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijjii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iijjji(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iijjji"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ij(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ij"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_iji"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ijiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ijj(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijj"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ijji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ijji"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_j(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_j"](index)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jdi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jdi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jdii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jdii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jfi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jfi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ji(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_ji"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jidi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jidii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jidii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jii"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiiji"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jiji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jiji"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jijii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jijiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jijj(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijj"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jijji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jijji"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_jji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
return Module["dynCall_jji"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_v(index) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_v"](index)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vd(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vd"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vf(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vf"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vff(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vff"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vfff(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vfff"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vffff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vffff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vffffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vffffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vfffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vfffi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vffi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vffi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vfi(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vfi"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vfii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vfii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vfiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vfiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vi(index, a1) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vi"](index, a1)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vid(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vid"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vidi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vidi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vidiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vidiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vif(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vif"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viff(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viff"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffff(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffff"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifffffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffffi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffffii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffffiifffiiiiif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffffiifffiiiiif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifffifii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffifii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifffii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifffii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffiifffffiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffiifffffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffiiiif(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viffiiiif"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifi(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vififiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vififiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifijii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vifijii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vii(index, a1, a2) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vii"](index, a1, a2)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viid(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viid"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viidi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viidii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viif(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viif"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiff(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifff(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifff"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffffffffiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffffffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifffffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffffi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiffiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifi(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viififii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viififii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viififiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viififiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viifiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viii(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiidi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiif(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiif"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifffi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiffi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiffii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiffii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifi(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiififfi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiififfi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiififi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiififi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiififii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiififii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiifiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiii(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiif(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiif"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiffffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiffffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifffffi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifffffi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiffffii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiffffii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifffi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiffi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifi(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiififfi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiififfi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiifi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifiifi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiiiiif(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifiiiiif"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiifiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiif(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiif"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiffi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiffi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiffii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiffii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiifi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiifi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiif(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiif"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiifi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiifi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiifii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiifii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiij(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiij"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiijiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiijiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiiji"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiijji(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiijji"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viij(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viij"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viiji"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijiijiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijiijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijijii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijijii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijijiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijijj(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijijj"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijj(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijj"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijji"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijjji(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viijjji"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vij(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vij"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viji(index, a1, a2, a3, a4) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_viji"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vijii(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vijiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vijiji(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijiji"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vijijji(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijijji"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vijji(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijji"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vijjii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vijjii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vji(index, a1, a2, a3) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vji"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vjiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vjji(index, a1, a2, a3, a4, a5) {
|
|
var sp = stackSave();
|
|
try {
|
|
Module["dynCall_vjji"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
stackRestore(sp);
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
Module.asmGlobalArg = {};
|
|
Module.asmLibraryArg = {
|
|
"abort": abort,
|
|
"assert": assert,
|
|
"enlargeMemory": enlargeMemory,
|
|
"getTotalMemory": getTotalMemory,
|
|
"abortOnCannotGrowMemory": abortOnCannotGrowMemory,
|
|
"invoke_dddi": invoke_dddi,
|
|
"invoke_ddi": invoke_ddi,
|
|
"invoke_dfi": invoke_dfi,
|
|
"invoke_di": invoke_di,
|
|
"invoke_diddi": invoke_diddi,
|
|
"invoke_didi": invoke_didi,
|
|
"invoke_dii": invoke_dii,
|
|
"invoke_diii": invoke_diii,
|
|
"invoke_diiidi": invoke_diiidi,
|
|
"invoke_diiii": invoke_diiii,
|
|
"invoke_dji": invoke_dji,
|
|
"invoke_f": invoke_f,
|
|
"invoke_fdi": invoke_fdi,
|
|
"invoke_ff": invoke_ff,
|
|
"invoke_fff": invoke_fff,
|
|
"invoke_ffffffi": invoke_ffffffi,
|
|
"invoke_fffffi": invoke_fffffi,
|
|
"invoke_ffffi": invoke_ffffi,
|
|
"invoke_fffi": invoke_fffi,
|
|
"invoke_fffiffffffi": invoke_fffiffffffi,
|
|
"invoke_fffifffffi": invoke_fffifffffi,
|
|
"invoke_fffifffi": invoke_fffifffi,
|
|
"invoke_ffi": invoke_ffi,
|
|
"invoke_fi": invoke_fi,
|
|
"invoke_fif": invoke_fif,
|
|
"invoke_fiff": invoke_fiff,
|
|
"invoke_fiffi": invoke_fiffi,
|
|
"invoke_fifi": invoke_fifi,
|
|
"invoke_fifii": invoke_fifii,
|
|
"invoke_fii": invoke_fii,
|
|
"invoke_fiiffi": invoke_fiiffi,
|
|
"invoke_fiifi": invoke_fiifi,
|
|
"invoke_fiifii": invoke_fiifii,
|
|
"invoke_fiii": invoke_fiii,
|
|
"invoke_fiiifi": invoke_fiiifi,
|
|
"invoke_fiiii": invoke_fiiii,
|
|
"invoke_fiiiif": invoke_fiiiif,
|
|
"invoke_fiiiii": invoke_fiiiii,
|
|
"invoke_fiiiiii": invoke_fiiiiii,
|
|
"invoke_fiiiiiifiifif": invoke_fiiiiiifiifif,
|
|
"invoke_fiiiiiifiiiif": invoke_fiiiiiifiiiif,
|
|
"invoke_fji": invoke_fji,
|
|
"invoke_i": invoke_i,
|
|
"invoke_iddi": invoke_iddi,
|
|
"invoke_idi": invoke_idi,
|
|
"invoke_idiii": invoke_idiii,
|
|
"invoke_ifffi": invoke_ifffi,
|
|
"invoke_iffi": invoke_iffi,
|
|
"invoke_ifi": invoke_ifi,
|
|
"invoke_ifii": invoke_ifii,
|
|
"invoke_ifiii": invoke_ifiii,
|
|
"invoke_ii": invoke_ii,
|
|
"invoke_iiddi": invoke_iiddi,
|
|
"invoke_iidi": invoke_iidi,
|
|
"invoke_iidii": invoke_iidii,
|
|
"invoke_iidiii": invoke_iidiii,
|
|
"invoke_iif": invoke_iif,
|
|
"invoke_iifff": invoke_iifff,
|
|
"invoke_iifffi": invoke_iifffi,
|
|
"invoke_iiffi": invoke_iiffi,
|
|
"invoke_iifi": invoke_iifi,
|
|
"invoke_iififii": invoke_iififii,
|
|
"invoke_iifii": invoke_iifii,
|
|
"invoke_iifiii": invoke_iifiii,
|
|
"invoke_iifiiiijii": invoke_iifiiiijii,
|
|
"invoke_iii": invoke_iii,
|
|
"invoke_iiidiii": invoke_iiidiii,
|
|
"invoke_iiif": invoke_iiif,
|
|
"invoke_iiiff": invoke_iiiff,
|
|
"invoke_iiifffi": invoke_iiifffi,
|
|
"invoke_iiiffi": invoke_iiiffi,
|
|
"invoke_iiifi": invoke_iiifi,
|
|
"invoke_iiififi": invoke_iiififi,
|
|
"invoke_iiififii": invoke_iiififii,
|
|
"invoke_iiifii": invoke_iiifii,
|
|
"invoke_iiifiii": invoke_iiifiii,
|
|
"invoke_iiifiiii": invoke_iiifiiii,
|
|
"invoke_iiii": invoke_iiii,
|
|
"invoke_iiiidi": invoke_iiiidi,
|
|
"invoke_iiiidii": invoke_iiiidii,
|
|
"invoke_iiiifffffi": invoke_iiiifffffi,
|
|
"invoke_iiiifffffii": invoke_iiiifffffii,
|
|
"invoke_iiiiffffi": invoke_iiiiffffi,
|
|
"invoke_iiiifffiii": invoke_iiiifffiii,
|
|
"invoke_iiiiffi": invoke_iiiiffi,
|
|
"invoke_iiiiffii": invoke_iiiiffii,
|
|
"invoke_iiiifi": invoke_iiiifi,
|
|
"invoke_iiiifii": invoke_iiiifii,
|
|
"invoke_iiiifiii": invoke_iiiifiii,
|
|
"invoke_iiiifiiii": invoke_iiiifiiii,
|
|
"invoke_iiiifiiiii": invoke_iiiifiiiii,
|
|
"invoke_iiiii": invoke_iiiii,
|
|
"invoke_iiiiifi": invoke_iiiiifi,
|
|
"invoke_iiiiifiii": invoke_iiiiifiii,
|
|
"invoke_iiiiifiiiiif": invoke_iiiiifiiiiif,
|
|
"invoke_iiiiii": invoke_iiiiii,
|
|
"invoke_iiiiiifff": invoke_iiiiiifff,
|
|
"invoke_iiiiiifffiiifiii": invoke_iiiiiifffiiifiii,
|
|
"invoke_iiiiiiffiiiiiiiiiffffiii": invoke_iiiiiiffiiiiiiiiiffffiii,
|
|
"invoke_iiiiiiffiiiiiiiiiffffiiii": invoke_iiiiiiffiiiiiiiiiffffiiii,
|
|
"invoke_iiiiiiffiiiiiiiiiiiiiii": invoke_iiiiiiffiiiiiiiiiiiiiii,
|
|
"invoke_iiiiiifiif": invoke_iiiiiifiif,
|
|
"invoke_iiiiiifiii": invoke_iiiiiifiii,
|
|
"invoke_iiiiiii": invoke_iiiiiii,
|
|
"invoke_iiiiiiifiif": invoke_iiiiiiifiif,
|
|
"invoke_iiiiiiii": invoke_iiiiiiii,
|
|
"invoke_iiiiiiiii": invoke_iiiiiiiii,
|
|
"invoke_iiiiiiiiii": invoke_iiiiiiiiii,
|
|
"invoke_iiiiiiiiiii": invoke_iiiiiiiiiii,
|
|
"invoke_iiiiiiiiiiii": invoke_iiiiiiiiiiii,
|
|
"invoke_iiiiiiiiiiiii": invoke_iiiiiiiiiiiii,
|
|
"invoke_iiiiiiiiiiiiii": invoke_iiiiiiiiiiiiii,
|
|
"invoke_iiiiiji": invoke_iiiiiji,
|
|
"invoke_iiiij": invoke_iiiij,
|
|
"invoke_iiiiji": invoke_iiiiji,
|
|
"invoke_iiiijii": invoke_iiiijii,
|
|
"invoke_iiiijiii": invoke_iiiijiii,
|
|
"invoke_iiij": invoke_iiij,
|
|
"invoke_iiiji": invoke_iiiji,
|
|
"invoke_iiijii": invoke_iiijii,
|
|
"invoke_iiijiii": invoke_iiijiii,
|
|
"invoke_iij": invoke_iij,
|
|
"invoke_iiji": invoke_iiji,
|
|
"invoke_iijii": invoke_iijii,
|
|
"invoke_iijiii": invoke_iijiii,
|
|
"invoke_iijji": invoke_iijji,
|
|
"invoke_iijjii": invoke_iijjii,
|
|
"invoke_iijjji": invoke_iijjji,
|
|
"invoke_ij": invoke_ij,
|
|
"invoke_iji": invoke_iji,
|
|
"invoke_ijiii": invoke_ijiii,
|
|
"invoke_ijj": invoke_ijj,
|
|
"invoke_ijji": invoke_ijji,
|
|
"invoke_j": invoke_j,
|
|
"invoke_jdi": invoke_jdi,
|
|
"invoke_jdii": invoke_jdii,
|
|
"invoke_jfi": invoke_jfi,
|
|
"invoke_ji": invoke_ji,
|
|
"invoke_jidi": invoke_jidi,
|
|
"invoke_jidii": invoke_jidii,
|
|
"invoke_jii": invoke_jii,
|
|
"invoke_jiii": invoke_jiii,
|
|
"invoke_jiiii": invoke_jiiii,
|
|
"invoke_jiiiii": invoke_jiiiii,
|
|
"invoke_jiiiiii": invoke_jiiiiii,
|
|
"invoke_jiiiiiiiiii": invoke_jiiiiiiiiii,
|
|
"invoke_jiiji": invoke_jiiji,
|
|
"invoke_jiji": invoke_jiji,
|
|
"invoke_jijii": invoke_jijii,
|
|
"invoke_jijiii": invoke_jijiii,
|
|
"invoke_jijj": invoke_jijj,
|
|
"invoke_jijji": invoke_jijji,
|
|
"invoke_jji": invoke_jji,
|
|
"invoke_v": invoke_v,
|
|
"invoke_vd": invoke_vd,
|
|
"invoke_vf": invoke_vf,
|
|
"invoke_vff": invoke_vff,
|
|
"invoke_vfff": invoke_vfff,
|
|
"invoke_vffff": invoke_vffff,
|
|
"invoke_vffffi": invoke_vffffi,
|
|
"invoke_vfffi": invoke_vfffi,
|
|
"invoke_vffi": invoke_vffi,
|
|
"invoke_vfi": invoke_vfi,
|
|
"invoke_vfii": invoke_vfii,
|
|
"invoke_vfiii": invoke_vfiii,
|
|
"invoke_vi": invoke_vi,
|
|
"invoke_vid": invoke_vid,
|
|
"invoke_vidi": invoke_vidi,
|
|
"invoke_vidiii": invoke_vidiii,
|
|
"invoke_vif": invoke_vif,
|
|
"invoke_viff": invoke_viff,
|
|
"invoke_vifff": invoke_vifff,
|
|
"invoke_viffff": invoke_viffff,
|
|
"invoke_viffffffi": invoke_viffffffi,
|
|
"invoke_vifffffi": invoke_vifffffi,
|
|
"invoke_viffffi": invoke_viffffi,
|
|
"invoke_viffffii": invoke_viffffii,
|
|
"invoke_viffffiifffiiiiif": invoke_viffffiifffiiiiif,
|
|
"invoke_vifffi": invoke_vifffi,
|
|
"invoke_vifffifii": invoke_vifffifii,
|
|
"invoke_vifffii": invoke_vifffii,
|
|
"invoke_viffi": invoke_viffi,
|
|
"invoke_viffii": invoke_viffii,
|
|
"invoke_viffiifffffiii": invoke_viffiifffffiii,
|
|
"invoke_viffiii": invoke_viffiii,
|
|
"invoke_viffiiiif": invoke_viffiiiif,
|
|
"invoke_vifi": invoke_vifi,
|
|
"invoke_vififiii": invoke_vififiii,
|
|
"invoke_vifii": invoke_vifii,
|
|
"invoke_vifiiii": invoke_vifiiii,
|
|
"invoke_vifijii": invoke_vifijii,
|
|
"invoke_vii": invoke_vii,
|
|
"invoke_viid": invoke_viid,
|
|
"invoke_viidi": invoke_viidi,
|
|
"invoke_viidii": invoke_viidii,
|
|
"invoke_viif": invoke_viif,
|
|
"invoke_viiff": invoke_viiff,
|
|
"invoke_viifff": invoke_viifff,
|
|
"invoke_viiffffffffi": invoke_viiffffffffi,
|
|
"invoke_viiffffffffiii": invoke_viiffffffffiii,
|
|
"invoke_viifffffffi": invoke_viifffffffi,
|
|
"invoke_viiffffffi": invoke_viiffffffi,
|
|
"invoke_viifffffi": invoke_viifffffi,
|
|
"invoke_viiffffi": invoke_viiffffi,
|
|
"invoke_viifffi": invoke_viifffi,
|
|
"invoke_viiffi": invoke_viiffi,
|
|
"invoke_viiffii": invoke_viiffii,
|
|
"invoke_viiffiii": invoke_viiffiii,
|
|
"invoke_viifi": invoke_viifi,
|
|
"invoke_viififii": invoke_viififii,
|
|
"invoke_viififiii": invoke_viififiii,
|
|
"invoke_viifii": invoke_viifii,
|
|
"invoke_viifiii": invoke_viifiii,
|
|
"invoke_viifiiii": invoke_viifiiii,
|
|
"invoke_viii": invoke_viii,
|
|
"invoke_viiidi": invoke_viiidi,
|
|
"invoke_viiif": invoke_viiif,
|
|
"invoke_viiifffi": invoke_viiifffi,
|
|
"invoke_viiiffi": invoke_viiiffi,
|
|
"invoke_viiiffii": invoke_viiiffii,
|
|
"invoke_viiifi": invoke_viiifi,
|
|
"invoke_viiififfi": invoke_viiififfi,
|
|
"invoke_viiififi": invoke_viiififi,
|
|
"invoke_viiififii": invoke_viiififii,
|
|
"invoke_viiifii": invoke_viiifii,
|
|
"invoke_viiifiii": invoke_viiifiii,
|
|
"invoke_viiifiiiii": invoke_viiifiiiii,
|
|
"invoke_viiii": invoke_viiii,
|
|
"invoke_viiiif": invoke_viiiif,
|
|
"invoke_viiiiffffffi": invoke_viiiiffffffi,
|
|
"invoke_viiiifffffi": invoke_viiiifffffi,
|
|
"invoke_viiiiffffii": invoke_viiiiffffii,
|
|
"invoke_viiiifffi": invoke_viiiifffi,
|
|
"invoke_viiiiffi": invoke_viiiiffi,
|
|
"invoke_viiiifi": invoke_viiiifi,
|
|
"invoke_viiiififfi": invoke_viiiififfi,
|
|
"invoke_viiiifii": invoke_viiiifii,
|
|
"invoke_viiiifiifi": invoke_viiiifiifi,
|
|
"invoke_viiiifiii": invoke_viiiifiii,
|
|
"invoke_viiiifiiii": invoke_viiiifiiii,
|
|
"invoke_viiiifiiiii": invoke_viiiifiiiii,
|
|
"invoke_viiiifiiiiif": invoke_viiiifiiiiif,
|
|
"invoke_viiiifiiiiiiii": invoke_viiiifiiiiiiii,
|
|
"invoke_viiiii": invoke_viiiii,
|
|
"invoke_viiiiif": invoke_viiiiif,
|
|
"invoke_viiiiiffi": invoke_viiiiiffi,
|
|
"invoke_viiiiiffii": invoke_viiiiiffii,
|
|
"invoke_viiiiifi": invoke_viiiiifi,
|
|
"invoke_viiiiii": invoke_viiiiii,
|
|
"invoke_viiiiiif": invoke_viiiiiif,
|
|
"invoke_viiiiiii": invoke_viiiiiii,
|
|
"invoke_viiiiiiifi": invoke_viiiiiiifi,
|
|
"invoke_viiiiiiii": invoke_viiiiiiii,
|
|
"invoke_viiiiiiiii": invoke_viiiiiiiii,
|
|
"invoke_viiiiiiiiii": invoke_viiiiiiiiii,
|
|
"invoke_viiiiiiiiiii": invoke_viiiiiiiiiii,
|
|
"invoke_viiiiiiiiiiifii": invoke_viiiiiiiiiiifii,
|
|
"invoke_viiiiiiiiiiii": invoke_viiiiiiiiiiii,
|
|
"invoke_viiiiiiiiiiiiii": invoke_viiiiiiiiiiiiii,
|
|
"invoke_viiiiiiiiiiiiiii": invoke_viiiiiiiiiiiiiii,
|
|
"invoke_viiiiiiiiiiiiiiiiii": invoke_viiiiiiiiiiiiiiiiii,
|
|
"invoke_viiiij": invoke_viiiij,
|
|
"invoke_viiiijiiii": invoke_viiiijiiii,
|
|
"invoke_viiiji": invoke_viiiji,
|
|
"invoke_viiijji": invoke_viiijji,
|
|
"invoke_viij": invoke_viij,
|
|
"invoke_viiji": invoke_viiji,
|
|
"invoke_viijii": invoke_viijii,
|
|
"invoke_viijiijiii": invoke_viijiijiii,
|
|
"invoke_viijijii": invoke_viijijii,
|
|
"invoke_viijijiii": invoke_viijijiii,
|
|
"invoke_viijijj": invoke_viijijj,
|
|
"invoke_viijj": invoke_viijj,
|
|
"invoke_viijji": invoke_viijji,
|
|
"invoke_viijjiii": invoke_viijjiii,
|
|
"invoke_viijjji": invoke_viijjji,
|
|
"invoke_vij": invoke_vij,
|
|
"invoke_viji": invoke_viji,
|
|
"invoke_vijii": invoke_vijii,
|
|
"invoke_vijiii": invoke_vijiii,
|
|
"invoke_vijiji": invoke_vijiji,
|
|
"invoke_vijijji": invoke_vijijji,
|
|
"invoke_vijji": invoke_vijji,
|
|
"invoke_vijjii": invoke_vijjii,
|
|
"invoke_vji": invoke_vji,
|
|
"invoke_vjiiii": invoke_vjiiii,
|
|
"invoke_vjji": invoke_vjji,
|
|
"JS_ScreenOrientation_eventHandler": JS_ScreenOrientation_eventHandler,
|
|
"_IsMobileBrowser": _IsMobileBrowser,
|
|
"_JS_Cursor_SetImage": _JS_Cursor_SetImage,
|
|
"_JS_Cursor_SetShow": _JS_Cursor_SetShow,
|
|
"_JS_Eval_ClearInterval": _JS_Eval_ClearInterval,
|
|
"_JS_Eval_OpenURL": _JS_Eval_OpenURL,
|
|
"_JS_Eval_SetInterval": _JS_Eval_SetInterval,
|
|
"_JS_FileSystem_Initialize": _JS_FileSystem_Initialize,
|
|
"_JS_FileSystem_Sync": _JS_FileSystem_Sync,
|
|
"_JS_Log_Dump": _JS_Log_Dump,
|
|
"_JS_Log_StackTrace": _JS_Log_StackTrace,
|
|
"_JS_ScreenOrientation_DeInit": _JS_ScreenOrientation_DeInit,
|
|
"_JS_ScreenOrientation_Init": _JS_ScreenOrientation_Init,
|
|
"_JS_Sound_Create_Channel": _JS_Sound_Create_Channel,
|
|
"_JS_Sound_GetLength": _JS_Sound_GetLength,
|
|
"_JS_Sound_GetLoadState": _JS_Sound_GetLoadState,
|
|
"_JS_Sound_Init": _JS_Sound_Init,
|
|
"_JS_Sound_Load": _JS_Sound_Load,
|
|
"_JS_Sound_Load_PCM": _JS_Sound_Load_PCM,
|
|
"_JS_Sound_Play": _JS_Sound_Play,
|
|
"_JS_Sound_ReleaseInstance": _JS_Sound_ReleaseInstance,
|
|
"_JS_Sound_ResumeIfNeeded": _JS_Sound_ResumeIfNeeded,
|
|
"_JS_Sound_Set3D": _JS_Sound_Set3D,
|
|
"_JS_Sound_SetListenerOrientation": _JS_Sound_SetListenerOrientation,
|
|
"_JS_Sound_SetListenerPosition": _JS_Sound_SetListenerPosition,
|
|
"_JS_Sound_SetLoop": _JS_Sound_SetLoop,
|
|
"_JS_Sound_SetLoopPoints": _JS_Sound_SetLoopPoints,
|
|
"_JS_Sound_SetPaused": _JS_Sound_SetPaused,
|
|
"_JS_Sound_SetPitch": _JS_Sound_SetPitch,
|
|
"_JS_Sound_SetPosition": _JS_Sound_SetPosition,
|
|
"_JS_Sound_SetVolume": _JS_Sound_SetVolume,
|
|
"_JS_Sound_Stop": _JS_Sound_Stop,
|
|
"_JS_SystemInfo_GetCanvasClientSize": _JS_SystemInfo_GetCanvasClientSize,
|
|
"_JS_SystemInfo_GetDocumentURL": _JS_SystemInfo_GetDocumentURL,
|
|
"_JS_SystemInfo_GetGPUInfo": _JS_SystemInfo_GetGPUInfo,
|
|
"_JS_SystemInfo_GetMatchWebGLToCanvasSize": _JS_SystemInfo_GetMatchWebGLToCanvasSize,
|
|
"_JS_SystemInfo_GetMemory": _JS_SystemInfo_GetMemory,
|
|
"_JS_SystemInfo_GetOS": _JS_SystemInfo_GetOS,
|
|
"_JS_SystemInfo_GetPreferredDevicePixelRatio": _JS_SystemInfo_GetPreferredDevicePixelRatio,
|
|
"_JS_SystemInfo_GetScreenSize": _JS_SystemInfo_GetScreenSize,
|
|
"_JS_SystemInfo_HasCursorLock": _JS_SystemInfo_HasCursorLock,
|
|
"_JS_SystemInfo_HasFullscreen": _JS_SystemInfo_HasFullscreen,
|
|
"_JS_SystemInfo_HasWebGL": _JS_SystemInfo_HasWebGL,
|
|
"__ZSt18uncaught_exceptionv": __ZSt18uncaught_exceptionv,
|
|
"___atomic_compare_exchange_8": ___atomic_compare_exchange_8,
|
|
"___atomic_fetch_add_8": ___atomic_fetch_add_8,
|
|
"___buildEnvironment": ___buildEnvironment,
|
|
"___cxa_allocate_exception": ___cxa_allocate_exception,
|
|
"___cxa_begin_catch": ___cxa_begin_catch,
|
|
"___cxa_end_catch": ___cxa_end_catch,
|
|
"___cxa_find_matching_catch": ___cxa_find_matching_catch,
|
|
"___cxa_find_matching_catch_2": ___cxa_find_matching_catch_2,
|
|
"___cxa_find_matching_catch_3": ___cxa_find_matching_catch_3,
|
|
"___cxa_find_matching_catch_4": ___cxa_find_matching_catch_4,
|
|
"___cxa_free_exception": ___cxa_free_exception,
|
|
"___cxa_pure_virtual": ___cxa_pure_virtual,
|
|
"___cxa_rethrow": ___cxa_rethrow,
|
|
"___cxa_throw": ___cxa_throw,
|
|
"___gxx_personality_v0": ___gxx_personality_v0,
|
|
"___lock": ___lock,
|
|
"___map_file": ___map_file,
|
|
"___resumeException": ___resumeException,
|
|
"___setErrNo": ___setErrNo,
|
|
"___syscall10": ___syscall10,
|
|
"___syscall102": ___syscall102,
|
|
"___syscall122": ___syscall122,
|
|
"___syscall140": ___syscall140,
|
|
"___syscall142": ___syscall142,
|
|
"___syscall145": ___syscall145,
|
|
"___syscall146": ___syscall146,
|
|
"___syscall15": ___syscall15,
|
|
"___syscall183": ___syscall183,
|
|
"___syscall192": ___syscall192,
|
|
"___syscall193": ___syscall193,
|
|
"___syscall195": ___syscall195,
|
|
"___syscall196": ___syscall196,
|
|
"___syscall197": ___syscall197,
|
|
"___syscall199": ___syscall199,
|
|
"___syscall202": ___syscall202,
|
|
"___syscall220": ___syscall220,
|
|
"___syscall221": ___syscall221,
|
|
"___syscall268": ___syscall268,
|
|
"___syscall3": ___syscall3,
|
|
"___syscall33": ___syscall33,
|
|
"___syscall38": ___syscall38,
|
|
"___syscall39": ___syscall39,
|
|
"___syscall4": ___syscall4,
|
|
"___syscall40": ___syscall40,
|
|
"___syscall5": ___syscall5,
|
|
"___syscall54": ___syscall54,
|
|
"___syscall6": ___syscall6,
|
|
"___syscall77": ___syscall77,
|
|
"___syscall85": ___syscall85,
|
|
"___syscall91": ___syscall91,
|
|
"___unlock": ___unlock,
|
|
"__addDays": __addDays,
|
|
"__arraySum": __arraySum,
|
|
"__emscripten_do_request_fullscreen": __emscripten_do_request_fullscreen,
|
|
"__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data,
|
|
"__emscripten_traverse_stack": __emscripten_traverse_stack,
|
|
"__exit": __exit,
|
|
"__formatString": __formatString,
|
|
"__inet_ntop4_raw": __inet_ntop4_raw,
|
|
"__inet_ntop6_raw": __inet_ntop6_raw,
|
|
"__inet_pton4_raw": __inet_pton4_raw,
|
|
"__inet_pton6_raw": __inet_pton6_raw,
|
|
"__isLeapYear": __isLeapYear,
|
|
"__read_sockaddr": __read_sockaddr,
|
|
"__reallyNegative": __reallyNegative,
|
|
"__setLetterbox": __setLetterbox,
|
|
"__write_sockaddr": __write_sockaddr,
|
|
"_abort": _abort,
|
|
"_atexit": _atexit,
|
|
"_clock": _clock,
|
|
"_clock_getres": _clock_getres,
|
|
"_clock_gettime": _clock_gettime,
|
|
"_difftime": _difftime,
|
|
"_dlclose": _dlclose,
|
|
"_dlerror": _dlerror,
|
|
"_dlopen": _dlopen,
|
|
"_dlsym": _dlsym,
|
|
"_emscripten_asm_const_i": _emscripten_asm_const_i,
|
|
"_emscripten_asm_const_ii": _emscripten_asm_const_ii,
|
|
"_emscripten_asm_const_sync_on_main_thread_i": _emscripten_asm_const_sync_on_main_thread_i,
|
|
"_emscripten_cancel_main_loop": _emscripten_cancel_main_loop,
|
|
"_emscripten_exit_fullscreen": _emscripten_exit_fullscreen,
|
|
"_emscripten_exit_pointerlock": _emscripten_exit_pointerlock,
|
|
"_emscripten_get_callstack_js": _emscripten_get_callstack_js,
|
|
"_emscripten_get_canvas_element_size": _emscripten_get_canvas_element_size,
|
|
"_emscripten_get_canvas_element_size_calling_thread": _emscripten_get_canvas_element_size_calling_thread,
|
|
"_emscripten_get_canvas_element_size_main_thread": _emscripten_get_canvas_element_size_main_thread,
|
|
"_emscripten_get_fullscreen_status": _emscripten_get_fullscreen_status,
|
|
"_emscripten_get_gamepad_status": _emscripten_get_gamepad_status,
|
|
"_emscripten_get_now": _emscripten_get_now,
|
|
"_emscripten_get_now_is_monotonic": _emscripten_get_now_is_monotonic,
|
|
"_emscripten_get_now_res": _emscripten_get_now_res,
|
|
"_emscripten_get_num_gamepads": _emscripten_get_num_gamepads,
|
|
"_emscripten_has_threading_support": _emscripten_has_threading_support,
|
|
"_emscripten_html5_remove_all_event_listeners": _emscripten_html5_remove_all_event_listeners,
|
|
"_emscripten_is_webgl_context_lost": _emscripten_is_webgl_context_lost,
|
|
"_emscripten_log": _emscripten_log,
|
|
"_emscripten_log_js": _emscripten_log_js,
|
|
"_emscripten_memcpy_big": _emscripten_memcpy_big,
|
|
"_emscripten_num_logical_cores": _emscripten_num_logical_cores,
|
|
"_emscripten_request_fullscreen": _emscripten_request_fullscreen,
|
|
"_emscripten_request_pointerlock": _emscripten_request_pointerlock,
|
|
"_emscripten_set_blur_callback_on_thread": _emscripten_set_blur_callback_on_thread,
|
|
"_emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size,
|
|
"_emscripten_set_canvas_element_size_calling_thread": _emscripten_set_canvas_element_size_calling_thread,
|
|
"_emscripten_set_canvas_element_size_main_thread": _emscripten_set_canvas_element_size_main_thread,
|
|
"_emscripten_set_dblclick_callback_on_thread": _emscripten_set_dblclick_callback_on_thread,
|
|
"_emscripten_set_devicemotion_callback_on_thread": _emscripten_set_devicemotion_callback_on_thread,
|
|
"_emscripten_set_deviceorientation_callback_on_thread": _emscripten_set_deviceorientation_callback_on_thread,
|
|
"_emscripten_set_focus_callback_on_thread": _emscripten_set_focus_callback_on_thread,
|
|
"_emscripten_set_fullscreenchange_callback_on_thread": _emscripten_set_fullscreenchange_callback_on_thread,
|
|
"_emscripten_set_gamepadconnected_callback_on_thread": _emscripten_set_gamepadconnected_callback_on_thread,
|
|
"_emscripten_set_gamepaddisconnected_callback_on_thread": _emscripten_set_gamepaddisconnected_callback_on_thread,
|
|
"_emscripten_set_keydown_callback_on_thread": _emscripten_set_keydown_callback_on_thread,
|
|
"_emscripten_set_keypress_callback_on_thread": _emscripten_set_keypress_callback_on_thread,
|
|
"_emscripten_set_keyup_callback_on_thread": _emscripten_set_keyup_callback_on_thread,
|
|
"_emscripten_set_main_loop": _emscripten_set_main_loop,
|
|
"_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing,
|
|
"_emscripten_set_mousedown_callback_on_thread": _emscripten_set_mousedown_callback_on_thread,
|
|
"_emscripten_set_mousemove_callback_on_thread": _emscripten_set_mousemove_callback_on_thread,
|
|
"_emscripten_set_mouseup_callback_on_thread": _emscripten_set_mouseup_callback_on_thread,
|
|
"_emscripten_set_touchcancel_callback_on_thread": _emscripten_set_touchcancel_callback_on_thread,
|
|
"_emscripten_set_touchend_callback_on_thread": _emscripten_set_touchend_callback_on_thread,
|
|
"_emscripten_set_touchmove_callback_on_thread": _emscripten_set_touchmove_callback_on_thread,
|
|
"_emscripten_set_touchstart_callback_on_thread": _emscripten_set_touchstart_callback_on_thread,
|
|
"_emscripten_set_wheel_callback_on_thread": _emscripten_set_wheel_callback_on_thread,
|
|
"_emscripten_webgl_create_context": _emscripten_webgl_create_context,
|
|
"_emscripten_webgl_destroy_context": _emscripten_webgl_destroy_context,
|
|
"_emscripten_webgl_destroy_context_calling_thread": _emscripten_webgl_destroy_context_calling_thread,
|
|
"_emscripten_webgl_do_create_context": _emscripten_webgl_do_create_context,
|
|
"_emscripten_webgl_do_get_current_context": _emscripten_webgl_do_get_current_context,
|
|
"_emscripten_webgl_enable_extension": _emscripten_webgl_enable_extension,
|
|
"_emscripten_webgl_enable_extension_calling_thread": _emscripten_webgl_enable_extension_calling_thread,
|
|
"_emscripten_webgl_get_current_context": _emscripten_webgl_get_current_context,
|
|
"_emscripten_webgl_init_context_attributes": _emscripten_webgl_init_context_attributes,
|
|
"_emscripten_webgl_make_context_current": _emscripten_webgl_make_context_current,
|
|
"_exit": _exit,
|
|
"_flock": _flock,
|
|
"_getenv": _getenv,
|
|
"_gethostbyaddr": _gethostbyaddr,
|
|
"_gethostbyname": _gethostbyname,
|
|
"_getpagesize": _getpagesize,
|
|
"_getpwuid": _getpwuid,
|
|
"_gettimeofday": _gettimeofday,
|
|
"_glActiveTexture": _glActiveTexture,
|
|
"_glAttachShader": _glAttachShader,
|
|
"_glBeginQuery": _glBeginQuery,
|
|
"_glBeginTransformFeedback": _glBeginTransformFeedback,
|
|
"_glBindAttribLocation": _glBindAttribLocation,
|
|
"_glBindBuffer": _glBindBuffer,
|
|
"_glBindBufferBase": _glBindBufferBase,
|
|
"_glBindBufferRange": _glBindBufferRange,
|
|
"_glBindFramebuffer": _glBindFramebuffer,
|
|
"_glBindRenderbuffer": _glBindRenderbuffer,
|
|
"_glBindSampler": _glBindSampler,
|
|
"_glBindTexture": _glBindTexture,
|
|
"_glBindTransformFeedback": _glBindTransformFeedback,
|
|
"_glBindVertexArray": _glBindVertexArray,
|
|
"_glBlendEquation": _glBlendEquation,
|
|
"_glBlendEquationSeparate": _glBlendEquationSeparate,
|
|
"_glBlendFuncSeparate": _glBlendFuncSeparate,
|
|
"_glBlitFramebuffer": _glBlitFramebuffer,
|
|
"_glBufferData": _glBufferData,
|
|
"_glBufferSubData": _glBufferSubData,
|
|
"_glCheckFramebufferStatus": _glCheckFramebufferStatus,
|
|
"_glClear": _glClear,
|
|
"_glClearBufferfi": _glClearBufferfi,
|
|
"_glClearBufferfv": _glClearBufferfv,
|
|
"_glClearBufferuiv": _glClearBufferuiv,
|
|
"_glClearColor": _glClearColor,
|
|
"_glClearDepthf": _glClearDepthf,
|
|
"_glClearStencil": _glClearStencil,
|
|
"_glClientWaitSync": _glClientWaitSync,
|
|
"_glColorMask": _glColorMask,
|
|
"_glCompileShader": _glCompileShader,
|
|
"_glCompressedTexImage2D": _glCompressedTexImage2D,
|
|
"_glCompressedTexImage3D": _glCompressedTexImage3D,
|
|
"_glCompressedTexSubImage2D": _glCompressedTexSubImage2D,
|
|
"_glCompressedTexSubImage3D": _glCompressedTexSubImage3D,
|
|
"_glCopyBufferSubData": _glCopyBufferSubData,
|
|
"_glCopyTexImage2D": _glCopyTexImage2D,
|
|
"_glCopyTexSubImage2D": _glCopyTexSubImage2D,
|
|
"_glCreateProgram": _glCreateProgram,
|
|
"_glCreateShader": _glCreateShader,
|
|
"_glCullFace": _glCullFace,
|
|
"_glDeleteBuffers": _glDeleteBuffers,
|
|
"_glDeleteFramebuffers": _glDeleteFramebuffers,
|
|
"_glDeleteProgram": _glDeleteProgram,
|
|
"_glDeleteQueries": _glDeleteQueries,
|
|
"_glDeleteRenderbuffers": _glDeleteRenderbuffers,
|
|
"_glDeleteSamplers": _glDeleteSamplers,
|
|
"_glDeleteShader": _glDeleteShader,
|
|
"_glDeleteSync": _glDeleteSync,
|
|
"_glDeleteTextures": _glDeleteTextures,
|
|
"_glDeleteTransformFeedbacks": _glDeleteTransformFeedbacks,
|
|
"_glDeleteVertexArrays": _glDeleteVertexArrays,
|
|
"_glDepthFunc": _glDepthFunc,
|
|
"_glDepthMask": _glDepthMask,
|
|
"_glDetachShader": _glDetachShader,
|
|
"_glDisable": _glDisable,
|
|
"_glDisableVertexAttribArray": _glDisableVertexAttribArray,
|
|
"_glDrawArrays": _glDrawArrays,
|
|
"_glDrawArraysInstanced": _glDrawArraysInstanced,
|
|
"_glDrawBuffers": _glDrawBuffers,
|
|
"_glDrawElements": _glDrawElements,
|
|
"_glDrawElementsInstanced": _glDrawElementsInstanced,
|
|
"_glEnable": _glEnable,
|
|
"_glEnableVertexAttribArray": _glEnableVertexAttribArray,
|
|
"_glEndQuery": _glEndQuery,
|
|
"_glEndTransformFeedback": _glEndTransformFeedback,
|
|
"_glFenceSync": _glFenceSync,
|
|
"_glFinish": _glFinish,
|
|
"_glFlush": _glFlush,
|
|
"_glFlushMappedBufferRange": _glFlushMappedBufferRange,
|
|
"_glFramebufferRenderbuffer": _glFramebufferRenderbuffer,
|
|
"_glFramebufferTexture2D": _glFramebufferTexture2D,
|
|
"_glFramebufferTextureLayer": _glFramebufferTextureLayer,
|
|
"_glFrontFace": _glFrontFace,
|
|
"_glGenBuffers": _glGenBuffers,
|
|
"_glGenFramebuffers": _glGenFramebuffers,
|
|
"_glGenQueries": _glGenQueries,
|
|
"_glGenRenderbuffers": _glGenRenderbuffers,
|
|
"_glGenSamplers": _glGenSamplers,
|
|
"_glGenTextures": _glGenTextures,
|
|
"_glGenTransformFeedbacks": _glGenTransformFeedbacks,
|
|
"_glGenVertexArrays": _glGenVertexArrays,
|
|
"_glGenerateMipmap": _glGenerateMipmap,
|
|
"_glGetActiveAttrib": _glGetActiveAttrib,
|
|
"_glGetActiveUniform": _glGetActiveUniform,
|
|
"_glGetActiveUniformBlockName": _glGetActiveUniformBlockName,
|
|
"_glGetActiveUniformBlockiv": _glGetActiveUniformBlockiv,
|
|
"_glGetActiveUniformsiv": _glGetActiveUniformsiv,
|
|
"_glGetAttribLocation": _glGetAttribLocation,
|
|
"_glGetError": _glGetError,
|
|
"_glGetFramebufferAttachmentParameteriv": _glGetFramebufferAttachmentParameteriv,
|
|
"_glGetIntegeri_v": _glGetIntegeri_v,
|
|
"_glGetIntegerv": _glGetIntegerv,
|
|
"_glGetInternalformativ": _glGetInternalformativ,
|
|
"_glGetProgramBinary": _glGetProgramBinary,
|
|
"_glGetProgramInfoLog": _glGetProgramInfoLog,
|
|
"_glGetProgramiv": _glGetProgramiv,
|
|
"_glGetQueryObjectuiv": _glGetQueryObjectuiv,
|
|
"_glGetQueryiv": _glGetQueryiv,
|
|
"_glGetRenderbufferParameteriv": _glGetRenderbufferParameteriv,
|
|
"_glGetShaderInfoLog": _glGetShaderInfoLog,
|
|
"_glGetShaderPrecisionFormat": _glGetShaderPrecisionFormat,
|
|
"_glGetShaderSource": _glGetShaderSource,
|
|
"_glGetShaderiv": _glGetShaderiv,
|
|
"_glGetString": _glGetString,
|
|
"_glGetStringi": _glGetStringi,
|
|
"_glGetTexParameteriv": _glGetTexParameteriv,
|
|
"_glGetUniformBlockIndex": _glGetUniformBlockIndex,
|
|
"_glGetUniformIndices": _glGetUniformIndices,
|
|
"_glGetUniformLocation": _glGetUniformLocation,
|
|
"_glGetUniformiv": _glGetUniformiv,
|
|
"_glGetVertexAttribiv": _glGetVertexAttribiv,
|
|
"_glInvalidateFramebuffer": _glInvalidateFramebuffer,
|
|
"_glIsEnabled": _glIsEnabled,
|
|
"_glIsVertexArray": _glIsVertexArray,
|
|
"_glLinkProgram": _glLinkProgram,
|
|
"_glMapBufferRange": _glMapBufferRange,
|
|
"_glPixelStorei": _glPixelStorei,
|
|
"_glPolygonOffset": _glPolygonOffset,
|
|
"_glProgramBinary": _glProgramBinary,
|
|
"_glProgramParameteri": _glProgramParameteri,
|
|
"_glReadBuffer": _glReadBuffer,
|
|
"_glReadPixels": _glReadPixels,
|
|
"_glRenderbufferStorage": _glRenderbufferStorage,
|
|
"_glRenderbufferStorageMultisample": _glRenderbufferStorageMultisample,
|
|
"_glSamplerParameteri": _glSamplerParameteri,
|
|
"_glScissor": _glScissor,
|
|
"_glShaderSource": _glShaderSource,
|
|
"_glStencilFuncSeparate": _glStencilFuncSeparate,
|
|
"_glStencilMask": _glStencilMask,
|
|
"_glStencilOpSeparate": _glStencilOpSeparate,
|
|
"_glTexImage2D": _glTexImage2D,
|
|
"_glTexImage3D": _glTexImage3D,
|
|
"_glTexParameterf": _glTexParameterf,
|
|
"_glTexParameteri": _glTexParameteri,
|
|
"_glTexParameteriv": _glTexParameteriv,
|
|
"_glTexStorage2D": _glTexStorage2D,
|
|
"_glTexStorage3D": _glTexStorage3D,
|
|
"_glTexSubImage2D": _glTexSubImage2D,
|
|
"_glTexSubImage3D": _glTexSubImage3D,
|
|
"_glTransformFeedbackVaryings": _glTransformFeedbackVaryings,
|
|
"_glUniform1fv": _glUniform1fv,
|
|
"_glUniform1i": _glUniform1i,
|
|
"_glUniform1iv": _glUniform1iv,
|
|
"_glUniform1uiv": _glUniform1uiv,
|
|
"_glUniform2fv": _glUniform2fv,
|
|
"_glUniform2iv": _glUniform2iv,
|
|
"_glUniform2uiv": _glUniform2uiv,
|
|
"_glUniform3fv": _glUniform3fv,
|
|
"_glUniform3iv": _glUniform3iv,
|
|
"_glUniform3uiv": _glUniform3uiv,
|
|
"_glUniform4fv": _glUniform4fv,
|
|
"_glUniform4iv": _glUniform4iv,
|
|
"_glUniform4uiv": _glUniform4uiv,
|
|
"_glUniformBlockBinding": _glUniformBlockBinding,
|
|
"_glUniformMatrix3fv": _glUniformMatrix3fv,
|
|
"_glUniformMatrix4fv": _glUniformMatrix4fv,
|
|
"_glUnmapBuffer": _glUnmapBuffer,
|
|
"_glUseProgram": _glUseProgram,
|
|
"_glValidateProgram": _glValidateProgram,
|
|
"_glVertexAttrib4f": _glVertexAttrib4f,
|
|
"_glVertexAttrib4fv": _glVertexAttrib4fv,
|
|
"_glVertexAttribIPointer": _glVertexAttribIPointer,
|
|
"_glVertexAttribPointer": _glVertexAttribPointer,
|
|
"_glViewport": _glViewport,
|
|
"_gmtime": _gmtime,
|
|
"_gmtime_r": _gmtime_r,
|
|
"_inet_addr": _inet_addr,
|
|
"_llvm_ceil_f32": _llvm_ceil_f32,
|
|
"_llvm_ceil_f64": _llvm_ceil_f64,
|
|
"_llvm_copysign_f64": _llvm_copysign_f64,
|
|
"_llvm_cttz_i32": _llvm_cttz_i32,
|
|
"_llvm_eh_typeid_for": _llvm_eh_typeid_for,
|
|
"_llvm_exp2_f32": _llvm_exp2_f32,
|
|
"_llvm_fabs_f32": _llvm_fabs_f32,
|
|
"_llvm_fabs_f64": _llvm_fabs_f64,
|
|
"_llvm_floor_f32": _llvm_floor_f32,
|
|
"_llvm_floor_f64": _llvm_floor_f64,
|
|
"_llvm_log10_f32": _llvm_log10_f32,
|
|
"_llvm_log2_f32": _llvm_log2_f32,
|
|
"_llvm_pow_f64": _llvm_pow_f64,
|
|
"_llvm_trap": _llvm_trap,
|
|
"_llvm_trunc_f32": _llvm_trunc_f32,
|
|
"_localtime": _localtime,
|
|
"_localtime_r": _localtime_r,
|
|
"_longjmp": _longjmp,
|
|
"_mktime": _mktime,
|
|
"_nanosleep": _nanosleep,
|
|
"_pthread_cond_destroy": _pthread_cond_destroy,
|
|
"_pthread_cond_init": _pthread_cond_init,
|
|
"_pthread_cond_timedwait": _pthread_cond_timedwait,
|
|
"_pthread_cond_wait": _pthread_cond_wait,
|
|
"_pthread_getspecific": _pthread_getspecific,
|
|
"_pthread_key_create": _pthread_key_create,
|
|
"_pthread_key_delete": _pthread_key_delete,
|
|
"_pthread_mutex_destroy": _pthread_mutex_destroy,
|
|
"_pthread_mutex_init": _pthread_mutex_init,
|
|
"_pthread_mutexattr_destroy": _pthread_mutexattr_destroy,
|
|
"_pthread_mutexattr_init": _pthread_mutexattr_init,
|
|
"_pthread_mutexattr_setprotocol": _pthread_mutexattr_setprotocol,
|
|
"_pthread_mutexattr_settype": _pthread_mutexattr_settype,
|
|
"_pthread_once": _pthread_once,
|
|
"_pthread_setspecific": _pthread_setspecific,
|
|
"_sched_yield": _sched_yield,
|
|
"_setenv": _setenv,
|
|
"_sigaction": _sigaction,
|
|
"_sigemptyset": _sigemptyset,
|
|
"_strftime": _strftime,
|
|
"_sysconf": _sysconf,
|
|
"_time": _time,
|
|
"_tzset": _tzset,
|
|
"_unsetenv": _unsetenv,
|
|
"_usleep": _usleep,
|
|
"_utime": _utime,
|
|
"emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize,
|
|
"emscriptenWebGLGet": emscriptenWebGLGet,
|
|
"emscriptenWebGLGetBufferBinding": emscriptenWebGLGetBufferBinding,
|
|
"emscriptenWebGLGetHeapForType": emscriptenWebGLGetHeapForType,
|
|
"emscriptenWebGLGetIndexed": emscriptenWebGLGetIndexed,
|
|
"emscriptenWebGLGetShiftForType": emscriptenWebGLGetShiftForType,
|
|
"emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData,
|
|
"emscriptenWebGLGetUniform": emscriptenWebGLGetUniform,
|
|
"emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib,
|
|
"emscriptenWebGLValidateMapBufferTarget": emscriptenWebGLValidateMapBufferTarget,
|
|
"emscripten_get_canvas_element_size_js": emscripten_get_canvas_element_size_js,
|
|
"emscripten_set_canvas_element_size_js": emscripten_set_canvas_element_size_js,
|
|
"DYNAMICTOP_PTR": DYNAMICTOP_PTR,
|
|
"tempDoublePtr": tempDoublePtr,
|
|
"ABORT": ABORT,
|
|
"STACKTOP": STACKTOP,
|
|
"STACK_MAX": STACK_MAX
|
|
};
|
|
var asm = Module["asm"](Module.asmGlobalArg, Module.asmLibraryArg, buffer);
|
|
Module["asm"] = asm;
|
|
var _SendMessage = Module["_SendMessage"] = (function() {
|
|
return Module["asm"]["_SendMessage"].apply(null, arguments)
|
|
});
|
|
var _SendMessageFloat = Module["_SendMessageFloat"] = (function() {
|
|
return Module["asm"]["_SendMessageFloat"].apply(null, arguments)
|
|
});
|
|
var _SendMessageString = Module["_SendMessageString"] = (function() {
|
|
return Module["asm"]["_SendMessageString"].apply(null, arguments)
|
|
});
|
|
var _SetFullscreen = Module["_SetFullscreen"] = (function() {
|
|
return Module["asm"]["_SetFullscreen"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AIScriptingClasses_cpp = Module["__GLOBAL__sub_I_AIScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AIScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AccessibilityScriptingClasses_cpp = Module["__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp = Module["__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AnimationClip_cpp = Module["__GLOBAL__sub_I_AnimationClip_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AnimationClip_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AnimationScriptingClasses_cpp = Module["__GLOBAL__sub_I_AnimationScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AnimationScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AssetBundleFileSystem_cpp = Module["__GLOBAL__sub_I_AssetBundleFileSystem_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AssetBundleFileSystem_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AssetBundleScriptingClasses_cpp = Module["__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_AudioScriptingClasses_cpp = Module["__GLOBAL__sub_I_AudioScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_AudioScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_ClothScriptingClasses_cpp = Module["__GLOBAL__sub_I_ClothScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_ClothScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_DirectorScriptingClasses_cpp = Module["__GLOBAL__sub_I_DirectorScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_DirectorScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp = Module["__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_External_Yoga_Yoga_0_cpp = Module["__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp = Module["__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_GUITexture_cpp = Module["__GLOBAL__sub_I_GUITexture_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_GUITexture_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_GfxDeviceNull_cpp = Module["__GLOBAL__sub_I_GfxDeviceNull_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_GfxDeviceNull_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_GridScriptingClasses_cpp = Module["__GLOBAL__sub_I_GridScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_GridScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_IMGUIScriptingClasses_cpp = Module["__GLOBAL__sub_I_IMGUIScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_IMGUIScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_InputLegacyScriptingClasses_cpp = Module["__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_InputScriptingClasses_cpp = Module["__GLOBAL__sub_I_InputScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_InputScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_LogAssert_cpp = Module["__GLOBAL__sub_I_LogAssert_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_LogAssert_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_gc_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_mono_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_os_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_os_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_os_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_utils_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_vm_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp = Module["__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Mesh_cpp = Module["__GLOBAL__sub_I_Mesh_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Mesh_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_0_cpp = Module["__GLOBAL__sub_I_Modules_Animation_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_2_cpp = Module["__GLOBAL__sub_I_Modules_Animation_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_7_cpp = Module["__GLOBAL__sub_I_Modules_Animation_7_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_7_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp = Module["__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_Audio_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_Audio_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_3_cpp = Module["__GLOBAL__sub_I_Modules_Audio_Public_3_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_3_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp = Module["__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp = Module["__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Cloth_0_cpp = Module["__GLOBAL__sub_I_Modules_Cloth_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Cloth_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Grid_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_Grid_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Grid_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_IMGUI_0_cpp = Module["__GLOBAL__sub_I_Modules_IMGUI_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_IMGUI_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_IMGUI_1_cpp = Module["__GLOBAL__sub_I_Modules_IMGUI_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_IMGUI_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Input_Private_0_cpp = Module["__GLOBAL__sub_I_Modules_Input_Private_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Input_Private_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_ParticleSystem_0_cpp = Module["__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics_0_cpp = Module["__GLOBAL__sub_I_Modules_Physics_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Physics_2_cpp = Module["__GLOBAL__sub_I_Modules_Physics_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Profiler_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp = Module["__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Subsystems_0_cpp = Module["__GLOBAL__sub_I_Modules_Subsystems_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Subsystems_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_2_cpp = Module["__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_Public_3_cpp = Module["__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Terrain_VR_0_cpp = Module["__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp = Module["__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Tilemap_0_cpp = Module["__GLOBAL__sub_I_Modules_Tilemap_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Tilemap_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UI_0_cpp = Module["__GLOBAL__sub_I_Modules_UI_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UI_1_cpp = Module["__GLOBAL__sub_I_Modules_UI_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UI_2_cpp = Module["__GLOBAL__sub_I_Modules_UI_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VFX_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_VFX_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VFX_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_VFX_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp = Module["__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VR_0_cpp = Module["__GLOBAL__sub_I_Modules_VR_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VR_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_VR_1_cpp = Module["__GLOBAL__sub_I_Modules_VR_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VR_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Video_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_Video_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Video_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp = Module["__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Stats_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_Stats_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Stats_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp = Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Modules_XR_Tracing_0_cpp = Module["__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_NoiseModule_cpp = Module["__GLOBAL__sub_I_NoiseModule_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_NoiseModule_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_ParticleSystemGeometryJob_cpp = Module["__GLOBAL__sub_I_ParticleSystemGeometryJob_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_ParticleSystemGeometryJob_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp = Module["__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Physics2DScriptingClasses_cpp = Module["__GLOBAL__sub_I_Physics2DScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Physics2DScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_PhysicsQuery_cpp = Module["__GLOBAL__sub_I_PhysicsQuery_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_PhysicsQuery_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_PhysicsScriptingClasses_cpp = Module["__GLOBAL__sub_I_PhysicsScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_PhysicsScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp = Module["__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp = Module["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp = Module["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_PluginInterfaceVR_cpp = Module["__GLOBAL__sub_I_PluginInterfaceVR_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_PluginInterfaceVR_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp = Module["__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp = Module["__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp = Module["__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Allocator_2_cpp = Module["__GLOBAL__sub_I_Runtime_Allocator_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Allocator_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Application_0_cpp = Module["__GLOBAL__sub_I_Runtime_Application_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Application_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_0_cpp = Module["__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_1_cpp = Module["__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_2_cpp = Module["__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_BaseClasses_3_cpp = Module["__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Burst_0_cpp = Module["__GLOBAL__sub_I_Runtime_Burst_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Burst_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_0_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_1_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_2_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_5_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_6_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_6_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_6_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_7_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_7_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_7_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_8_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_8_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_8_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp = Module["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Containers_0_cpp = Module["__GLOBAL__sub_I_Runtime_Containers_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Containers_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp = Module["__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Director_Core_1_cpp = Module["__GLOBAL__sub_I_Runtime_Director_Core_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Director_Core_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp = Module["__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_File_0_cpp = Module["__GLOBAL__sub_I_Runtime_File_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_File_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Geometry_2_cpp = Module["__GLOBAL__sub_I_Runtime_Geometry_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Geometry_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_1_cpp = Module["__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_2_cpp = Module["__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_3_cpp = Module["__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_4_cpp = Module["__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_5_cpp = Module["__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp = Module["__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_0_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_10_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_10_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_10_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_11_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_11_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_11_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_12_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_12_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_12_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_1_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_2_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_4_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_4_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_4_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_5_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_6_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_6_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_6_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_8_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_8_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_8_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_9_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_9_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_9_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp = Module["__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Input_0_cpp = Module["__GLOBAL__sub_I_Runtime_Input_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Input_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Interfaces_0_cpp = Module["__GLOBAL__sub_I_Runtime_Interfaces_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Interfaces_1_cpp = Module["__GLOBAL__sub_I_Runtime_Interfaces_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Interfaces_2_cpp = Module["__GLOBAL__sub_I_Runtime_Interfaces_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_0_cpp = Module["__GLOBAL__sub_I_Runtime_Jobs_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_1_cpp = Module["__GLOBAL__sub_I_Runtime_Jobs_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp = Module["__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp = Module["__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Math_2_cpp = Module["__GLOBAL__sub_I_Runtime_Math_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Math_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Math_Random_0_cpp = Module["__GLOBAL__sub_I_Runtime_Math_Random_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Math_Random_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_0_cpp = Module["__GLOBAL__sub_I_Runtime_Misc_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_2_cpp = Module["__GLOBAL__sub_I_Runtime_Misc_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_3_cpp = Module["__GLOBAL__sub_I_Runtime_Misc_3_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_3_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_4_cpp = Module["__GLOBAL__sub_I_Runtime_Misc_4_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_4_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Misc_5_cpp = Module["__GLOBAL__sub_I_Runtime_Misc_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Modules_0_cpp = Module["__GLOBAL__sub_I_Runtime_Modules_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Modules_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Mono_0_cpp = Module["__GLOBAL__sub_I_Runtime_Mono_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp = Module["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp = Module["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_PluginInterface_0_cpp = Module["__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_PreloadManager_0_cpp = Module["__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_0_cpp = Module["__GLOBAL__sub_I_Runtime_Profiler_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_2_cpp = Module["__GLOBAL__sub_I_Runtime_Profiler_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp = Module["__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp = Module["__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_SceneManager_0_cpp = Module["__GLOBAL__sub_I_Runtime_SceneManager_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_SceneManager_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp = Module["__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_0_cpp = Module["__GLOBAL__sub_I_Runtime_Scripting_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_2_cpp = Module["__GLOBAL__sub_I_Runtime_Scripting_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_3_cpp = Module["__GLOBAL__sub_I_Runtime_Scripting_3_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_3_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp = Module["__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_1_cpp = Module["__GLOBAL__sub_I_Runtime_Serialize_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_2_cpp = Module["__GLOBAL__sub_I_Runtime_Serialize_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp = Module["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp = Module["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_0_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_1_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_2_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_4_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_4_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_4_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_5_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp = Module["__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Transform_0_cpp = Module["__GLOBAL__sub_I_Runtime_Transform_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Transform_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Transform_1_cpp = Module["__GLOBAL__sub_I_Runtime_Transform_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Transform_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_2_cpp = Module["__GLOBAL__sub_I_Runtime_Utilities_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_5_cpp = Module["__GLOBAL__sub_I_Runtime_Utilities_5_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_5_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_6_cpp = Module["__GLOBAL__sub_I_Runtime_Utilities_6_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_6_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_7_cpp = Module["__GLOBAL__sub_I_Runtime_Utilities_7_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_7_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Utilities_9_cpp = Module["__GLOBAL__sub_I_Runtime_Utilities_9_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_9_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_Video_0_cpp = Module["__GLOBAL__sub_I_Runtime_Video_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Video_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp = Module["__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Shader_cpp = Module["__GLOBAL__sub_I_Shader_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Shader_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Shadows_cpp = Module["__GLOBAL__sub_I_Shadows_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Shadows_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_ShapeModule_cpp = Module["__GLOBAL__sub_I_ShapeModule_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_ShapeModule_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_SubsystemsScriptingClasses_cpp = Module["__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_SwInterCollision_cpp = Module["__GLOBAL__sub_I_SwInterCollision_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_SwInterCollision_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_SwSolverKernel_cpp = Module["__GLOBAL__sub_I_SwSolverKernel_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_SwSolverKernel_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_TemplateInstantiations_cpp = Module["__GLOBAL__sub_I_TemplateInstantiations_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_TemplateInstantiations_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_TerrainScriptingClasses_cpp = Module["__GLOBAL__sub_I_TerrainScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_TerrainScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_TextCoreScriptingClasses_cpp = Module["__GLOBAL__sub_I_TextCoreScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_TextCoreScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_TextRenderingScriptingClasses_cpp = Module["__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_TilemapScriptingClasses_cpp = Module["__GLOBAL__sub_I_TilemapScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_TilemapScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp = Module["__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_UIScriptingClasses_cpp = Module["__GLOBAL__sub_I_UIScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_UIScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_UVModule_cpp = Module["__GLOBAL__sub_I_UVModule_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_UVModule_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_UnityAdsSettings_cpp = Module["__GLOBAL__sub_I_UnityAdsSettings_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_UnityAdsSettings_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp = Module["__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp = Module["__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_VFXScriptingClasses_cpp = Module["__GLOBAL__sub_I_VFXScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_VFXScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_VRScriptingClasses_cpp = Module["__GLOBAL__sub_I_VRScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_VRScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_VideoScriptingClasses_cpp = Module["__GLOBAL__sub_I_VideoScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_VideoScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_VideoYUV420Convert_cpp = Module["__GLOBAL__sub_I_VideoYUV420Convert_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_VideoYUV420Convert_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_VisualEffectAsset_cpp = Module["__GLOBAL__sub_I_VisualEffectAsset_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_VisualEffectAsset_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_Wind_cpp = Module["__GLOBAL__sub_I_Wind_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_Wind_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_XRAudio_cpp = Module["__GLOBAL__sub_I_XRAudio_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRAudio_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_XRPreInit_cpp = Module["__GLOBAL__sub_I_XRPreInit_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRPreInit_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_XRScriptingClasses_cpp = Module["__GLOBAL__sub_I_XRScriptingClasses_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRScriptingClasses_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_XRWindowsLocatableCamera_cpp = Module["__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp = Module["__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_nvcloth_src_0_cpp = Module["__GLOBAL__sub_I_nvcloth_src_0_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_nvcloth_src_0_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_nvcloth_src_1_cpp = Module["__GLOBAL__sub_I_nvcloth_src_1_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_nvcloth_src_1_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_physx_source_physxextensions_src_2_cpp = Module["__GLOBAL__sub_I_physx_source_physxextensions_src_2_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_physx_source_physxextensions_src_2_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_umbra_cpp = Module["__GLOBAL__sub_I_umbra_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_umbra_cpp"].apply(null, arguments)
|
|
});
|
|
var ___cxa_can_catch = Module["___cxa_can_catch"] = (function() {
|
|
return Module["asm"]["___cxa_can_catch"].apply(null, arguments)
|
|
});
|
|
var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = (function() {
|
|
return Module["asm"]["___cxa_is_pointer_type"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_10024 = Module["___cxx_global_var_init_10024"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_10024"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_104_4269 = Module["___cxx_global_var_init_104_4269"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_104_4269"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_130_7666 = Module["___cxx_global_var_init_130_7666"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_130_7666"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_18_10374 = Module["___cxx_global_var_init_18_10374"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_18_10374"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_18_1122 = Module["___cxx_global_var_init_18_1122"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_18_1122"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_19_10375 = Module["___cxx_global_var_init_19_10375"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_19_10375"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_20_10376 = Module["___cxx_global_var_init_20_10376"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_20_10376"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_23_17 = Module["___cxx_global_var_init_23_17"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_23_17"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_3992 = Module["___cxx_global_var_init_3992"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_3992"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_528 = Module["___cxx_global_var_init_528"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_528"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_62_8873 = Module["___cxx_global_var_init_62_8873"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_62_8873"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_89_7101 = Module["___cxx_global_var_init_89_7101"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_89_7101"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_9577 = Module["___cxx_global_var_init_9577"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_9577"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_9_9378 = Module["___cxx_global_var_init_9_9378"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_9_9378"].apply(null, arguments)
|
|
});
|
|
var ___emscripten_environ_constructor = Module["___emscripten_environ_constructor"] = (function() {
|
|
return Module["asm"]["___emscripten_environ_constructor"].apply(null, arguments)
|
|
});
|
|
var ___errno_location = Module["___errno_location"] = (function() {
|
|
return Module["asm"]["___errno_location"].apply(null, arguments)
|
|
});
|
|
var __get_daylight = Module["__get_daylight"] = (function() {
|
|
return Module["asm"]["__get_daylight"].apply(null, arguments)
|
|
});
|
|
var __get_environ = Module["__get_environ"] = (function() {
|
|
return Module["asm"]["__get_environ"].apply(null, arguments)
|
|
});
|
|
var __get_timezone = Module["__get_timezone"] = (function() {
|
|
return Module["asm"]["__get_timezone"].apply(null, arguments)
|
|
});
|
|
var __get_tzname = Module["__get_tzname"] = (function() {
|
|
return Module["asm"]["__get_tzname"].apply(null, arguments)
|
|
});
|
|
var _emscripten_replace_memory = Module["_emscripten_replace_memory"] = (function() {
|
|
return Module["asm"]["_emscripten_replace_memory"].apply(null, arguments)
|
|
});
|
|
var _free = Module["_free"] = (function() {
|
|
return Module["asm"]["_free"].apply(null, arguments)
|
|
});
|
|
var _htonl = Module["_htonl"] = (function() {
|
|
return Module["asm"]["_htonl"].apply(null, arguments)
|
|
});
|
|
var _htons = Module["_htons"] = (function() {
|
|
return Module["asm"]["_htons"].apply(null, arguments)
|
|
});
|
|
var _i64Add = Module["_i64Add"] = (function() {
|
|
return Module["asm"]["_i64Add"].apply(null, arguments)
|
|
});
|
|
var _llvm_bswap_i16 = Module["_llvm_bswap_i16"] = (function() {
|
|
return Module["asm"]["_llvm_bswap_i16"].apply(null, arguments)
|
|
});
|
|
var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = (function() {
|
|
return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments)
|
|
});
|
|
var _llvm_ctlz_i64 = Module["_llvm_ctlz_i64"] = (function() {
|
|
return Module["asm"]["_llvm_ctlz_i64"].apply(null, arguments)
|
|
});
|
|
var _llvm_ctpop_i32 = Module["_llvm_ctpop_i32"] = (function() {
|
|
return Module["asm"]["_llvm_ctpop_i32"].apply(null, arguments)
|
|
});
|
|
var _llvm_maxnum_f32 = Module["_llvm_maxnum_f32"] = (function() {
|
|
return Module["asm"]["_llvm_maxnum_f32"].apply(null, arguments)
|
|
});
|
|
var _llvm_maxnum_f64 = Module["_llvm_maxnum_f64"] = (function() {
|
|
return Module["asm"]["_llvm_maxnum_f64"].apply(null, arguments)
|
|
});
|
|
var _llvm_minnum_f32 = Module["_llvm_minnum_f32"] = (function() {
|
|
return Module["asm"]["_llvm_minnum_f32"].apply(null, arguments)
|
|
});
|
|
var _llvm_round_f32 = Module["_llvm_round_f32"] = (function() {
|
|
return Module["asm"]["_llvm_round_f32"].apply(null, arguments)
|
|
});
|
|
var _main = Module["_main"] = (function() {
|
|
return Module["asm"]["_main"].apply(null, arguments)
|
|
});
|
|
var _malloc = Module["_malloc"] = (function() {
|
|
return Module["asm"]["_malloc"].apply(null, arguments)
|
|
});
|
|
var _memalign = Module["_memalign"] = (function() {
|
|
return Module["asm"]["_memalign"].apply(null, arguments)
|
|
});
|
|
var _memcpy = Module["_memcpy"] = (function() {
|
|
return Module["asm"]["_memcpy"].apply(null, arguments)
|
|
});
|
|
var _memmove = Module["_memmove"] = (function() {
|
|
return Module["asm"]["_memmove"].apply(null, arguments)
|
|
});
|
|
var _memset = Module["_memset"] = (function() {
|
|
return Module["asm"]["_memset"].apply(null, arguments)
|
|
});
|
|
var _ntohs = Module["_ntohs"] = (function() {
|
|
return Module["asm"]["_ntohs"].apply(null, arguments)
|
|
});
|
|
var _pthread_cond_broadcast = Module["_pthread_cond_broadcast"] = (function() {
|
|
return Module["asm"]["_pthread_cond_broadcast"].apply(null, arguments)
|
|
});
|
|
var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = (function() {
|
|
return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments)
|
|
});
|
|
var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = (function() {
|
|
return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments)
|
|
});
|
|
var _realloc = Module["_realloc"] = (function() {
|
|
return Module["asm"]["_realloc"].apply(null, arguments)
|
|
});
|
|
var _saveSetjmp = Module["_saveSetjmp"] = (function() {
|
|
return Module["asm"]["_saveSetjmp"].apply(null, arguments)
|
|
});
|
|
var _sbrk = Module["_sbrk"] = (function() {
|
|
return Module["asm"]["_sbrk"].apply(null, arguments)
|
|
});
|
|
var _strlen = Module["_strlen"] = (function() {
|
|
return Module["asm"]["_strlen"].apply(null, arguments)
|
|
});
|
|
var _testSetjmp = Module["_testSetjmp"] = (function() {
|
|
return Module["asm"]["_testSetjmp"].apply(null, arguments)
|
|
});
|
|
var establishStackSpace = Module["establishStackSpace"] = (function() {
|
|
return Module["asm"]["establishStackSpace"].apply(null, arguments)
|
|
});
|
|
var getTempRet0 = Module["getTempRet0"] = (function() {
|
|
return Module["asm"]["getTempRet0"].apply(null, arguments)
|
|
});
|
|
var runPostSets = Module["runPostSets"] = (function() {
|
|
return Module["asm"]["runPostSets"].apply(null, arguments)
|
|
});
|
|
var setTempRet0 = Module["setTempRet0"] = (function() {
|
|
return Module["asm"]["setTempRet0"].apply(null, arguments)
|
|
});
|
|
var setThrew = Module["setThrew"] = (function() {
|
|
return Module["asm"]["setThrew"].apply(null, arguments)
|
|
});
|
|
var stackAlloc = Module["stackAlloc"] = (function() {
|
|
return Module["asm"]["stackAlloc"].apply(null, arguments)
|
|
});
|
|
var stackRestore = Module["stackRestore"] = (function() {
|
|
return Module["asm"]["stackRestore"].apply(null, arguments)
|
|
});
|
|
var stackSave = Module["stackSave"] = (function() {
|
|
return Module["asm"]["stackSave"].apply(null, arguments)
|
|
});
|
|
var dynCall_dddi = Module["dynCall_dddi"] = (function() {
|
|
return Module["asm"]["dynCall_dddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ddi = Module["dynCall_ddi"] = (function() {
|
|
return Module["asm"]["dynCall_ddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_dfi = Module["dynCall_dfi"] = (function() {
|
|
return Module["asm"]["dynCall_dfi"].apply(null, arguments)
|
|
});
|
|
var dynCall_di = Module["dynCall_di"] = (function() {
|
|
return Module["asm"]["dynCall_di"].apply(null, arguments)
|
|
});
|
|
var dynCall_diddi = Module["dynCall_diddi"] = (function() {
|
|
return Module["asm"]["dynCall_diddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_didi = Module["dynCall_didi"] = (function() {
|
|
return Module["asm"]["dynCall_didi"].apply(null, arguments)
|
|
});
|
|
var dynCall_dii = Module["dynCall_dii"] = (function() {
|
|
return Module["asm"]["dynCall_dii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diii = Module["dynCall_diii"] = (function() {
|
|
return Module["asm"]["dynCall_diii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiidi = Module["dynCall_diiidi"] = (function() {
|
|
return Module["asm"]["dynCall_diiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiii = Module["dynCall_diiii"] = (function() {
|
|
return Module["asm"]["dynCall_diiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_dji = Module["dynCall_dji"] = (function() {
|
|
return Module["asm"]["dynCall_dji"].apply(null, arguments)
|
|
});
|
|
var dynCall_f = Module["dynCall_f"] = (function() {
|
|
return Module["asm"]["dynCall_f"].apply(null, arguments)
|
|
});
|
|
var dynCall_fdi = Module["dynCall_fdi"] = (function() {
|
|
return Module["asm"]["dynCall_fdi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ff = Module["dynCall_ff"] = (function() {
|
|
return Module["asm"]["dynCall_ff"].apply(null, arguments)
|
|
});
|
|
var dynCall_fff = Module["dynCall_fff"] = (function() {
|
|
return Module["asm"]["dynCall_fff"].apply(null, arguments)
|
|
});
|
|
var dynCall_ffffffi = Module["dynCall_ffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_ffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fffffi = Module["dynCall_fffffi"] = (function() {
|
|
return Module["asm"]["dynCall_fffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ffffi = Module["dynCall_ffffi"] = (function() {
|
|
return Module["asm"]["dynCall_ffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fffi = Module["dynCall_fffi"] = (function() {
|
|
return Module["asm"]["dynCall_fffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fffiffffffi = Module["dynCall_fffiffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_fffiffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fffifffffi = Module["dynCall_fffifffffi"] = (function() {
|
|
return Module["asm"]["dynCall_fffifffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fffifffi = Module["dynCall_fffifffi"] = (function() {
|
|
return Module["asm"]["dynCall_fffifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ffi = Module["dynCall_ffi"] = (function() {
|
|
return Module["asm"]["dynCall_ffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fi = Module["dynCall_fi"] = (function() {
|
|
return Module["asm"]["dynCall_fi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fif = Module["dynCall_fif"] = (function() {
|
|
return Module["asm"]["dynCall_fif"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiff = Module["dynCall_fiff"] = (function() {
|
|
return Module["asm"]["dynCall_fiff"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiffi = Module["dynCall_fiffi"] = (function() {
|
|
return Module["asm"]["dynCall_fiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fifi = Module["dynCall_fifi"] = (function() {
|
|
return Module["asm"]["dynCall_fifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fifii = Module["dynCall_fifii"] = (function() {
|
|
return Module["asm"]["dynCall_fifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fii = Module["dynCall_fii"] = (function() {
|
|
return Module["asm"]["dynCall_fii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiffi = Module["dynCall_fiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_fiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiifi = Module["dynCall_fiifi"] = (function() {
|
|
return Module["asm"]["dynCall_fiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiifii = Module["dynCall_fiifii"] = (function() {
|
|
return Module["asm"]["dynCall_fiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiii = Module["dynCall_fiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiifi = Module["dynCall_fiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_fiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiii = Module["dynCall_fiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiif = Module["dynCall_fiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiii = Module["dynCall_fiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiii = Module["dynCall_fiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiiifiifif = Module["dynCall_fiiiiiifiifif"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiiifiifif"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiiifiiiif = Module["dynCall_fiiiiiifiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiiifiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_fji = Module["dynCall_fji"] = (function() {
|
|
return Module["asm"]["dynCall_fji"].apply(null, arguments)
|
|
});
|
|
var dynCall_i = Module["dynCall_i"] = (function() {
|
|
return Module["asm"]["dynCall_i"].apply(null, arguments)
|
|
});
|
|
var dynCall_iddi = Module["dynCall_iddi"] = (function() {
|
|
return Module["asm"]["dynCall_iddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_idi = Module["dynCall_idi"] = (function() {
|
|
return Module["asm"]["dynCall_idi"].apply(null, arguments)
|
|
});
|
|
var dynCall_idiii = Module["dynCall_idiii"] = (function() {
|
|
return Module["asm"]["dynCall_idiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_ifffi = Module["dynCall_ifffi"] = (function() {
|
|
return Module["asm"]["dynCall_ifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iffi = Module["dynCall_iffi"] = (function() {
|
|
return Module["asm"]["dynCall_iffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ifi = Module["dynCall_ifi"] = (function() {
|
|
return Module["asm"]["dynCall_ifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ifii = Module["dynCall_ifii"] = (function() {
|
|
return Module["asm"]["dynCall_ifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_ifiii = Module["dynCall_ifiii"] = (function() {
|
|
return Module["asm"]["dynCall_ifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_ii = Module["dynCall_ii"] = (function() {
|
|
return Module["asm"]["dynCall_ii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiddi = Module["dynCall_iiddi"] = (function() {
|
|
return Module["asm"]["dynCall_iiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iidi = Module["dynCall_iidi"] = (function() {
|
|
return Module["asm"]["dynCall_iidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iidii = Module["dynCall_iidii"] = (function() {
|
|
return Module["asm"]["dynCall_iidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iidiii = Module["dynCall_iidiii"] = (function() {
|
|
return Module["asm"]["dynCall_iidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iif = Module["dynCall_iif"] = (function() {
|
|
return Module["asm"]["dynCall_iif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifff = Module["dynCall_iifff"] = (function() {
|
|
return Module["asm"]["dynCall_iifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifffi = Module["dynCall_iifffi"] = (function() {
|
|
return Module["asm"]["dynCall_iifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiffi = Module["dynCall_iiffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifi = Module["dynCall_iifi"] = (function() {
|
|
return Module["asm"]["dynCall_iifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iififii = Module["dynCall_iififii"] = (function() {
|
|
return Module["asm"]["dynCall_iififii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifii = Module["dynCall_iifii"] = (function() {
|
|
return Module["asm"]["dynCall_iifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifiii = Module["dynCall_iifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifiiiijii = Module["dynCall_iifiiiijii"] = (function() {
|
|
return Module["asm"]["dynCall_iifiiiijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iii = Module["dynCall_iii"] = (function() {
|
|
return Module["asm"]["dynCall_iii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiidiii = Module["dynCall_iiidiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiif = Module["dynCall_iiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiff = Module["dynCall_iiiff"] = (function() {
|
|
return Module["asm"]["dynCall_iiiff"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifffi = Module["dynCall_iiifffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiffi = Module["dynCall_iiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifi = Module["dynCall_iiifi"] = (function() {
|
|
return Module["asm"]["dynCall_iiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiififi = Module["dynCall_iiififi"] = (function() {
|
|
return Module["asm"]["dynCall_iiififi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiififii = Module["dynCall_iiififii"] = (function() {
|
|
return Module["asm"]["dynCall_iiififii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifii = Module["dynCall_iiifii"] = (function() {
|
|
return Module["asm"]["dynCall_iiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifiii = Module["dynCall_iiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifiiii = Module["dynCall_iiifiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiifiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiii = Module["dynCall_iiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiidi = Module["dynCall_iiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiidii = Module["dynCall_iiiidii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifffffi = Module["dynCall_iiiifffffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifffffii = Module["dynCall_iiiifffffii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifffffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiffffi = Module["dynCall_iiiiffffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifffiii = Module["dynCall_iiiifffiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiffi = Module["dynCall_iiiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiffii = Module["dynCall_iiiiffii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifi = Module["dynCall_iiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifii = Module["dynCall_iiiifii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifiii = Module["dynCall_iiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifiiii = Module["dynCall_iiiifiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifiiiii = Module["dynCall_iiiifiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiii = Module["dynCall_iiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiifi = Module["dynCall_iiiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiifiii = Module["dynCall_iiiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiifiiiiif = Module["dynCall_iiiiifiiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiifiiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiii = Module["dynCall_iiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiifff = Module["dynCall_iiiiiifff"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiifffiiifiii = Module["dynCall_iiiiiifffiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiifffiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiffiiiiiiiiiffffiii = Module["dynCall_iiiiiiffiiiiiiiiiffffiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiffiiiiiiiiiffffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiffiiiiiiiiiffffiiii = Module["dynCall_iiiiiiffiiiiiiiiiffffiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiffiiiiiiiiiffffiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiffiiiiiiiiiiiiiii = Module["dynCall_iiiiiiffiiiiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiffiiiiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiifiif = Module["dynCall_iiiiiifiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiifiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiifiii = Module["dynCall_iiiiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiifiif = Module["dynCall_iiiiiiifiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiifiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiiii = Module["dynCall_iiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiiiii = Module["dynCall_iiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiji = Module["dynCall_iiiiiji"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiij = Module["dynCall_iiiij"] = (function() {
|
|
return Module["asm"]["dynCall_iiiij"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiji = Module["dynCall_iiiiji"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiijii = Module["dynCall_iiiijii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiijiii = Module["dynCall_iiiijiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiij = Module["dynCall_iiij"] = (function() {
|
|
return Module["asm"]["dynCall_iiij"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiji = Module["dynCall_iiiji"] = (function() {
|
|
return Module["asm"]["dynCall_iiiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiijii = Module["dynCall_iiijii"] = (function() {
|
|
return Module["asm"]["dynCall_iiijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiijiii = Module["dynCall_iiijiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iij = Module["dynCall_iij"] = (function() {
|
|
return Module["asm"]["dynCall_iij"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiji = Module["dynCall_iiji"] = (function() {
|
|
return Module["asm"]["dynCall_iiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_iijii = Module["dynCall_iijii"] = (function() {
|
|
return Module["asm"]["dynCall_iijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iijiii = Module["dynCall_iijiii"] = (function() {
|
|
return Module["asm"]["dynCall_iijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iijji = Module["dynCall_iijji"] = (function() {
|
|
return Module["asm"]["dynCall_iijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_iijjii = Module["dynCall_iijjii"] = (function() {
|
|
return Module["asm"]["dynCall_iijjii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iijjji = Module["dynCall_iijjji"] = (function() {
|
|
return Module["asm"]["dynCall_iijjji"].apply(null, arguments)
|
|
});
|
|
var dynCall_ij = Module["dynCall_ij"] = (function() {
|
|
return Module["asm"]["dynCall_ij"].apply(null, arguments)
|
|
});
|
|
var dynCall_iji = Module["dynCall_iji"] = (function() {
|
|
return Module["asm"]["dynCall_iji"].apply(null, arguments)
|
|
});
|
|
var dynCall_ijiii = Module["dynCall_ijiii"] = (function() {
|
|
return Module["asm"]["dynCall_ijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_ijj = Module["dynCall_ijj"] = (function() {
|
|
return Module["asm"]["dynCall_ijj"].apply(null, arguments)
|
|
});
|
|
var dynCall_ijji = Module["dynCall_ijji"] = (function() {
|
|
return Module["asm"]["dynCall_ijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_j = Module["dynCall_j"] = (function() {
|
|
return Module["asm"]["dynCall_j"].apply(null, arguments)
|
|
});
|
|
var dynCall_jdi = Module["dynCall_jdi"] = (function() {
|
|
return Module["asm"]["dynCall_jdi"].apply(null, arguments)
|
|
});
|
|
var dynCall_jdii = Module["dynCall_jdii"] = (function() {
|
|
return Module["asm"]["dynCall_jdii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jfi = Module["dynCall_jfi"] = (function() {
|
|
return Module["asm"]["dynCall_jfi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ji = Module["dynCall_ji"] = (function() {
|
|
return Module["asm"]["dynCall_ji"].apply(null, arguments)
|
|
});
|
|
var dynCall_jidi = Module["dynCall_jidi"] = (function() {
|
|
return Module["asm"]["dynCall_jidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_jidii = Module["dynCall_jidii"] = (function() {
|
|
return Module["asm"]["dynCall_jidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jii = Module["dynCall_jii"] = (function() {
|
|
return Module["asm"]["dynCall_jii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiii = Module["dynCall_jiii"] = (function() {
|
|
return Module["asm"]["dynCall_jiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiiii = Module["dynCall_jiiii"] = (function() {
|
|
return Module["asm"]["dynCall_jiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiiiii = Module["dynCall_jiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_jiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiiiiii = Module["dynCall_jiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_jiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiiiiiiiiii = Module["dynCall_jiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_jiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiiji = Module["dynCall_jiiji"] = (function() {
|
|
return Module["asm"]["dynCall_jiiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_jiji = Module["dynCall_jiji"] = (function() {
|
|
return Module["asm"]["dynCall_jiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_jijii = Module["dynCall_jijii"] = (function() {
|
|
return Module["asm"]["dynCall_jijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jijiii = Module["dynCall_jijiii"] = (function() {
|
|
return Module["asm"]["dynCall_jijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_jijj = Module["dynCall_jijj"] = (function() {
|
|
return Module["asm"]["dynCall_jijj"].apply(null, arguments)
|
|
});
|
|
var dynCall_jijji = Module["dynCall_jijji"] = (function() {
|
|
return Module["asm"]["dynCall_jijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_jji = Module["dynCall_jji"] = (function() {
|
|
return Module["asm"]["dynCall_jji"].apply(null, arguments)
|
|
});
|
|
var dynCall_v = Module["dynCall_v"] = (function() {
|
|
return Module["asm"]["dynCall_v"].apply(null, arguments)
|
|
});
|
|
var dynCall_vd = Module["dynCall_vd"] = (function() {
|
|
return Module["asm"]["dynCall_vd"].apply(null, arguments)
|
|
});
|
|
var dynCall_vf = Module["dynCall_vf"] = (function() {
|
|
return Module["asm"]["dynCall_vf"].apply(null, arguments)
|
|
});
|
|
var dynCall_vff = Module["dynCall_vff"] = (function() {
|
|
return Module["asm"]["dynCall_vff"].apply(null, arguments)
|
|
});
|
|
var dynCall_vfff = Module["dynCall_vfff"] = (function() {
|
|
return Module["asm"]["dynCall_vfff"].apply(null, arguments)
|
|
});
|
|
var dynCall_vffff = Module["dynCall_vffff"] = (function() {
|
|
return Module["asm"]["dynCall_vffff"].apply(null, arguments)
|
|
});
|
|
var dynCall_vffffi = Module["dynCall_vffffi"] = (function() {
|
|
return Module["asm"]["dynCall_vffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vfffi = Module["dynCall_vfffi"] = (function() {
|
|
return Module["asm"]["dynCall_vfffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vffi = Module["dynCall_vffi"] = (function() {
|
|
return Module["asm"]["dynCall_vffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vfi = Module["dynCall_vfi"] = (function() {
|
|
return Module["asm"]["dynCall_vfi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vfii = Module["dynCall_vfii"] = (function() {
|
|
return Module["asm"]["dynCall_vfii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vfiii = Module["dynCall_vfiii"] = (function() {
|
|
return Module["asm"]["dynCall_vfiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vi = Module["dynCall_vi"] = (function() {
|
|
return Module["asm"]["dynCall_vi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vid = Module["dynCall_vid"] = (function() {
|
|
return Module["asm"]["dynCall_vid"].apply(null, arguments)
|
|
});
|
|
var dynCall_vidi = Module["dynCall_vidi"] = (function() {
|
|
return Module["asm"]["dynCall_vidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vidiii = Module["dynCall_vidiii"] = (function() {
|
|
return Module["asm"]["dynCall_vidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vif = Module["dynCall_vif"] = (function() {
|
|
return Module["asm"]["dynCall_vif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viff = Module["dynCall_viff"] = (function() {
|
|
return Module["asm"]["dynCall_viff"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifff = Module["dynCall_vifff"] = (function() {
|
|
return Module["asm"]["dynCall_vifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffff = Module["dynCall_viffff"] = (function() {
|
|
return Module["asm"]["dynCall_viffff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffffffi = Module["dynCall_viffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifffffi = Module["dynCall_vifffffi"] = (function() {
|
|
return Module["asm"]["dynCall_vifffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffffi = Module["dynCall_viffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffffii = Module["dynCall_viffffii"] = (function() {
|
|
return Module["asm"]["dynCall_viffffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffffiifffiiiiif = Module["dynCall_viffffiifffiiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_viffffiifffiiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifffi = Module["dynCall_vifffi"] = (function() {
|
|
return Module["asm"]["dynCall_vifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifffifii = Module["dynCall_vifffifii"] = (function() {
|
|
return Module["asm"]["dynCall_vifffifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifffii = Module["dynCall_vifffii"] = (function() {
|
|
return Module["asm"]["dynCall_vifffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffi = Module["dynCall_viffi"] = (function() {
|
|
return Module["asm"]["dynCall_viffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffii = Module["dynCall_viffii"] = (function() {
|
|
return Module["asm"]["dynCall_viffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffiifffffiii = Module["dynCall_viffiifffffiii"] = (function() {
|
|
return Module["asm"]["dynCall_viffiifffffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffiii = Module["dynCall_viffiii"] = (function() {
|
|
return Module["asm"]["dynCall_viffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffiiiif = Module["dynCall_viffiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_viffiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifi = Module["dynCall_vifi"] = (function() {
|
|
return Module["asm"]["dynCall_vifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vififiii = Module["dynCall_vififiii"] = (function() {
|
|
return Module["asm"]["dynCall_vififiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifii = Module["dynCall_vifii"] = (function() {
|
|
return Module["asm"]["dynCall_vifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifiiii = Module["dynCall_vifiiii"] = (function() {
|
|
return Module["asm"]["dynCall_vifiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifijii = Module["dynCall_vifijii"] = (function() {
|
|
return Module["asm"]["dynCall_vifijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vii = Module["dynCall_vii"] = (function() {
|
|
return Module["asm"]["dynCall_vii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viid = Module["dynCall_viid"] = (function() {
|
|
return Module["asm"]["dynCall_viid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidi = Module["dynCall_viidi"] = (function() {
|
|
return Module["asm"]["dynCall_viidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidii = Module["dynCall_viidii"] = (function() {
|
|
return Module["asm"]["dynCall_viidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viif = Module["dynCall_viif"] = (function() {
|
|
return Module["asm"]["dynCall_viif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiff = Module["dynCall_viiff"] = (function() {
|
|
return Module["asm"]["dynCall_viiff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifff = Module["dynCall_viifff"] = (function() {
|
|
return Module["asm"]["dynCall_viifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffffffffi = Module["dynCall_viiffffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiffffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffffffffiii = Module["dynCall_viiffffffffiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiffffffffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifffffffi = Module["dynCall_viifffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viifffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffffffi = Module["dynCall_viiffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifffffi = Module["dynCall_viifffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viifffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffffi = Module["dynCall_viiffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifffi = Module["dynCall_viifffi"] = (function() {
|
|
return Module["asm"]["dynCall_viifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffi = Module["dynCall_viiffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffii = Module["dynCall_viiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffiii = Module["dynCall_viiffiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifi = Module["dynCall_viifi"] = (function() {
|
|
return Module["asm"]["dynCall_viifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viififii = Module["dynCall_viififii"] = (function() {
|
|
return Module["asm"]["dynCall_viififii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viififiii = Module["dynCall_viififiii"] = (function() {
|
|
return Module["asm"]["dynCall_viififiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifii = Module["dynCall_viifii"] = (function() {
|
|
return Module["asm"]["dynCall_viifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifiii = Module["dynCall_viifiii"] = (function() {
|
|
return Module["asm"]["dynCall_viifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifiiii = Module["dynCall_viifiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viifiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viii = Module["dynCall_viii"] = (function() {
|
|
return Module["asm"]["dynCall_viii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidi = Module["dynCall_viiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiif = Module["dynCall_viiif"] = (function() {
|
|
return Module["asm"]["dynCall_viiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifffi = Module["dynCall_viiifffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiffi = Module["dynCall_viiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiffii = Module["dynCall_viiiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifi = Module["dynCall_viiifi"] = (function() {
|
|
return Module["asm"]["dynCall_viiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiififfi = Module["dynCall_viiififfi"] = (function() {
|
|
return Module["asm"]["dynCall_viiififfi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiififi = Module["dynCall_viiififi"] = (function() {
|
|
return Module["asm"]["dynCall_viiififi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiififii = Module["dynCall_viiififii"] = (function() {
|
|
return Module["asm"]["dynCall_viiififii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifii = Module["dynCall_viiifii"] = (function() {
|
|
return Module["asm"]["dynCall_viiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifiii = Module["dynCall_viiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifiiiii = Module["dynCall_viiifiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiifiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiii = Module["dynCall_viiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiif = Module["dynCall_viiiif"] = (function() {
|
|
return Module["asm"]["dynCall_viiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiffffffi = Module["dynCall_viiiiffffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiffffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifffffi = Module["dynCall_viiiifffffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifffffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiffffii = Module["dynCall_viiiiffffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiffffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifffi = Module["dynCall_viiiifffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiffi = Module["dynCall_viiiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifi = Module["dynCall_viiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiififfi = Module["dynCall_viiiififfi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiififfi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifii = Module["dynCall_viiiifii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiifi = Module["dynCall_viiiifiifi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiii = Module["dynCall_viiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiiii = Module["dynCall_viiiifiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiiiii = Module["dynCall_viiiifiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiiiiif = Module["dynCall_viiiifiiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiiiiiiii = Module["dynCall_viiiifiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiii = Module["dynCall_viiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiif = Module["dynCall_viiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiffi = Module["dynCall_viiiiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiffii = Module["dynCall_viiiiiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiifi = Module["dynCall_viiiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiii = Module["dynCall_viiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiif = Module["dynCall_viiiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiifi = Module["dynCall_viiiiiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiii = Module["dynCall_viiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiifii = Module["dynCall_viiiiiiiiiiifii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiii = Module["dynCall_viiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiij = Module["dynCall_viiiij"] = (function() {
|
|
return Module["asm"]["dynCall_viiiij"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiijiiii = Module["dynCall_viiiijiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiijiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiji = Module["dynCall_viiiji"] = (function() {
|
|
return Module["asm"]["dynCall_viiiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiijji = Module["dynCall_viiijji"] = (function() {
|
|
return Module["asm"]["dynCall_viiijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_viij = Module["dynCall_viij"] = (function() {
|
|
return Module["asm"]["dynCall_viij"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiji = Module["dynCall_viiji"] = (function() {
|
|
return Module["asm"]["dynCall_viiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijii = Module["dynCall_viijii"] = (function() {
|
|
return Module["asm"]["dynCall_viijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijiijiii = Module["dynCall_viijiijiii"] = (function() {
|
|
return Module["asm"]["dynCall_viijiijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijijii = Module["dynCall_viijijii"] = (function() {
|
|
return Module["asm"]["dynCall_viijijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijijiii = Module["dynCall_viijijiii"] = (function() {
|
|
return Module["asm"]["dynCall_viijijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijijj = Module["dynCall_viijijj"] = (function() {
|
|
return Module["asm"]["dynCall_viijijj"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijj = Module["dynCall_viijj"] = (function() {
|
|
return Module["asm"]["dynCall_viijj"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijji = Module["dynCall_viijji"] = (function() {
|
|
return Module["asm"]["dynCall_viijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijjiii = Module["dynCall_viijjiii"] = (function() {
|
|
return Module["asm"]["dynCall_viijjiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijjji = Module["dynCall_viijjji"] = (function() {
|
|
return Module["asm"]["dynCall_viijjji"].apply(null, arguments)
|
|
});
|
|
var dynCall_vij = Module["dynCall_vij"] = (function() {
|
|
return Module["asm"]["dynCall_vij"].apply(null, arguments)
|
|
});
|
|
var dynCall_viji = Module["dynCall_viji"] = (function() {
|
|
return Module["asm"]["dynCall_viji"].apply(null, arguments)
|
|
});
|
|
var dynCall_vijii = Module["dynCall_vijii"] = (function() {
|
|
return Module["asm"]["dynCall_vijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vijiii = Module["dynCall_vijiii"] = (function() {
|
|
return Module["asm"]["dynCall_vijiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vijiji = Module["dynCall_vijiji"] = (function() {
|
|
return Module["asm"]["dynCall_vijiji"].apply(null, arguments)
|
|
});
|
|
var dynCall_vijijji = Module["dynCall_vijijji"] = (function() {
|
|
return Module["asm"]["dynCall_vijijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_vijji = Module["dynCall_vijji"] = (function() {
|
|
return Module["asm"]["dynCall_vijji"].apply(null, arguments)
|
|
});
|
|
var dynCall_vijjii = Module["dynCall_vijjii"] = (function() {
|
|
return Module["asm"]["dynCall_vijjii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vji = Module["dynCall_vji"] = (function() {
|
|
return Module["asm"]["dynCall_vji"].apply(null, arguments)
|
|
});
|
|
var dynCall_vjiiii = Module["dynCall_vjiiii"] = (function() {
|
|
return Module["asm"]["dynCall_vjiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vjji = Module["dynCall_vjji"] = (function() {
|
|
return Module["asm"]["dynCall_vjji"].apply(null, arguments)
|
|
});
|
|
Module["asm"] = asm;
|
|
Module["ccall"] = ccall;
|
|
Module["cwrap"] = cwrap;
|
|
Module["stackTrace"] = stackTrace;
|
|
Module["addRunDependency"] = addRunDependency;
|
|
Module["removeRunDependency"] = removeRunDependency;
|
|
Module["FS_createPath"] = FS.createPath;
|
|
Module["FS_createDataFile"] = FS.createDataFile;
|
|
|
|
function ExitStatus(status) {
|
|
this.name = "ExitStatus";
|
|
this.message = "Program terminated with exit(" + status + ")";
|
|
this.status = status
|
|
}
|
|
ExitStatus.prototype = new Error;
|
|
ExitStatus.prototype.constructor = ExitStatus;
|
|
var initialStackTop;
|
|
var calledMain = false;
|
|
dependenciesFulfilled = function runCaller() {
|
|
if (!Module["calledRun"]) run();
|
|
if (!Module["calledRun"]) dependenciesFulfilled = runCaller
|
|
};
|
|
Module["callMain"] = function callMain(args) {
|
|
args = args || [];
|
|
ensureInitRuntime();
|
|
var argc = args.length + 1;
|
|
var argv = stackAlloc((argc + 1) * 4);
|
|
HEAP32[argv >> 2] = allocateUTF8OnStack(Module["thisProgram"]);
|
|
for (var i = 1; i < argc; i++) {
|
|
HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1])
|
|
}
|
|
HEAP32[(argv >> 2) + argc] = 0;
|
|
try {
|
|
var ret = Module["_main"](argc, argv, 0);
|
|
exit(ret, true)
|
|
} catch (e) {
|
|
if (e instanceof ExitStatus) {
|
|
return
|
|
} else if (e == "SimulateInfiniteLoop") {
|
|
Module["noExitRuntime"] = true;
|
|
return
|
|
} else {
|
|
var toLog = e;
|
|
if (e && typeof e === "object" && e.stack) {
|
|
toLog = [e, e.stack]
|
|
}
|
|
err("exception thrown: " + toLog);
|
|
Module["quit"](1, e)
|
|
}
|
|
} finally {
|
|
calledMain = true
|
|
}
|
|
};
|
|
|
|
function run(args) {
|
|
args = args || Module["arguments"];
|
|
if (runDependencies > 0) {
|
|
return
|
|
}
|
|
preRun();
|
|
if (runDependencies > 0) return;
|
|
if (Module["calledRun"]) return;
|
|
|
|
function doRun() {
|
|
if (Module["calledRun"]) return;
|
|
Module["calledRun"] = true;
|
|
if (ABORT) return;
|
|
ensureInitRuntime();
|
|
preMain();
|
|
if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"]();
|
|
if (Module["_main"] && shouldRunNow) Module["callMain"](args);
|
|
postRun()
|
|
}
|
|
if (Module["setStatus"]) {
|
|
Module["setStatus"]("Running...");
|
|
setTimeout((function() {
|
|
setTimeout((function() {
|
|
Module["setStatus"]("")
|
|
}), 1);
|
|
doRun()
|
|
}), 1)
|
|
} else {
|
|
doRun()
|
|
}
|
|
}
|
|
Module["run"] = run;
|
|
|
|
function exit(status, implicit) {
|
|
if (implicit && Module["noExitRuntime"] && status === 0) {
|
|
return
|
|
}
|
|
if (Module["noExitRuntime"]) {} else {
|
|
ABORT = true;
|
|
EXITSTATUS = status;
|
|
STACKTOP = initialStackTop;
|
|
exitRuntime();
|
|
if (Module["onExit"]) Module["onExit"](status)
|
|
}
|
|
Module["quit"](status, new ExitStatus(status))
|
|
}
|
|
|
|
function abort(what) {
|
|
if (Module["onAbort"]) {
|
|
Module["onAbort"](what)
|
|
}
|
|
if (what !== undefined) {
|
|
out(what);
|
|
err(what);
|
|
what = JSON.stringify(what)
|
|
} else {
|
|
what = ""
|
|
}
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
throw "abort(" + what + "). Build with -s ASSERTIONS=1 for more info."
|
|
}
|
|
Module["abort"] = abort;
|
|
if (Module["preInit"]) {
|
|
if (typeof Module["preInit"] == "function") Module["preInit"] = [Module["preInit"]];
|
|
while (Module["preInit"].length > 0) {
|
|
Module["preInit"].pop()()
|
|
}
|
|
}
|
|
var shouldRunNow = true;
|
|
if (Module["noInitialRun"]) {
|
|
shouldRunNow = false
|
|
}
|
|
Module["noExitRuntime"] = true;
|
|
run()
|
|
} |